From 6149900e0c6bb835334a9c46aee9ca1616d14173 Mon Sep 17 00:00:00 2001 From: Reinier Balt Date: Fri, 5 Dec 2008 15:58:20 +0100 Subject: [PATCH 1/4] remove old compressed js and css from the asset_packager plugin that we don't use anymore --- public/javascripts/tracks_1222451275.js | 844 ----------------------- public/stylesheets/tracks_1225223947.css | 293 -------- 2 files changed, 1137 deletions(-) delete mode 100644 public/javascripts/tracks_1222451275.js delete mode 100644 public/stylesheets/tracks_1225223947.css diff --git a/public/javascripts/tracks_1222451275.js b/public/javascripts/tracks_1222451275.js deleted file mode 100644 index 2c6f9eb4..00000000 --- a/public/javascripts/tracks_1222451275.js +++ /dev/null @@ -1,844 +0,0 @@ -var Prototype={Version:'1.6.0.1',Browser:{IE:!!(window.attachEvent&&!window.opera),Opera:!!window.opera,WebKit:navigator.userAgent.indexOf('AppleWebKit/')>-1,Gecko:navigator.userAgent.indexOf('Gecko')>-1&&navigator.userAgent.indexOf('KHTML')==-1,MobileSafari:!!navigator.userAgent.match(/Apple.*Mobile.*Safari/)},BrowserFeatures:{XPath:!!document.evaluate,ElementExtensions:!!window.HTMLElement,SpecificElementExtensions:document.createElement('div').__proto__&&document.createElement('div').__proto__!==document.createElement('form').__proto__},ScriptFragment:']*>([\\S\\s]*?)<\/script>',JSONFilter:/^\/\*-secure-([\s\S]*)\*\/\s*$/,emptyFunction:function(){},K:function(x){return x}};if(Prototype.Browser.MobileSafari) -Prototype.BrowserFeatures.SpecificElementExtensions=false;var Class={create:function(){var parent=null,properties=$A(arguments);if(Object.isFunction(properties[0])) -parent=properties.shift();function klass(){this.initialize.apply(this,arguments);} -Object.extend(klass,Class.Methods);klass.superclass=parent;klass.subclasses=[];if(parent){var subclass=function(){};subclass.prototype=parent.prototype;klass.prototype=new subclass;parent.subclasses.push(klass);} -for(var i=0;i0){if(match=source.match(pattern)){result+=source.slice(0,match.index);result+=String.interpret(replacement(match));source=source.slice(match.index+match[0].length);}else{result+=source,source='';}} -return result;},sub:function(pattern,replacement,count){replacement=this.gsub.prepareReplacement(replacement);count=Object.isUndefined(count)?1:count;return this.gsub(pattern,function(match){if(--count<0)return match[0];return replacement(match);});},scan:function(pattern,iterator){this.gsub(pattern,iterator);return String(this);},truncate:function(length,truncation){length=length||30;truncation=Object.isUndefined(truncation)?'...':truncation;return this.length>length?this.slice(0,length-truncation.length)+truncation:String(this);},strip:function(){return this.replace(/^\s+/,'').replace(/\s+$/,'');},stripTags:function(){return this.replace(/<\/?[^>]+>/gi,'');},stripScripts:function(){return this.replace(new RegExp(Prototype.ScriptFragment,'img'),'');},extractScripts:function(){var matchAll=new RegExp(Prototype.ScriptFragment,'img');var matchOne=new RegExp(Prototype.ScriptFragment,'im');return(this.match(matchAll)||[]).map(function(scriptTag){return(scriptTag.match(matchOne)||['',''])[1];});},evalScripts:function(){return this.extractScripts().map(function(script){return eval(script)});},escapeHTML:function(){var self=arguments.callee;self.text.data=this;return self.div.innerHTML;},unescapeHTML:function(){var div=new Element('div');div.innerHTML=this.stripTags();return div.childNodes[0]?(div.childNodes.length>1?$A(div.childNodes).inject('',function(memo,node){return memo+node.nodeValue}):div.childNodes[0].nodeValue):'';},toQueryParams:function(separator){var match=this.strip().match(/([^?#]*)(#.*)?$/);if(!match)return{};return match[1].split(separator||'&').inject({},function(hash,pair){if((pair=pair.split('='))[0]){var key=decodeURIComponent(pair.shift());var value=pair.length>1?pair.join('='):pair[0];if(value!=undefined)value=decodeURIComponent(value);if(key in hash){if(!Object.isArray(hash[key]))hash[key]=[hash[key]];hash[key].push(value);} -else hash[key]=value;} -return hash;});},toArray:function(){return this.split('');},succ:function(){return this.slice(0,this.length-1)+ -String.fromCharCode(this.charCodeAt(this.length-1)+1);},times:function(count){return count<1?'':new Array(count+1).join(this);},camelize:function(){var parts=this.split('-'),len=parts.length;if(len==1)return parts[0];var camelized=this.charAt(0)=='-'?parts[0].charAt(0).toUpperCase()+parts[0].substring(1):parts[0];for(var i=1;i-1;},startsWith:function(pattern){return this.indexOf(pattern)===0;},endsWith:function(pattern){var d=this.length-pattern.length;return d>=0&&this.lastIndexOf(pattern)===d;},empty:function(){return this=='';},blank:function(){return/^\s*$/.test(this);},interpolate:function(object,pattern){return new Template(this,pattern).evaluate(object);}});if(Prototype.Browser.WebKit||Prototype.Browser.IE)Object.extend(String.prototype,{escapeHTML:function(){return this.replace(/&/g,'&').replace(//g,'>');},unescapeHTML:function(){return this.replace(/&/g,'&').replace(/</g,'<').replace(/>/g,'>');}});String.prototype.gsub.prepareReplacement=function(replacement){if(Object.isFunction(replacement))return replacement;var template=new Template(replacement);return function(match){return template.evaluate(match)};};String.prototype.parseQuery=String.prototype.toQueryParams;Object.extend(String.prototype.escapeHTML,{div:document.createElement('div'),text:document.createTextNode('')});with(String.prototype.escapeHTML)div.appendChild(text);var Template=Class.create({initialize:function(template,pattern){this.template=template.toString();this.pattern=pattern||Template.Pattern;},evaluate:function(object){if(Object.isFunction(object.toTemplateReplacements)) -object=object.toTemplateReplacements();return this.template.gsub(this.pattern,function(match){if(object==null)return'';var before=match[1]||'';if(before=='\\')return match[2];var ctx=object,expr=match[3];var pattern=/^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/;match=pattern.exec(expr);if(match==null)return before;while(match!=null){var comp=match[1].startsWith('[')?match[2].gsub('\\\\]',']'):match[1];ctx=ctx[comp];if(null==ctx||''==match[3])break;expr=expr.substring('['==match[3]?match[1].length:match[0].length);match=pattern.exec(expr);} -return before+String.interpret(ctx);}.bind(this));}});Template.Pattern=/(^|.|\r|\n)(#\{(.*?)\})/;var $break={};var Enumerable={each:function(iterator,context){var index=0;iterator=iterator.bind(context);try{this._each(function(value){iterator(value,index++);});}catch(e){if(e!=$break)throw e;} -return this;},eachSlice:function(number,iterator,context){iterator=iterator?iterator.bind(context):Prototype.K;var index=-number,slices=[],array=this.toArray();while((index+=number)=result) -result=value;});return result;},min:function(iterator,context){iterator=iterator?iterator.bind(context):Prototype.K;var result;this.each(function(value,index){value=iterator(value,index);if(result==null||valueb?1:0;}).pluck('value');},toArray:function(){return this.map();},zip:function(){var iterator=Prototype.K,args=$A(arguments);if(Object.isFunction(args.last())) -iterator=args.pop();var collections=[this].concat(args).map($A);return this.map(function(value,index){return iterator(collections.pluck(index));});},size:function(){return this.toArray().length;},inspect:function(){return'#';}};Object.extend(Enumerable,{map:Enumerable.collect,find:Enumerable.detect,select:Enumerable.findAll,filter:Enumerable.findAll,member:Enumerable.include,entries:Enumerable.toArray,every:Enumerable.all,some:Enumerable.any});function $A(iterable){if(!iterable)return[];if(iterable.toArray)return iterable.toArray();var length=iterable.length,results=new Array(length);while(length--)results[length]=iterable[length];return results;} -if(Prototype.Browser.WebKit){function $A(iterable){if(!iterable)return[];if(!(Object.isFunction(iterable)&&iterable=='[object NodeList]')&&iterable.toArray)return iterable.toArray();var length=iterable.length,results=new Array(length);while(length--)results[length]=iterable[length];return results;}} -Array.from=$A;Object.extend(Array.prototype,Enumerable);if(!Array.prototype._reverse)Array.prototype._reverse=Array.prototype.reverse;Object.extend(Array.prototype,{_each:function(iterator){for(var i=0,length=this.length;i1?this:this[0];},uniq:function(sorted){return this.inject([],function(array,value,index){if(0==index||(sorted?array.last()!=value:!array.include(value))) -array.push(value);return array;});},intersect:function(array){return this.uniq().findAll(function(item){return array.detect(function(value){return item===value});});},clone:function(){return[].concat(this);},size:function(){return this.length;},inspect:function(){return'['+this.map(Object.inspect).join(', ')+']';},toJSON:function(){var results=[];this.each(function(object){var value=Object.toJSON(object);if(!Object.isUndefined(value))results.push(value);});return'['+results.join(', ')+']';}});if(Object.isFunction(Array.prototype.forEach)) -Array.prototype._each=Array.prototype.forEach;if(!Array.prototype.indexOf)Array.prototype.indexOf=function(item,i){i||(i=0);var length=this.length;if(i<0)i=length+i;for(;i';},toJSON:function(){return Object.toJSON(this.toObject());},clone:function(){return new Hash(this);}}})());Hash.prototype.toTemplateReplacements=Hash.prototype.toObject;Hash.from=$H;var ObjectRange=Class.create(Enumerable,{initialize:function(start,end,exclusive){this.start=start;this.end=end;this.exclusive=exclusive;},_each:function(iterator){var value=this.start;while(this.include(value)){iterator(value);value=value.succ();}},include:function(value){if(value1&&!((readyState==4)&&this._complete)) -this.respondToReadyState(this.transport.readyState);},setRequestHeaders:function(){var headers={'X-Requested-With':'XMLHttpRequest','X-Prototype-Version':Prototype.Version,'Accept':'text/javascript, text/html, application/xml, text/xml, */*'};if(this.method=='post'){headers['Content-type']=this.options.contentType+ -(this.options.encoding?'; charset='+this.options.encoding:'');if(this.transport.overrideMimeType&&(navigator.userAgent.match(/Gecko\/(\d{4})/)||[0,2005])[1]<2005) -headers['Connection']='close';} -if(typeof this.options.requestHeaders=='object'){var extras=this.options.requestHeaders;if(Object.isFunction(extras.push)) -for(var i=0,length=extras.length;i=200&&status<300);},getStatus:function(){try{return this.transport.status||0;}catch(e){return 0}},respondToReadyState:function(readyState){var state=Ajax.Request.Events[readyState],response=new Ajax.Response(this);if(state=='Complete'){try{this._complete=true;(this.options['on'+response.status]||this.options['on'+(this.success()?'Success':'Failure')]||Prototype.emptyFunction)(response,response.headerJSON);}catch(e){this.dispatchException(e);} -var contentType=response.getHeader('Content-type');if(this.options.evalJS=='force'||(this.options.evalJS&&contentType&&contentType.match(/^\s*(text|application)\/(x-)?(java|ecma)script(;.*)?\s*$/i))) -this.evalResponse();} -try{(this.options['on'+state]||Prototype.emptyFunction)(response,response.headerJSON);Ajax.Responders.dispatch('on'+state,this,response,response.headerJSON);}catch(e){this.dispatchException(e);} -if(state=='Complete'){this.transport.onreadystatechange=Prototype.emptyFunction;}},getHeader:function(name){try{return this.transport.getResponseHeader(name);}catch(e){return null}},evalResponse:function(){try{return eval((this.transport.responseText||'').unfilterJSON());}catch(e){this.dispatchException(e);}},dispatchException:function(exception){(this.options.onException||Prototype.emptyFunction)(this,exception);Ajax.Responders.dispatch('onException',this,exception);}});Ajax.Request.Events=['Uninitialized','Loading','Loaded','Interactive','Complete'];Ajax.Response=Class.create({initialize:function(request){this.request=request;var transport=this.transport=request.transport,readyState=this.readyState=transport.readyState;if((readyState>2&&!Prototype.Browser.IE)||readyState==4){this.status=this.getStatus();this.statusText=this.getStatusText();this.responseText=String.interpret(transport.responseText);this.headerJSON=this._getHeaderJSON();} -if(readyState==4){var xml=transport.responseXML;this.responseXML=Object.isUndefined(xml)?null:xml;this.responseJSON=this._getResponseJSON();}},status:0,statusText:'',getStatus:Ajax.Request.prototype.getStatus,getStatusText:function(){try{return this.transport.statusText||'';}catch(e){return''}},getHeader:Ajax.Request.prototype.getHeader,getAllHeaders:function(){try{return this.getAllResponseHeaders();}catch(e){return null}},getResponseHeader:function(name){return this.transport.getResponseHeader(name);},getAllResponseHeaders:function(){return this.transport.getAllResponseHeaders();},_getHeaderJSON:function(){var json=this.getHeader('X-JSON');if(!json)return null;json=decodeURIComponent(escape(json));try{return json.evalJSON(this.request.options.sanitizeJSON);}catch(e){this.request.dispatchException(e);}},_getResponseJSON:function(){var options=this.request.options;if(!options.evalJSON||(options.evalJSON!='force'&&!(this.getHeader('Content-type')||'').include('application/json'))||this.responseText.blank()) -return null;try{return this.responseText.evalJSON(options.sanitizeJSON);}catch(e){this.request.dispatchException(e);}}});Ajax.Updater=Class.create(Ajax.Request,{initialize:function($super,container,url,options){this.container={success:(container.success||container),failure:(container.failure||(container.success?null:container))};options=Object.clone(options);var onComplete=options.onComplete;options.onComplete=(function(response,json){this.updateContent(response.responseText);if(Object.isFunction(onComplete))onComplete(response,json);}).bind(this);$super(url,options);},updateContent:function(responseText){var receiver=this.container[this.success()?'success':'failure'],options=this.options;if(!options.evalScripts)responseText=responseText.stripScripts();if(receiver=$(receiver)){if(options.insertion){if(Object.isString(options.insertion)){var insertion={};insertion[options.insertion]=responseText;receiver.insert(insertion);} -else options.insertion(receiver,responseText);} -else receiver.update(responseText);}}});Ajax.PeriodicalUpdater=Class.create(Ajax.Base,{initialize:function($super,container,url,options){$super(options);this.onComplete=this.options.onComplete;this.frequency=(this.options.frequency||2);this.decay=(this.options.decay||1);this.updater={};this.container=container;this.url=url;this.start();},start:function(){this.options.onComplete=this.updateComplete.bind(this);this.onTimerEvent();},stop:function(){this.updater.options.onComplete=undefined;clearTimeout(this.timer);(this.onComplete||Prototype.emptyFunction).apply(this,arguments);},updateComplete:function(response){if(this.options.decay){this.decay=(response.responseText==this.lastText?this.decay*this.options.decay:1);this.lastText=response.responseText;} -this.timer=this.onTimerEvent.bind(this).delay(this.decay*this.frequency);},onTimerEvent:function(){this.updater=new Ajax.Updater(this.container,this.url,this.options);}});function $(element){if(arguments.length>1){for(var i=0,elements=[],length=arguments.length;i';delete attributes.name;return Element.writeAttribute(document.createElement(tagName),attributes);} -if(!cache[tagName])cache[tagName]=Element.extend(document.createElement(tagName));return Element.writeAttribute(cache[tagName].cloneNode(false),attributes);};Object.extend(this.Element,element||{});}).call(window);Element.cache={};Element.Methods={visible:function(element){return $(element).style.display!='none';},toggle:function(element){element=$(element);Element[Element.visible(element)?'hide':'show'](element);return element;},hide:function(element){$(element).style.display='none';return element;},show:function(element){$(element).style.display='';return element;},remove:function(element){element=$(element);element.parentNode.removeChild(element);return element;},update:function(element,content){element=$(element);if(content&&content.toElement)content=content.toElement();if(Object.isElement(content))return element.update().insert(content);content=Object.toHTML(content);element.innerHTML=content.stripScripts();content.evalScripts.bind(content).defer();return element;},replace:function(element,content){element=$(element);if(content&&content.toElement)content=content.toElement();else if(!Object.isElement(content)){content=Object.toHTML(content);var range=element.ownerDocument.createRange();range.selectNode(element);content.evalScripts.bind(content).defer();content=range.createContextualFragment(content.stripScripts());} -element.parentNode.replaceChild(content,element);return element;},insert:function(element,insertions){element=$(element);if(Object.isString(insertions)||Object.isNumber(insertions)||Object.isElement(insertions)||(insertions&&(insertions.toElement||insertions.toHTML))) -insertions={bottom:insertions};var content,t,range;for(position in insertions){content=insertions[position];position=position.toLowerCase();t=Element._insertionTranslations[position];if(content&&content.toElement)content=content.toElement();if(Object.isElement(content)){t.insert(element,content);continue;} -content=Object.toHTML(content);range=element.ownerDocument.createRange();t.initializeRange(element,range);t.insert(element,range.createContextualFragment(content.stripScripts()));content.evalScripts.bind(content).defer();} -return element;},wrap:function(element,wrapper,attributes){element=$(element);if(Object.isElement(wrapper)) -$(wrapper).writeAttribute(attributes||{});else if(Object.isString(wrapper))wrapper=new Element(wrapper,attributes);else wrapper=new Element('div',wrapper);if(element.parentNode) -element.parentNode.replaceChild(wrapper,element);wrapper.appendChild(element);return wrapper;},inspect:function(element){element=$(element);var result='<'+element.tagName.toLowerCase();$H({'id':'id','className':'class'}).each(function(pair){var property=pair.first(),attribute=pair.last();var value=(element[property]||'').toString();if(value)result+=' '+attribute+'='+value.inspect(true);});return result+'>';},recursivelyCollect:function(element,property){element=$(element);var elements=[];while(element=element[property]) -if(element.nodeType==1) -elements.push(Element.extend(element));return elements;},ancestors:function(element){return $(element).recursivelyCollect('parentNode');},descendants:function(element){return $(element).getElementsBySelector("*");},firstDescendant:function(element){element=$(element).firstChild;while(element&&element.nodeType!=1)element=element.nextSibling;return $(element);},immediateDescendants:function(element){if(!(element=$(element).firstChild))return[];while(element&&element.nodeType!=1)element=element.nextSibling;if(element)return[element].concat($(element).nextSiblings());return[];},previousSiblings:function(element){return $(element).recursivelyCollect('previousSibling');},nextSiblings:function(element){return $(element).recursivelyCollect('nextSibling');},siblings:function(element){element=$(element);return element.previousSiblings().reverse().concat(element.nextSiblings());},match:function(element,selector){if(Object.isString(selector)) -selector=new Selector(selector);return selector.match($(element));},up:function(element,expression,index){element=$(element);if(arguments.length==1)return $(element.parentNode);var ancestors=element.ancestors();return expression?Selector.findElement(ancestors,expression,index):ancestors[index||0];},down:function(element,expression,index){element=$(element);if(arguments.length==1)return element.firstDescendant();var descendants=element.descendants();return expression?Selector.findElement(descendants,expression,index):descendants[index||0];},previous:function(element,expression,index){element=$(element);if(arguments.length==1)return $(Selector.handlers.previousElementSibling(element));var previousSiblings=element.previousSiblings();return expression?Selector.findElement(previousSiblings,expression,index):previousSiblings[index||0];},next:function(element,expression,index){element=$(element);if(arguments.length==1)return $(Selector.handlers.nextElementSibling(element));var nextSiblings=element.nextSiblings();return expression?Selector.findElement(nextSiblings,expression,index):nextSiblings[index||0];},select:function(){var args=$A(arguments),element=$(args.shift());return Selector.findChildElements(element,args);},adjacent:function(){var args=$A(arguments),element=$(args.shift());return Selector.findChildElements(element.parentNode,args).without(element);},identify:function(element){element=$(element);var id=element.readAttribute('id'),self=arguments.callee;if(id)return id;do{id='anonymous_element_'+self.counter++}while($(id));element.writeAttribute('id',id);return id;},readAttribute:function(element,name){element=$(element);if(Prototype.Browser.IE){var t=Element._attributeTranslations.read;if(t.values[name])return t.values[name](element,name);if(t.names[name])name=t.names[name];if(name.include(':')){return(!element.attributes||!element.attributes[name])?null:element.attributes[name].value;}} -return element.getAttribute(name);},writeAttribute:function(element,name,value){element=$(element);var attributes={},t=Element._attributeTranslations.write;if(typeof name=='object')attributes=name;else attributes[name]=Object.isUndefined(value)?true:value;for(var attr in attributes){name=t.names[attr]||attr;value=attributes[attr];if(t.values[attr])name=t.values[attr](element,value);if(value===false||value===null) -element.removeAttribute(name);else if(value===true) -element.setAttribute(name,name);else element.setAttribute(name,value);} -return element;},getHeight:function(element){return $(element).getDimensions().height;},getWidth:function(element){return $(element).getDimensions().width;},classNames:function(element){return new Element.ClassNames(element);},hasClassName:function(element,className){if(!(element=$(element)))return;var elementClassName=element.className;return(elementClassName.length>0&&(elementClassName==className||new RegExp("(^|\\s)"+className+"(\\s|$)").test(elementClassName)));},addClassName:function(element,className){if(!(element=$(element)))return;if(!element.hasClassName(className)) -element.className+=(element.className?' ':'')+className;return element;},removeClassName:function(element,className){if(!(element=$(element)))return;element.className=element.className.replace(new RegExp("(^|\\s+)"+className+"(\\s+|$)"),' ').strip();return element;},toggleClassName:function(element,className){if(!(element=$(element)))return;return element[element.hasClassName(className)?'removeClassName':'addClassName'](className);},cleanWhitespace:function(element){element=$(element);var node=element.firstChild;while(node){var nextNode=node.nextSibling;if(node.nodeType==3&&!/\S/.test(node.nodeValue)) -element.removeChild(node);node=nextNode;} -return element;},empty:function(element){return $(element).innerHTML.blank();},descendantOf:function(element,ancestor){element=$(element),ancestor=$(ancestor);var originalAncestor=ancestor;if(element.compareDocumentPosition) -return(element.compareDocumentPosition(ancestor)&8)===8;if(element.sourceIndex&&!Prototype.Browser.Opera){var e=element.sourceIndex,a=ancestor.sourceIndex,nextAncestor=ancestor.nextSibling;if(!nextAncestor){do{ancestor=ancestor.parentNode;} -while(!(nextAncestor=ancestor.nextSibling)&&ancestor.parentNode);} -if(nextAncestor)return(e>a&&e','',1],TBODY:['','
',2],TR:['','
',3],TD:['
','
',4],SELECT:['',1]}};(function(){this.bottom.initializeRange=this.top.initializeRange;Object.extend(this.tags,{THEAD:this.tags.TBODY,TFOOT:this.tags.TBODY,TH:this.tags.TD});}).call(Element._insertionTranslations);Element.Methods.Simulated={hasAttribute:function(element,attribute){attribute=Element._attributeTranslations.has[attribute]||attribute;var node=$(element).getAttributeNode(attribute);return node&&node.specified;}};Element.Methods.ByTag={};Object.extend(Element,Element.Methods);if(!Prototype.BrowserFeatures.ElementExtensions&&document.createElement('div').__proto__){window.HTMLElement={};window.HTMLElement.prototype=document.createElement('div').__proto__;Prototype.BrowserFeatures.ElementExtensions=true;} -Element.extend=(function(){if(Prototype.BrowserFeatures.SpecificElementExtensions) -return Prototype.K;var Methods={},ByTag=Element.Methods.ByTag;var extend=Object.extend(function(element){if(!element||element._extendedByPrototype||element.nodeType!=1||element==window)return element;var methods=Object.clone(Methods),tagName=element.tagName,property,value;if(ByTag[tagName])Object.extend(methods,ByTag[tagName]);for(property in methods){value=methods[property];if(Object.isFunction(value)&&!(property in element)) -element[property]=value.methodize();} -element._extendedByPrototype=Prototype.emptyFunction;return element;},{refresh:function(){if(!Prototype.BrowserFeatures.ElementExtensions){Object.extend(Methods,Element.Methods);Object.extend(Methods,Element.Methods.Simulated);}}});extend.refresh();return extend;})();Element.hasAttribute=function(element,attribute){if(element.hasAttribute)return element.hasAttribute(attribute);return Element.Methods.Simulated.hasAttribute(element,attribute);};Element.addMethods=function(methods){var F=Prototype.BrowserFeatures,T=Element.Methods.ByTag;if(!methods){Object.extend(Form,Form.Methods);Object.extend(Form.Element,Form.Element.Methods);Object.extend(Element.Methods.ByTag,{"FORM":Object.clone(Form.Methods),"INPUT":Object.clone(Form.Element.Methods),"SELECT":Object.clone(Form.Element.Methods),"TEXTAREA":Object.clone(Form.Element.Methods)});} -if(arguments.length==2){var tagName=methods;methods=arguments[1];} -if(!tagName)Object.extend(Element.Methods,methods||{});else{if(Object.isArray(tagName))tagName.each(extend);else extend(tagName);} -function extend(tagName){tagName=tagName.toUpperCase();if(!Element.Methods.ByTag[tagName]) -Element.Methods.ByTag[tagName]={};Object.extend(Element.Methods.ByTag[tagName],methods);} -function copy(methods,destination,onlyIfAbsent){onlyIfAbsent=onlyIfAbsent||false;for(var property in methods){var value=methods[property];if(!Object.isFunction(value))continue;if(!onlyIfAbsent||!(property in destination)) -destination[property]=value.methodize();}} -function findDOMClass(tagName){var klass;var trans={"OPTGROUP":"OptGroup","TEXTAREA":"TextArea","P":"Paragraph","FIELDSET":"FieldSet","UL":"UList","OL":"OList","DL":"DList","DIR":"Directory","H1":"Heading","H2":"Heading","H3":"Heading","H4":"Heading","H5":"Heading","H6":"Heading","Q":"Quote","INS":"Mod","DEL":"Mod","A":"Anchor","IMG":"Image","CAPTION":"TableCaption","COL":"TableCol","COLGROUP":"TableCol","THEAD":"TableSection","TFOOT":"TableSection","TBODY":"TableSection","TR":"TableRow","TH":"TableCell","TD":"TableCell","FRAMESET":"FrameSet","IFRAME":"IFrame"};if(trans[tagName])klass='HTML'+trans[tagName]+'Element';if(window[klass])return window[klass];klass='HTML'+tagName+'Element';if(window[klass])return window[klass];klass='HTML'+tagName.capitalize()+'Element';if(window[klass])return window[klass];window[klass]={};window[klass].prototype=document.createElement(tagName).__proto__;return window[klass];} -if(F.ElementExtensions){copy(Element.Methods,HTMLElement.prototype);copy(Element.Methods.Simulated,HTMLElement.prototype,true);} -if(F.SpecificElementExtensions){for(var tag in Element.Methods.ByTag){var klass=findDOMClass(tag);if(Object.isUndefined(klass))continue;copy(T[tag],klass.prototype);}} -Object.extend(Element,Element.Methods);delete Element.ByTag;if(Element.extend.refresh)Element.extend.refresh();Element.cache={};};document.viewport={getDimensions:function(){var dimensions={};var B=Prototype.Browser;$w('width height').each(function(d){var D=d.capitalize();dimensions[d]=(B.WebKit&&!document.evaluate)?self['inner'+D]:(B.Opera)?document.body['client'+D]:document.documentElement['client'+D];});return dimensions;},getWidth:function(){return this.getDimensions().width;},getHeight:function(){return this.getDimensions().height;},getScrollOffsets:function(){return Element._returnOffset(window.pageXOffset||document.documentElement.scrollLeft||document.body.scrollLeft,window.pageYOffset||document.documentElement.scrollTop||document.body.scrollTop);}};var Selector=Class.create({initialize:function(expression){this.expression=expression.strip();this.compileMatcher();},shouldUseXPath:function(){if(!Prototype.BrowserFeatures.XPath)return false;var e=this.expression;if(Prototype.Browser.WebKit&&(e.include("-of-type")||e.include(":empty"))) -return false;if((/(\[[\w-]*?:|:checked)/).test(this.expression)) -return false;return true;},compileMatcher:function(){if(this.shouldUseXPath()) -return this.compileXPathMatcher();var e=this.expression,ps=Selector.patterns,h=Selector.handlers,c=Selector.criteria,le,p,m;if(Selector._cache[e]){this.matcher=Selector._cache[e];return;} -this.matcher=["this.matcher = function(root) {","var r = root, h = Selector.handlers, c = false, n;"];while(e&&le!=e&&(/\S/).test(e)){le=e;for(var i in ps){p=ps[i];if(m=e.match(p)){this.matcher.push(Object.isFunction(c[i])?c[i](m):new Template(c[i]).evaluate(m));e=e.replace(m[0],'');break;}}} -this.matcher.push("return h.unique(n);\n}");eval(this.matcher.join('\n'));Selector._cache[this.expression]=this.matcher;},compileXPathMatcher:function(){var e=this.expression,ps=Selector.patterns,x=Selector.xpath,le,m;if(Selector._cache[e]){this.xpath=Selector._cache[e];return;} -this.matcher=['.//*'];while(e&&le!=e&&(/\S/).test(e)){le=e;for(var i in ps){if(m=e.match(ps[i])){this.matcher.push(Object.isFunction(x[i])?x[i](m):new Template(x[i]).evaluate(m));e=e.replace(m[0],'');break;}}} -this.xpath=this.matcher.join('');Selector._cache[this.expression]=this.xpath;},findElements:function(root){root=root||document;if(this.xpath)return document._getElementsByXPath(this.xpath,root);return this.matcher(root);},match:function(element){this.tokens=[];var e=this.expression,ps=Selector.patterns,as=Selector.assertions;var le,p,m;while(e&&le!==e&&(/\S/).test(e)){le=e;for(var i in ps){p=ps[i];if(m=e.match(p)){if(as[i]){this.tokens.push([i,Object.clone(m)]);e=e.replace(m[0],'');}else{return this.findElements(document).include(element);}}}} -var match=true,name,matches;for(var i=0,token;token=this.tokens[i];i++){name=token[0],matches=token[1];if(!Selector.assertions[name](element,matches)){match=false;break;}} -return match;},toString:function(){return this.expression;},inspect:function(){return"#";}});Object.extend(Selector,{_cache:{},xpath:{descendant:"//*",child:"/*",adjacent:"/following-sibling::*[1]",laterSibling:'/following-sibling::*',tagName:function(m){if(m[1]=='*')return'';return"[local-name()='"+m[1].toLowerCase()+"' or local-name()='"+m[1].toUpperCase()+"']";},className:"[contains(concat(' ', @class, ' '), ' #{1} ')]",id:"[@id='#{1}']",attrPresence:function(m){m[1]=m[1].toLowerCase();return new Template("[@#{1}]").evaluate(m);},attr:function(m){m[1]=m[1].toLowerCase();m[3]=m[5]||m[6];return new Template(Selector.xpath.operators[m[2]]).evaluate(m);},pseudo:function(m){var h=Selector.xpath.pseudos[m[1]];if(!h)return'';if(Object.isFunction(h))return h(m);return new Template(Selector.xpath.pseudos[m[1]]).evaluate(m);},operators:{'=':"[@#{1}='#{3}']",'!=':"[@#{1}!='#{3}']",'^=':"[starts-with(@#{1}, '#{3}')]",'$=':"[substring(@#{1}, (string-length(@#{1}) - string-length('#{3}') + 1))='#{3}']",'*=':"[contains(@#{1}, '#{3}')]",'~=':"[contains(concat(' ', @#{1}, ' '), ' #{3} ')]",'|=':"[contains(concat('-', @#{1}, '-'), '-#{3}-')]"},pseudos:{'first-child':'[not(preceding-sibling::*)]','last-child':'[not(following-sibling::*)]','only-child':'[not(preceding-sibling::* or following-sibling::*)]','empty':"[count(*) = 0 and (count(text()) = 0 or translate(text(), ' \t\r\n', '') = '')]",'checked':"[@checked]",'disabled':"[@disabled]",'enabled':"[not(@disabled)]",'not':function(m){var e=m[6],p=Selector.patterns,x=Selector.xpath,le,v;var exclusion=[];while(e&&le!=e&&(/\S/).test(e)){le=e;for(var i in p){if(m=e.match(p[i])){v=Object.isFunction(x[i])?x[i](m):new Template(x[i]).evaluate(m);exclusion.push("("+v.substring(1,v.length-1)+")");e=e.replace(m[0],'');break;}}} -return"[not("+exclusion.join(" and ")+")]";},'nth-child':function(m){return Selector.xpath.pseudos.nth("(count(./preceding-sibling::*) + 1) ",m);},'nth-last-child':function(m){return Selector.xpath.pseudos.nth("(count(./following-sibling::*) + 1) ",m);},'nth-of-type':function(m){return Selector.xpath.pseudos.nth("position() ",m);},'nth-last-of-type':function(m){return Selector.xpath.pseudos.nth("(last() + 1 - position()) ",m);},'first-of-type':function(m){m[6]="1";return Selector.xpath.pseudos['nth-of-type'](m);},'last-of-type':function(m){m[6]="1";return Selector.xpath.pseudos['nth-last-of-type'](m);},'only-of-type':function(m){var p=Selector.xpath.pseudos;return p['first-of-type'](m)+p['last-of-type'](m);},nth:function(fragment,m){var mm,formula=m[6],predicate;if(formula=='even')formula='2n+0';if(formula=='odd')formula='2n+1';if(mm=formula.match(/^(\d+)$/)) -return'['+fragment+"= "+mm[1]+']';if(mm=formula.match(/^(-?\d*)?n(([+-])(\d+))?/)){if(mm[1]=="-")mm[1]=-1;var a=mm[1]?Number(mm[1]):1;var b=mm[2]?Number(mm[2]):0;predicate="[((#{fragment} - #{b}) mod #{a} = 0) and "+"((#{fragment} - #{b}) div #{a} >= 0)]";return new Template(predicate).evaluate({fragment:fragment,a:a,b:b});}}}},criteria:{tagName:'n = h.tagName(n, r, "#{1}", c); c = false;',className:'n = h.className(n, r, "#{1}", c); c = false;',id:'n = h.id(n, r, "#{1}", c); c = false;',attrPresence:'n = h.attrPresence(n, r, "#{1}"); c = false;',attr:function(m){m[3]=(m[5]||m[6]);return new Template('n = h.attr(n, r, "#{1}", "#{3}", "#{2}"); c = false;').evaluate(m);},pseudo:function(m){if(m[6])m[6]=m[6].replace(/"/g,'\\"');return new Template('n = h.pseudo(n, "#{1}", "#{6}", r, c); c = false;').evaluate(m);},descendant:'c = "descendant";',child:'c = "child";',adjacent:'c = "adjacent";',laterSibling:'c = "laterSibling";'},patterns:{laterSibling:/^\s*~\s*/,child:/^\s*>\s*/,adjacent:/^\s*\+\s*/,descendant:/^\s/,tagName:/^\s*(\*|[\w\-]+)(\b|$)?/,id:/^#([\w\-\*]+)(\b|$)/,className:/^\.([\w\-\*]+)(\b|$)/,pseudo:/^:((first|last|nth|nth-last|only)(-child|-of-type)|empty|checked|(en|dis)abled|not)(\((.*?)\))?(\b|$|(?=\s)|(?=:))/,attrPresence:/^\[([\w]+)\]/,attr:/\[((?:[\w-]*:)?[\w-]+)\s*(?:([!^$*~|]?=)\s*((['"])([^\4]*?)\4|([^'"][^\]]*?)))?\]/},assertions:{tagName:function(element,matches){return matches[1].toUpperCase()==element.tagName.toUpperCase();},className:function(element,matches){return Element.hasClassName(element,matches[1]);},id:function(element,matches){return element.id===matches[1];},attrPresence:function(element,matches){return Element.hasAttribute(element,matches[1]);},attr:function(element,matches){var nodeValue=Element.readAttribute(element,matches[1]);return Selector.operators[matches[2]](nodeValue,matches[3]);}},handlers:{concat:function(a,b){for(var i=0,node;node=b[i];i++) -a.push(node);return a;},mark:function(nodes){for(var i=0,node;node=nodes[i];i++) -node._counted=true;return nodes;},unmark:function(nodes){for(var i=0,node;node=nodes[i];i++) -node._counted=undefined;return nodes;},index:function(parentNode,reverse,ofType){parentNode._counted=true;if(reverse){for(var nodes=parentNode.childNodes,i=nodes.length-1,j=1;i>=0;i--){var node=nodes[i];if(node.nodeType==1&&(!ofType||node._counted))node.nodeIndex=j++;}}else{for(var i=0,j=1,nodes=parentNode.childNodes;node=nodes[i];i++) -if(node.nodeType==1&&(!ofType||node._counted))node.nodeIndex=j++;}},unique:function(nodes){if(nodes.length==0)return nodes;var results=[],n;for(var i=0,l=nodes.length;i0?[b]:[];return $R(1,total).inject([],function(memo,i){if(0==(i-b)%a&&(i-b)/a>=0)memo.push(i);return memo;});},nth:function(nodes,formula,root,reverse,ofType){if(nodes.length==0)return[];if(formula=='even')formula='2n+0';if(formula=='odd')formula='2n+1';var h=Selector.handlers,results=[],indexed=[],m;h.mark(nodes);for(var i=0,node;node=nodes[i];i++){if(!node.parentNode._counted){h.index(node.parentNode,reverse,ofType);indexed.push(node.parentNode);}} -if(formula.match(/^\d+$/)){formula=Number(formula);for(var i=0,node;node=nodes[i];i++) -if(node.nodeIndex==formula)results.push(node);}else if(m=formula.match(/^(-?\d*)?n(([+-])(\d+))?/)){if(m[1]=="-")m[1]=-1;var a=m[1]?Number(m[1]):1;var b=m[2]?Number(m[2]):0;var indices=Selector.pseudos.getIndices(a,b,nodes.length);for(var i=0,node,l=indices.length;node=nodes[i];i++){for(var j=0;j+()\s-]+|\*|\[.*?\])+)\s*(,|$)/,function(m){expressions.push(m[1].strip());});var results=[],h=Selector.handlers;for(var i=0,l=expressions.length,selector;i1)?h.unique(results):results;}});if(Prototype.Browser.IE){Selector.handlers.concat=function(a,b){for(var i=0,node;node=b[i];i++) -if(node.tagName!=="!")a.push(node);return a;};} -function $$(){return Selector.findChildElements(document,$A(arguments));} -var Form={reset:function(form){$(form).reset();return form;},serializeElements:function(elements,options){if(typeof options!='object')options={hash:!!options};else if(Object.isUndefined(options.hash))options.hash=true;var key,value,submitted=false,submit=options.submit;var data=elements.inject({},function(result,element){if(!element.disabled&&element.name){key=element.name;value=$(element).getValue();if(value!=null&&(element.type!='submit'||(!submitted&&submit!==false&&(!submit||key==submit)&&(submitted=true)))){if(key in result){if(!Object.isArray(result[key]))result[key]=[result[key]];result[key].push(value);} -else result[key]=value;}} -return result;});return options.hash?data:Object.toQueryString(data);}};Form.Methods={serialize:function(form,options){return Form.serializeElements(Form.getElements(form),options);},getElements:function(form){return $A($(form).getElementsByTagName('*')).inject([],function(elements,child){if(Form.Element.Serializers[child.tagName.toLowerCase()]) -elements.push(Element.extend(child));return elements;});},getInputs:function(form,typeName,name){form=$(form);var inputs=form.getElementsByTagName('input');if(!typeName&&!name)return $A(inputs).map(Element.extend);for(var i=0,matchingInputs=[],length=inputs.length;i=0;}).sortBy(function(element){return element.tabIndex}).first();return firstByIndex?firstByIndex:elements.find(function(element){return['input','select','textarea'].include(element.tagName.toLowerCase());});},focusFirstElement:function(form){form=$(form);form.findFirstElement().activate();return form;},request:function(form,options){form=$(form),options=Object.clone(options||{});var params=options.parameters,action=form.readAttribute('action')||'';if(action.blank())action=window.location.href;options.parameters=form.serialize(true);if(params){if(Object.isString(params))params=params.toQueryParams();Object.extend(options.parameters,params);} -if(form.hasAttribute('method')&&!options.method) -options.method=form.method;return new Ajax.Request(action,options);}};Form.Element={focus:function(element){$(element).focus();return element;},select:function(element){$(element).select();return element;}};Form.Element.Methods={serialize:function(element){element=$(element);if(!element.disabled&&element.name){var value=element.getValue();if(value!=undefined){var pair={};pair[element.name]=value;return Object.toQueryString(pair);}} -return'';},getValue:function(element){element=$(element);var method=element.tagName.toLowerCase();return Form.Element.Serializers[method](element);},setValue:function(element,value){element=$(element);var method=element.tagName.toLowerCase();Form.Element.Serializers[method](element,value);return element;},clear:function(element){$(element).value='';return element;},present:function(element){return $(element).value!='';},activate:function(element){element=$(element);try{element.focus();if(element.select&&(element.tagName.toLowerCase()!='input'||!['button','reset','submit'].include(element.type))) -element.select();}catch(e){} -return element;},disable:function(element){element=$(element);element.blur();element.disabled=true;return element;},enable:function(element){element=$(element);element.disabled=false;return element;}};var Field=Form.Element;var $F=Form.Element.Methods.getValue;Form.Element.Serializers={input:function(element,value){switch(element.type.toLowerCase()){case'checkbox':case'radio':return Form.Element.Serializers.inputSelector(element,value);default:return Form.Element.Serializers.textarea(element,value);}},inputSelector:function(element,value){if(Object.isUndefined(value))return element.checked?element.value:null;else element.checked=!!value;},textarea:function(element,value){if(Object.isUndefined(value))return element.value;else element.value=value;},select:function(element,index){if(Object.isUndefined(index)) -return this[element.type=='select-one'?'selectOne':'selectMany'](element);else{var opt,value,single=!Object.isArray(index);for(var i=0,length=element.length;i=0?this.optionValue(element.options[index]):null;},selectMany:function(element){var values,length=element.length;if(!length)return null;for(var i=0,values=[];i<\/script>");$("__onDOMContentLoaded").onreadystatechange=function(){if(this.readyState=="complete"){this.onreadystatechange=null;fireContentLoadedEvent();}};}})();Hash.toQueryString=Object.toQueryString;var Toggle={display:Element.toggle};Element.Methods.childOf=Element.Methods.descendantOf;var Insertion={Before:function(element,content){return Element.insert(element,{before:content});},Top:function(element,content){return Element.insert(element,{top:content});},Bottom:function(element,content){return Element.insert(element,{bottom:content});},After:function(element,content){return Element.insert(element,{after:content});}};var $continue=new Error('"throw $continue" is deprecated, use "return" instead');var Position={includeScrollOffsets:false,prepare:function(){this.deltaX=window.pageXOffset||document.documentElement.scrollLeft||document.body.scrollLeft||0;this.deltaY=window.pageYOffset||document.documentElement.scrollTop||document.body.scrollTop||0;},within:function(element,x,y){if(this.includeScrollOffsets) -return this.withinIncludingScrolloffsets(element,x,y);this.xcomp=x;this.ycomp=y;this.offset=Element.cumulativeOffset(element);return(y>=this.offset[1]&&y=this.offset[0]&&x=this.offset[1]&&this.ycomp=this.offset[0]&&this.xcomp0;})._each(iterator);},set:function(className){this.element.className=className;},add:function(classNameToAdd){if(this.include(classNameToAdd))return;this.set($A(this).concat(classNameToAdd).join(' '));},remove:function(classNameToRemove){if(!this.include(classNameToRemove))return;this.set($A(this).without(classNameToRemove).join(' '));},toString:function(){return $A(this).join(' ');}};Object.extend(Element.ClassNames.prototype,Enumerable);Element.addMethods();String.prototype.parseColor=function(){var color='#';if(this.slice(0,4)=='rgb('){var cols=this.slice(4,this.length-1).split(',');var i=0;do{color+=parseInt(cols[i]).toColorPart()}while(++i<3);}else{if(this.slice(0,1)=='#'){if(this.length==4)for(var i=1;i<4;i++)color+=(this.charAt(i)+this.charAt(i)).toLowerCase();if(this.length==7)color=this.toLowerCase();}} -return(color.length==7?color:(arguments[0]||this));};Element.collectTextNodes=function(element){return $A($(element).childNodes).collect(function(node){return(node.nodeType==3?node.nodeValue:(node.hasChildNodes()?Element.collectTextNodes(node):''));}).flatten().join('');};Element.collectTextNodesIgnoreClass=function(element,className){return $A($(element).childNodes).collect(function(node){return(node.nodeType==3?node.nodeValue:((node.hasChildNodes()&&!Element.hasClassName(node,className))?Element.collectTextNodesIgnoreClass(node,className):''));}).flatten().join('');};Element.setContentZoom=function(element,percent){element=$(element);element.setStyle({fontSize:(percent/100)+'em'});if(Prototype.Browser.WebKit)window.scrollBy(0,0);return element;};Element.getInlineOpacity=function(element){return $(element).style.opacity||'';};Element.forceRerendering=function(element){try{element=$(element);var n=document.createTextNode(' ');element.appendChild(n);element.removeChild(n);}catch(e){}};var Effect={_elementDoesNotExistError:{name:'ElementDoesNotExistError',message:'The specified DOM element does not exist, but is required for this effect to operate'},Transitions:{linear:Prototype.K,sinoidal:function(pos){return(-Math.cos(pos*Math.PI)/2)+0.5;},reverse:function(pos){return 1-pos;},flicker:function(pos){var pos=((-Math.cos(pos*Math.PI)/4)+0.75)+Math.random()/4;return pos>1?1:pos;},wobble:function(pos){return(-Math.cos(pos*Math.PI*(9*pos))/2)+0.5;},pulse:function(pos,pulses){pulses=pulses||5;return(((pos%(1/pulses))*pulses).round()==0?((pos*pulses*2)-(pos*pulses*2).floor()):1-((pos*pulses*2)-(pos*pulses*2).floor()));},spring:function(pos){return 1-(Math.cos(pos*4.5*Math.PI)*Math.exp(-pos*6));},none:function(pos){return 0;},full:function(pos){return 1;}},DefaultOptions:{duration:1.0,fps:100,sync:false,from:0.0,to:1.0,delay:0.0,queue:'parallel'},tagifyText:function(element){var tagifyStyle='position:relative';if(Prototype.Browser.IE)tagifyStyle+=';zoom:1';element=$(element);$A(element.childNodes).each(function(child){if(child.nodeType==3){child.nodeValue.toArray().each(function(character){element.insertBefore(new Element('span',{style:tagifyStyle}).update(character==' '?String.fromCharCode(160):character),child);});Element.remove(child);}});},multiple:function(element,effect){var elements;if(((typeof element=='object')||Object.isFunction(element))&&(element.length)) -elements=element;else -elements=$(element).childNodes;var options=Object.extend({speed:0.1,delay:0.0},arguments[2]||{});var masterDelay=options.delay;$A(elements).each(function(element,index){new effect(element,Object.extend(options,{delay:index*options.speed+masterDelay}));});},PAIRS:{'slide':['SlideDown','SlideUp'],'blind':['BlindDown','BlindUp'],'appear':['Appear','Fade']},toggle:function(element,effect){element=$(element);effect=(effect||'appear').toLowerCase();var options=Object.extend({queue:{position:'end',scope:(element.id||'global'),limit:1}},arguments[2]||{});Effect[element.visible()?Effect.PAIRS[effect][1]:Effect.PAIRS[effect][0]](element,options);}};Effect.DefaultOptions.transition=Effect.Transitions.sinoidal;Effect.ScopedQueue=Class.create(Enumerable,{initialize:function(){this.effects=[];this.interval=null;},_each:function(iterator){this.effects._each(iterator);},add:function(effect){var timestamp=new Date().getTime();var position=Object.isString(effect.options.queue)?effect.options.queue:effect.options.queue.position;switch(position){case'front':this.effects.findAll(function(e){return e.state=='idle'}).each(function(e){e.startOn+=effect.finishOn;e.finishOn+=effect.finishOn;});break;case'with-last':timestamp=this.effects.pluck('startOn').max()||timestamp;break;case'end':timestamp=this.effects.pluck('finishOn').max()||timestamp;break;} -effect.startOn+=timestamp;effect.finishOn+=timestamp;if(!effect.options.queue.limit||(this.effects.length=this.startOn){if(timePos>=this.finishOn){this.render(1.0);this.cancel();this.event('beforeFinish');if(this.finish)this.finish();this.event('afterFinish');return;} -var pos=(timePos-this.startOn)/this.totalTime,frame=(pos*this.totalFrames).round();if(frame>this.currentFrame){this.render(pos);this.currentFrame=frame;}}},cancel:function(){if(!this.options.sync) -Effect.Queues.get(Object.isString(this.options.queue)?'global':this.options.queue.scope).remove(this);this.state='finished';},event:function(eventName){if(this.options[eventName+'Internal'])this.options[eventName+'Internal'](this);if(this.options[eventName])this.options[eventName](this);},inspect:function(){var data=$H();for(property in this) -if(!Object.isFunction(this[property]))data.set(property,this[property]);return'#';}});Effect.Parallel=Class.create(Effect.Base,{initialize:function(effects){this.effects=effects||[];this.start(arguments[1]);},update:function(position){this.effects.invoke('render',position);},finish:function(position){this.effects.each(function(effect){effect.render(1.0);effect.cancel();effect.event('beforeFinish');if(effect.finish)effect.finish(position);effect.event('afterFinish');});}});Effect.Tween=Class.create(Effect.Base,{initialize:function(object,from,to){object=Object.isString(object)?$(object):object;var args=$A(arguments),method=args.last(),options=args.length==5?args[3]:null;this.method=Object.isFunction(method)?method.bind(object):Object.isFunction(object[method])?object[method].bind(object):function(value){object[method]=value};this.start(Object.extend({from:from,to:to},options||{}));},update:function(position){this.method(position);}});Effect.Event=Class.create(Effect.Base,{initialize:function(){this.start(Object.extend({duration:0},arguments[0]||{}));},update:Prototype.emptyFunction});Effect.Opacity=Class.create(Effect.Base,{initialize:function(element){this.element=$(element);if(!this.element)throw(Effect._elementDoesNotExistError);if(Prototype.Browser.IE&&(!this.element.currentStyle.hasLayout)) -this.element.setStyle({zoom:1});var options=Object.extend({from:this.element.getOpacity()||0.0,to:1.0},arguments[1]||{});this.start(options);},update:function(position){this.element.setOpacity(position);}});Effect.Move=Class.create(Effect.Base,{initialize:function(element){this.element=$(element);if(!this.element)throw(Effect._elementDoesNotExistError);var options=Object.extend({x:0,y:0,mode:'relative'},arguments[1]||{});this.start(options);},setup:function(){this.element.makePositioned();this.originalLeft=parseFloat(this.element.getStyle('left')||'0');this.originalTop=parseFloat(this.element.getStyle('top')||'0');if(this.options.mode=='absolute'){this.options.x=this.options.x-this.originalLeft;this.options.y=this.options.y-this.originalTop;}},update:function(position){this.element.setStyle({left:(this.options.x*position+this.originalLeft).round()+'px',top:(this.options.y*position+this.originalTop).round()+'px'});}});Effect.MoveBy=function(element,toTop,toLeft){return new Effect.Move(element,Object.extend({x:toLeft,y:toTop},arguments[3]||{}));};Effect.Scale=Class.create(Effect.Base,{initialize:function(element,percent){this.element=$(element);if(!this.element)throw(Effect._elementDoesNotExistError);var options=Object.extend({scaleX:true,scaleY:true,scaleContent:true,scaleFromCenter:false,scaleMode:'box',scaleFrom:100.0,scaleTo:percent},arguments[2]||{});this.start(options);},setup:function(){this.restoreAfterFinish=this.options.restoreAfterFinish||false;this.elementPositioning=this.element.getStyle('position');this.originalStyle={};['top','left','width','height','fontSize'].each(function(k){this.originalStyle[k]=this.element.style[k];}.bind(this));this.originalTop=this.element.offsetTop;this.originalLeft=this.element.offsetLeft;var fontSize=this.element.getStyle('font-size')||'100%';['em','px','%','pt'].each(function(fontSizeType){if(fontSize.indexOf(fontSizeType)>0){this.fontSize=parseFloat(fontSize);this.fontSizeType=fontSizeType;}}.bind(this));this.factor=(this.options.scaleTo-this.options.scaleFrom)/100;this.dims=null;if(this.options.scaleMode=='box') -this.dims=[this.element.offsetHeight,this.element.offsetWidth];if(/^content/.test(this.options.scaleMode)) -this.dims=[this.element.scrollHeight,this.element.scrollWidth];if(!this.dims) -this.dims=[this.options.scaleMode.originalHeight,this.options.scaleMode.originalWidth];},update:function(position){var currentScale=(this.options.scaleFrom/100.0)+(this.factor*position);if(this.options.scaleContent&&this.fontSize) -this.element.setStyle({fontSize:this.fontSize*currentScale+this.fontSizeType});this.setDimensions(this.dims[0]*currentScale,this.dims[1]*currentScale);},finish:function(position){if(this.restoreAfterFinish)this.element.setStyle(this.originalStyle);},setDimensions:function(height,width){var d={};if(this.options.scaleX)d.width=width.round()+'px';if(this.options.scaleY)d.height=height.round()+'px';if(this.options.scaleFromCenter){var topd=(height-this.dims[0])/2;var leftd=(width-this.dims[1])/2;if(this.elementPositioning=='absolute'){if(this.options.scaleY)d.top=this.originalTop-topd+'px';if(this.options.scaleX)d.left=this.originalLeft-leftd+'px';}else{if(this.options.scaleY)d.top=-topd+'px';if(this.options.scaleX)d.left=-leftd+'px';}} -this.element.setStyle(d);}});Effect.Highlight=Class.create(Effect.Base,{initialize:function(element){this.element=$(element);if(!this.element)throw(Effect._elementDoesNotExistError);var options=Object.extend({startcolor:'#ffff99'},arguments[1]||{});this.start(options);},setup:function(){if(this.element.getStyle('display')=='none'){this.cancel();return;} -this.oldStyle={};if(!this.options.keepBackgroundImage){this.oldStyle.backgroundImage=this.element.getStyle('background-image');this.element.setStyle({backgroundImage:'none'});} -if(!this.options.endcolor) -this.options.endcolor=this.element.getStyle('background-color').parseColor('#ffffff');if(!this.options.restorecolor) -this.options.restorecolor=this.element.getStyle('background-color');this._base=$R(0,2).map(function(i){return parseInt(this.options.startcolor.slice(i*2+1,i*2+3),16)}.bind(this));this._delta=$R(0,2).map(function(i){return parseInt(this.options.endcolor.slice(i*2+1,i*2+3),16)-this._base[i]}.bind(this));},update:function(position){this.element.setStyle({backgroundColor:$R(0,2).inject('#',function(m,v,i){return m+((this._base[i]+(this._delta[i]*position)).round().toColorPart());}.bind(this))});},finish:function(){this.element.setStyle(Object.extend(this.oldStyle,{backgroundColor:this.options.restorecolor}));}});Effect.ScrollTo=function(element){var options=arguments[1]||{},scrollOffsets=document.viewport.getScrollOffsets(),elementOffsets=$(element).cumulativeOffset(),max=(window.height||document.body.scrollHeight)-document.viewport.getHeight();if(options.offset)elementOffsets[1]+=options.offset;return new Effect.Tween(null,scrollOffsets.top,elementOffsets[1]>max?max:elementOffsets[1],options,function(p){scrollTo(scrollOffsets.left,p.round())});};Effect.Fade=function(element){element=$(element);var oldOpacity=element.getInlineOpacity();var options=Object.extend({from:element.getOpacity()||1.0,to:0.0,afterFinishInternal:function(effect){if(effect.options.to!=0)return;effect.element.hide().setStyle({opacity:oldOpacity});}},arguments[1]||{});return new Effect.Opacity(element,options);};Effect.Appear=function(element){element=$(element);var options=Object.extend({from:(element.getStyle('display')=='none'?0.0:element.getOpacity()||0.0),to:1.0,afterFinishInternal:function(effect){effect.element.forceRerendering();},beforeSetup:function(effect){effect.element.setOpacity(effect.options.from).show();}},arguments[1]||{});return new Effect.Opacity(element,options);};Effect.Puff=function(element){element=$(element);var oldStyle={opacity:element.getInlineOpacity(),position:element.getStyle('position'),top:element.style.top,left:element.style.left,width:element.style.width,height:element.style.height};return new Effect.Parallel([new Effect.Scale(element,200,{sync:true,scaleFromCenter:true,scaleContent:true,restoreAfterFinish:true}),new Effect.Opacity(element,{sync:true,to:0.0})],Object.extend({duration:1.0,beforeSetupInternal:function(effect){Position.absolutize(effect.effects[0].element)},afterFinishInternal:function(effect){effect.effects[0].element.hide().setStyle(oldStyle);}},arguments[1]||{}));};Effect.BlindUp=function(element){element=$(element);element.makeClipping();return new Effect.Scale(element,0,Object.extend({scaleContent:false,scaleX:false,restoreAfterFinish:true,afterFinishInternal:function(effect){effect.element.hide().undoClipping();}},arguments[1]||{}));};Effect.BlindDown=function(element){element=$(element);var elementDimensions=element.getDimensions();return new Effect.Scale(element,100,Object.extend({scaleContent:false,scaleX:false,scaleFrom:0,scaleMode:{originalHeight:elementDimensions.height,originalWidth:elementDimensions.width},restoreAfterFinish:true,afterSetup:function(effect){effect.element.makeClipping().setStyle({height:'0px'}).show();},afterFinishInternal:function(effect){effect.element.undoClipping();}},arguments[1]||{}));};Effect.SwitchOff=function(element){element=$(element);var oldOpacity=element.getInlineOpacity();return new Effect.Appear(element,Object.extend({duration:0.4,from:0,transition:Effect.Transitions.flicker,afterFinishInternal:function(effect){new Effect.Scale(effect.element,1,{duration:0.3,scaleFromCenter:true,scaleX:false,scaleContent:false,restoreAfterFinish:true,beforeSetup:function(effect){effect.element.makePositioned().makeClipping();},afterFinishInternal:function(effect){effect.element.hide().undoClipping().undoPositioned().setStyle({opacity:oldOpacity});}})}},arguments[1]||{}));};Effect.DropOut=function(element){element=$(element);var oldStyle={top:element.getStyle('top'),left:element.getStyle('left'),opacity:element.getInlineOpacity()};return new Effect.Parallel([new Effect.Move(element,{x:0,y:100,sync:true}),new Effect.Opacity(element,{sync:true,to:0.0})],Object.extend({duration:0.5,beforeSetup:function(effect){effect.effects[0].element.makePositioned();},afterFinishInternal:function(effect){effect.effects[0].element.hide().undoPositioned().setStyle(oldStyle);}},arguments[1]||{}));};Effect.Shake=function(element){element=$(element);var options=Object.extend({distance:20,duration:0.5},arguments[1]||{});var distance=parseFloat(options.distance);var split=parseFloat(options.duration)/10.0;var oldStyle={top:element.getStyle('top'),left:element.getStyle('left')};return new Effect.Move(element,{x:distance,y:0,duration:split,afterFinishInternal:function(effect){new Effect.Move(effect.element,{x:-distance*2,y:0,duration:split*2,afterFinishInternal:function(effect){new Effect.Move(effect.element,{x:distance*2,y:0,duration:split*2,afterFinishInternal:function(effect){new Effect.Move(effect.element,{x:-distance*2,y:0,duration:split*2,afterFinishInternal:function(effect){new Effect.Move(effect.element,{x:distance*2,y:0,duration:split*2,afterFinishInternal:function(effect){new Effect.Move(effect.element,{x:-distance,y:0,duration:split,afterFinishInternal:function(effect){effect.element.undoPositioned().setStyle(oldStyle);}})}})}})}})}})}});};Effect.SlideDown=function(element){element=$(element).cleanWhitespace();var oldInnerBottom=element.down().getStyle('bottom');var elementDimensions=element.getDimensions();return new Effect.Scale(element,100,Object.extend({scaleContent:false,scaleX:false,scaleFrom:window.opera?0:1,scaleMode:{originalHeight:elementDimensions.height,originalWidth:elementDimensions.width},restoreAfterFinish:true,afterSetup:function(effect){effect.element.makePositioned();effect.element.down().makePositioned();if(window.opera)effect.element.setStyle({top:''});effect.element.makeClipping().setStyle({height:'0px'}).show();},afterUpdateInternal:function(effect){effect.element.down().setStyle({bottom:(effect.dims[0]-effect.element.clientHeight)+'px'});},afterFinishInternal:function(effect){effect.element.undoClipping().undoPositioned();effect.element.down().undoPositioned().setStyle({bottom:oldInnerBottom});}},arguments[1]||{}));};Effect.SlideUp=function(element){element=$(element).cleanWhitespace();var oldInnerBottom=element.down().getStyle('bottom');var elementDimensions=element.getDimensions();return new Effect.Scale(element,window.opera?0:1,Object.extend({scaleContent:false,scaleX:false,scaleMode:'box',scaleFrom:100,scaleMode:{originalHeight:elementDimensions.height,originalWidth:elementDimensions.width},restoreAfterFinish:true,afterSetup:function(effect){effect.element.makePositioned();effect.element.down().makePositioned();if(window.opera)effect.element.setStyle({top:''});effect.element.makeClipping().show();},afterUpdateInternal:function(effect){effect.element.down().setStyle({bottom:(effect.dims[0]-effect.element.clientHeight)+'px'});},afterFinishInternal:function(effect){effect.element.hide().undoClipping().undoPositioned();effect.element.down().undoPositioned().setStyle({bottom:oldInnerBottom});}},arguments[1]||{}));};Effect.Squish=function(element){return new Effect.Scale(element,window.opera?1:0,{restoreAfterFinish:true,beforeSetup:function(effect){effect.element.makeClipping();},afterFinishInternal:function(effect){effect.element.hide().undoClipping();}});};Effect.Grow=function(element){element=$(element);var options=Object.extend({direction:'center',moveTransition:Effect.Transitions.sinoidal,scaleTransition:Effect.Transitions.sinoidal,opacityTransition:Effect.Transitions.full},arguments[1]||{});var oldStyle={top:element.style.top,left:element.style.left,height:element.style.height,width:element.style.width,opacity:element.getInlineOpacity()};var dims=element.getDimensions();var initialMoveX,initialMoveY;var moveX,moveY;switch(options.direction){case'top-left':initialMoveX=initialMoveY=moveX=moveY=0;break;case'top-right':initialMoveX=dims.width;initialMoveY=moveY=0;moveX=-dims.width;break;case'bottom-left':initialMoveX=moveX=0;initialMoveY=dims.height;moveY=-dims.height;break;case'bottom-right':initialMoveX=dims.width;initialMoveY=dims.height;moveX=-dims.width;moveY=-dims.height;break;case'center':initialMoveX=dims.width/2;initialMoveY=dims.height/2;moveX=-dims.width/2;moveY=-dims.height/2;break;} -return new Effect.Move(element,{x:initialMoveX,y:initialMoveY,duration:0.01,beforeSetup:function(effect){effect.element.hide().makeClipping().makePositioned();},afterFinishInternal:function(effect){new Effect.Parallel([new Effect.Opacity(effect.element,{sync:true,to:1.0,from:0.0,transition:options.opacityTransition}),new Effect.Move(effect.element,{x:moveX,y:moveY,sync:true,transition:options.moveTransition}),new Effect.Scale(effect.element,100,{scaleMode:{originalHeight:dims.height,originalWidth:dims.width},sync:true,scaleFrom:window.opera?1:0,transition:options.scaleTransition,restoreAfterFinish:true})],Object.extend({beforeSetup:function(effect){effect.effects[0].element.setStyle({height:'0px'}).show();},afterFinishInternal:function(effect){effect.effects[0].element.undoClipping().undoPositioned().setStyle(oldStyle);}},options))}});};Effect.Shrink=function(element){element=$(element);var options=Object.extend({direction:'center',moveTransition:Effect.Transitions.sinoidal,scaleTransition:Effect.Transitions.sinoidal,opacityTransition:Effect.Transitions.none},arguments[1]||{});var oldStyle={top:element.style.top,left:element.style.left,height:element.style.height,width:element.style.width,opacity:element.getInlineOpacity()};var dims=element.getDimensions();var moveX,moveY;switch(options.direction){case'top-left':moveX=moveY=0;break;case'top-right':moveX=dims.width;moveY=0;break;case'bottom-left':moveX=0;moveY=dims.height;break;case'bottom-right':moveX=dims.width;moveY=dims.height;break;case'center':moveX=dims.width/2;moveY=dims.height/2;break;} -return new Effect.Parallel([new Effect.Opacity(element,{sync:true,to:0.0,from:1.0,transition:options.opacityTransition}),new Effect.Scale(element,window.opera?1:0,{sync:true,transition:options.scaleTransition,restoreAfterFinish:true}),new Effect.Move(element,{x:moveX,y:moveY,sync:true,transition:options.moveTransition})],Object.extend({beforeStartInternal:function(effect){effect.effects[0].element.makePositioned().makeClipping();},afterFinishInternal:function(effect){effect.effects[0].element.hide().undoClipping().undoPositioned().setStyle(oldStyle);}},options));};Effect.Pulsate=function(element){element=$(element);var options=arguments[1]||{};var oldOpacity=element.getInlineOpacity();var transition=options.transition||Effect.Transitions.sinoidal;var reverser=function(pos){return transition(1-Effect.Transitions.pulse(pos,options.pulses))};reverser.bind(transition);return new Effect.Opacity(element,Object.extend(Object.extend({duration:2.0,from:0,afterFinishInternal:function(effect){effect.element.setStyle({opacity:oldOpacity});}},options),{transition:reverser}));};Effect.Fold=function(element){element=$(element);var oldStyle={top:element.style.top,left:element.style.left,width:element.style.width,height:element.style.height};element.makeClipping();return new Effect.Scale(element,5,Object.extend({scaleContent:false,scaleX:false,afterFinishInternal:function(effect){new Effect.Scale(element,1,{scaleContent:false,scaleY:false,afterFinishInternal:function(effect){effect.element.hide().undoClipping().setStyle(oldStyle);}});}},arguments[1]||{}));};Effect.Morph=Class.create(Effect.Base,{initialize:function(element){this.element=$(element);if(!this.element)throw(Effect._elementDoesNotExistError);var options=Object.extend({style:{}},arguments[1]||{});if(!Object.isString(options.style))this.style=$H(options.style);else{if(options.style.include(':')) -this.style=options.style.parseStyle();else{this.element.addClassName(options.style);this.style=$H(this.element.getStyles());this.element.removeClassName(options.style);var css=this.element.getStyles();this.style=this.style.reject(function(style){return style.value==css[style.key];});options.afterFinishInternal=function(effect){effect.element.addClassName(effect.options.style);effect.transforms.each(function(transform){effect.element.style[transform.style]='';});}}} -this.start(options);},setup:function(){function parseColor(color){if(!color||['rgba(0, 0, 0, 0)','transparent'].include(color))color='#ffffff';color=color.parseColor();return $R(0,2).map(function(i){return parseInt(color.slice(i*2+1,i*2+3),16)});} -this.transforms=this.style.map(function(pair){var property=pair[0],value=pair[1],unit=null;if(value.parseColor('#zzzzzz')!='#zzzzzz'){value=value.parseColor();unit='color';}else if(property=='opacity'){value=parseFloat(value);if(Prototype.Browser.IE&&(!this.element.currentStyle.hasLayout)) -this.element.setStyle({zoom:1});}else if(Element.CSS_LENGTH.test(value)){var components=value.match(/^([\+\-]?[0-9\.]+)(.*)$/);value=parseFloat(components[1]);unit=(components.length==3)?components[2]:null;} -var originalValue=this.element.getStyle(property);return{style:property.camelize(),originalValue:unit=='color'?parseColor(originalValue):parseFloat(originalValue||0),targetValue:unit=='color'?parseColor(value):value,unit:unit};}.bind(this)).reject(function(transform){return((transform.originalValue==transform.targetValue)||(transform.unit!='color'&&(isNaN(transform.originalValue)||isNaN(transform.targetValue))))});},update:function(position){var style={},transform,i=this.transforms.length;while(i--) -style[(transform=this.transforms[i]).style]=transform.unit=='color'?'#'+ -(Math.round(transform.originalValue[0]+ -(transform.targetValue[0]-transform.originalValue[0])*position)).toColorPart()+ -(Math.round(transform.originalValue[1]+ -(transform.targetValue[1]-transform.originalValue[1])*position)).toColorPart()+ -(Math.round(transform.originalValue[2]+ -(transform.targetValue[2]-transform.originalValue[2])*position)).toColorPart():(transform.originalValue+ -(transform.targetValue-transform.originalValue)*position).toFixed(3)+ -(transform.unit===null?'':transform.unit);this.element.setStyle(style,true);}});Effect.Transform=Class.create({initialize:function(tracks){this.tracks=[];this.options=arguments[1]||{};this.addTracks(tracks);},addTracks:function(tracks){tracks.each(function(track){track=$H(track);var data=track.values().first();this.tracks.push($H({ids:track.keys().first(),effect:Effect.Morph,options:{style:data}}));}.bind(this));return this;},play:function(){return new Effect.Parallel(this.tracks.map(function(track){var ids=track.get('ids'),effect=track.get('effect'),options=track.get('options');var elements=[$(ids)||$$(ids)].flatten();return elements.map(function(e){return new effect(e,Object.extend({sync:true},options))});}).flatten(),this.options);}});Element.CSS_PROPERTIES=$w('backgroundColor backgroundPosition borderBottomColor borderBottomStyle '+'borderBottomWidth borderLeftColor borderLeftStyle borderLeftWidth '+'borderRightColor borderRightStyle borderRightWidth borderSpacing '+'borderTopColor borderTopStyle borderTopWidth bottom clip color '+'fontSize fontWeight height left letterSpacing lineHeight '+'marginBottom marginLeft marginRight marginTop markerOffset maxHeight '+'maxWidth minHeight minWidth opacity outlineColor outlineOffset '+'outlineWidth paddingBottom paddingLeft paddingRight paddingTop '+'right textIndent top width wordSpacing zIndex');Element.CSS_LENGTH=/^(([\+\-]?[0-9\.]+)(em|ex|px|in|cm|mm|pt|pc|\%))|0$/;String.__parseStyleElement=document.createElement('div');String.prototype.parseStyle=function(){var style,styleRules=$H();if(Prototype.Browser.WebKit) -style=new Element('div',{style:this}).style;else{String.__parseStyleElement.innerHTML='
';style=String.__parseStyleElement.childNodes[0].style;} -Element.CSS_PROPERTIES.each(function(property){if(style[property])styleRules.set(property,style[property]);});if(Prototype.Browser.IE&&this.include('opacity')) -styleRules.set('opacity',this.match(/opacity:\s*((?:0|1)?(?:\.\d*)?)/)[1]);return styleRules;};if(document.defaultView&&document.defaultView.getComputedStyle){Element.getStyles=function(element){var css=document.defaultView.getComputedStyle($(element),null);return Element.CSS_PROPERTIES.inject({},function(styles,property){styles[property]=css[property];return styles;});};}else{Element.getStyles=function(element){element=$(element);var css=element.currentStyle,styles;styles=Element.CSS_PROPERTIES.inject({},function(hash,property){hash.set(property,css[property]);return hash;});if(!styles.opacity)styles.set('opacity',element.getOpacity());return styles;};};Effect.Methods={morph:function(element,style){element=$(element);new Effect.Morph(element,Object.extend({style:style},arguments[2]||{}));return element;},visualEffect:function(element,effect,options){element=$(element) -var s=effect.dasherize().camelize(),klass=s.charAt(0).toUpperCase()+s.substring(1);new Effect[klass](element,options);return element;},highlight:function(element,options){element=$(element);new Effect.Highlight(element,options);return element;}};$w('fade appear grow shrink fold blindUp blindDown slideUp slideDown '+'pulsate shake puff squish switchOff dropOut').each(function(effect){Effect.Methods[effect]=function(element,options){element=$(element);Effect[effect.charAt(0).toUpperCase()+effect.substring(1)](element,options);return element;}});$w('getInlineOpacity forceRerendering setContentZoom collectTextNodes collectTextNodesIgnoreClass getStyles').each(function(f){Effect.Methods[f]=Element[f];});Element.addMethods(Effect.Methods);if(Object.isUndefined(Effect)) -throw("dragdrop.js requires including script.aculo.us' effects.js library");var Droppables={drops:[],remove:function(element){this.drops=this.drops.reject(function(d){return d.element==$(element)});},add:function(element){element=$(element);var options=Object.extend({greedy:true,hoverclass:null,tree:false},arguments[1]||{});if(options.containment){options._containers=[];var containment=options.containment;if(Object.isArray(containment)){containment.each(function(c){options._containers.push($(c))});}else{options._containers.push($(containment));}} -if(options.accept)options.accept=[options.accept].flatten();Element.makePositioned(element);options.element=element;this.drops.push(options);},findDeepestChild:function(drops){deepest=drops[0];for(i=1;i0) -drop=Droppables.findDeepestChild(affected);if(this.last_active&&this.last_active!=drop)this.deactivate(this.last_active);if(drop){Position.within(drop.element,point[0],point[1]);if(drop.onHover) -drop.onHover(element,drop.element,Position.overlap(drop.overlap,drop.element));if(drop!=this.last_active)Droppables.activate(drop);}},fire:function(event,element){if(!this.last_active)return;Position.prepare();if(this.isAffected([Event.pointerX(event),Event.pointerY(event)],element,this.last_active)) -if(this.last_active.onDrop){this.last_active.onDrop(element,this.last_active.element,event);return true;}},reset:function(){if(this.last_active) -this.deactivate(this.last_active);}} -var Draggables={drags:[],observers:[],register:function(draggable){if(this.drags.length==0){this.eventMouseUp=this.endDrag.bindAsEventListener(this);this.eventMouseMove=this.updateDrag.bindAsEventListener(this);this.eventKeypress=this.keyPress.bindAsEventListener(this);Event.observe(document,"mouseup",this.eventMouseUp);Event.observe(document,"mousemove",this.eventMouseMove);Event.observe(document,"keypress",this.eventKeypress);} -this.drags.push(draggable);},unregister:function(draggable){this.drags=this.drags.reject(function(d){return d==draggable});if(this.drags.length==0){Event.stopObserving(document,"mouseup",this.eventMouseUp);Event.stopObserving(document,"mousemove",this.eventMouseMove);Event.stopObserving(document,"keypress",this.eventKeypress);}},activate:function(draggable){if(draggable.options.delay){this._timeout=setTimeout(function(){Draggables._timeout=null;window.focus();Draggables.activeDraggable=draggable;}.bind(this),draggable.options.delay);}else{window.focus();this.activeDraggable=draggable;}},deactivate:function(){this.activeDraggable=null;},updateDrag:function(event){if(!this.activeDraggable)return;var pointer=[Event.pointerX(event),Event.pointerY(event)];if(this._lastPointer&&(this._lastPointer.inspect()==pointer.inspect()))return;this._lastPointer=pointer;this.activeDraggable.updateDrag(event,pointer);},endDrag:function(event){if(this._timeout){clearTimeout(this._timeout);this._timeout=null;} -if(!this.activeDraggable)return;this._lastPointer=null;this.activeDraggable.endDrag(event);this.activeDraggable=null;},keyPress:function(event){if(this.activeDraggable) -this.activeDraggable.keyPress(event);},addObserver:function(observer){this.observers.push(observer);this._cacheObserverCallbacks();},removeObserver:function(element){this.observers=this.observers.reject(function(o){return o.element==element});this._cacheObserverCallbacks();},notify:function(eventName,draggable,event){if(this[eventName+'Count']>0) -this.observers.each(function(o){if(o[eventName])o[eventName](eventName,draggable,event);});if(draggable.options[eventName])draggable.options[eventName](draggable,event);},_cacheObserverCallbacks:function(){['onStart','onEnd','onDrag'].each(function(eventName){Draggables[eventName+'Count']=Draggables.observers.select(function(o){return o[eventName];}).length;});}} -var Draggable=Class.create({initialize:function(element){var defaults={handle:false,reverteffect:function(element,top_offset,left_offset){var dur=Math.sqrt(Math.abs(top_offset^2)+Math.abs(left_offset^2))*0.02;new Effect.Move(element,{x:-left_offset,y:-top_offset,duration:dur,queue:{scope:'_draggable',position:'end'}});},endeffect:function(element){var toOpacity=Object.isNumber(element._opacity)?element._opacity:1.0;new Effect.Opacity(element,{duration:0.2,from:0.7,to:toOpacity,queue:{scope:'_draggable',position:'end'},afterFinish:function(){Draggable._dragging[element]=false}});},zindex:1000,revert:false,quiet:false,scroll:false,scrollSensitivity:20,scrollSpeed:15,snap:false,delay:0};if(!arguments[1]||Object.isUndefined(arguments[1].endeffect)) -Object.extend(defaults,{starteffect:function(element){element._opacity=Element.getOpacity(element);Draggable._dragging[element]=true;new Effect.Opacity(element,{duration:0.2,from:element._opacity,to:0.7});}});var options=Object.extend(defaults,arguments[1]||{});this.element=$(element);if(options.handle&&Object.isString(options.handle)) -this.handle=this.element.down('.'+options.handle,0);if(!this.handle)this.handle=$(options.handle);if(!this.handle)this.handle=this.element;if(options.scroll&&!options.scroll.scrollTo&&!options.scroll.outerHTML){options.scroll=$(options.scroll);this._isScrollChild=Element.childOf(this.element,options.scroll);} -Element.makePositioned(this.element);this.options=options;this.dragging=false;this.eventMouseDown=this.initDrag.bindAsEventListener(this);Event.observe(this.handle,"mousedown",this.eventMouseDown);Draggables.register(this);},destroy:function(){Event.stopObserving(this.handle,"mousedown",this.eventMouseDown);Draggables.unregister(this);},currentDelta:function(){return([parseInt(Element.getStyle(this.element,'left')||'0'),parseInt(Element.getStyle(this.element,'top')||'0')]);},initDrag:function(event){if(!Object.isUndefined(Draggable._dragging[this.element])&&Draggable._dragging[this.element])return;if(Event.isLeftClick(event)){var src=Event.element(event);if((tag_name=src.tagName.toUpperCase())&&(tag_name=='INPUT'||tag_name=='SELECT'||tag_name=='OPTION'||tag_name=='BUTTON'||tag_name=='TEXTAREA'))return;var pointer=[Event.pointerX(event),Event.pointerY(event)];var pos=Position.cumulativeOffset(this.element);this.offset=[0,1].map(function(i){return(pointer[i]-pos[i])});Draggables.activate(this);Event.stop(event);}},startDrag:function(event){this.dragging=true;if(!this.delta) -this.delta=this.currentDelta();if(this.options.zindex){this.originalZ=parseInt(Element.getStyle(this.element,'z-index')||0);this.element.style.zIndex=this.options.zindex;} -if(this.options.ghosting){this._clone=this.element.cloneNode(true);this.element._originallyAbsolute=(this.element.getStyle('position')=='absolute');if(!this.element._originallyAbsolute) -Position.absolutize(this.element);this.element.parentNode.insertBefore(this._clone,this.element);} -if(this.options.scroll){if(this.options.scroll==window){var where=this._getWindowScroll(this.options.scroll);this.originalScrollLeft=where.left;this.originalScrollTop=where.top;}else{this.originalScrollLeft=this.options.scroll.scrollLeft;this.originalScrollTop=this.options.scroll.scrollTop;}} -Draggables.notify('onStart',this,event);if(this.options.starteffect)this.options.starteffect(this.element);},updateDrag:function(event,pointer){if(!this.dragging)this.startDrag(event);if(!this.options.quiet){Position.prepare();Droppables.show(pointer,this.element);} -Draggables.notify('onDrag',this,event);this.draw(pointer);if(this.options.change)this.options.change(this);if(this.options.scroll){this.stopScrolling();var p;if(this.options.scroll==window){with(this._getWindowScroll(this.options.scroll)){p=[left,top,left+width,top+height];}}else{p=Position.page(this.options.scroll);p[0]+=this.options.scroll.scrollLeft+Position.deltaX;p[1]+=this.options.scroll.scrollTop+Position.deltaY;p.push(p[0]+this.options.scroll.offsetWidth);p.push(p[1]+this.options.scroll.offsetHeight);} -var speed=[0,0];if(pointer[0]<(p[0]+this.options.scrollSensitivity))speed[0]=pointer[0]-(p[0]+this.options.scrollSensitivity);if(pointer[1]<(p[1]+this.options.scrollSensitivity))speed[1]=pointer[1]-(p[1]+this.options.scrollSensitivity);if(pointer[0]>(p[2]-this.options.scrollSensitivity))speed[0]=pointer[0]-(p[2]-this.options.scrollSensitivity);if(pointer[1]>(p[3]-this.options.scrollSensitivity))speed[1]=pointer[1]-(p[3]-this.options.scrollSensitivity);this.startScrolling(speed);} -if(Prototype.Browser.WebKit)window.scrollBy(0,0);Event.stop(event);},finishDrag:function(event,success){this.dragging=false;if(this.options.quiet){Position.prepare();var pointer=[Event.pointerX(event),Event.pointerY(event)];Droppables.show(pointer,this.element);} -if(this.options.ghosting){if(!this.element._originallyAbsolute) -Position.relativize(this.element);delete this.element._originallyAbsolute;Element.remove(this._clone);this._clone=null;} -var dropped=false;if(success){dropped=Droppables.fire(event,this.element);if(!dropped)dropped=false;} -if(dropped&&this.options.onDropped)this.options.onDropped(this.element);Draggables.notify('onEnd',this,event);var revert=this.options.revert;if(revert&&Object.isFunction(revert))revert=revert(this.element);var d=this.currentDelta();if(revert&&this.options.reverteffect){if(dropped==0||revert!='failure') -this.options.reverteffect(this.element,d[1]-this.delta[1],d[0]-this.delta[0]);}else{this.delta=d;} -if(this.options.zindex) -this.element.style.zIndex=this.originalZ;if(this.options.endeffect) -this.options.endeffect(this.element);Draggables.deactivate(this);Droppables.reset();},keyPress:function(event){if(event.keyCode!=Event.KEY_ESC)return;this.finishDrag(event,false);Event.stop(event);},endDrag:function(event){if(!this.dragging)return;this.stopScrolling();this.finishDrag(event,true);Event.stop(event);},draw:function(point){var pos=Position.cumulativeOffset(this.element);if(this.options.ghosting){var r=Position.realOffset(this.element);pos[0]+=r[0]-Position.deltaX;pos[1]+=r[1]-Position.deltaY;} -var d=this.currentDelta();pos[0]-=d[0];pos[1]-=d[1];if(this.options.scroll&&(this.options.scroll!=window&&this._isScrollChild)){pos[0]-=this.options.scroll.scrollLeft-this.originalScrollLeft;pos[1]-=this.options.scroll.scrollTop-this.originalScrollTop;} -var p=[0,1].map(function(i){return(point[i]-pos[i]-this.offset[i])}.bind(this));if(this.options.snap){if(Object.isFunction(this.options.snap)){p=this.options.snap(p[0],p[1],this);}else{if(Object.isArray(this.options.snap)){p=p.map(function(v,i){return(v/this.options.snap[i]).round()*this.options.snap[i]}.bind(this))}else{p=p.map(function(v){return(v/this.options.snap).round()*this.options.snap}.bind(this))}}} -var style=this.element.style;if((!this.options.constraint)||(this.options.constraint=='horizontal')) -style.left=p[0]+"px";if((!this.options.constraint)||(this.options.constraint=='vertical')) -style.top=p[1]+"px";if(style.visibility=="hidden")style.visibility="";},stopScrolling:function(){if(this.scrollInterval){clearInterval(this.scrollInterval);this.scrollInterval=null;Draggables._lastScrollPointer=null;}},startScrolling:function(speed){if(!(speed[0]||speed[1]))return;this.scrollSpeed=[speed[0]*this.options.scrollSpeed,speed[1]*this.options.scrollSpeed];this.lastScrolled=new Date();this.scrollInterval=setInterval(this.scroll.bind(this),10);},scroll:function(){var current=new Date();var delta=current-this.lastScrolled;this.lastScrolled=current;if(this.options.scroll==window){with(this._getWindowScroll(this.options.scroll)){if(this.scrollSpeed[0]||this.scrollSpeed[1]){var d=delta/1000;this.options.scroll.scrollTo(left+d*this.scrollSpeed[0],top+d*this.scrollSpeed[1]);}}}else{this.options.scroll.scrollLeft+=this.scrollSpeed[0]*delta/1000;this.options.scroll.scrollTop+=this.scrollSpeed[1]*delta/1000;} -Position.prepare();Droppables.show(Draggables._lastPointer,this.element);Draggables.notify('onDrag',this);if(this._isScrollChild){Draggables._lastScrollPointer=Draggables._lastScrollPointer||$A(Draggables._lastPointer);Draggables._lastScrollPointer[0]+=this.scrollSpeed[0]*delta/1000;Draggables._lastScrollPointer[1]+=this.scrollSpeed[1]*delta/1000;if(Draggables._lastScrollPointer[0]<0) -Draggables._lastScrollPointer[0]=0;if(Draggables._lastScrollPointer[1]<0) -Draggables._lastScrollPointer[1]=0;this.draw(Draggables._lastScrollPointer);} -if(this.options.change)this.options.change(this);},_getWindowScroll:function(w){var T,L,W,H;with(w.document){if(w.document.documentElement&&documentElement.scrollTop){T=documentElement.scrollTop;L=documentElement.scrollLeft;}else if(w.document.body){T=body.scrollTop;L=body.scrollLeft;} -if(w.innerWidth){W=w.innerWidth;H=w.innerHeight;}else if(w.document.documentElement&&documentElement.clientWidth){W=documentElement.clientWidth;H=documentElement.clientHeight;}else{W=body.offsetWidth;H=body.offsetHeight}} -return{top:T,left:L,width:W,height:H};}});Draggable._dragging={};var SortableObserver=Class.create({initialize:function(element,observer){this.element=$(element);this.observer=observer;this.lastValue=Sortable.serialize(this.element);},onStart:function(){this.lastValue=Sortable.serialize(this.element);},onEnd:function(){Sortable.unmark();if(this.lastValue!=Sortable.serialize(this.element)) -this.observer(this.element)}});var Sortable={SERIALIZE_RULE:/^[^_\-](?:[A-Za-z0-9\-\_]*)[_](.*)$/,sortables:{},_findRootElement:function(element){while(element.tagName.toUpperCase()!="BODY"){if(element.id&&Sortable.sortables[element.id])return element;element=element.parentNode;}},options:function(element){element=Sortable._findRootElement($(element));if(!element)return;return Sortable.sortables[element.id];},destroy:function(element){var s=Sortable.options(element);if(s){Draggables.removeObserver(s.element);s.droppables.each(function(d){Droppables.remove(d)});s.draggables.invoke('destroy');delete Sortable.sortables[s.element.id];}},create:function(element){element=$(element);var options=Object.extend({element:element,tag:'li',dropOnEmpty:false,tree:false,treeTag:'ul',overlap:'vertical',constraint:'vertical',containment:element,handle:false,only:false,delay:0,hoverclass:null,ghosting:false,quiet:false,scroll:false,scrollSensitivity:20,scrollSpeed:15,format:this.SERIALIZE_RULE,elements:false,handles:false,onChange:Prototype.emptyFunction,onUpdate:Prototype.emptyFunction},arguments[1]||{});this.destroy(element);var options_for_draggable={revert:true,quiet:options.quiet,scroll:options.scroll,scrollSpeed:options.scrollSpeed,scrollSensitivity:options.scrollSensitivity,delay:options.delay,ghosting:options.ghosting,constraint:options.constraint,handle:options.handle};if(options.starteffect) -options_for_draggable.starteffect=options.starteffect;if(options.reverteffect) -options_for_draggable.reverteffect=options.reverteffect;else -if(options.ghosting)options_for_draggable.reverteffect=function(element){element.style.top=0;element.style.left=0;};if(options.endeffect) -options_for_draggable.endeffect=options.endeffect;if(options.zindex) -options_for_draggable.zindex=options.zindex;var options_for_droppable={overlap:options.overlap,containment:options.containment,tree:options.tree,hoverclass:options.hoverclass,onHover:Sortable.onHover} -var options_for_tree={onHover:Sortable.onEmptyHover,overlap:options.overlap,containment:options.containment,hoverclass:options.hoverclass} -Element.cleanWhitespace(element);options.draggables=[];options.droppables=[];if(options.dropOnEmpty||options.tree){Droppables.add(element,options_for_tree);options.droppables.push(element);} -(options.elements||this.findElements(element,options)||[]).each(function(e,i){var handle=options.handles?$(options.handles[i]):(options.handle?$(e).select('.'+options.handle)[0]:e);options.draggables.push(new Draggable(e,Object.extend(options_for_draggable,{handle:handle})));Droppables.add(e,options_for_droppable);if(options.tree)e.treeNode=element;options.droppables.push(e);});if(options.tree){(Sortable.findTreeElements(element,options)||[]).each(function(e){Droppables.add(e,options_for_tree);e.treeNode=element;options.droppables.push(e);});} -this.sortables[element.id]=options;Draggables.addObserver(new SortableObserver(element,options.onUpdate));},findElements:function(element,options){return Element.findChildren(element,options.only,options.tree?true:false,options.tag);},findTreeElements:function(element,options){return Element.findChildren(element,options.only,options.tree?true:false,options.treeTag);},onHover:function(element,dropon,overlap){if(Element.isParent(dropon,element))return;if(overlap>.33&&overlap<.66&&Sortable.options(dropon).tree){return;}else if(overlap>0.5){Sortable.mark(dropon,'before');if(dropon.previousSibling!=element){var oldParentNode=element.parentNode;element.style.visibility="hidden";dropon.parentNode.insertBefore(element,dropon);if(dropon.parentNode!=oldParentNode) -Sortable.options(oldParentNode).onChange(element);Sortable.options(dropon.parentNode).onChange(element);}}else{Sortable.mark(dropon,'after');var nextElement=dropon.nextSibling||null;if(nextElement!=element){var oldParentNode=element.parentNode;element.style.visibility="hidden";dropon.parentNode.insertBefore(element,nextElement);if(dropon.parentNode!=oldParentNode) -Sortable.options(oldParentNode).onChange(element);Sortable.options(dropon.parentNode).onChange(element);}}},onEmptyHover:function(element,dropon,overlap){var oldParentNode=element.parentNode;var droponOptions=Sortable.options(dropon);if(!Element.isParent(dropon,element)){var index;var children=Sortable.findElements(dropon,{tag:droponOptions.tag,only:droponOptions.only});var child=null;if(children){var offset=Element.offsetSize(dropon,droponOptions.overlap)*(1.0-overlap);for(index=0;index=0){offset-=Element.offsetSize(children[index],droponOptions.overlap);}else if(offset-(Element.offsetSize(children[index],droponOptions.overlap)/2)>=0){child=index+1');this.iefix=$(this.update.id+'_iefix');} -if(this.iefix)setTimeout(this.fixIEOverlapping.bind(this),50);},fixIEOverlapping:function(){Position.clone(this.update,this.iefix,{setTop:(!this.update.style.height)});this.iefix.style.zIndex=1;this.update.style.zIndex=2;Element.show(this.iefix);},hide:function(){this.stopIndicator();if(Element.getStyle(this.update,'display')!='none')this.options.onHide(this.element,this.update);if(this.iefix)Element.hide(this.iefix);},startIndicator:function(){if(this.options.indicator)Element.show(this.options.indicator);},stopIndicator:function(){if(this.options.indicator)Element.hide(this.options.indicator);},onKeyPress:function(event){if(this.active) -switch(event.keyCode){case Event.KEY_TAB:case Event.KEY_RETURN:this.selectEntry();Event.stop(event);case Event.KEY_ESC:this.hide();this.active=false;Event.stop(event);return;case Event.KEY_LEFT:case Event.KEY_RIGHT:return;case Event.KEY_UP:this.markPrevious();this.render();Event.stop(event);return;case Event.KEY_DOWN:this.markNext();this.render();Event.stop(event);return;} -else -if(event.keyCode==Event.KEY_TAB||event.keyCode==Event.KEY_RETURN||(Prototype.Browser.WebKit>0&&event.keyCode==0))return;this.changed=true;this.hasFocus=true;if(this.observer)clearTimeout(this.observer);this.observer=setTimeout(this.onObserverEvent.bind(this),this.options.frequency*1000);},activate:function(){this.changed=false;this.hasFocus=true;this.getUpdatedChoices();},onHover:function(event){var element=Event.findElement(event,'LI');if(this.index!=element.autocompleteIndex) -{this.index=element.autocompleteIndex;this.render();} -Event.stop(event);},onClick:function(event){var element=Event.findElement(event,'LI');this.index=element.autocompleteIndex;this.selectEntry();this.hide();},onBlur:function(event){setTimeout(this.hide.bind(this),250);this.hasFocus=false;this.active=false;},render:function(){if(this.entryCount>0){for(var i=0;i0)this.index-- -else this.index=this.entryCount-1;this.getEntry(this.index).scrollIntoView(false);},markNext:function(){if(this.index0)value=Element.collectTextNodes(nodes[0],this.options.select);}else -value=Element.collectTextNodesIgnoreClass(selectedElement,'informal');var bounds=this.getTokenBounds();if(bounds[0]!=-1){var newValue=this.element.value.substr(0,bounds[0]);var whitespace=this.element.value.substr(bounds[0]).match(/^\s+/);if(whitespace) -newValue+=whitespace[0];this.element.value=newValue+value+this.element.value.substr(bounds[1]);}else{this.element.value=value;} -this.oldElementValue=this.element.value;this.element.focus();if(this.options.afterUpdateElement) -this.options.afterUpdateElement(this.element,selectedElement);},updateChoices:function(choices){if(!this.changed&&this.hasFocus){this.update.innerHTML=choices;Element.cleanWhitespace(this.update);Element.cleanWhitespace(this.update.down());if(this.update.firstChild&&this.update.down().childNodes){this.entryCount=this.update.down().childNodes.length;for(var i=0;i=this.options.minChars){this.getUpdatedChoices();}else{this.active=false;this.hide();} -this.oldElementValue=this.element.value;},getToken:function(){var bounds=this.getTokenBounds();return this.element.value.substring(bounds[0],bounds[1]).strip();},getTokenBounds:function(){if(null!=this.tokenBounds)return this.tokenBounds;var value=this.element.value;if(value.strip().empty())return[-1,0];var diff=arguments.callee.getFirstDifferencePos(value,this.oldElementValue);var offset=(diff==this.oldElementValue.length?1:0);var prevTokenPos=-1,nextTokenPos=value.length;var tp;for(var index=0,l=this.options.tokens.length;indexprevTokenPos)prevTokenPos=tp;tp=value.indexOf(this.options.tokens[index],diff+offset);if(-1!=tp&&tp"+elem.substr(0,entry.length)+""+ -elem.substr(entry.length)+"");break;}else if(entry.length>=instance.options.partialChars&&instance.options.partialSearch&&foundPos!=-1){if(instance.options.fullSearch||/\s/.test(elem.substr(foundPos-1,1))){partial.push("
  • "+elem.substr(0,foundPos)+""+ -elem.substr(foundPos,entry.length)+""+elem.substr(foundPos+entry.length)+"
  • ");break;}} -foundPos=instance.options.ignoreCase?elem.toLowerCase().indexOf(entry.toLowerCase(),foundPos+1):elem.indexOf(entry,foundPos+1);}} -if(partial.length) -ret=ret.concat(partial.slice(0,instance.options.choices-ret.length)) -return"
      "+ret.join('')+"
    ";}},options||{});}});Field.scrollFreeActivate=function(field){setTimeout(function(){Field.activate(field);},1);} -Ajax.InPlaceEditor=Class.create({initialize:function(element,url,options){this.url=url;this.element=element=$(element);this.prepareOptions();this._controls={};arguments.callee.dealWithDeprecatedOptions(options);Object.extend(this.options,options||{});if(!this.options.formId&&this.element.id){this.options.formId=this.element.id+'-inplaceeditor';if($(this.options.formId)) -this.options.formId='';} -if(this.options.externalControl) -this.options.externalControl=$(this.options.externalControl);if(!this.options.externalControl) -this.options.externalControlOnly=false;this._originalBackground=this.element.getStyle('background-color')||'transparent';this.element.title=this.options.clickToEditText;this._boundCancelHandler=this.handleFormCancellation.bind(this);this._boundComplete=(this.options.onComplete||Prototype.emptyFunction).bind(this);this._boundFailureHandler=this.handleAJAXFailure.bind(this);this._boundSubmitHandler=this.handleFormSubmission.bind(this);this._boundWrapperHandler=this.wrapUp.bind(this);this.registerListeners();},checkForEscapeOrReturn:function(e){if(!this._editing||e.ctrlKey||e.altKey||e.shiftKey)return;if(Event.KEY_ESC==e.keyCode) -this.handleFormCancellation(e);else if(Event.KEY_RETURN==e.keyCode) -this.handleFormSubmission(e);},createControl:function(mode,handler,extraClasses){var control=this.options[mode+'Control'];var text=this.options[mode+'Text'];if('button'==control){var btn=document.createElement('input');btn.type='submit';btn.value=text;btn.className='editor_'+mode+'_button';if('cancel'==mode) -btn.onclick=this._boundCancelHandler;this._form.appendChild(btn);this._controls[mode]=btn;}else if('link'==control){var link=document.createElement('a');link.href='#';link.appendChild(document.createTextNode(text));link.onclick='cancel'==mode?this._boundCancelHandler:this._boundSubmitHandler;link.className='editor_'+mode+'_link';if(extraClasses) -link.className+=' '+extraClasses;this._form.appendChild(link);this._controls[mode]=link;}},createEditField:function(){var text=(this.options.loadTextURL?this.options.loadingText:this.getText());var fld;if(1>=this.options.rows&&!/\r|\n/.test(this.getText())){fld=document.createElement('input');fld.type='text';var size=this.options.size||this.options.cols||0;if(0=this.options.rows?this.options.autoRows:this.options.rows);fld.cols=this.options.cols||40;} -fld.name=this.options.paramName;fld.value=text;fld.className='editor_field';if(this.options.submitOnBlur) -fld.onblur=this._boundSubmitHandler;this._controls.editor=fld;if(this.options.loadTextURL) -this.loadExternalText();this._form.appendChild(this._controls.editor);},createForm:function(){var ipe=this;function addText(mode,condition){var text=ipe.options['text'+mode+'Controls'];if(!text||condition===false)return;ipe._form.appendChild(document.createTextNode(text));};this._form=$(document.createElement('form'));this._form.id=this.options.formId;this._form.addClassName(this.options.formClassName);this._form.onsubmit=this._boundSubmitHandler;this.createEditField();if('textarea'==this._controls.editor.tagName.toLowerCase()) -this._form.appendChild(document.createElement('br'));if(this.options.onFormCustomization) -this.options.onFormCustomization(this,this._form);addText('Before',this.options.okControl||this.options.cancelControl);this.createControl('ok',this._boundSubmitHandler);addText('Between',this.options.okControl&&this.options.cancelControl);this.createControl('cancel',this._boundCancelHandler,'editor_cancel');addText('After',this.options.okControl||this.options.cancelControl);},destroy:function(){if(this._oldInnerHTML) -this.element.innerHTML=this._oldInnerHTML;this.leaveEditMode();this.unregisterListeners();},enterEditMode:function(e){if(this._saving||this._editing)return;this._editing=true;this.triggerCallback('onEnterEditMode');if(this.options.externalControl) -this.options.externalControl.hide();this.element.hide();this.createForm();this.element.parentNode.insertBefore(this._form,this.element);if(!this.options.loadTextURL) -this.postProcessEditField();if(e)Event.stop(e);},enterHover:function(e){if(this.options.hoverClassName) -this.element.addClassName(this.options.hoverClassName);if(this._saving)return;this.triggerCallback('onEnterHover');},getText:function(){return this.element.innerHTML;},handleAJAXFailure:function(transport){this.triggerCallback('onFailure',transport);if(this._oldInnerHTML){this.element.innerHTML=this._oldInnerHTML;this._oldInnerHTML=null;}},handleFormCancellation:function(e){this.wrapUp();if(e)Event.stop(e);},handleFormSubmission:function(e){var form=this._form;var value=$F(this._controls.editor);this.prepareSubmission();var params=this.options.callback(form,value)||'';if(Object.isString(params)) -params=params.toQueryParams();params.editorId=this.element.id;if(this.options.htmlResponse){var options=Object.extend({evalScripts:true},this.options.ajaxOptions);Object.extend(options,{parameters:params,onComplete:this._boundWrapperHandler,onFailure:this._boundFailureHandler});new Ajax.Updater({success:this.element},this.url,options);}else{var options=Object.extend({method:'get'},this.options.ajaxOptions);Object.extend(options,{parameters:params,onComplete:this._boundWrapperHandler,onFailure:this._boundFailureHandler});new Ajax.Request(this.url,options);} -if(e)Event.stop(e);},leaveEditMode:function(){this.element.removeClassName(this.options.savingClassName);this.removeForm();this.leaveHover();this.element.style.backgroundColor=this._originalBackground;this.element.show();if(this.options.externalControl) -this.options.externalControl.show();this._saving=false;this._editing=false;this._oldInnerHTML=null;this.triggerCallback('onLeaveEditMode');},leaveHover:function(e){if(this.options.hoverClassName) -this.element.removeClassName(this.options.hoverClassName);if(this._saving)return;this.triggerCallback('onLeaveHover');},loadExternalText:function(){this._form.addClassName(this.options.loadingClassName);this._controls.editor.disabled=true;var options=Object.extend({method:'get'},this.options.ajaxOptions);Object.extend(options,{parameters:'editorId='+encodeURIComponent(this.element.id),onComplete:Prototype.emptyFunction,onSuccess:function(transport){this._form.removeClassName(this.options.loadingClassName);var text=transport.responseText;if(this.options.stripLoadedTextTags) -text=text.stripTags();this._controls.editor.value=text;this._controls.editor.disabled=false;this.postProcessEditField();}.bind(this),onFailure:this._boundFailureHandler});new Ajax.Request(this.options.loadTextURL,options);},postProcessEditField:function(){var fpc=this.options.fieldPostCreation;if(fpc) -$(this._controls.editor)['focus'==fpc?'focus':'activate']();},prepareOptions:function(){this.options=Object.clone(Ajax.InPlaceEditor.DefaultOptions);Object.extend(this.options,Ajax.InPlaceEditor.DefaultCallbacks);[this._extraDefaultOptions].flatten().compact().each(function(defs){Object.extend(this.options,defs);}.bind(this));},prepareSubmission:function(){this._saving=true;this.removeForm();this.leaveHover();this.showSaving();},registerListeners:function(){this._listeners={};var listener;$H(Ajax.InPlaceEditor.Listeners).each(function(pair){listener=this[pair.value].bind(this);this._listeners[pair.key]=listener;if(!this.options.externalControlOnly) -this.element.observe(pair.key,listener);if(this.options.externalControl) -this.options.externalControl.observe(pair.key,listener);}.bind(this));},removeForm:function(){if(!this._form)return;this._form.remove();this._form=null;this._controls={};},showSaving:function(){this._oldInnerHTML=this.element.innerHTML;this.element.innerHTML=this.options.savingText;this.element.addClassName(this.options.savingClassName);this.element.style.backgroundColor=this._originalBackground;this.element.show();},triggerCallback:function(cbName,arg){if('function'==typeof this.options[cbName]){this.options[cbName](this,arg);}},unregisterListeners:function(){$H(this._listeners).each(function(pair){if(!this.options.externalControlOnly) -this.element.stopObserving(pair.key,pair.value);if(this.options.externalControl) -this.options.externalControl.stopObserving(pair.key,pair.value);}.bind(this));},wrapUp:function(transport){this.leaveEditMode();this._boundComplete(transport,this.element);}});Object.extend(Ajax.InPlaceEditor.prototype,{dispose:Ajax.InPlaceEditor.prototype.destroy});Ajax.InPlaceCollectionEditor=Class.create(Ajax.InPlaceEditor,{initialize:function($super,element,url,options){this._extraDefaultOptions=Ajax.InPlaceCollectionEditor.DefaultOptions;$super(element,url,options);},createEditField:function(){var list=document.createElement('select');list.name=this.options.paramName;list.size=1;this._controls.editor=list;this._collection=this.options.collection||[];if(this.options.loadCollectionURL) -this.loadCollection();else -this.checkForExternalText();this._form.appendChild(this._controls.editor);},loadCollection:function(){this._form.addClassName(this.options.loadingClassName);this.showLoadingText(this.options.loadingCollectionText);var options=Object.extend({method:'get'},this.options.ajaxOptions);Object.extend(options,{parameters:'editorId='+encodeURIComponent(this.element.id),onComplete:Prototype.emptyFunction,onSuccess:function(transport){var js=transport.responseText.strip();if(!/^\[.*\]$/.test(js)) -throw'Server returned an invalid collection representation.';this._collection=eval(js);this.checkForExternalText();}.bind(this),onFailure:this.onFailure});new Ajax.Request(this.options.loadCollectionURL,options);},showLoadingText:function(text){this._controls.editor.disabled=true;var tempOption=this._controls.editor.firstChild;if(!tempOption){tempOption=document.createElement('option');tempOption.value='';this._controls.editor.appendChild(tempOption);tempOption.selected=true;} -tempOption.update((text||'').stripScripts().stripTags());},checkForExternalText:function(){this._text=this.getText();if(this.options.loadTextURL) -this.loadExternalText();else -this.buildOptionList();},loadExternalText:function(){this.showLoadingText(this.options.loadingText);var options=Object.extend({method:'get'},this.options.ajaxOptions);Object.extend(options,{parameters:'editorId='+encodeURIComponent(this.element.id),onComplete:Prototype.emptyFunction,onSuccess:function(transport){this._text=transport.responseText.strip();this.buildOptionList();}.bind(this),onFailure:this.onFailure});new Ajax.Request(this.options.loadTextURL,options);},buildOptionList:function(){this._form.removeClassName(this.options.loadingClassName);this._collection=this._collection.map(function(entry){return 2===entry.length?entry:[entry,entry].flatten();});var marker=('value'in this.options)?this.options.value:this._text;var textFound=this._collection.any(function(entry){return entry[0]==marker;}.bind(this));this._controls.editor.update('');var option;this._collection.each(function(entry,index){option=document.createElement('option');option.value=entry[0];option.selected=textFound?entry[0]==marker:0==index;option.appendChild(document.createTextNode(entry[1]));this._controls.editor.appendChild(option);}.bind(this));this._controls.editor.disabled=false;Field.scrollFreeActivate(this._controls.editor);}});Ajax.InPlaceEditor.prototype.initialize.dealWithDeprecatedOptions=function(options){if(!options)return;function fallback(name,expr){if(name in options||expr===undefined)return;options[name]=expr;};fallback('cancelControl',(options.cancelLink?'link':(options.cancelButton?'button':options.cancelLink==options.cancelButton==false?false:undefined)));fallback('okControl',(options.okLink?'link':(options.okButton?'button':options.okLink==options.okButton==false?false:undefined)));fallback('highlightColor',options.highlightcolor);fallback('highlightEndColor',options.highlightendcolor);};Object.extend(Ajax.InPlaceEditor,{DefaultOptions:{ajaxOptions:{},autoRows:3,cancelControl:'link',cancelText:'cancel',clickToEditText:'Click to edit',externalControl:null,externalControlOnly:false,fieldPostCreation:'activate',formClassName:'inplaceeditor-form',formId:null,highlightColor:'#ffff99',highlightEndColor:'#ffffff',hoverClassName:'',htmlResponse:true,loadingClassName:'inplaceeditor-loading',loadingText:'Loading...',okControl:'button',okText:'ok',paramName:'value',rows:1,savingClassName:'inplaceeditor-saving',savingText:'Saving...',size:0,stripLoadedTextTags:false,submitOnBlur:false,textAfterControls:'',textBeforeControls:'',textBetweenControls:''},DefaultCallbacks:{callback:function(form){return Form.serialize(form);},onComplete:function(transport,element){new Effect.Highlight(element,{startcolor:this.options.highlightColor,keepBackgroundImage:true});},onEnterEditMode:null,onEnterHover:function(ipe){ipe.element.style.backgroundColor=ipe.options.highlightColor;if(ipe._effect) -ipe._effect.cancel();},onFailure:function(transport,ipe){alert('Error communication with the server: '+transport.responseText.stripTags());},onFormCustomization:null,onLeaveEditMode:null,onLeaveHover:function(ipe){ipe._effect=new Effect.Highlight(ipe.element,{startcolor:ipe.options.highlightColor,endcolor:ipe.options.highlightEndColor,restorecolor:ipe._originalBackground,keepBackgroundImage:true});}},Listeners:{click:'enterEditMode',keydown:'checkForEscapeOrReturn',mouseover:'enterHover',mouseout:'leaveHover'}});Ajax.InPlaceCollectionEditor.DefaultOptions={loadingCollectionText:'Loading options...'};Form.Element.DelayedObserver=Class.create({initialize:function(element,delay,callback){this.delay=delay||0.5;this.element=$(element);this.callback=callback;this.timer=null;this.lastValue=$F(this.element);Event.observe(this.element,'keyup',this.delayedListener.bindAsEventListener(this));},delayedListener:function(event){if(this.lastValue==$F(this.element))return;if(this.timer)clearTimeout(this.timer);this.timer=setTimeout(this.onTimerEvent.bind(this),this.delay*1000);this.lastValue=$F(this.element);},onTimerEvent:function(){this.timer=null;this.callback(this.element,$F(this.element));}});var Login={showOpenid:function(){if($('database_auth_form'))$('database_auth_form').hide();if($('openid_auth_form'))$('openid_auth_form').show();if($('alternate_auth_openid'))$('alternate_auth_openid').hide();if($('alternate_auth_database'))$('alternate_auth_database').show();if($('openid_url'))$('openid_url').focus();if($('openid_url'))$('openid_url').select();new CookieManager().setCookie('preferred_auth','openid');},showDatabase:function(container){if($('openid_auth_form'))$('openid_auth_form').hide();if($('database_auth_form'))$('database_auth_form').show();if($('alternate_auth_database'))$('alternate_auth_database').hide();if($('alternate_auth_openid'))$('alternate_auth_openid').show();if($('user_login'))$('user_login').focus();if($('user_login'))$('user_login').select();new CookieManager().setCookie('preferred_auth','database');}} -var TracksForm={toggle:function(toggleDivId,formContainerId,formId,hideLinkText,hideLinkTitle,showLinkText,showLinkTitle){$(formContainerId).toggle();toggleDiv=$(toggleDivId);toggleLink=toggleDiv.down('a');if(toggleDiv.hasClassName('hide_form')){toggleLink.update(showLinkText).setAttribute('title',showLinkTitle);} -else{toggleLink.update(hideLinkText).setAttribute('title',hideLinkTitle);Form.focusFirstElement(formId);} -toggleDiv.toggleClassName('hide_form');},get_period:function(){if($('recurring_todo_recurring_period_daily').checked){return'daily';} -else if($('recurring_todo_recurring_period_weekly').checked){return'weekly';} -else if($('recurring_todo_recurring_period_monthly').checked){return'monthly';} -else if($('recurring_todo_recurring_period_yearly').checked){return'yearly';} -else{return'no period'}},get_edit_period:function(){if($('recurring_edit_todo_recurring_period_daily').checked){return'daily';} -else if($('recurring_edit_todo_recurring_period_weekly').checked){return'weekly';} -else if($('recurring_edit_todo_recurring_period_monthly').checked){return'monthly';} -else if($('recurring_edit_todo_recurring_period_yearly').checked){return'yearly';} -else{return'no period'}},hide_all_recurring:function(){$('recurring_daily').hide();$('recurring_weekly').hide();$('recurring_monthly').hide();$('recurring_yearly').hide();},hide_all_edit_recurring:function(){$('recurring_edit_daily').hide();$('recurring_edit_weekly').hide();$('recurring_edit_monthly').hide();$('recurring_edit_yearly').hide();},toggle_overlay:function(){el=document.getElementById("overlay");el.style.visibility=(el.style.visibility=="visible")?"hidden":"visible";}} -Event.observe(window,'load',function(){$A(document.getElementsByClassName('alert')).each(function(o){o.opacity=100.0 -Effect.Fade(o,{duration:8.0})});});CookieManager=Class.create();CookieManager.prototype={BROWSER_IS_IE:(document.all&&window.ActiveXObject&&navigator.userAgent.toLowerCase().indexOf("msie")>-1&&navigator.userAgent.toLowerCase().indexOf("opera")==-1),BROWSER_IS_OPERA:(navigator.userAgent.toLowerCase().indexOf("opera")!=-1),initialize:function(options) -{this.options=Object.extend({shelfLife:365,userData:false},options||{});this.cookieShelfLife=this.options.shelfLife;this.userDataForIE=this.options.userData;if(this.BROWSER_IS_IE&&this.userDataForIE) -{this.IE_CACHE_NAME="storage";if($(this.IE_CACHE_NAME)==null) -{var div=document.createElement("DIV");div.id=this.IE_CACHE_NAME;document.body.appendChild(div);} -this.store=$(this.IE_CACHE_NAME);this.store.style.behavior="url('#default#userData')";}},getCookie:function(aCookieName) -{var result=null;if(this.BROWSER_IS_IE&&this.userDataForIE) -{this.store.load(this.IE_CACHE_NAME);result=this.store.getAttribute(aCookieName);} -else -{for(var i=0;i0;){ar[--i]=Calendar._DN[i].substr(0,Calendar._SDN_len);} -Calendar._SDN=ar;if(typeof Calendar._SMN_len=="undefined") -Calendar._SMN_len=3;ar=new Array();for(var i=12;i>0;){ar[--i]=Calendar._MN[i].substr(0,Calendar._SMN_len);} -Calendar._SMN=ar;}};Calendar._C=null;Calendar.is_ie=(/msie/i.test(navigator.userAgent)&&!/opera/i.test(navigator.userAgent));Calendar.is_ie5=(Calendar.is_ie&&/msie 5\.0/i.test(navigator.userAgent));Calendar.is_opera=/opera/i.test(navigator.userAgent);Calendar.is_khtml=/Konqueror|Safari|KHTML/i.test(navigator.userAgent);Calendar.getAbsolutePos=function(el){var SL=0,ST=0;var is_div=/^div$/i.test(el.tagName);if(is_div&&el.scrollLeft) -SL=el.scrollLeft;if(is_div&&el.scrollTop) -ST=el.scrollTop;var r={x:el.offsetLeft-SL,y:el.offsetTop-ST};if(el.offsetParent){var tmp=this.getAbsolutePos(el.offsetParent);r.x+=tmp.x;r.y+=tmp.y;} -return r;};Calendar.isRelated=function(el,evt){var related=evt.relatedTarget;if(!related){var type=evt.type;if(type=="mouseover"){related=evt.fromElement;}else if(type=="mouseout"){related=evt.toElement;}} -while(related){if(related==el){return true;} -related=related.parentNode;} -return false;};Calendar.removeClass=function(el,className){if(!(el&&el.className)){return;} -var cls=el.className.split(" ");var ar=new Array();for(var i=cls.length;i>0;){if(cls[--i]!=className){ar[ar.length]=cls[i];}} -el.className=ar.join(" ");};Calendar.addClass=function(el,className){Calendar.removeClass(el,className);el.className+=" "+className;};Calendar.getElement=function(ev){var f=Calendar.is_ie?window.event.srcElement:ev.currentTarget;while(f.nodeType!=1||/^div$/i.test(f.tagName)) -f=f.parentNode;return f;};Calendar.getTargetElement=function(ev){var f=Calendar.is_ie?window.event.srcElement:ev.target;while(f.nodeType!=1) -f=f.parentNode;return f;};Calendar.stopEvent=function(ev){ev||(ev=window.event);if(Calendar.is_ie){ev.cancelBubble=true;ev.returnValue=false;}else{ev.preventDefault();ev.stopPropagation();} -return false;};Calendar.addEvent=function(el,evname,func){if(el.attachEvent){el.attachEvent("on"+evname,func);}else if(el.addEventListener){el.addEventListener(evname,func,true);}else{el["on"+evname]=func;}};Calendar.removeEvent=function(el,evname,func){if(el.detachEvent){el.detachEvent("on"+evname,func);}else if(el.removeEventListener){el.removeEventListener(evname,func,true);}else{el["on"+evname]=null;}};Calendar.createElement=function(type,parent){var el=null;if(document.createElementNS){el=document.createElementNS("http://www.w3.org/1999/xhtml",type);}else{el=document.createElement(type);} -if(typeof parent!="undefined"){parent.appendChild(el);} -return el;};Calendar._add_evs=function(el){with(Calendar){addEvent(el,"mouseover",dayMouseOver);addEvent(el,"mousedown",dayMouseDown);addEvent(el,"mouseout",dayMouseOut);if(is_ie){addEvent(el,"dblclick",dayMouseDblClick);el.setAttribute("unselectable",true);}}};Calendar.findMonth=function(el){if(typeof el.month!="undefined"){return el;}else if(typeof el.parentNode.month!="undefined"){return el.parentNode;} -return null;};Calendar.findYear=function(el){if(typeof el.year!="undefined"){return el;}else if(typeof el.parentNode.year!="undefined"){return el.parentNode;} -return null;};Calendar.showMonthsCombo=function(){var cal=Calendar._C;if(!cal){return false;} -var cal=cal;var cd=cal.activeDiv;var mc=cal.monthsCombo;if(cal.hilitedMonth){Calendar.removeClass(cal.hilitedMonth,"hilite");} -if(cal.activeMonth){Calendar.removeClass(cal.activeMonth,"active");} -var mon=cal.monthsCombo.getElementsByTagName("div")[cal.date.getMonth()];Calendar.addClass(mon,"active");cal.activeMonth=mon;var s=mc.style;s.display="block";if(cd.navtype<0) -s.left=cd.offsetLeft+"px";else{var mcw=mc.offsetWidth;if(typeof mcw=="undefined") -mcw=50;s.left=(cd.offsetLeft+cd.offsetWidth-mcw)+"px";} -s.top=(cd.offsetTop+cd.offsetHeight)+"px";};Calendar.showYearsCombo=function(fwd){var cal=Calendar._C;if(!cal){return false;} -var cal=cal;var cd=cal.activeDiv;var yc=cal.yearsCombo;if(cal.hilitedYear){Calendar.removeClass(cal.hilitedYear,"hilite");} -if(cal.activeYear){Calendar.removeClass(cal.activeYear,"active");} -cal.activeYear=null;var Y=cal.date.getFullYear()+(fwd?1:-1);var yr=yc.firstChild;var show=false;for(var i=12;i>0;--i){if(Y>=cal.minYear&&Y<=cal.maxYear){yr.innerHTML=Y;yr.year=Y;yr.style.display="block";show=true;}else{yr.style.display="none";} -yr=yr.nextSibling;Y+=fwd?cal.yearStep:-cal.yearStep;} -if(show){var s=yc.style;s.display="block";if(cd.navtype<0) -s.left=cd.offsetLeft+"px";else{var ycw=yc.offsetWidth;if(typeof ycw=="undefined") -ycw=50;s.left=(cd.offsetLeft+cd.offsetWidth-ycw)+"px";} -s.top=(cd.offsetTop+cd.offsetHeight)+"px";}};Calendar.tableMouseUp=function(ev){var cal=Calendar._C;if(!cal){return false;} -if(cal.timeout){clearTimeout(cal.timeout);} -var el=cal.activeDiv;if(!el){return false;} -var target=Calendar.getTargetElement(ev);ev||(ev=window.event);Calendar.removeClass(el,"active");if(target==el||target.parentNode==el){Calendar.cellClick(el,ev);} -var mon=Calendar.findMonth(target);var date=null;if(mon){date=new Date(cal.date);if(mon.month!=date.getMonth()){date.setMonth(mon.month);cal.setDate(date);cal.dateClicked=false;cal.callHandler();}}else{var year=Calendar.findYear(target);if(year){date=new Date(cal.date);if(year.year!=date.getFullYear()){date.setFullYear(year.year);cal.setDate(date);cal.dateClicked=false;cal.callHandler();}}} -with(Calendar){removeEvent(document,"mouseup",tableMouseUp);removeEvent(document,"mouseover",tableMouseOver);removeEvent(document,"mousemove",tableMouseOver);cal._hideCombos();_C=null;return stopEvent(ev);}};Calendar.tableMouseOver=function(ev){var cal=Calendar._C;if(!cal){return;} -var el=cal.activeDiv;var target=Calendar.getTargetElement(ev);if(target==el||target.parentNode==el){Calendar.addClass(el,"hilite active");Calendar.addClass(el.parentNode,"rowhilite");}else{if(typeof el.navtype=="undefined"||(el.navtype!=50&&(el.navtype==0||Math.abs(el.navtype)>2))) -Calendar.removeClass(el,"active");Calendar.removeClass(el,"hilite");Calendar.removeClass(el.parentNode,"rowhilite");} -ev||(ev=window.event);if(el.navtype==50&&target!=el){var pos=Calendar.getAbsolutePos(el);var w=el.offsetWidth;var x=ev.clientX;var dx;var decrease=true;if(x>pos.x+w){dx=x-pos.x-w;decrease=false;}else -dx=pos.x-x;if(dx<0)dx=0;var range=el._range;var current=el._current;var count=Math.floor(dx/10)%range.length;for(var i=range.length;--i>=0;) -if(range[i]==current) -break;while(count-->0) -if(decrease){if(--i<0) -i=range.length-1;}else if(++i>=range.length) -i=0;var newval=range[i];el.innerHTML=newval;cal.onUpdateTime();} -var mon=Calendar.findMonth(target);if(mon){if(mon.month!=cal.date.getMonth()){if(cal.hilitedMonth){Calendar.removeClass(cal.hilitedMonth,"hilite");} -Calendar.addClass(mon,"hilite");cal.hilitedMonth=mon;}else if(cal.hilitedMonth){Calendar.removeClass(cal.hilitedMonth,"hilite");}}else{if(cal.hilitedMonth){Calendar.removeClass(cal.hilitedMonth,"hilite");} -var year=Calendar.findYear(target);if(year){if(year.year!=cal.date.getFullYear()){if(cal.hilitedYear){Calendar.removeClass(cal.hilitedYear,"hilite");} -Calendar.addClass(year,"hilite");cal.hilitedYear=year;}else if(cal.hilitedYear){Calendar.removeClass(cal.hilitedYear,"hilite");}}else if(cal.hilitedYear){Calendar.removeClass(cal.hilitedYear,"hilite");}} -return Calendar.stopEvent(ev);};Calendar.tableMouseDown=function(ev){if(Calendar.getTargetElement(ev)==Calendar.getElement(ev)){return Calendar.stopEvent(ev);}};Calendar.calDragIt=function(ev){var cal=Calendar._C;if(!(cal&&cal.dragging)){return false;} -var posX;var posY;if(Calendar.is_ie){posY=window.event.clientY+document.body.scrollTop;posX=window.event.clientX+document.body.scrollLeft;}else{posX=ev.pageX;posY=ev.pageY;} -cal.hideShowCovered();var st=cal.element.style;st.left=(posX-cal.xOffs)+"px";st.top=(posY-cal.yOffs)+"px";return Calendar.stopEvent(ev);};Calendar.calDragEnd=function(ev){var cal=Calendar._C;if(!cal){return false;} -cal.dragging=false;with(Calendar){removeEvent(document,"mousemove",calDragIt);removeEvent(document,"mouseup",calDragEnd);tableMouseUp(ev);} -cal.hideShowCovered();};Calendar.dayMouseDown=function(ev){var el=Calendar.getElement(ev);if(el.disabled){return false;} -var cal=el.calendar;cal.activeDiv=el;Calendar._C=cal;if(el.navtype!=300)with(Calendar){if(el.navtype==50){el._current=el.innerHTML;addEvent(document,"mousemove",tableMouseOver);}else -addEvent(document,Calendar.is_ie5?"mousemove":"mouseover",tableMouseOver);addClass(el,"hilite active");addEvent(document,"mouseup",tableMouseUp);}else if(cal.isPopup){cal._dragStart(ev);} -if(el.navtype==-1||el.navtype==1){if(cal.timeout)clearTimeout(cal.timeout);cal.timeout=setTimeout("Calendar.showMonthsCombo()",250);}else if(el.navtype==-2||el.navtype==2){if(cal.timeout)clearTimeout(cal.timeout);cal.timeout=setTimeout((el.navtype>0)?"Calendar.showYearsCombo(true)":"Calendar.showYearsCombo(false)",250);}else{cal.timeout=null;} -return Calendar.stopEvent(ev);};Calendar.dayMouseDblClick=function(ev){Calendar.cellClick(Calendar.getElement(ev),ev||window.event);if(Calendar.is_ie){document.selection.empty();}};Calendar.dayMouseOver=function(ev){var el=Calendar.getElement(ev);if(Calendar.isRelated(el,ev)||Calendar._C||el.disabled){return false;} -if(el.ttip){if(el.ttip.substr(0,1)=="_"){el.ttip=el.caldate.print(el.calendar.ttDateFormat)+el.ttip.substr(1);} -el.calendar.tooltips.innerHTML=el.ttip;} -if(el.navtype!=300){Calendar.addClass(el,"hilite");if(el.caldate){Calendar.addClass(el.parentNode,"rowhilite");}} -return Calendar.stopEvent(ev);};Calendar.dayMouseOut=function(ev){with(Calendar){var el=getElement(ev);if(isRelated(el,ev)||_C||el.disabled) -return false;removeClass(el,"hilite");if(el.caldate) -removeClass(el.parentNode,"rowhilite");if(el.calendar) -el.calendar.tooltips.innerHTML=_TT["SEL_DATE"];return stopEvent(ev);}};Calendar.cellClick=function(el,ev){var cal=el.calendar;var closing=false;var newdate=false;var date=null;if(typeof el.navtype=="undefined"){if(cal.currentDateEl){Calendar.removeClass(cal.currentDateEl,"selected");Calendar.addClass(el,"selected");closing=(cal.currentDateEl==el);if(!closing){cal.currentDateEl=el;}} -cal.date.setDateOnly(el.caldate);date=cal.date;var other_month=!(cal.dateClicked=!el.otherMonth);if(!other_month&&!cal.currentDateEl) -cal._toggleMultipleDate(new Date(date));else -newdate=!el.disabled;if(other_month) -cal._init(cal.firstDayOfWeek,date);}else{if(el.navtype==200){Calendar.removeClass(el,"hilite");cal.callCloseHandler();return;} -date=new Date(cal.date);if(el.navtype==0) -date.setDateOnly(new Date());cal.dateClicked=false;var year=date.getFullYear();var mon=date.getMonth();function setMonth(m){var day=date.getDate();var max=date.getMonthDays(m);if(day>max){date.setDate(max);} -date.setMonth(m);};switch(el.navtype){case 400:Calendar.removeClass(el,"hilite");var text=Calendar._TT["ABOUT"];if(typeof text!="undefined"){text+=cal.showsTime?Calendar._TT["ABOUT_TIME"]:"";}else{text="Help and about box text is not translated into this language.\n"+"If you know this language and you feel generous please update\n"+"the corresponding file in \"lang\" subdir to match calendar-en.js\n"+"and send it back to to get it into the distribution ;-)\n\n"+"Thank you!\n"+"http://dynarch.com/mishoo/calendar.epl\n";} -alert(text);return;case-2:if(year>cal.minYear){date.setFullYear(year-1);} -break;case-1:if(mon>0){setMonth(mon-1);}else if(year-->cal.minYear){date.setFullYear(year);setMonth(11);} -break;case 1:if(mon<11){setMonth(mon+1);}else if(year=0;) -if(range[i]==current) -break;if(ev&&ev.shiftKey){if(--i<0) -i=range.length-1;}else if(++i>=range.length) -i=0;var newval=range[i];el.innerHTML=newval;cal.onUpdateTime();return;case 0:if((typeof cal.getDateStatus=="function")&&cal.getDateStatus(date,date.getFullYear(),date.getMonth(),date.getDate())){return false;} -break;} -if(!date.equalsTo(cal.date)){cal.setDate(date);newdate=true;}else if(el.navtype==0) -newdate=closing=true;} -if(newdate){ev&&cal.callHandler();} -if(closing){Calendar.removeClass(el,"hilite");ev&&cal.callCloseHandler();}};Calendar.prototype.create=function(_par){var parent=null;if(!_par){parent=document.getElementsByTagName("body")[0];this.isPopup=true;}else{parent=_par;this.isPopup=false;} -this.date=this.dateStr?new Date(this.dateStr):new Date();var table=Calendar.createElement("table");this.table=table;table.cellSpacing=0;table.cellPadding=0;table.calendar=this;Calendar.addEvent(table,"mousedown",Calendar.tableMouseDown);var div=Calendar.createElement("div");this.element=div;div.className="calendar";if(this.isPopup){div.style.position="absolute";div.style.display="none";} -div.appendChild(table);var thead=Calendar.createElement("thead",table);var cell=null;var row=null;var cal=this;var hh=function(text,cs,navtype){cell=Calendar.createElement("td",row);cell.colSpan=cs;cell.className="button";if(navtype!=0&&Math.abs(navtype)<=2) -cell.className+=" nav";Calendar._add_evs(cell);cell.calendar=cal;cell.navtype=navtype;cell.innerHTML="
    "+text+"
    ";return cell;};row=Calendar.createElement("tr",thead);var title_length=6;(this.isPopup)&&--title_length;(this.weekNumbers)&&++title_length;hh("?",1,400).ttip=Calendar._TT["INFO"];this.title=hh("",title_length,300);this.title.className="title";if(this.isPopup){this.title.ttip=Calendar._TT["DRAG_TO_MOVE"];this.title.style.cursor="move";hh("×",1,200).ttip=Calendar._TT["CLOSE"];} -row=Calendar.createElement("tr",thead);row.className="headrow";this._nav_py=hh("«",1,-2);this._nav_py.ttip=Calendar._TT["PREV_YEAR"];this._nav_pm=hh("‹",1,-1);this._nav_pm.ttip=Calendar._TT["PREV_MONTH"];this._nav_now=hh(Calendar._TT["TODAY"],this.weekNumbers?4:3,0);this._nav_now.ttip=Calendar._TT["GO_TODAY"];this._nav_nm=hh("›",1,1);this._nav_nm.ttip=Calendar._TT["NEXT_MONTH"];this._nav_ny=hh("»",1,2);this._nav_ny.ttip=Calendar._TT["NEXT_YEAR"];row=Calendar.createElement("tr",thead);row.className="daynames";if(this.weekNumbers){cell=Calendar.createElement("td",row);cell.className="name wn";cell.innerHTML=Calendar._TT["WK"];} -for(var i=7;i>0;--i){cell=Calendar.createElement("td",row);if(!i){cell.navtype=100;cell.calendar=this;Calendar._add_evs(cell);}} -this.firstdayname=(this.weekNumbers)?row.firstChild.nextSibling:row.firstChild;this._displayWeekdays();var tbody=Calendar.createElement("tbody",table);this.tbody=tbody;for(i=6;i>0;--i){row=Calendar.createElement("tr",tbody);if(this.weekNumbers){cell=Calendar.createElement("td",row);} -for(var j=7;j>0;--j){cell=Calendar.createElement("td",row);cell.calendar=this;Calendar._add_evs(cell);}} -if(this.showsTime){row=Calendar.createElement("tr",tbody);row.className="time";cell=Calendar.createElement("td",row);cell.className="time";cell.colSpan=2;cell.innerHTML=Calendar._TT["TIME"]||" ";cell=Calendar.createElement("td",row);cell.className="time";cell.colSpan=this.weekNumbers?4:3;(function(){function makeTimePart(className,init,range_start,range_end){var part=Calendar.createElement("span",cell);part.className=className;part.innerHTML=init;part.calendar=cal;part.ttip=Calendar._TT["TIME_PART"];part.navtype=50;part._range=[];if(typeof range_start!="number") -part._range=range_start;else{for(var i=range_start;i<=range_end;++i){var txt;if(i<10&&range_end>=10)txt='0'+i;else txt=''+i;part._range[part._range.length]=txt;}} -Calendar._add_evs(part);return part;};var hrs=cal.date.getHours();var mins=cal.date.getMinutes();var t12=!cal.time24;var pm=(hrs>12);if(t12&&pm)hrs-=12;var H=makeTimePart("hour",hrs,t12?1:0,t12?12:23);var span=Calendar.createElement("span",cell);span.innerHTML=":";span.className="colon";var M=makeTimePart("minute",mins,0,59);var AP=null;cell=Calendar.createElement("td",row);cell.className="time";cell.colSpan=2;if(t12) -AP=makeTimePart("ampm",pm?"pm":"am",["am","pm"]);else -cell.innerHTML=" ";cal.onSetTime=function(){var pm,hrs=this.date.getHours(),mins=this.date.getMinutes();if(t12){pm=(hrs>=12);if(pm)hrs-=12;if(hrs==0)hrs=12;AP.innerHTML=pm?"pm":"am";} -H.innerHTML=(hrs<10)?("0"+hrs):hrs;M.innerHTML=(mins<10)?("0"+mins):mins;};cal.onUpdateTime=function(){var date=this.date;var h=parseInt(H.innerHTML,10);if(t12){if(/pm/i.test(AP.innerHTML)&&h<12) -h+=12;else if(/am/i.test(AP.innerHTML)&&h==12) -h=0;} -var d=date.getDate();var m=date.getMonth();var y=date.getFullYear();date.setHours(h);date.setMinutes(parseInt(M.innerHTML,10));date.setFullYear(y);date.setMonth(m);date.setDate(d);this.dateClicked=false;this.callHandler();};})();}else{this.onSetTime=this.onUpdateTime=function(){};} -var tfoot=Calendar.createElement("tfoot",table);row=Calendar.createElement("tr",tfoot);row.className="footrow";cell=hh(Calendar._TT["SEL_DATE"],this.weekNumbers?8:7,300);cell.className="ttip";if(this.isPopup){cell.ttip=Calendar._TT["DRAG_TO_MOVE"];cell.style.cursor="move";} -this.tooltips=cell;div=Calendar.createElement("div",this.element);this.monthsCombo=div;div.className="combo";for(i=0;i0;--i){var yr=Calendar.createElement("div");yr.className=Calendar.is_ie?"label-IEfix":"label";div.appendChild(yr);} -this._init(this.firstDayOfWeek,this.date);parent.appendChild(this.element);};Calendar._keyEvent=function(ev){var cal=window._dynarch_popupCalendar;if(!cal||cal.multiple) -return false;(Calendar.is_ie)&&(ev=window.event);var act=(Calendar.is_ie||ev.type=="keypress"),K=ev.keyCode;if(ev.ctrlKey){switch(K){case 37:act&&Calendar.cellClick(cal._nav_pm);break;case 38:act&&Calendar.cellClick(cal._nav_py);break;case 39:act&&Calendar.cellClick(cal._nav_nm);break;case 40:act&&Calendar.cellClick(cal._nav_ny);break;default:return false;}}else switch(K){case 32:Calendar.cellClick(cal._nav_now);break;case 27:act&&cal.callCloseHandler();break;case 37:case 38:case 39:case 40:if(act){var prev,x,y,ne,el,step;prev=K==37||K==38;step=(K==37||K==39)?1:7;function setVars(){el=cal.currentDateEl;var p=el.pos;x=p&15;y=p>>4;ne=cal.ar_days[y][x];};setVars();function prevMonth(){var date=new Date(cal.date);date.setDate(date.getDate()-step);cal.setDate(date);};function nextMonth(){var date=new Date(cal.date);date.setDate(date.getDate()+step);cal.setDate(date);};while(1){switch(K){case 37:if(--x>=0) -ne=cal.ar_days[y][x];else{x=6;K=38;continue;} -break;case 38:if(--y>=0) -ne=cal.ar_days[y][x];else{prevMonth();setVars();} -break;case 39:if(++x<7) -ne=cal.ar_days[y][x];else{x=0;K=40;continue;} -break;case 40:if(++ythis.maxYear){year=this.maxYear;date.setFullYear(year);} -this.firstDayOfWeek=firstDayOfWeek;this.date=new Date(date);var month=date.getMonth();var mday=date.getDate();var no_days=date.getMonthDays();date.setDate(1);var day1=(date.getDay()-this.firstDayOfWeek)%7;if(day1<0) -day1+=7;date.setDate(-day1);date.setDate(date.getDate()+1);var row=this.tbody.firstChild;var MN=Calendar._SMN[month];var ar_days=this.ar_days=new Array();var weekend=Calendar._TT["WEEKEND"];var dates=this.multiple?(this.datesCells={}):null;for(var i=0;i<6;++i,row=row.nextSibling){var cell=row.firstChild;if(this.weekNumbers){cell.className="day wn";cell.innerHTML=date.getWeekNumber();cell=cell.nextSibling;} -row.className="daysrow";var hasdays=false,iday,dpos=ar_days[i]=[];for(var j=0;j<7;++j,cell=cell.nextSibling,date.setDate(iday+1)){iday=date.getDate();var wday=date.getDay();cell.className="day";cell.pos=i<<4|j;dpos[j]=cell;var current_month=(date.getMonth()==month);if(!current_month){if(this.showsOtherMonths){cell.className+=" othermonth";cell.otherMonth=true;}else{cell.className="emptycell";cell.innerHTML=" ";cell.disabled=true;continue;}}else{cell.otherMonth=false;hasdays=true;} -cell.disabled=false;cell.innerHTML=this.getDateText?this.getDateText(date,iday):iday;if(dates) -dates[date.print("%Y%m%d")]=cell;if(this.getDateStatus){var status=this.getDateStatus(date,year,month,iday);if(this.getDateToolTip){var toolTip=this.getDateToolTip(date,year,month,iday);if(toolTip) -cell.title=toolTip;} -if(status===true){cell.className+=" disabled";cell.disabled=true;}else{if(/disabled/i.test(status)) -cell.disabled=true;cell.className+=" "+status;}} -if(!cell.disabled){cell.caldate=new Date(date);cell.ttip="_";if(!this.multiple&¤t_month&&iday==mday&&this.hiliteToday){cell.className+=" selected";this.currentDateEl=cell;} -if(date.getFullYear()==TY&&date.getMonth()==TM&&iday==TD){cell.className+=" today";cell.ttip+=Calendar._TT["PART_TODAY"];} -if(weekend.indexOf(wday.toString())!=-1) -cell.className+=cell.otherMonth?" oweekend":" weekend";}} -if(!(hasdays||this.showsOtherMonths)) -row.className="emptyrow";} -this.title.innerHTML=Calendar._MN[month]+", "+year;this.onSetTime();this.table.style.visibility="visible";this._initMultipleDates();};Calendar.prototype._initMultipleDates=function(){if(this.multiple){for(var i in this.multiple){var cell=this.datesCells[i];var d=this.multiple[i];if(!d) -continue;if(cell) -cell.className+=" selected";}}};Calendar.prototype._toggleMultipleDate=function(date){if(this.multiple){var ds=date.print("%Y%m%d");var cell=this.datesCells[ds];if(cell){var d=this.multiple[ds];if(!d){Calendar.addClass(cell,"selected");this.multiple[ds]=date;}else{Calendar.removeClass(cell,"selected");delete this.multiple[ds];}}}};Calendar.prototype.setDateToolTipHandler=function(unaryFunction){this.getDateToolTip=unaryFunction;};Calendar.prototype.setDate=function(date){if(!date.equalsTo(this.date)){this._init(this.firstDayOfWeek,date);}};Calendar.prototype.refresh=function(){this._init(this.firstDayOfWeek,this.date);};Calendar.prototype.setFirstDayOfWeek=function(firstDayOfWeek){this._init(firstDayOfWeek,this.date);this._displayWeekdays();};Calendar.prototype.setDateStatusHandler=Calendar.prototype.setDisabledHandler=function(unaryFunction){this.getDateStatus=unaryFunction;};Calendar.prototype.setRange=function(a,z){this.minYear=a;this.maxYear=z;};Calendar.prototype.callHandler=function(){if(this.onSelected){this.onSelected(this,this.date.print(this.dateFormat));}};Calendar.prototype.callCloseHandler=function(){if(this.onClose){this.onClose(this);} -this.hideShowCovered();};Calendar.prototype.destroy=function(){var el=this.element.parentNode;el.removeChild(this.element);Calendar._C=null;window._dynarch_popupCalendar=null;};Calendar.prototype.reparent=function(new_parent){var el=this.element;el.parentNode.removeChild(el);new_parent.appendChild(el);};Calendar._checkCalendar=function(ev){var calendar=window._dynarch_popupCalendar;if(!calendar){return false;} -var el=Calendar.is_ie?Calendar.getElement(ev):Calendar.getTargetElement(ev);for(;el!=null&&el!=calendar.element;el=el.parentNode);if(el==null){window._dynarch_popupCalendar.callCloseHandler();return Calendar.stopEvent(ev);}};Calendar.prototype.show=function(){var rows=this.table.getElementsByTagName("tr");for(var i=rows.length;i>0;){var row=rows[--i];Calendar.removeClass(row,"rowhilite");var cells=row.getElementsByTagName("td");for(var j=cells.length;j>0;){var cell=cells[--j];Calendar.removeClass(cell,"hilite");Calendar.removeClass(cell,"active");}} -this.element.style.display="block";this.hidden=false;if(this.isPopup){window._dynarch_popupCalendar=this;Calendar.addEvent(document,"keydown",Calendar._keyEvent);Calendar.addEvent(document,"keypress",Calendar._keyEvent);Calendar.addEvent(document,"mousedown",Calendar._checkCalendar);} -this.hideShowCovered();};Calendar.prototype.hide=function(){if(this.isPopup){Calendar.removeEvent(document,"keydown",Calendar._keyEvent);Calendar.removeEvent(document,"keypress",Calendar._keyEvent);Calendar.removeEvent(document,"mousedown",Calendar._checkCalendar);} -this.element.style.display="none";this.hidden=true;this.hideShowCovered();};Calendar.prototype.showAt=function(x,y){var s=this.element.style;s.left=x+"px";s.top=y+"px";this.show();};Calendar.prototype.showAtElement=function(el,opts){var self=this;var p=Calendar.getAbsolutePos(el);if(!opts||typeof opts!="string"){this.showAt(p.x,p.y+el.offsetHeight);return true;} -function fixPosition(box){if(box.x<0) -box.x=0;if(box.y<0) -box.y=0;var cp=document.createElement("div");var s=cp.style;s.position="absolute";s.right=s.bottom=s.width=s.height="0px";document.body.appendChild(cp);var br=Calendar.getAbsolutePos(cp);document.body.removeChild(cp);if(Calendar.is_ie){br.y+=document.body.scrollTop;br.x+=document.body.scrollLeft;}else{br.y+=window.scrollY;br.x+=window.scrollX;} -var tmp=box.x+box.width-br.x;if(tmp>0)box.x-=tmp;tmp=box.y+box.height-br.y;if(tmp>0)box.y-=tmp;};this.element.style.display="block";Calendar.continuation_for_the_fucking_khtml_browser=function(){var w=self.element.offsetWidth;var h=self.element.offsetHeight;self.element.style.display="none";var valign=opts.substr(0,1);var halign="l";if(opts.length>1){halign=opts.substr(1,1);} -switch(valign){case"T":p.y-=h;break;case"B":p.y+=el.offsetHeight;break;case"C":p.y+=(el.offsetHeight-h)/2;break;case"t":p.y+=el.offsetHeight-h;break;case"b":break;} -switch(halign){case"L":p.x-=w;break;case"R":p.x+=el.offsetWidth;break;case"C":p.x+=(el.offsetWidth-w)/2;break;case"l":p.x+=el.offsetWidth-w;break;case"r":break;} -p.width=w;p.height=h+40;self.monthsCombo.style.display="none";fixPosition(p);self.showAt(p.x,p.y);};if(Calendar.is_khtml) -setTimeout("Calendar.continuation_for_the_fucking_khtml_browser()",10);else -Calendar.continuation_for_the_fucking_khtml_browser();};Calendar.prototype.setDateFormat=function(str){this.dateFormat=str;};Calendar.prototype.setTtDateFormat=function(str){this.ttDateFormat=str;};Calendar.prototype.parseDate=function(str,fmt){if(!fmt) -fmt=this.dateFormat;this.setDate(Date.parseDate(str,fmt));};Calendar.prototype.hideShowCovered=function(){if(!Calendar.is_ie&&!Calendar.is_opera) -return;function getVisib(obj){var value=obj.style.visibility;if(!value){if(document.defaultView&&typeof(document.defaultView.getComputedStyle)=="function"){if(!Calendar.is_khtml) -value=document.defaultView.getComputedStyle(obj,"").getPropertyValue("visibility");else -value='';}else if(obj.currentStyle){value=obj.currentStyle.visibility;}else -value='';} -return value;};var tags=new Array("applet","iframe","select");var el=this.element;var p=Calendar.getAbsolutePos(el);var EX1=p.x;var EX2=el.offsetWidth+EX1;var EY1=p.y;var EY2=el.offsetHeight+EY1;for(var k=tags.length;k>0;){var ar=document.getElementsByTagName(tags[--k]);var cc=null;for(var i=ar.length;i>0;){cc=ar[--i];p=Calendar.getAbsolutePos(cc);var CX1=p.x;var CX2=cc.offsetWidth+CX1;var CY1=p.y;var CY2=cc.offsetHeight+CY1;if(this.hidden||(CX1>EX2)||(CX2EY2)||(CY229)?1900:2000);break;case"%b":case"%B":for(j=0;j<12;++j){if(Calendar._MN[j].substr(0,a[i].length).toLowerCase()==a[i].toLowerCase()){m=j;break;}} -break;case"%H":case"%I":case"%k":case"%l":hr=parseInt(a[i],10);break;case"%P":case"%p":if(/pm/i.test(a[i])&&hr<12) -hr+=12;else if(/am/i.test(a[i])&&hr>=12) -hr-=12;break;case"%M":min=parseInt(a[i],10);break;}} -if(isNaN(y))y=today.getFullYear();if(isNaN(m))m=today.getMonth();if(isNaN(d))d=today.getDate();if(isNaN(hr))hr=today.getHours();if(isNaN(min))min=today.getMinutes();if(y!=0&&m!=-1&&d!=0) -return new Date(y,m,d,hr,min,0);y=0;m=-1;d=0;for(i=0;i31&&y==0){y=parseInt(a[i],10);(y<100)&&(y+=(y>29)?1900:2000);}else if(d==0){d=a[i];}} -if(y==0) -y=today.getFullYear();if(m!=-1&&d!=0) -return new Date(y,m,d,hr,min,0);return today;};Date.prototype.getMonthDays=function(month){var year=this.getFullYear();if(typeof month=="undefined"){month=this.getMonth();} -if(((0==(year%4))&&((0!=(year%100))||(0==(year%400))))&&month==1){return 29;}else{return Date._MD[month];}};Date.prototype.getDayOfYear=function(){var now=new Date(this.getFullYear(),this.getMonth(),this.getDate(),0,0,0);var then=new Date(this.getFullYear(),0,0,0,0,0);var time=now-then;return Math.floor(time/Date.DAY);};Date.prototype.getWeekNumber=function(){var d=new Date(this.getFullYear(),this.getMonth(),this.getDate(),0,0,0);var DoW=d.getDay();d.setDate(d.getDate()-(DoW+6)%7+3);var ms=d.valueOf();d.setMonth(0);d.setDate(4);return Math.round((ms-d.valueOf())/(7*864e5))+1;};Date.prototype.equalsTo=function(date){return((this.getFullYear()==date.getFullYear())&&(this.getMonth()==date.getMonth())&&(this.getDate()==date.getDate())&&(this.getHours()==date.getHours())&&(this.getMinutes()==date.getMinutes()));};Date.prototype.setDateOnly=function(date){var tmp=new Date(date);this.setDate(1);this.setFullYear(tmp.getFullYear());this.setMonth(tmp.getMonth());this.setDate(tmp.getDate());};Date.prototype.print=function(str){var m=this.getMonth();var d=this.getDate();var y=this.getFullYear();var wn=this.getWeekNumber();var w=this.getDay();var s={};var hr=this.getHours();var pm=(hr>=12);var ir=(pm)?(hr-12):hr;var dy=this.getDayOfYear();if(ir==0) -ir=12;var min=this.getMinutes();var sec=this.getSeconds();s["%a"]=Calendar._SDN[w];s["%A"]=Calendar._DN[w];s["%b"]=Calendar._SMN[m];s["%B"]=Calendar._MN[m];s["%C"]=1+Math.floor(y/100);s["%d"]=(d<10)?("0"+d):d;s["%e"]=d;s["%H"]=(hr<10)?("0"+hr):hr;s["%I"]=(ir<10)?("0"+ir):ir;s["%j"]=(dy<100)?((dy<10)?("00"+dy):("0"+dy)):dy;s["%k"]=hr;s["%l"]=ir;s["%m"]=(m<9)?("0"+(1+m)):(1+m);s["%M"]=(min<10)?("0"+min):min;s["%n"]="\n";s["%p"]=pm?"PM":"AM";s["%P"]=pm?"pm":"am";s["%s"]=Math.floor(this.getTime()/1000);s["%S"]=(sec<10)?("0"+sec):sec;s["%t"]="\t";s["%U"]=s["%W"]=s["%V"]=(wn<10)?("0"+wn):wn;s["%u"]=w+1;s["%w"]=w;s["%y"]=(''+y).substr(2,2);s["%Y"]=y;s["%%"]="%";var re=/%./g;if(!Calendar.is_ie5&&!Calendar.is_khtml) -return str.replace(re,function(par){return s[par]||par;});var a=str.match(re);for(var i=0;i=0;){var d=params.multiple[i];var ds=d.print("%Y%m%d");cal.multiple[ds]=d;}} -cal.showsOtherMonths=params.showOthers;cal.yearStep=params.step;cal.setRange(params.range[0],params.range[1]);cal.params=params;cal.setDateStatusHandler(params.dateStatusFunc);cal.getDateText=params.dateText;cal.setDateFormat(dateFmt);if(mustCreate) -cal.create();cal.refresh();if(!params.position) -cal.showAtElement(params.button||params.displayArea||params.inputField,params.align);else -cal.showAt(params.position[0],params.position[1]);return false;};if(params.inputField){new DateDueKeyboardShortcutSupport(params.inputField,params.ifFormat,cal);} -return cal;};DateDueKeyboardShortcutSupport=Class.create();DateDueKeyboardShortcutSupport.prototype={initialize:function(element,dateFormat){this.element=$(element);this.dateFormat=dateFormat||"%Y/%m/%d";Event.observe(this.element,'keypress',this.onkeypress.bindAsEventListener(this));title=this.element.getAttributeNode("title");tooltip='Shortcuts: (t) today; (-) or (<) previous day; (+) or (>) next day; ([) previous week; (]) next week; ({) previous month; (}) next month; Click to show calendar';if(title&&title.value) -{this.element.setAttribute("title",title.value+' ('+tooltip+')');} -else -{this.element.setAttribute("title",tooltip);}},onkeypress:function(event){handled=true;switch(this.getCharFromKeyPressEvent(event)){case"t":this.setTextBoxToTodaysDate();break;case"+":case">":case"=":this.setTextBoxToNextDay();break;case"-":case"<":this.setTextBoxToPreviousDay();break;case"[":this.setTextBoxToPreviousWeek();break;case"]":this.setTextBoxToNextWeek();break;case"{":this.setTextBoxToPreviousMonth();break;case"}":this.setTextBoxToNextMonth();break;default:handled=false;break;} -if(handled){this.cancel(event);}},setTextBoxToChronicDate:function(){today=new Date();this.setDate(today);},setTextBoxToTodaysDate:function(){today=new Date();this.setDate(today);},setTextBoxToNextDay:function(){this.addDaysToTextBoxDate(1);},setTextBoxToPreviousDay:function(){this.addDaysToTextBoxDate(-1);},setTextBoxToNextWeek:function(){this.addDaysToTextBoxDate(7);},setTextBoxToPreviousWeek:function(){this.addDaysToTextBoxDate(-7);},addDaysToTextBoxDate:function(numDays){date=Date.parseDate(this.element.value,this.dateFormat);date.setDate(date.getDate()+numDays);this.setDate(date);},setTextBoxToNextMonth:function(){date=Date.parseDate(this.element.value,this.dateFormat);date.setMonth(date.getMonth()+1);this.setDate(date);},setTextBoxToPreviousMonth:function(){date=Date.parseDate(this.element.value,this.dateFormat);date.setMonth(date.getMonth()-1);this.setDate(date);},setDate:function(date){this.element.value=date.print(this.dateFormat);if(window.calendar){window.calendar.setDate(date);}},cancel:function(event){if(event.preventDefault){event.preventDefault();} -event.returnValue=false;},getCharFromKeyPressEvent:function(event){var charCode=(event.charCode)?event.charCode:((event.keyCode)?event.keyCode:((event.which)?event.which:0));return String.fromCharCode(charCode);}};var accessKeyHintsAdder={run:function(){var elemTypes=new Array('a','area','button','input','label','legend','textarea');for(var i=0;i=0?true:false);} -var oldonload=window.onload;if(typeof(NiftyLoad)!='function')NiftyLoad=function(){};if(typeof(oldonload)=='function') -window.onload=function(){oldonload();NiftyLoad()};else window.onload=function(){NiftyLoad()};function Nifty(selector,options){if(niftyOk==false)return;var i,v=selector.split(","),h=0;if(options==null)options="";if(options.find("fixed-height")) -h=getElementsBySelector(v[0])[0].offsetHeight;for(i=0;i0;i--) -d.appendChild(CreateStrip(i,side,color,border,btype));el.style.paddingBottom=0;el.appendChild(d);} -function CreateStrip(index,side,color,border,btype){var x=CreateEl("b");x.className=btype+index;x.style.backgroundColor=color;x.style.borderColor=border;if(side=="left"){x.style.borderRightWidth="0";x.style.marginRight="0";} -else if(side=="right"){x.style.borderLeftWidth="0";x.style.marginLeft="0";} -return(x);} -function CreateEl(x){return(document.createElement(x));} -function FixIE(el){if(el.currentStyle!=null&&el.currentStyle.hasLayout!=null&&el.currentStyle.hasLayout==false) -el.style.display="inline-block";} -function SameHeight(selector,maxh){var i,v=selector.split(","),t,j,els=[],gap;for(i=0;imaxh)maxh=els[i].offsetHeight;els[i].style.height="auto";} -for(i=0;i0){t=CreateEl("b");t.className="niftyfill";t.style.height=gap+"px";nc=els[i].lastChild;if(nc.className=="niftycorners") -els[i].insertBefore(t,nc);else els[i].appendChild(t);}}} -function getElementsBySelector(selector){var i,j,selid="",selclass="",tag=selector,tag2="",v2,k,f,a,s=[],objlist=[],c;if(selector.find("#")){if(selector.find(" ")){s=selector.split(" ");var fs=s[0].split("#");if(fs.length==1)return(objlist);f=document.getElementById(fs[1]);if(f){v=f.getElementsByTagName(s[1]);for(i=0;i7){deconcept.SWFObject.doPrepUnload=true;}if(c){this.addParam("bgcolor",c);}var q=_7?_7:"high";this.addParam("quality",q);this.setAttribute("useExpressInstall",false);this.setAttribute("doExpressInstall",false);var _c=(_8)?_8:window.location;this.setAttribute("xiRedirectUrl",_c);this.setAttribute("redirectUrl","");if(_9){this.setAttribute("redirectUrl",_9);}};deconcept.SWFObject.prototype={useExpressInstall:function(_d){this.xiSWFPath=!_d?"expressinstall.swf":_d;this.setAttribute("useExpressInstall",true);},setAttribute:function(_e,_f){this.attributes[_e]=_f;},getAttribute:function(_10){return this.attributes[_10];},addParam:function(_11,_12){this.params[_11]=_12;},getParams:function(){return this.params;},addVariable:function(_13,_14){this.variables[_13]=_14;},getVariable:function(_15){return this.variables[_15];},getVariables:function(){return this.variables;},getVariablePairs:function(){var _16=new Array();var key;var _18=this.getVariables();for(key in _18){_16[_16.length]=key+"="+_18[key];}return _16;},getSWFHTML:function(){var _19="";if(navigator.plugins&&navigator.mimeTypes&&navigator.mimeTypes.length){if(this.getAttribute("doExpressInstall")){this.addVariable("MMplayerType","PlugIn");this.setAttribute("swf",this.xiSWFPath);}_19="0){_19+="flashvars=\""+_1c+"\"";}_19+="/>";}else{if(this.getAttribute("doExpressInstall")){this.addVariable("MMplayerType","ActiveX");this.setAttribute("swf",this.xiSWFPath);}_19="";_19+="";var _1d=this.getParams();for(var key in _1d){_19+="";}var _1f=this.getVariablePairs().join("&");if(_1f.length>0){_19+="";}_19+="";}return _19;},write:function(_20){if(this.getAttribute("useExpressInstall")){var _21=new deconcept.PlayerVersion([6,0,65]);if(this.installedVer.versionIsValid(_21)&&!this.installedVer.versionIsValid(this.getAttribute("version"))){this.setAttribute("doExpressInstall",true);this.addVariable("MMredirectURL",escape(this.getAttribute("xiRedirectUrl")));document.title=document.title.slice(0,47)+" - Flash Player Installation";this.addVariable("MMdoctitle",document.title);}}if(this.skipDetect||this.getAttribute("doExpressInstall")||this.installedVer.versionIsValid(this.getAttribute("version"))){var n=(typeof _20=="string")?document.getElementById(_20):_20;n.innerHTML=this.getSWFHTML();return true;}else{if(this.getAttribute("redirectUrl")!=""){document.location.replace(this.getAttribute("redirectUrl"));}}return false;}};deconcept.SWFObjectUtil.getPlayerVersion=function(){var _23=new deconcept.PlayerVersion([0,0,0]);if(navigator.plugins&&navigator.mimeTypes.length){var x=navigator.plugins["Shockwave Flash"];if(x&&x.description){_23=new deconcept.PlayerVersion(x.description.replace(/([a-zA-Z]|\s)+/,"").replace(/(\s+r|\s+b[0-9]+)/,".").split("."));}}else{if(navigator.userAgent&&navigator.userAgent.indexOf("Windows CE")>=0){var axo=1;var _26=3;while(axo){try{_26++;axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash."+_26);_23=new deconcept.PlayerVersion([_26,0,0]);}catch(e){axo=null;}}}else{try{var axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.7");}catch(e){try{var axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.6");_23=new deconcept.PlayerVersion([6,0,21]);axo.AllowScriptAccess="always";}catch(e){if(_23.major==6){return _23;}}try{axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash");}catch(e){}}if(axo!=null){_23=new deconcept.PlayerVersion(axo.GetVariable("$version").split(" ")[1].split(","));}}}return _23;};deconcept.PlayerVersion=function(_29){this.major=_29[0]!=null?parseInt(_29[0]):0;this.minor=_29[1]!=null?parseInt(_29[1]):0;this.rev=_29[2]!=null?parseInt(_29[2]):0;};deconcept.PlayerVersion.prototype.versionIsValid=function(fv){if(this.majorfv.major){return true;}if(this.minorfv.minor){return true;}if(this.rev=0;i--){_2f[i].style.display="none";for(var x in _2f[i]){if(typeof _2f[i][x]=="function"){_2f[i][x]=function(){};}}}};if(deconcept.SWFObject.doPrepUnload){if(!deconcept.unloadSet){deconcept.SWFObjectUtil.prepUnload=function(){__flash_unloadHandler=function(){};__flash_savedUnloadHandler=function(){};window.attachEvent("onunload",deconcept.SWFObjectUtil.cleanupSWFs);};window.attachEvent("onbeforeunload",deconcept.SWFObjectUtil.prepUnload);deconcept.unloadSet=true;}}if(!document.getElementById&&document.all){document.getElementById=function(id){return document.all[id];};}var getQueryParamValue=deconcept.util.getRequestParameter;var FlashObject=deconcept.SWFObject;var SWFObject=deconcept.SWFObject;LowPro={};LowPro.Version='0.2';if(!Element.addMethods) -Element.addMethods=function(o){Object.extend(Element.Methods,o)};DOM={nextElement:function(element){element=$(element);while(element=element.nextSibling) -if(element.nodeType==1)return $(element);return null;},previousElement:function(element){element=$(element);while(element=element.previousSibling) -if(element.nodeType==1)return $(element);return null;},remove:function(element){return $(element).parentNode.removeChild(element);},insertAfter:function(element,node){return $(element).previousSibling.inserBefore(node);},replaceElement:function(element,node){$(element).parentNode.replaceChild(node,element);return node;}};Element.addMethods(DOM);DOM.Builder={IE_TRANSLATIONS:{'class':'className','for':'htmlFor'},ieAttrSet:function(attrs,attr,el){var trans;if(trans=this.IE_TRANSLATIONS[attr])el[trans]=attrs[attr];else if(attr=='style')el.style.cssText=attrs[attr];else if(attr.match(/^on/))el[attr]=new Function(attrs[attr]);else el.setAttribute(attr,attrs[attr]);},tagFunc:function(tag){return function(){var attrs,children;if(arguments.length>0){if(arguments[0].nodeName||typeof arguments[0]=="string")children=arguments;else{attrs=arguments[0];children=[].slice.call(arguments,1);};} -return DOM.Builder.create(tag,attrs,children);};},create:function(tag,attrs,children){attrs=attrs||{};children=children||[];var isIE=navigator.userAgent.match(/MSIE/);var el=document.createElement((isIE&&attrs.name)?"<"+tag+" name="+attrs.name+">":tag);for(var attr in attrs){if(typeof attrs[attr]!='function'){if(isIE)this.ieAttrSet(attrs,attrs,el);else el.setAttribute(attr,attrs[attr]);};} -for(var i=0;i=0;i--){var params={tag:'*',id:null,classes:[]};var selector=selectors[i];var needle=selector.length-1;do{var id=selector.lastIndexOf("#");var klass=selector.lastIndexOf(".");var cursor=Math.max(id,klass);if(cursor==-1)params.tag=selector.toUpperCase();else if(id==-1||klass==cursor)params.classes.push(selector.substring(klass+1));else if(!params.id)params.id=selector.substring(id+1);selector=selector.substring(0,cursor);}while(cursor>0);this.selectors[i]=params;}},get:function(root){this.findElements(root||document,this.index==(this.selectors.length-1));return this.results;},findElements:function(parent,descendant){var selector=this.selectors[this.index],results=[],element;if(selector.id){element=$(selector.id);if(element&&(selector.tag=='*'||element.tagName==selector.tag)&&(element.childOf(parent))){results=[element];}}else{results=$A(parent.getElementsByTagName(selector.tag));} -if(selector.classes.length==1){results=results.select(function(target){return $(target).hasClassName(selector.classes[0]);});}else if(selector.classes.length>1){results=results.select(function(target){var klasses=$(target).classNames();return selector.classes.all(function(klass){return klasses.include(klass);});});} -if(descendant){this.results=this.results.concat(results);}else{++this.index;results.each(function(target){this.findElements(target,this.index==(this.selectors.length-1));}.bind(this));}}};LowPro.$$old=$$;LowPro.optimize$$=false;$$=function(a,b){if(LowPro.optimize$$==false||b||a.indexOf("[")>=0) -return LowPro.$$old(a,b);return new LowPro.SelectorLite(a.split(/\s+/)).get();}; \ No newline at end of file diff --git a/public/stylesheets/tracks_1225223947.css b/public/stylesheets/tracks_1225223947.css deleted file mode 100644 index 8afe55d2..00000000 --- a/public/stylesheets/tracks_1225223947.css +++ /dev/null @@ -1,293 +0,0 @@ -body,div,dl,dt,dd,ul,ol,li,h1,h2,h3,h4,h5,h6,pre,form,fieldset,input,textarea,p,blockquote,th,td {margin:0; padding:0} -table {border-collapse:collapse; border-spacing:0} -fieldset,img {border:0} -address,caption,cite,code,dfn,em,strong,th,var {font-style:normal; font-weight:normal} -ol,ul {list-style:none} -caption,th {text-align:left} -h1,h2,h3,h4,h5,h6 {font-size:100%; font-weight:normal} -q:before,q:after {content:''} -abbr,acronym {border:0} -body {font-family: "Lucida Grande", Verdana, Geneva, Arial, sans-serif; font-size: 80%; padding: 0px 10px; margin: 0px; background: #eee} -p {padding: 2px; font-size: 92%; line-height: 140%} -a, a:link, a:active, a:visited {color: #cc3334; text-decoration: none; padding-left: 1px; padding-right: 1px} -a:hover {color: #fff; background-color: #cc3334} -h1 {font-size: 304%; font-weight: bold} -h2 {font-size: 148%; font-weight: bold} -h3 {font-size: 129%; font-weight: bold} -img.edit_item {background-image: url(../images/edit_off.png); background-repeat: no-repeat; border: none;} -a:hover img.edit_item {background-image: url(../images/edit_on.png); background-color: transparent; background-repeat: no-repeat; border: none;} -img.delete_item {background-image: url(../images/delete_off.png); background-repeat: no-repeat; border: none;} -a:hover img.delete_item {background-image: url(../images/delete_on.png);background-color: transparent;background-repeat: no-repeat; border: none;} -img.starred_todo {background-image: url(../images/staricons.png); background-repeat: no-repeat; border:none; background-position: 0px 0px;} -a:hover img.starred_todo {background-image: url(../images/staricons.png); background-repeat: no-repeat; border:none; background-position: -16px 0px;} -img.unstarred_todo {background-image: url(../images/staricons.png); background-repeat: no-repeat; border:none; background-position: -32px 0px;} -a:hover img.unstarred_todo {background-image: url(../images/staricons.png); background-repeat: no-repeat; border:none; background-position: -48px 0px;} -a.to_top {background: transparent url(../images/top_off.png) no-repeat;} -a.to_top:hover {background: transparent url(../images/top_on.png) no-repeat;} -a.up {background: transparent url(../images/up_off.png) no-repeat;} -a.up:hover {background: transparent url(../images/up_on.png) no-repeat;} -a.down {background: transparent url(../images/down_off.png) no-repeat;} -a.down:hover {background: transparent url(../images/down_on.png) no-repeat;} -a.to_bottom {background: transparent url(../images/bottom_off.png) no-repeat;} -a.to_bottom:hover {background: transparent url(../images/bottom_on.png) no-repeat;} -a.show_notes, a.link_to_notes {background-image: url(../images/notes_off.png); background-repeat: no-repeat; padding: 1px; background-color: transparent;} -a.show_notes:hover, a.link_to_notes:hover {background-image: url(../images/notes_on.png); background-repeat: no-repeat; padding: 1px; background-color: transparent;} -#content {margin-top: 90px} -#display_box {float: left; width: 55%; margin: 0px 10px 50px 15px} -#single_box {width: 60%; margin: 80px auto} -#full_width_display {float: left; width: 95%; margin: 0px 15px 90px 15px} -#display_box_projects {float: left; width: 95%; margin: 0px 15px 90px 15px} -#recurring_timespan, #recurring_target {border: none; clear: both} -#recurring_target {border-top-style: dotted; padding: 15px 0px 0px 0px} -#recurring_daily, #recurring_weekly, #recurring_monthly, #recurring_yearly, #recurring_edit_daily, #recurring_edit_weekly, #recurring_edit_monthly, #recurring_edit_yearly {border: none; border-top-style: dotted; clear: both; padding: 15px 0px 15px 0px} -#recurring_period_id, #recurring_edit_period_id {border: none; float: left; margin: 0px 50px 0px 0px; padding: 0px 25px 15px 50px; border-right-style: none} -#recurring_todo {width: 270px} -#recurring_todo_form_container {border-right-style: dotted; padding: 0px 50px 15px 0px; float: left} -#recurring_todo input, #recurring_todo textarea {width: 100%} -#overlay {visibility: hidden; position: absolute; left: 0px; top: 0px; width: 100%; height: 100%; z-index: 102; text-align: center; background-image:url("../images/trans70.png")} -#overlay #new-recurring-todo, #overlay #edit-recurring-todo {width:750px; background-color: #fff; border:1px solid #000; padding: 15px; margin: 70px auto} -.recurring_container {padding: 0px 5px 0px 5px; border: 1px solid #999; margin: 0px 0px 0px 0px; background: #fff; text-align: left} -.recurring_submit_box {height: 25px; padding: 5px 0; text-align: center; clear: both; border: none} -#navcontainer {position: fixed; top: 48px; left: 0px} -#navlist {margin: 0; padding: 0 0 20px 5px} -#navlist ul, #navlist li {margin: 0; padding: 0; display: inline; list-style-type: none} -#navlist a:link, #navlist a:visited {float: left; line-height: 14px; font-weight: bold; margin: 0 10px 4px 10px; text-decoration: none; color: #eee} -#navlist a:link#current, #navlist a:visited#current, #navlist a:hover {border-bottom: 4px solid #CCC; padding-bottom: 2px; background: transparent; color: #CCC} -#navlist a:hover {color: #CCC} -#topbar {position: fixed; top: 0px; left: 0px; height: 68px; margin-bottom: 20px; clear: both; background-color: #000; filter: alpha(opacity=75); -moz-opacity: .75; opacity: .75; color: #eee; width: 100%; z-index:101} -body.stats #topbar {filter: alpha(opacity=100); -moz-opacity: 1; opacity: 1} -#date {float: left; width: 45%; padding-left: 15px; margin-top: 15px; margin-bottom: 5px; white-space: nowrap} -#date h1 {font-size: 152%} -#minilinks {text-align: right; position: fixed; right: 15px; top: 10px; font-size: 0.9em} -.container {padding: 0px 5px 0px 5px; border: 1px solid #999; margin: 0px 0px 15px 0px; background: #fff} -.completed {background: #eee} -.container h2 {background: #ccc; padding: 5px; margin-top: 0px; margin-left: -5px; margin-right: -5px; margin-bottom: 0px; color: #666; position:static} -.container_toggle img {height:20px; width:20px; border:0px} -h2 a, h2 a:link, h2 a:active, h2 a:visited {color: #666; text-decoration: none} -h2 a:hover {color: #cc3334; background-color: transparent; text-decoration: none} -div#input_box {margin: 0px 15px 0px 58%; padding: 0px 15px 0px 0px} -#input_box h2 {color: #999} -#input_box ul {list-style-type: circle; font-size: 0.9em;} -.show_from_input, .due_input, .project_input, .context_input {float:left} -.box {float: left; width: 20px} -div.item-container {padding: 2px 0px; line-height:20px; clear: both} -a.recurring_icon {vertical-align: middle; background-color: transparent} -a.icon {float: left; vertical-align: middle; background-color: transparent} -input.item-checkbox {float: left; margin-left: 10px; vertical-align: middle} -.description {margin-left: 85px; position:relative } -.stale_l1, .stale_l2, .stale_l3 {margin-left: 82px; padding-left: 3px} -.stale_l1 {background: #ffC} -.tools {margin-left: 25px; width: 40px; border-top: 1px solid #999} -#footer {clear: both; font-size: 85%; text-align: center; color: #999; margin: 20px 20px 5px 20px; padding: 0px} -.todo_notes {margin: 5px; padding: 3px; border: 1px solid #F5ED59; background: #FAF6AE; color: #666666} -.todo_notes p, .todo_notes li {padding: 1px; margin: 0px; font-size: 12px} -.todo_notes ul, .note_wrapper ul {list-style-type: disc; margin-left:20px} -.todo_notes ol {list-style-type: decimal; margin-left:20px} -div.note_wrapper {margin: 3px; padding: 2px} -div.note_wrapper p {display: inline} -div.note_footer {border-top: 1px solid #999; padding-top: 3px; font-style: italic; font-size: 0.9em; color: #666} -div.note_footer a, div.note_footer a:hover {border-top: none; padding-top: 0px; vertical-align: middle; background-color: transparent} -div.add_note_link {margin-top:12px; float: right} -div#project_status > div {padding: 10px} -#project_status span {margin-right:5px; background-color:white} -#project_status .active_state {font-weight:bold} -div#default_context > div{ padding:10px} -a.footer_link {color: #cc3334; font-style: normal;} -a.footer_link:hover {color: #fff; background-color: #cc3334 !important;} -span.tag {font-size: 0.8em; background-color: #CCE7FF; color: #000; padding: 1px; margin-right: 2px} -span.tag a, span.tag a:link, span.tag a:active, span.tag a:visited {color: #000} -span.tag a:hover {background-color: #99CCFF; color: #333} -div#message_holder {position: absolute; z-index: 100; left: 60%; top: 30px; right: 0px; margin: 0px} -h4.alert {font-size: 1em; margin: 0px; padding: 5px; text-align: center} -h4.warning {border: 1px solid #ED2E38; background-color: #F6979C; color: #000} -h4.error {color:#fff; background:#c00} -h4.notice {border: 1px solid #007E00; background-color: #c2ffc2; color: #007E00} -.project_completed {border: 1px solid #007E00; background-color: #c2ffc2; padding: 5px; color: #007E00; text-align: center} -.red {color: #fff; background: #f00; padding: 1px; font-size: 85%} -.amber {color: #fff; background: #ff6600; padding: 1px; font-size: 85%} -.orange {color: #fff; background: #FFA500; padding: 1px; font-size: 85%} -.green {color: #fff; background: #33cc00; padding: 1px; font-size: 85%} -.grey {color: #fff; background: #999; padding: 2px; font-size: 85%} -.info {color: #fff; background: #CCC; border: 1px solid #999; padding: 5px; text-align: center} -.highlight {background: #ffC; padding: 2px} -.stale_l1 {background: #ffC} -.stale_l2 {background: #ff6} -.stale_l3 {background: #ff0} -.badge {color: #fff; background: #f00; padding: 3px 5px; font-size: 12pt; margin: 10px 10px 0px 0px; height:26px} -ul {list-style-type: none} -#sidebar h3 {margin-top:15px; margin-bottom:5px} -#sidebar ul {margin-left: auto; list-style-position: inside} -li {font-size: 1.1em; padding: 3px 0px} -#sidebar .integrations-link {margin-top:10px; padding-top:10px; font-size: 0.8em} -.sortable_row {background: #fff; _background: transparent; padding: 4px 4px 4px 8px; margin: 2px 2px; border: 1px solid #ccc} -.edit-form {background: #ccc; padding: 0 10px; border-top: 1px solid #999; border-bottom: 1px solid #999; position:relative} -.label {text-align: right} -input {vertical-align: middle} -img.position, a:hover img.position {text-align: left; vertical-align: middle; background-color: transparent} -.data {text-align: left; margin-left: 20px; float: left} -div.buttons, div.buttons a, div.buttons a:hover {text-align: right; margin-right: 0px; vertical-align: middle; background-color: transparent} -div#list-active-projects, div#list-hidden-projects, div#list-completed-projects, div#list-contexts, div#projects-empty-nd {clear:right; border: 1px solid #999} -.project-state-group h2 {margin:20px 0px 8px 13px} -.search-result-group h2 {margin:20px 0px 8px 13px } -div.menu_sort {margin-top:-20px; float:right} -div.alpha_sort, div.tasks_sort,span.sort_separator {float:left} -.container td {border: none; padding-bottom: 5px} -.container form {border: none} -div.project_description {background: #eee; padding: 5px; margin-top: 0px; margin-left: -5px; margin-right: -5px; color: #666; font-style: italic; font-size: 12px; font-weight: normal} -#project-next-prev {text-align:right} -form {border: 1px solid #CCC; padding: 10px; margin: 0px} -.inline-form {border: none; padding: 3px} -.inline-form table {padding-right: 3px} -.inline-form table, .inline-form textarea#item_notes, .inline-form input#item_description {width: 100%} -.inline-form table td.label {width: 13ex} -#todo_new_action_container, #project_new_project_container, #context_new_container, #recurring_new_container {background: #ddd; width: 270px; padding: 5px 10px; background-color: #000; filter: alpha(opacity=75); -moz-opacity: .75; opacity: .75; color: #eee} -#recurring_new_container img {vertical-align: middle} -#project_new_project_filler {padding-top: 50px} -#todo_new_action_container input, #todo_new_action_container textarea, #project_new_project_container input, #project_new_project_container textarea, #context_new_container input {width: 100%} -input#go_to_project, input#context_hide {width: 5%} -#todo_new_action_container .show_from_input, #todo_new_action_container .due_input {width: 45%} -#todo_new_action_container .show_from_input {float: right} -#todo-form-new-action .submit_box, #project_form .submit_box, #context_form .submit_box {height: 25px; padding: 5px 0; text-align: center; clear: right} -.edit_todo_form .submit_box {height: 25px; padding: 5px 0; text-align: center; clear: right} -.edit_todo_form input, .edit_todo_form textarea {width:100%} -.edit_todo_form .Date {width:89%} -.edit_todo_form a.date_clear:hover {background: #CCCCCC} -.edit_todo_form .tag_list_label {clear:both} -.edit_todo_form .due_input, .edit_todo_form .show_from_input, .edit_todo_form .project_input, .edit_todo_form .context_input {width:48%} -.edit_todo_form .show_from_input, .edit_todo_form .context_input {float: right} -.edit_todo_form .submit_box input {width:120px} -.hide_form {text-align:right} -#todo-form-new-action label, .edit_todo_form label {display: block; padding-bottom: 3px} -form.button-to {border: none; padding: 0px; margin: 0px} -label {font-weight: bold; padding: 0px 0px} -input, select, textarea {margin: 0px 0px 5px 0px} -#feedicons-project, #feedicons-context {background-color: #D2D3D6; margin: 0px 0px 0px 60px; padding: 0px 0px 0px 5px; width: 70%} -.feed {font-family: verdana, sans-serif; font-size: 10px; font-weight:bold; text-decoration:none; color: white; background-color: #F60; border:1px solid; border-color: #FC9 #630 #330 #F96; padding:0px 3px 0px 3px; margin:0px} -.position {float: left; margin-top:2px} -.handle {color: #fff; background: #000; padding: 2px; font-size: 92%; cursor: move} -div.message {margin: 5px 0px; background: #FAF4B5; padding: 2px} -.message p {margin: 0px; padding: 0px; text-align: center; font-size: 1em; color: #666} -.fieldWithErrors {padding: 2px; background-color: red; display: table} -#errorExplanation {border: 2px solid #ff0000; padding: 7px; padding-bottom: 12px; margin: 10px auto 20px auto; background-color: #f0f0f0} -#errorExplanation h2 {text-align: left; font-weight: bold; padding: 5px 5px 5px 15px; font-size: 12px; margin: -7px; background-color: #c00; color: #fff} -#errorExplanation > p {color: #333; margin-top: 5px; margin-bottom: 0; padding: 5px} -#errorExplanation ul li {font-size: 1em; list-style-type: disc; list-style-position: inside; margin-left:7px; color: #333} -ul#prefs {list-style-type: disc; margin-left: 15px;} -#token_area, #authentication_area {text-align:center; margin-top:20px; margin-bottom:10px} -#token_area .description{ font-weight:bold} -#token_area form {width:100%; text-align:center} -.prefscontainer .actions {text-align:center; margin-bottom:20px} -.authtype_container .actions {margin-top:20px; margin-bottom:20px} -#feedlegend {padding: 2px; background-color: #D2D3D6; color: #666; padding: 5px 20px; text-align: left} -#feedlegend h3, #feedlegend dl, #feedlegend dt, #feedlegend dd {display: inline} -#feedlegend dt {margin-left: 15px} -#feedlegend dd {margin-left: 3px} -#feedlegend p {margin-bottom: 0px} -#feeds img.rss-icon {margin-bottom: -4px} -#feeds li {font-size:13px; font-family: "Lucida Grande", Verdana, Geneva, Arial, sans-serif} -#feeds li h4 {margin-top: 12px; margin-bottom: 4px; font-weight: normal; font-style:oblique} -input.open_id {background: url(../images/open-id-login-bg.gif) no-repeat; background-color: #fff; background-position: 0 50%; color: #000; padding-left: 18px; width:182px} -div.page_name_auto_complete {width: 100%; background: #fff; display: inline; z-index: 100} -div.page_name_auto_complete ul {border: 1px solid #888; margin: 0; padding: 0; width: 100%; list-style-type: none} -div.page_name_auto_complete ul li {margin: 0; padding: 2px; font-weight:bold; list-style-type: none; color: #000} -div.page_name_auto_complete ul li.selected {background-color: #ffb} -div.page_name_auto_complete ul strong.highlight {color: #800; margin: 0; padding: 0} -table.next_actions td {padding:5px 3px 2px 0px} -table.users_table {width: 100%; text-align: center; border: 1px solid #666; background-color: #fff; border-spacing: 0px} -.users_table th {color: #fff; background-color: #000;} -.users_table td {border: none;} -table.export_table {border: 1px solid #666; background-color: #fff; border-spacing: 0px} -.export_table th {color: #fff; background-color: #000;} -.export_table td {border: 1px; padding: 5px 0px 5px 5px;} -.widgets a, .widgets button{ display:block; float: left; margin:0px 7px 0 0; background-color:#f5f5f5; border:1px solid #dedede; border-top:1px solid #eee; border-left:1px solid #eee; font-family:"Lucida Grande", Verdana, Geneva, Arial, sans-serif; font-size:80%; line-height:100%; text-decoration:none; font-weight:bold; color:#565656; cursor:pointer; padding:3px 5px 7px 5px} -.widgets button{ width:auto; overflow:visible; padding:3px 5px 5px 5px} -.widgets button[type]{ padding:3px 5px 4px 5px; line-height:15px} -.widgets button img, .widgets a img{ margin:0 3px -3px 0 !important; padding:0; border:none; width:16px; height:16px} -.widgets a:hover{ background-color:#dff4ff; border:1px solid #c2e1ef; color:#336699} -.widgets a:active{ background-color:#6299c5; border:1px solid #6299c5; color:#fff} -button.positive, .widgets a.positive{ color: #498111} -.widgets a.positive:hover, button.positive:hover{ background-color:#E6EFC2; border:1px solid #C6D880; color:#529214} -.widgets a.positive:active{ background-color:#529214; border:1px solid #529214; color:#fff} -.widgets a.negative, button.negative{ color:#d12f19} -.widgets a.negative:hover, button.negative:hover{ background:#fbe3e4; border:1px solid #fbc2c4; color:#d12f19} -.widgets a.negative:active{ background-color:#d12f19; border:1px solid #d12f19; color:#fff} -.tracks__waiting {background-image:url('../images/waiting.gif'); background-repeat:no-repeat; background-position:center center; background-color:white} -.bigWaiting {background-image:url('../images/bigWaiting.gif'); background-repeat:no-repeat; background-position:center 20%; background-color:white} -.blackWaiting {background-image:url('../images/blackWaiting.gif'); background-repeat:no-repeat; background-position:center center; background-color:black} -.bigBlackWaiting {background-image:url('../images/bigBlackWaiting.gif'); background-repeat:no-repeat; background-position:center center; background-color:black} -.stats_content .open-flash-chart, .stats_content .stats_module {float: left; width: 450px; margin-right:20px; padding-bottom:20px} -.stats_content h2 {clear:both; margin-top:15px; margin-bottom:15px} -body.integrations h2 {margin-top:40px; padding-top:20px; margin-bottom:10px; border-top:1px solid #ccc} -body.integrations p, body.integrations li {font-size:1.0em} -body.integrations li {list-style-type: disc; list-style-position: inside; margin-left:30px} -body.integrations textarea {margin:10px; padding:3px; width:80%; background-color:#ddd} -.defer-container {float:right} -.defer-container a:hover {background-color: inherit} -div.calendar {position: relative} -.calendar, .calendar table {border: 1px solid #556; font-size: 11px; color: #000; cursor: default; background: #eef; z-index: 110; font-family: tahoma,verdana,sans-serif} -.calendar .button {text-align: center; padding: 2px} -.calendar .nav {background: #778 url(../images/menuarrow.gif) no-repeat 100% 100%} -.calendar thead .title {font-weight: bold; text-align: center; background: #fff; color: #000; padding: 2px} -.calendar thead .headrow {background: #778; color: #fff} -.calendar thead .daynames {background: #bdf} -.calendar thead .name {border-bottom: 1px solid #556; padding: 2px; text-align: center; color: #000} -.calendar thead .weekend {color: #a66} -.calendar thead .hilite {background-color: #aaf; color: #000; border: 1px solid #04f; padding: 1px} -.calendar thead .active {background-color: #77c; padding: 2px 0px 0px 2px} -.calendar tbody .day {width: 2em; color: #456; text-align: right; padding: 2px 4px 2px 2px} -.calendar tbody .day.othermonth {font-size: 80%; color: #bbb} -.calendar tbody .day.othermonth.oweekend {color: #fbb} -.calendar table .wn {padding: 2px 3px 2px 2px; border-right: 1px solid #000; background: #bdf} -.calendar tbody .rowhilite td {background: #def} -.calendar tbody .rowhilite td.wn {background: #eef} -.calendar tbody td.hilite {background: #def; padding: 1px 3px 1px 1px; border: 1px solid #bbb} -.calendar tbody td.active {background: #cde; padding: 2px 2px 0px 2px} -.calendar tbody td.selected {font-weight: bold; border: 1px solid #000; padding: 1px 3px 1px 1px; background: #fff; color: #000} -.calendar tbody td.weekend {color: #a66} -.calendar tbody td.today {font-weight: bold; color: #00f} -.calendar tbody .disabled {color: #999} -.calendar tbody .emptycell {visibility: hidden} -.calendar tbody .emptyrow {display: none} -.calendar tfoot .footrow {text-align: center; background: #556; color: #fff} -.calendar tfoot .ttip {background: #fff; color: #445; border-top: 1px solid #556; padding: 1px} -.calendar tfoot .hilite {background: #aaf; border: 1px solid #04f; color: #000; padding: 1px} -.calendar tfoot .active {background: #77c; padding: 2px 0px 0px 2px} -.calendar .combo {position: absolute; display: none; top: 0px; left: 0px; width: 4em; cursor: default; border: 1px solid #655; background: #def; color: #000; font-size: 90%; z-index: 100} -.calendar .combo .label, .calendar .combo .label-IEfix {text-align: center; padding: 1px} -.calendar .combo .label-IEfix {width: 4em} -.calendar .combo .hilite {background: #acf} -.calendar .combo .active {border-top: 1px solid #46a; border-bottom: 1px solid #46a; background: #eef; font-weight: bold} -.calendar td.time {border-top: 1px solid #000; padding: 1px 0px; text-align: center; background-color: #f4f0e8} -.calendar td.time .hour, .calendar td.time .minute, .calendar td.time .ampm {padding: 0px 3px 0px 4px; border: 1px solid #889; font-weight: bold; background-color: #fff} -.calendar td.time .ampm {text-align: center} -.calendar td.time .colon {padding: 0px 2px 0px 3px; font-weight: bold} -.calendar td.time span.hilite {border-color: #000; background-color: #667; color: #fff} -.calendar td.time span.active {border-color: #f00; background-color: #000; color: #0f0} -b.niftycorners,b.niftyfill{display:block} -b.niftycorners *{display:block;height: 1px;line-height:1px;font-size: 1px; overflow:hidden;border-style:solid;border-width: 0 1px} -b.r1{margin: 0 3px;border-width: 0 2px} -b.r2{margin: 0 2px} -b.r3{margin: 0 1px} -b.r4{height: 2px} -b.rb1{margin: 0 8px;border-width:0 2px} -b.rb2{margin: 0 6px;border-width:0 2px} -b.rb3{margin: 0 5px} -b.rb4{margin: 0 4px} -b.rb5{margin: 0 3px} -b.rb6{margin: 0 2px} -b.rb7{margin: 0 1px;height:2px} -b.rb8{margin: 0;height:2px} -b.rs1{margin: 0 1px} -b.t1{border-width: 0 5px} -b.t2{border-width: 0 3px} -b.t3{border-width: 0 2px} -b.t4{height: 2px} -b.tb1{border-width: 0 10px} -b.tb2{border-width: 0 8px} -b.tb3{border-width: 0 6px} -b.tb4{border-width: 0 5px} -b.tb5{border-width: 0 4px} -b.tb6{border-width: 0 3px} -b.tb7{border-width: 0 2px;height:2px} -b.tb8{border-width: 0 1px;height:2px} -b.ts1{border-width: 0 2px} \ No newline at end of file From e92dae2ffca71ba2f24861bc59a0f33b598a464c Mon Sep 17 00:00:00 2001 From: Eric Allen Date: Mon, 8 Dec 2008 00:44:09 -0500 Subject: [PATCH 2/4] Upgraded to open_id_authentication plugin at http://github.com/rails/open_id_authentication/commit/00d8bc7f97b9a3113e004475b63dbf84f5397237 and unpacked ruby-openid gem version 2.1.2. --- vendor/gems/ruby-openid-2.1.2/.specification | 289 ++ vendor/gems/ruby-openid-2.1.2/CHANGELOG | 78 + vendor/gems/ruby-openid-2.1.2/INSTALL | 47 + .../ruby-openid-2.1.2}/LICENSE | 8 + vendor/gems/ruby-openid-2.1.2/NOTICE | 2 + vendor/gems/ruby-openid-2.1.2/README | 82 + vendor/gems/ruby-openid-2.1.2/UPGRADE | 127 + .../gems/ruby-openid-2.1.2/admin/runtests.rb | 36 + vendor/gems/ruby-openid-2.1.2/examples/README | 32 + .../active_record_openid_store/README | 58 + .../XXX_add_open_id_store_to_db.rb | 24 + .../XXX_upgrade_open_id_store.rb | 26 + .../active_record_openid_store/init.rb | 8 + .../lib/association.rb | 10 + .../active_record_openid_store/lib/nonce.rb | 3 + .../lib/open_id_setting.rb | 4 + .../lib/openid_ar_store.rb | 57 + .../test/store_test.rb | 212 ++ .../gems/ruby-openid-2.1.2/examples/discover | 49 + .../examples/rails_openid/README | 153 + .../examples/rails_openid/Rakefile | 10 + .../app/controllers/application.rb | 4 + .../app/controllers/consumer_controller.rb | 122 + .../app/controllers/login_controller.rb | 45 + .../app/controllers/server_controller.rb | 265 ++ .../app/helpers/application_helper.rb | 3 + .../rails_openid/app/helpers/login_helper.rb | 2 + .../rails_openid/app/helpers/server_helper.rb | 9 + .../app/views/consumer/index.rhtml | 81 + .../app/views/layouts/server.rhtml | 68 + .../rails_openid/app/views/login/index.rhtml | 56 + .../app/views/server/decide.rhtml | 26 + .../examples/rails_openid/config/boot.rb | 19 + .../examples/rails_openid/config/database.yml | 74 + .../rails_openid/config/environment.rb | 54 + .../config/environments/development.rb | 19 + .../config/environments/production.rb | 19 + .../rails_openid/config/environments/test.rb | 19 + .../examples/rails_openid/config/routes.rb | 24 + .../examples/rails_openid/doc/README_FOR_APP | 2 + .../examples/rails_openid/public/404.html | 8 + .../examples/rails_openid/public/500.html | 8 + .../examples/rails_openid/public/dispatch.cgi | 12 + .../rails_openid/public/dispatch.fcgi | 26 + .../examples/rails_openid/public/dispatch.rb | 12 + .../examples/rails_openid/public/favicon.ico | 0 .../public/images/openid_login_bg.gif | Bin 0 -> 237 bytes .../public/javascripts/controls.js | 750 +++++ .../public/javascripts/dragdrop.js | 584 ++++ .../public/javascripts/effects.js | 854 ++++++ .../public/javascripts/prototype.js | 1785 ++++++++++++ .../examples/rails_openid/public/robots.txt | 1 + .../examples/rails_openid/script/about | 3 + .../examples/rails_openid/script/breakpointer | 3 + .../examples/rails_openid/script/console | 3 + .../examples/rails_openid/script/destroy | 3 + .../examples/rails_openid/script/generate | 3 + .../script/performance/benchmarker | 3 + .../rails_openid/script/performance/profiler | 3 + .../examples/rails_openid/script/plugin | 3 + .../rails_openid/script/process/reaper | 3 + .../rails_openid/script/process/spawner | 3 + .../rails_openid/script/process/spinner | 3 + .../examples/rails_openid/script/runner | 3 + .../examples/rails_openid/script/server | 3 + .../test/functional/login_controller_test.rb | 18 + .../test/functional/server_controller_test.rb | 18 + .../examples/rails_openid/test/test_helper.rb | 28 + .../gems/ruby-openid-2.1.2/lib/hmac/hmac.rb | 112 + .../gems/ruby-openid-2.1.2/lib/hmac/sha1.rb | 11 + .../gems/ruby-openid-2.1.2/lib/hmac/sha2.rb | 25 + vendor/gems/ruby-openid-2.1.2/lib/openid.rb | 20 + .../lib/openid/association.rb | 249 ++ .../ruby-openid-2.1.2/lib/openid/consumer.rb | 394 +++ .../lib/openid/consumer/associationmanager.rb | 340 +++ .../lib/openid/consumer/checkid_request.rb | 186 ++ .../lib/openid/consumer/discovery.rb | 490 ++++ .../lib/openid/consumer/discovery_manager.rb | 123 + .../lib/openid/consumer/html_parse.rb | 134 + .../lib/openid/consumer/idres.rb | 523 ++++ .../lib/openid/consumer/responses.rb | 148 + .../ruby-openid-2.1.2/lib/openid/cryptutil.rb | 97 + .../gems/ruby-openid-2.1.2/lib/openid/dh.rb | 89 + .../ruby-openid-2.1.2/lib/openid/extension.rb | 39 + .../lib/openid/extensions/ax.rb | 516 ++++ .../lib/openid/extensions/pape.rb | 179 ++ .../lib/openid/extensions/sreg.rb | 277 ++ .../ruby-openid-2.1.2/lib/openid/extras.rb | 11 + .../ruby-openid-2.1.2/lib/openid/fetchers.rb | 239 ++ .../ruby-openid-2.1.2/lib/openid/kvform.rb | 136 + .../ruby-openid-2.1.2/lib/openid/kvpost.rb | 58 + .../ruby-openid-2.1.2/lib/openid/message.rb | 553 ++++ .../lib/openid/protocolerror.rb | 8 + .../ruby-openid-2.1.2/lib/openid/server.rb | 1544 +++++++++++ .../lib/openid/store/filesystem.rb | 271 ++ .../lib/openid/store/interface.rb | 75 + .../lib/openid/store/memory.rb | 84 + .../lib/openid/store/nonce.rb | 68 + .../ruby-openid-2.1.2/lib/openid/trustroot.rb | 349 +++ .../ruby-openid-2.1.2/lib/openid/urinorm.rb | 75 + .../gems/ruby-openid-2.1.2/lib/openid/util.rb | 110 + .../lib/openid/yadis/accept.rb | 148 + .../lib/openid/yadis/constants.rb | 21 + .../lib/openid/yadis/discovery.rb | 153 + .../lib/openid/yadis/filters.rb | 205 ++ .../lib/openid/yadis/htmltokenizer.rb | 305 ++ .../lib/openid/yadis/parsehtml.rb | 44 + .../lib/openid/yadis/services.rb | 42 + .../lib/openid/yadis/xrds.rb | 155 ++ .../ruby-openid-2.1.2/lib/openid/yadis/xri.rb | 90 + .../lib/openid/yadis/xrires.rb | 106 + .../ruby-openid-2.1.2/test/data/accept.txt | 124 + .../gems/ruby-openid-2.1.2/test/data/dh.txt | 29 + .../test/data/example-xrds.xml | 14 + .../ruby-openid-2.1.2/test/data/linkparse.txt | 587 ++++ vendor/gems/ruby-openid-2.1.2/test/data/n2b64 | 650 +++++ .../test/data/test1-discover.txt | 137 + .../test/data/test1-parsehtml.txt | 152 + .../test/data/test_discover/openid.html | 11 + .../test/data/test_discover/openid2.html | 11 + .../test/data/test_discover/openid2_xrds.xml | 12 + .../openid2_xrds_no_local_id.xml | 11 + .../data/test_discover/openid_1_and_2.html | 11 + .../test_discover/openid_1_and_2_xrds.xml | 16 + .../openid_1_and_2_xrds_bad_delegate.xml | 17 + .../data/test_discover/openid_and_yadis.html | 12 + .../test_discover/openid_no_delegate.html | 10 + .../data/test_discover/yadis_0entries.xml | 12 + .../test_discover/yadis_2_bad_local_id.xml | 15 + .../test_discover/yadis_2entries_delegate.xml | 22 + .../data/test_discover/yadis_2entries_idp.xml | 21 + .../test_discover/yadis_another_delegate.xml | 14 + .../test/data/test_discover/yadis_idp.xml | 12 + .../data/test_discover/yadis_idp_delegate.xml | 13 + .../data/test_discover/yadis_no_delegate.xml | 11 + .../test/data/test_xrds/=j3h.2007.11.14.xrds | 25 + .../test/data/test_xrds/README | 12 + .../data/test_xrds/delegated-20060809-r1.xrds | 34 + .../data/test_xrds/delegated-20060809-r2.xrds | 34 + .../data/test_xrds/delegated-20060809.xrds | 34 + .../test/data/test_xrds/no-xrd.xml | 7 + .../test/data/test_xrds/not-xrds.xml | 2 + .../test/data/test_xrds/prefixsometimes.xrds | 34 + .../test/data/test_xrds/ref.xrds | 109 + .../test/data/test_xrds/sometimesprefix.xrds | 34 + .../test/data/test_xrds/spoof1.xrds | 25 + .../test/data/test_xrds/spoof2.xrds | 25 + .../test/data/test_xrds/spoof3.xrds | 37 + .../test/data/test_xrds/status222.xrds | 9 + .../test/data/test_xrds/subsegments.xrds | 58 + .../data/test_xrds/valid-populated-xrds.xml | 39 + .../ruby-openid-2.1.2/test/data/trustroot.txt | 153 + .../ruby-openid-2.1.2/test/data/urinorm.txt | 79 + .../ruby-openid-2.1.2/test/discoverdata.rb | 131 + .../ruby-openid-2.1.2/test/test_accept.rb | 170 ++ .../test/test_association.rb | 266 ++ .../test/test_associationmanager.rb | 917 ++++++ vendor/gems/ruby-openid-2.1.2/test/test_ax.rb | 648 +++++ .../test/test_checkid_request.rb | 294 ++ .../ruby-openid-2.1.2/test/test_consumer.rb | 257 ++ .../ruby-openid-2.1.2/test/test_cryptutil.rb | 119 + vendor/gems/ruby-openid-2.1.2/test/test_dh.rb | 86 + .../ruby-openid-2.1.2/test/test_discover.rb | 789 ++++++ .../test/test_discovery_manager.rb | 262 ++ .../ruby-openid-2.1.2/test/test_extension.rb | 46 + .../ruby-openid-2.1.2/test/test_extras.rb | 35 + .../ruby-openid-2.1.2/test/test_fetchers.rb | 538 ++++ .../ruby-openid-2.1.2/test/test_filters.rb | 270 ++ .../gems/ruby-openid-2.1.2/test/test_idres.rb | 904 ++++++ .../ruby-openid-2.1.2/test/test_kvform.rb | 165 ++ .../ruby-openid-2.1.2/test/test_kvpost.rb | 65 + .../ruby-openid-2.1.2/test/test_linkparse.rb | 101 + .../ruby-openid-2.1.2/test/test_message.rb | 1116 ++++++++ .../gems/ruby-openid-2.1.2/test/test_nonce.rb | 89 + .../test/test_openid_yadis.rb | 178 ++ .../gems/ruby-openid-2.1.2/test/test_pape.rb | 247 ++ .../ruby-openid-2.1.2/test/test_parsehtml.rb | 80 + .../ruby-openid-2.1.2/test/test_responses.rb | 63 + .../ruby-openid-2.1.2/test/test_server.rb | 2453 +++++++++++++++++ .../gems/ruby-openid-2.1.2/test/test_sreg.rb | 479 ++++ .../ruby-openid-2.1.2/test/test_stores.rb | 269 ++ .../ruby-openid-2.1.2/test/test_trustroot.rb | 113 + .../ruby-openid-2.1.2/test/test_urinorm.rb | 35 + .../gems/ruby-openid-2.1.2/test/test_util.rb | 145 + .../gems/ruby-openid-2.1.2/test/test_xrds.rb | 169 ++ .../gems/ruby-openid-2.1.2/test/test_xri.rb | 48 + .../ruby-openid-2.1.2/test/test_xrires.rb | 63 + .../test/test_yadis_discovery.rb | 220 ++ .../gems/ruby-openid-2.1.2/test/testutil.rb | 127 + vendor/gems/ruby-openid-2.1.2/test/util.rb | 53 + .../plugins/open_id_authentication/CHANGELOG | 35 + vendor/plugins/open_id_authentication/README | 218 ++ .../plugins/open_id_authentication/Rakefile | 22 + ...open_id_authentication_tables_generator.rb | 11 + .../templates/migration.rb | 20 + .../templates/migration.rb | 26 + ...open_id_authentication_tables_generator.rb | 11 + vendor/plugins/open_id_authentication/init.rb | 17 + .../lib/open_id_authentication.rb | 176 ++ .../lib/open_id_authentication/association.rb | 9 + .../lib/open_id_authentication/db_store.rb | 55 + .../open_id_authentication/mem_cache_store.rb | 73 + .../lib/open_id_authentication/nonce.rb | 5 + .../lib/open_id_authentication/request.rb | 17 + .../open_id_authentication/timeout_fixes.rb | 20 + .../tasks/open_id_authentication_tasks.rake | 30 + .../test/mem_cache_store_test.rb | 151 + .../test/normalize_test.rb | 32 + .../test/open_id_authentication_test.rb | 46 + .../test/status_test.rb | 14 + .../test/test_helper.rb | 14 + vendor/plugins/openid_consumer_plugin/README | 22 - .../plugins/openid_consumer_plugin/Rakefile | 39 - .../open_id_consumer_controller_generator.rb | 86 - .../templates/controller.rb | 74 - .../templates/functional_test.rb | 34 - .../templates/helper.rb | 19 - .../templates/index.rhtml | 32 - .../open_id_migration_generator.rb | 29 - .../open_id_migration/templates/migration.rb | 45 - vendor/plugins/openid_consumer_plugin/init.rb | 23 - .../plugins/openid_consumer_plugin/install.rb | 18 - .../active_record_open_id_store.rb | 103 - .../lib/open_id_consumer/association.rb | 31 - .../open_id_consumer/controller_methods.rb | 70 - .../lib/open_id_consumer/nonce.rb | 22 - .../lib/open_id_consumer/setting.rb | 22 - 227 files changed, 30857 insertions(+), 669 deletions(-) create mode 100644 vendor/gems/ruby-openid-2.1.2/.specification create mode 100644 vendor/gems/ruby-openid-2.1.2/CHANGELOG create mode 100644 vendor/gems/ruby-openid-2.1.2/INSTALL rename vendor/{plugins/openid_consumer_plugin => gems/ruby-openid-2.1.2}/LICENSE (96%) create mode 100644 vendor/gems/ruby-openid-2.1.2/NOTICE create mode 100644 vendor/gems/ruby-openid-2.1.2/README create mode 100644 vendor/gems/ruby-openid-2.1.2/UPGRADE create mode 100644 vendor/gems/ruby-openid-2.1.2/admin/runtests.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/README create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/README create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_add_open_id_store_to_db.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_upgrade_open_id_store.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/init.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/association.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/nonce.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/open_id_setting.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/openid_ar_store.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/test/store_test.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/discover create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/README create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/Rakefile create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/application.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/consumer_controller.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/login_controller.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/server_controller.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/application_helper.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/login_helper.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/server_helper.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/consumer/index.rhtml create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/layouts/server.rhtml create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/login/index.rhtml create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/server/decide.rhtml create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/boot.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/database.yml create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environment.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/development.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/production.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/test.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/routes.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/doc/README_FOR_APP create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/404.html create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/500.html create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.cgi create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.fcgi create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/favicon.ico create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/images/openid_login_bg.gif create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/controls.js create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/dragdrop.js create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/effects.js create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/prototype.js create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/robots.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/about create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/breakpointer create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/console create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/destroy create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/generate create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/benchmarker create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/profiler create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/plugin create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/reaper create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spawner create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spinner create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/runner create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/server create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/login_controller_test.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/server_controller_test.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/test_helper.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/hmac/hmac.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/hmac/sha1.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/hmac/sha2.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/association.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/associationmanager.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/checkid_request.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery_manager.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/html_parse.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/idres.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/responses.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/cryptutil.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/dh.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/extension.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/ax.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/pape.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/sreg.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/extras.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/fetchers.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/kvform.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/kvpost.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/message.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/protocolerror.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/server.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/store/filesystem.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/store/interface.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/store/memory.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/store/nonce.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/trustroot.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/urinorm.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/util.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/accept.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/constants.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/discovery.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/filters.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/htmltokenizer.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/parsehtml.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/services.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrds.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xri.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrires.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/accept.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/dh.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/example-xrds.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/linkparse.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/n2b64 create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test1-discover.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test1-parsehtml.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid.html create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid2.html create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid2_xrds.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid2_xrds_no_local_id.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid_1_and_2.html create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid_1_and_2_xrds.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid_1_and_2_xrds_bad_delegate.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid_and_yadis.html create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/openid_no_delegate.html create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_0entries.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_2_bad_local_id.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_2entries_delegate.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_2entries_idp.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_another_delegate.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_idp.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_idp_delegate.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_discover/yadis_no_delegate.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/=j3h.2007.11.14.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/README create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/delegated-20060809-r1.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/delegated-20060809-r2.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/delegated-20060809.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/no-xrd.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/not-xrds.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/prefixsometimes.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/ref.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/sometimesprefix.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/spoof1.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/spoof2.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/spoof3.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/status222.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/subsegments.xrds create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/test_xrds/valid-populated-xrds.xml create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/trustroot.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/data/urinorm.txt create mode 100644 vendor/gems/ruby-openid-2.1.2/test/discoverdata.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_accept.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_association.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_associationmanager.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_ax.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_checkid_request.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_consumer.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_cryptutil.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_dh.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_discover.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_discovery_manager.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_extension.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_extras.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_fetchers.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_filters.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_idres.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_kvform.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_kvpost.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_linkparse.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_message.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_nonce.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_openid_yadis.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_pape.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_parsehtml.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_responses.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_server.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_sreg.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_stores.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_trustroot.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_urinorm.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_util.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_xrds.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_xri.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_xrires.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/test_yadis_discovery.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/testutil.rb create mode 100644 vendor/gems/ruby-openid-2.1.2/test/util.rb create mode 100644 vendor/plugins/open_id_authentication/CHANGELOG create mode 100644 vendor/plugins/open_id_authentication/README create mode 100644 vendor/plugins/open_id_authentication/Rakefile create mode 100644 vendor/plugins/open_id_authentication/generators/open_id_authentication_tables/open_id_authentication_tables_generator.rb create mode 100644 vendor/plugins/open_id_authentication/generators/open_id_authentication_tables/templates/migration.rb create mode 100644 vendor/plugins/open_id_authentication/generators/upgrade_open_id_authentication_tables/templates/migration.rb create mode 100644 vendor/plugins/open_id_authentication/generators/upgrade_open_id_authentication_tables/upgrade_open_id_authentication_tables_generator.rb create mode 100644 vendor/plugins/open_id_authentication/init.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication/association.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication/db_store.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication/mem_cache_store.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication/nonce.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication/request.rb create mode 100644 vendor/plugins/open_id_authentication/lib/open_id_authentication/timeout_fixes.rb create mode 100644 vendor/plugins/open_id_authentication/tasks/open_id_authentication_tasks.rake create mode 100644 vendor/plugins/open_id_authentication/test/mem_cache_store_test.rb create mode 100644 vendor/plugins/open_id_authentication/test/normalize_test.rb create mode 100644 vendor/plugins/open_id_authentication/test/open_id_authentication_test.rb create mode 100644 vendor/plugins/open_id_authentication/test/status_test.rb create mode 100644 vendor/plugins/open_id_authentication/test/test_helper.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/README delete mode 100644 vendor/plugins/openid_consumer_plugin/Rakefile delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_consumer_controller/open_id_consumer_controller_generator.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_consumer_controller/templates/controller.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_consumer_controller/templates/functional_test.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_consumer_controller/templates/helper.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_consumer_controller/templates/index.rhtml delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_migration/open_id_migration_generator.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/generators/open_id_migration/templates/migration.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/init.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/install.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/lib/open_id_consumer/active_record_open_id_store.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/lib/open_id_consumer/association.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/lib/open_id_consumer/controller_methods.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/lib/open_id_consumer/nonce.rb delete mode 100644 vendor/plugins/openid_consumer_plugin/lib/open_id_consumer/setting.rb diff --git a/vendor/gems/ruby-openid-2.1.2/.specification b/vendor/gems/ruby-openid-2.1.2/.specification new file mode 100644 index 00000000..e6c9612d --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/.specification @@ -0,0 +1,289 @@ +--- !ruby/object:Gem::Specification +name: ruby-openid +version: !ruby/object:Gem::Version + version: 2.1.2 +platform: ruby +authors: +- JanRain, Inc +autorequire: openid +bindir: bin +cert_chain: +date: 2008-06-27 00:00:00 -04:00 +default_executable: +dependencies: [] + +description: +email: openid@janrain.com +executables: [] + +extensions: [] + +extra_rdoc_files: +- README +- INSTALL +- LICENSE +- UPGRADE +files: +- examples/README +- examples/active_record_openid_store +- examples/rails_openid +- examples/discover +- examples/active_record_openid_store/lib +- examples/active_record_openid_store/test +- examples/active_record_openid_store/init.rb +- examples/active_record_openid_store/README +- examples/active_record_openid_store/XXX_add_open_id_store_to_db.rb +- examples/active_record_openid_store/XXX_upgrade_open_id_store.rb +- examples/active_record_openid_store/lib/association.rb +- examples/active_record_openid_store/lib/nonce.rb +- examples/active_record_openid_store/lib/open_id_setting.rb +- examples/active_record_openid_store/lib/openid_ar_store.rb +- examples/active_record_openid_store/test/store_test.rb +- examples/rails_openid/app +- examples/rails_openid/components +- examples/rails_openid/config +- examples/rails_openid/db +- examples/rails_openid/doc +- examples/rails_openid/lib +- examples/rails_openid/log +- examples/rails_openid/public +- examples/rails_openid/script +- examples/rails_openid/test +- examples/rails_openid/vendor +- examples/rails_openid/Rakefile +- examples/rails_openid/README +- examples/rails_openid/app/controllers +- examples/rails_openid/app/helpers +- examples/rails_openid/app/models +- examples/rails_openid/app/views +- examples/rails_openid/app/controllers/application.rb +- examples/rails_openid/app/controllers/login_controller.rb +- examples/rails_openid/app/controllers/server_controller.rb +- examples/rails_openid/app/controllers/consumer_controller.rb +- examples/rails_openid/app/helpers/application_helper.rb +- examples/rails_openid/app/helpers/login_helper.rb +- examples/rails_openid/app/helpers/server_helper.rb +- examples/rails_openid/app/views/layouts +- examples/rails_openid/app/views/login +- examples/rails_openid/app/views/server +- examples/rails_openid/app/views/consumer +- examples/rails_openid/app/views/layouts/server.rhtml +- examples/rails_openid/app/views/login/index.rhtml +- examples/rails_openid/app/views/server/decide.rhtml +- examples/rails_openid/app/views/consumer/index.rhtml +- examples/rails_openid/config/environments +- examples/rails_openid/config/database.yml +- examples/rails_openid/config/boot.rb +- examples/rails_openid/config/environment.rb +- examples/rails_openid/config/routes.rb +- examples/rails_openid/config/environments/development.rb +- examples/rails_openid/config/environments/production.rb +- examples/rails_openid/config/environments/test.rb +- examples/rails_openid/doc/README_FOR_APP +- examples/rails_openid/lib/tasks +- examples/rails_openid/public/images +- examples/rails_openid/public/javascripts +- examples/rails_openid/public/stylesheets +- examples/rails_openid/public/dispatch.cgi +- examples/rails_openid/public/404.html +- examples/rails_openid/public/500.html +- examples/rails_openid/public/dispatch.fcgi +- examples/rails_openid/public/dispatch.rb +- examples/rails_openid/public/favicon.ico +- examples/rails_openid/public/robots.txt +- examples/rails_openid/public/images/openid_login_bg.gif +- examples/rails_openid/public/javascripts/controls.js +- examples/rails_openid/public/javascripts/dragdrop.js +- examples/rails_openid/public/javascripts/effects.js +- examples/rails_openid/public/javascripts/prototype.js +- examples/rails_openid/script/performance +- examples/rails_openid/script/process +- examples/rails_openid/script/console +- examples/rails_openid/script/about +- examples/rails_openid/script/breakpointer +- examples/rails_openid/script/destroy +- examples/rails_openid/script/generate +- examples/rails_openid/script/plugin +- examples/rails_openid/script/runner +- examples/rails_openid/script/server +- examples/rails_openid/script/performance/benchmarker +- examples/rails_openid/script/performance/profiler +- examples/rails_openid/script/process/spawner +- examples/rails_openid/script/process/reaper +- examples/rails_openid/script/process/spinner +- examples/rails_openid/test/fixtures +- examples/rails_openid/test/functional +- examples/rails_openid/test/mocks +- examples/rails_openid/test/unit +- examples/rails_openid/test/test_helper.rb +- examples/rails_openid/test/functional/login_controller_test.rb +- examples/rails_openid/test/functional/server_controller_test.rb +- examples/rails_openid/test/mocks/development +- examples/rails_openid/test/mocks/test +- lib/openid +- lib/hmac +- lib/openid.rb +- lib/openid/cryptutil.rb +- lib/openid/extras.rb +- lib/openid/urinorm.rb +- lib/openid/util.rb +- lib/openid/trustroot.rb +- lib/openid/message.rb +- lib/openid/yadis +- lib/openid/consumer +- lib/openid/fetchers.rb +- lib/openid/dh.rb +- lib/openid/kvform.rb +- lib/openid/association.rb +- lib/openid/store +- lib/openid/kvpost.rb +- lib/openid/extensions +- lib/openid/protocolerror.rb +- lib/openid/server.rb +- lib/openid/extension.rb +- lib/openid/consumer.rb +- lib/openid/yadis/htmltokenizer.rb +- lib/openid/yadis/parsehtml.rb +- lib/openid/yadis/filters.rb +- lib/openid/yadis/xrds.rb +- lib/openid/yadis/accept.rb +- lib/openid/yadis/constants.rb +- lib/openid/yadis/discovery.rb +- lib/openid/yadis/xri.rb +- lib/openid/yadis/xrires.rb +- lib/openid/yadis/services.rb +- lib/openid/consumer/html_parse.rb +- lib/openid/consumer/idres.rb +- lib/openid/consumer/associationmanager.rb +- lib/openid/consumer/discovery.rb +- lib/openid/consumer/discovery_manager.rb +- lib/openid/consumer/checkid_request.rb +- lib/openid/consumer/responses.rb +- lib/openid/store/filesystem.rb +- lib/openid/store/interface.rb +- lib/openid/store/nonce.rb +- lib/openid/store/memory.rb +- lib/openid/extensions/sreg.rb +- lib/openid/extensions/ax.rb +- lib/openid/extensions/pape.rb +- lib/hmac/hmac.rb +- lib/hmac/sha1.rb +- lib/hmac/sha2.rb +- test/data +- test/test_association.rb +- test/test_urinorm.rb +- test/testutil.rb +- test/test_util.rb +- test/test_message.rb +- test/test_cryptutil.rb +- test/test_extras.rb +- test/util.rb +- test/test_trustroot.rb +- test/test_parsehtml.rb +- test/test_fetchers.rb +- test/test_dh.rb +- test/test_kvform.rb +- test/test_openid_yadis.rb +- test/test_linkparse.rb +- test/test_stores.rb +- test/test_filters.rb +- test/test_xrds.rb +- test/test_nonce.rb +- test/test_accept.rb +- test/test_kvpost.rb +- test/test_associationmanager.rb +- test/discoverdata.rb +- test/test_server.rb +- test/test_yadis_discovery.rb +- test/test_sreg.rb +- test/test_idres.rb +- test/test_ax.rb +- test/test_xri.rb +- test/test_xrires.rb +- test/test_discover.rb +- test/test_consumer.rb +- test/test_pape.rb +- test/test_checkid_request.rb +- test/test_discovery_manager.rb +- test/test_responses.rb +- test/test_extension.rb +- test/data/test_xrds +- test/data/urinorm.txt +- test/data/n2b64 +- test/data/trustroot.txt +- test/data/dh.txt +- test/data/test1-parsehtml.txt +- test/data/linkparse.txt +- test/data/accept.txt +- test/data/test_discover +- test/data/example-xrds.xml +- test/data/test1-discover.txt +- test/data/test_xrds/ref.xrds +- test/data/test_xrds/README +- test/data/test_xrds/delegated-20060809-r1.xrds +- test/data/test_xrds/delegated-20060809-r2.xrds +- test/data/test_xrds/delegated-20060809.xrds +- test/data/test_xrds/no-xrd.xml +- test/data/test_xrds/not-xrds.xml +- test/data/test_xrds/prefixsometimes.xrds +- test/data/test_xrds/sometimesprefix.xrds +- test/data/test_xrds/spoof1.xrds +- test/data/test_xrds/spoof2.xrds +- test/data/test_xrds/spoof3.xrds +- test/data/test_xrds/status222.xrds +- test/data/test_xrds/valid-populated-xrds.xml +- test/data/test_xrds/=j3h.2007.11.14.xrds +- test/data/test_xrds/subsegments.xrds +- test/data/test_discover/openid2_xrds.xml +- test/data/test_discover/openid.html +- test/data/test_discover/openid2.html +- test/data/test_discover/openid2_xrds_no_local_id.xml +- test/data/test_discover/openid_1_and_2.html +- test/data/test_discover/openid_1_and_2_xrds.xml +- test/data/test_discover/openid_and_yadis.html +- test/data/test_discover/openid_1_and_2_xrds_bad_delegate.xml +- test/data/test_discover/openid_no_delegate.html +- test/data/test_discover/yadis_0entries.xml +- test/data/test_discover/yadis_2_bad_local_id.xml +- test/data/test_discover/yadis_2entries_delegate.xml +- test/data/test_discover/yadis_2entries_idp.xml +- test/data/test_discover/yadis_another_delegate.xml +- test/data/test_discover/yadis_idp.xml +- test/data/test_discover/yadis_idp_delegate.xml +- test/data/test_discover/yadis_no_delegate.xml +- NOTICE +- CHANGELOG +- README +- INSTALL +- LICENSE +- UPGRADE +- admin/runtests.rb +has_rdoc: true +homepage: http://openidenabled.com/ruby-openid/ +post_install_message: +rdoc_options: +- --main +- README +require_paths: +- lib +required_ruby_version: !ruby/object:Gem::Requirement + requirements: + - - ">" + - !ruby/object:Gem::Version + version: 0.0.0 + version: +required_rubygems_version: !ruby/object:Gem::Requirement + requirements: + - - ">=" + - !ruby/object:Gem::Version + version: "0" + version: +requirements: [] + +rubyforge_project: +rubygems_version: 1.2.0 +signing_key: +specification_version: 1 +summary: A library for consuming and serving OpenID identities. +test_files: +- admin/runtests.rb diff --git a/vendor/gems/ruby-openid-2.1.2/CHANGELOG b/vendor/gems/ruby-openid-2.1.2/CHANGELOG new file mode 100644 index 00000000..deece367 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/CHANGELOG @@ -0,0 +1,78 @@ +Fri Jun 27 15:39:14 PDT 2008 Kevin Turner + tagged 2.1.2 + +Fri Jun 27 15:38:05 PDT 2008 Kevin Turner + * update version to 2.1.2 + +Fri Jun 27 15:01:35 PDT 2008 Kevin Turner + * util: remove call to srand + + From the Ruby FAQ: + + 9.2 How do random number seeds work? + + It depends. In Ruby versions prior to 1.5.2, the random number generator had + (by default) a constant seed, and so would produce the same series of numbers + each time a program was run. If you needed less deterministic behaviors, you + called srand to set up a less predictable seed. + + Newer Rubys (Rubies?) have a different behavior. If rand is called without a + prior call to srand, Ruby will generate its own random(ish) seed. Successive + runs of a program that does not use srand will generate different sequences of + random numbers. To get the old, predictable, behavior (perhaps for testing), + call srand with a constant seed. + +Fri Jun 27 13:34:43 PDT 2008 Kevin Turner + * LICENSE: htmltokenizer is (c) 2004 Ben Giddings + +Fri Jun 27 13:32:09 PDT 2008 Kevin Turner + * Yadis.html_yadis_location: catch HTMLTokenizerError + +Fri Jun 27 13:24:13 PDT 2008 Kevin Turner + * htmltokenizer: define HTMLTokenizerError to raise + +Fri Jun 27 13:18:38 PDT 2008 Kevin Turner + * htmltokenizer: Don't raise OpenIDError from htmltokenizer (it's not in the OpenID module namespace) #255 + +Wed Jun 25 17:31:26 PDT 2008 Kevin Turner + * OpenID::Server::CheckIDRequest.answer: document return type + +Wed Jun 25 17:06:35 PDT 2008 Kevin Turner + * TrustRoot.check_sanity: don't fail if the trust root is not parseable + +Wed Jun 25 16:31:30 PDT 2008 Kevin Turner + * Message.from_http_response: accept 206 code + +Wed Jun 25 14:14:05 PDT 2008 Kevin Turner + * move OpenID::VERSION definition in openid.rb, for #256 + +Wed Jun 25 13:55:18 PDT 2008 Kevin Turner + * Add admin/gettlds.py to ease updating of TLD list in trust root validation + +Wed Jun 25 13:50:22 PDT 2008 Kevin Turner + * TrustRoot.TOP_LEVEL_DOMAINS: updated + +Fri Jun 13 14:18:04 PDT 2008 Kevin Turner + * xrds.rb: fix stray colon + +Fri Jun 13 13:41:58 PDT 2008 Kevin Turner + * Yadis::get_canonical_id: case-insensitive comparison + + Porting a patch from =wil: + + 1. There should only be a single CanonicalID in each XRD (in the latest XRI + resolution spec), so I made it use the first CID found instead of the last. + + 2. Use case-insensitive comparison when comparing CanonicalIDs. + +Wed Jun 11 15:24:12 PDT 2008 Kevin Turner + * Accept response code 206 from fetcher results. Fixes #260 + +Wed Jun 11 11:27:25 PDT 2008 cygnus@janrain.com + * admin/fixperms: Fix stale entries + +Wed Jun 11 11:08:11 PDT 2008 cygnus@janrain.com + * Add test cases for trust roots with non-ASCII characters in path or hostname + +Fri Jun 6 15:50:12 PDT 2008 cygnus@janrain.com + tagged 2.1.1 diff --git a/vendor/gems/ruby-openid-2.1.2/INSTALL b/vendor/gems/ruby-openid-2.1.2/INSTALL new file mode 100644 index 00000000..89f1b9bd --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/INSTALL @@ -0,0 +1,47 @@ += Ruby OpenID Library Installation + +== Rubygems Installation + +Rubygems is a tool for installing ruby libraries and their +dependancies. If you have rubygems installed, simply: + + gem install ruby-openid + +== Manual Installation + +Unpack the archive and run setup.rb to install: + + ruby setup.rb + +setup.rb installs the library into your system ruby. If don't want to +add openid to you system ruby, you may instead add the *lib* directory of +the extracted tarball to your RUBYLIB environment variable: + + $ export RUBYLIB=${RUBYLIB}:/path/to/ruby-openid/lib + + +== Testing the Installation + +Make sure everything installed ok: + $> irb + irb$> require "openid" + => true + +Or, if you installed via rubygems: + + $> irb + irb$> require "rubygems" + => true + irb$> require_gem "ruby-openid" + => true + +== Run the test suite + +Go into the test directory and execute the *runtests.rb* script. + +== Next steps + +* Run consumer.rb in the examples directory. +* Get started writing your own consumer using OpenID::Consumer +* Write your own server with OpenID::Server +* Use the OpenIDLoginGenerator! Read example/README for more info. diff --git a/vendor/plugins/openid_consumer_plugin/LICENSE b/vendor/gems/ruby-openid-2.1.2/LICENSE similarity index 96% rename from vendor/plugins/openid_consumer_plugin/LICENSE rename to vendor/gems/ruby-openid-2.1.2/LICENSE index d6456956..c1c57734 100644 --- a/vendor/plugins/openid_consumer_plugin/LICENSE +++ b/vendor/gems/ruby-openid-2.1.2/LICENSE @@ -1,3 +1,11 @@ +The code in lib/hmac/ is Copyright 2001 by Daiki Ueno, and distributed under +the terms of the Ruby license. See http://www.ruby-lang.org/en/LICENSE.txt + +lib/openid/yadis/htmltokenizer.rb is Copyright 2004 by Ben Giddings and +distributed under the terms of the Ruby license. + +The remainder of this package is Copyright 2006-2008 by JanRain, Inc. and +distributed under the terms of license below: Apache License Version 2.0, January 2004 diff --git a/vendor/gems/ruby-openid-2.1.2/NOTICE b/vendor/gems/ruby-openid-2.1.2/NOTICE new file mode 100644 index 00000000..62df93be --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/NOTICE @@ -0,0 +1,2 @@ +This product includes software developed by JanRain, +available from http://openidenabled.com/ diff --git a/vendor/gems/ruby-openid-2.1.2/README b/vendor/gems/ruby-openid-2.1.2/README new file mode 100644 index 00000000..c6e833b4 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/README @@ -0,0 +1,82 @@ +=Ruby OpenID + +A Ruby library for verifying and serving OpenID identities. + +==Features +* Easy to use API for verifying OpenID identites - OpenID::Consumer +* Support for serving OpenID identites - OpenID::Server +* Does not depend on underlying web framework +* Supports multiple storage mechanisms (Filesystem, ActiveRecord, Memory) +* Example code to help you get started, including: + * Ruby on Rails based consumer and server + * OpenIDLoginGenerator for quickly getting creating a rails app that uses + OpenID for authentication + * ActiveRecordOpenIDStore plugin +* Comprehensive test suite +* Supports both OpenID 1 and OpenID 2 transparently + +==Installing +Before running the examples or writing your own code you'll need to install +the library. See the INSTALL file or use rubygems: + + gem install ruby-openid + +Check the installation: + + $ irb + irb> require 'rubygems' + irb> require_gem 'ruby-openid' + => true + +The library is known to work with Ruby 1.8.4 on Unix, Max OSX and +Win32. Examples have been tested with Rails 1.1 and 1.2, and 2.0. + +==Getting Started +The best way to start is to look at the rails_openid example. +You can run it with: + cd examples/rails_openid + script/server + +If you are writing an OpenID Relying Party, a good place to start is: +examples/rails_openid/app/controllers/consumer_controller.rb + +And if you are writing an OpenID provider: +examples/rails_openid/app/controllers/server_controller.rb + +The library code is quite well documented, so don't be squeamish, and +look at the library itself if there's anything you don't understand in +the examples. + +==Homepage +http://openidenabled.com/ruby-openid/ + +See also: +http://openid.net/ +http://openidenabled.com/ + +==Community +Discussion regarding the Ruby OpenID library and other JanRain OpenID +libraries takes place on the the OpenID mailing list on +openidenabled.com. + +http://lists.openidenabled.com/mailman/listinfo/dev + +Please join this list to discuss, ask implementation questions, report +bugs, etc. Also check out the openid channel on the freenode IRC +network. + +If you have a bugfix or feature you'd like to contribute, don't +hesitate to send it to us. For more detailed information on how to +contribute, see + + http://openidenabled.com/contribute/ + +==Author +Copyright 2006-2008, JanRain, Inc. + +Contact openid@janrain.com or visit the OpenID channel on pibb.com: + +http://pibb.com/go/openid + +==License +Apache Software License. For more information see the LICENSE file. diff --git a/vendor/gems/ruby-openid-2.1.2/UPGRADE b/vendor/gems/ruby-openid-2.1.2/UPGRADE new file mode 100644 index 00000000..b80e8232 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/UPGRADE @@ -0,0 +1,127 @@ += Upgrading from the OpenID 1.x series library + +== Consumer Upgrade + +The flow is largely the same, however there are a number of significant +changes. The consumer example is helpful to look at: +examples/rails_openid/app/controllers/consumer_controller.rb + + +=== Stores + +You will need to require the file for the store that you are using. +For the filesystem store, this is 'openid/stores/filesystem' +They are also now in modules. The filesystem store is + OpenID::Store::Filesystem +The format has changed, and you should remove your old store directory. + +The ActiveRecord store ( examples/active_record_openid_store ) still needs +to be put in a plugin directory for your rails app. There's a migration +that needs to be run; examine the README in that directory. + +Also, note that the stores now can be garbage collected with the method + store.cleanup + + +=== Starting the OpenID transaction + +The OpenIDRequest object no longer has status codes. Instead, +consumer.begin raises an OpenID::OpenIDError if there is a problem +initiating the transaction, so you'll want something along the lines of: + + begin + openid_request = consumer.begin(params[:openid_identifier]) + rescue OpenID::OpenIDError => e + # display error e + return + end + #success case + +Data regarding the OpenID server once lived in + openid_request.service + +The corresponding object in the 2.0 lib can be retrieved with + openid_request.endpoint + +Getting the unverified identifier: Where you once had + openid_request.identity_url +you will now want + openid_request.endpoint.claimed_id +which might be different from what you get at the end of the transaction, +since it is now possible for users to enter their server's url directly. + +Arguments on the return_to URL are now verified, so if you want to add +additional arguments to the return_to url, use + openid_request.return_to_args['param'] = value + +Generating the redirect is the same as before, but add any extensions +first. + +If you need to set up an SSL certificate authority list for the fetcher, +use the 'ca_file' attr_accessor on the OpenID::StandardFetcher. This has +changed from 'ca_path' in the 1.x.x series library. That is, set +OpenID.fetcher.ca_file = '/path/to/ca.list' +before calling consumer.begin. + +=== Requesting Simple Registration Data + +You'll need to require the code for the extension + require 'openid/extensions/sreg' + +The new code for adding an SReg request now looks like: + + sreg_request = OpenID::SReg::Request.new + sreg_request.request_fields(['email', 'dob'], true) # required + sreg_request.request_fields(['nickname', 'fullname'], false) # optional + sreg_request.policy_url = policy_url + openid_request.add_extension(sreg_request) + +The code for adding other extensions is similar. Code for the Attribute +Exchange (AX) and Provider Authentication Policy Extension (PAPE) are +included with the library, and additional extensions can be implemented +subclassing OpenID::Extension. + + +=== Completing the transaction + +The return_to and its arguments are verified, so you need to pass in +the base URL and the arguments. With Rails, the params method mashes +together parameters from GET, POST, and the path, so you'll need to pull +off the path "parameters" with something like + + return_to = url_for(:only_path => false, + :controller => 'openid', + :action => 'complete') + parameters = params.reject{|k,v| request.path_parameters[k] } + openid_response = consumer.complete(parameters, return_to) + +The response still uses the status codes, but they are now namespaced +slightly differently, for example OpenID::Consumer::SUCCESS + +In the case of failure, the error message is now found in + openid_response.message + +The identifier to display to the user can be found in + openid_response.endpoint.display_identifier + +The Simple Registration response can be read from the OpenID response +with + sreg_response = OpenID::SReg::Response.from_success_response(openid_response) + nickname = sreg_response['nickname'] + # etc. + + +== Server Upgrade + +The server code is mostly the same as before, with the exception of +extensions. Also, you must pass in the endpoint URL to the server +constructor: + @server = OpenID::Server.new(store, server_url) + +I recommend looking at +examples/rails_openid/app/controllers/server_controller.rb +for an example of the new way of doing extensions. + +-- +Dag Arneson, JanRain Inc. +Please direct questions to openid@janrain.com diff --git a/vendor/gems/ruby-openid-2.1.2/admin/runtests.rb b/vendor/gems/ruby-openid-2.1.2/admin/runtests.rb new file mode 100644 index 00000000..50abe044 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/admin/runtests.rb @@ -0,0 +1,36 @@ +#!/usr/bin/ruby + +require "logger" +require "stringio" +require "pathname" + +require 'test/unit/collector/dir' +require 'test/unit/ui/console/testrunner' + +def main + old_verbose = $VERBOSE + $VERBOSE = true + + tests_dir = Pathname.new(__FILE__).dirname.dirname.join('test') + + # Collect tests from everything named test_*.rb. + c = Test::Unit::Collector::Dir.new + + if c.respond_to?(:base=) + # In order to supress warnings from ruby 1.8.6 about accessing + # undefined member + c.base = tests_dir + suite = c.collect + else + # Because base is not defined in ruby < 1.8.6 + suite = c.collect(tests_dir) + end + + + result = Test::Unit::UI::Console::TestRunner.run(suite) + result.passed? +ensure + $VERBOSE = old_verbose +end + +exit(main) diff --git a/vendor/gems/ruby-openid-2.1.2/examples/README b/vendor/gems/ruby-openid-2.1.2/examples/README new file mode 100644 index 00000000..71aa30d7 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/README @@ -0,0 +1,32 @@ +This directory contains several examples that demonstrate use of the +OpenID library. Make sure you have properly installed the library +before running the examples. These examples are a great place to +start in integrating OpenID into your application. + +==Rails example + +The rails_openid contains a fully functional OpenID server and relying +party, and acts as a starting point for implementing your own +production rails server. You'll need the latest version of Ruby on +Rails installed, and then: + + cd rails_openid + ./script/server + +Open a web browser to http://localhost:3000/ and follow the instructions. + +The relevant code to work from when writing your Rails OpenID Relying +Party is: + rails_openid/app/controllers/consumer_controller.rb +If you are working on an OpenID provider, check out + rails_openid/app/controllers/server_controller.rb + +Since the library and examples are Apache-licensed, don't be shy about +copy-and-paste. + +==Rails ActiveRecord OpenIDStore plugin + +For various reasons you may want or need to deploy your ruby openid +consumer/server using an SQL based store. The active_record_openid_store +is a plugin that makes using an SQL based store simple. Follow the +README inside the plugin's dir for usage. diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/README b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/README new file mode 100644 index 00000000..11787298 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/README @@ -0,0 +1,58 @@ +=Active Record OpenID Store Plugin + +A store is required by an OpenID server and optionally by the consumer +to store associations, nonces, and auth key information across +requests and processes. If rails is distributed across several +machines, they must must all have access to the same OpenID store +data, so the FilesystemStore won't do. + +This directory contains a plugin for connecting your +OpenID enabled rails app to an ActiveRecord based OpenID store. + +==Install + +1) Copy this directory and all it's contents into your +RAILS_ROOT/vendor/plugins directory. You structure should look like +this: + + RAILS_ROOT/vendor/plugins/active_record_openid_store/ + +2) Copy the migration, XXX_add_open_id_store_to_db.rb to your + RAILS_ROOT/db/migrate directory. Rename the XXX portion of the + file to next sequential migration number. + +3) Run the migration: + + rake migrate + +4) Change your app to use the ActiveRecordOpenIDStore: + + store = ActiveRecordOpenIDStore.new + consumer = OpenID::Consumer.new(session, store) + +5) That's it! All your OpenID state will now be stored in the database. + +==Upgrade + +If you are upgrading from the 1.x ActiveRecord store, replace your old +RAILS_ROOT/vendor/plugins/active_record_openid_store/ directory with +the new one and run the migration XXX_upgrade_open_id_store.rb. + +==What about garbage collection? + +You may garbage collect unused nonces and expired associations using +the gc instance method of ActiveRecordOpenIDStore. Hook it up to a +task in your app's Rakefile like so: + + desc 'GC OpenID store' + task :gc_openid_store => :environment do + ActiveRecordOpenIDStore.new.cleanup + end + +Run it by typing: + + rake gc_openid_store + + +==Questions? +Contact Dag Arneson: dag at janrain dot com diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_add_open_id_store_to_db.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_add_open_id_store_to_db.rb new file mode 100644 index 00000000..99625453 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_add_open_id_store_to_db.rb @@ -0,0 +1,24 @@ +# Use this migration to create the tables for the ActiveRecord store +class AddOpenIdStoreToDb < ActiveRecord::Migration + def self.up + create_table "open_id_associations", :force => true do |t| + t.column "server_url", :binary, :null => false + t.column "handle", :string, :null => false + t.column "secret", :binary, :null => false + t.column "issued", :integer, :null => false + t.column "lifetime", :integer, :null => false + t.column "assoc_type", :string, :null => false + end + + create_table "open_id_nonces", :force => true do |t| + t.column :server_url, :string, :null => false + t.column :timestamp, :integer, :null => false + t.column :salt, :string, :null => false + end + end + + def self.down + drop_table "open_id_associations" + drop_table "open_id_nonces" + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_upgrade_open_id_store.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_upgrade_open_id_store.rb new file mode 100644 index 00000000..273d285b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/XXX_upgrade_open_id_store.rb @@ -0,0 +1,26 @@ +# Use this migration to upgrade the old 1.1 ActiveRecord store schema +# to the new 2.0 schema. +class UpgradeOpenIdStore < ActiveRecord::Migration + def self.up + drop_table "open_id_settings" + drop_table "open_id_nonces" + create_table "open_id_nonces", :force => true do |t| + t.column :server_url, :string, :null => false + t.column :timestamp, :integer, :null => false + t.column :salt, :string, :null => false + end + end + + def self.down + drop_table "open_id_nonces" + create_table "open_id_nonces", :force => true do |t| + t.column "nonce", :string + t.column "created", :integer + end + + create_table "open_id_settings", :force => true do |t| + t.column "setting", :string + t.column "value", :binary + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/init.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/init.rb new file mode 100644 index 00000000..b625179e --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/init.rb @@ -0,0 +1,8 @@ +# might using the ruby-openid gem +begin + require 'rubygems' +rescue LoadError + nil +end +require 'openid' +require 'openid_ar_store' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/association.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/association.rb new file mode 100644 index 00000000..09eda8b5 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/association.rb @@ -0,0 +1,10 @@ +require 'openid/association' +require 'time' + +class Association < ActiveRecord::Base + set_table_name 'open_id_associations' + def from_record + OpenID::Association.new(handle, secret, Time.at(issued), lifetime, assoc_type) + end +end + diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/nonce.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/nonce.rb new file mode 100644 index 00000000..fcf51530 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/nonce.rb @@ -0,0 +1,3 @@ +class Nonce < ActiveRecord::Base + set_table_name 'open_id_nonces' +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/open_id_setting.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/open_id_setting.rb new file mode 100644 index 00000000..030e4c25 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/open_id_setting.rb @@ -0,0 +1,4 @@ +class OpenIdSetting < ActiveRecord::Base + + validates_uniqueness_of :setting +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/openid_ar_store.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/openid_ar_store.rb new file mode 100644 index 00000000..276569c5 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/lib/openid_ar_store.rb @@ -0,0 +1,57 @@ +require 'association' +require 'nonce' +require 'openid/store/interface' + +# not in OpenID module to avoid namespace conflict +class ActiveRecordStore < OpenID::Store::Interface + def store_association(server_url, assoc) + remove_association(server_url, assoc.handle) + Association.create!(:server_url => server_url, + :handle => assoc.handle, + :secret => assoc.secret, + :issued => assoc.issued.to_i, + :lifetime => assoc.lifetime, + :assoc_type => assoc.assoc_type) + end + + def get_association(server_url, handle=nil) + assocs = if handle.blank? + Association.find_all_by_server_url(server_url) + else + Association.find_all_by_server_url_and_handle(server_url, handle) + end + + assocs.reverse.each do |assoc| + a = assoc.from_record + if a.expires_in == 0 + assoc.destroy + else + return a + end + end if assocs.any? + + return nil + end + + def remove_association(server_url, handle) + Association.delete_all(['server_url = ? AND handle = ?', server_url, handle]) > 0 + end + + def use_nonce(server_url, timestamp, salt) + return false if Nonce.find_by_server_url_and_timestamp_and_salt(server_url, timestamp, salt) + return false if (timestamp - Time.now.to_i).abs > OpenID::Nonce.skew + Nonce.create!(:server_url => server_url, :timestamp => timestamp, :salt => salt) + return true + end + + def cleanup_nonces + now = Time.now.to_i + Nonce.delete_all(["timestamp > ? OR timestamp < ?", now + OpenID::Nonce.skew, now - OpenID::Nonce.skew]) + end + + def cleanup_associations + now = Time.now.to_i + Association.delete_all(['issued + lifetime > ?',now]) + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/test/store_test.rb b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/test/store_test.rb new file mode 100644 index 00000000..8e1986c6 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/active_record_openid_store/test/store_test.rb @@ -0,0 +1,212 @@ +$:.unshift(File.dirname(__FILE__) + '/../lib') +require 'test/unit' +RAILS_ENV = "test" +require File.expand_path(File.join(File.dirname(__FILE__), '../../../../config/environment.rb')) + +module StoreTestCase + @@allowed_handle = '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ!"#$%&\'()*+,-./:;<=>?@[\\]^_`{|}~' + @@allowed_nonce = "0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ" + + def _gen_nonce + OpenID::CryptUtil.random_string(8, @@allowed_nonce) + end + + def _gen_handle(n) + OpenID::CryptUtil.random_string(n, @@allowed_handle) + end + + def _gen_secret(n, chars=nil) + OpenID::CryptUtil.random_string(n, chars) + end + + def _gen_assoc(issued, lifetime=600) + secret = _gen_secret(20) + handle = _gen_handle(128) + OpenID::Association.new(handle, secret, Time.now + issued, lifetime, + 'HMAC-SHA1') + end + + def _check_retrieve(url, handle=nil, expected=nil) + ret_assoc = @store.get_association(url, handle) + + if expected.nil? + assert_nil(ret_assoc) + else + assert_equal(expected, ret_assoc) + assert_equal(expected.handle, ret_assoc.handle) + assert_equal(expected.secret, ret_assoc.secret) + end + end + + def _check_remove(url, handle, expected) + present = @store.remove_association(url, handle) + assert_equal(expected, present) + end + + def test_store + server_url = "http://www.myopenid.com/openid" + assoc = _gen_assoc(issued=0) + + # Make sure that a missing association returns no result + _check_retrieve(server_url) + + # Check that after storage, getting returns the same result + @store.store_association(server_url, assoc) + _check_retrieve(server_url, nil, assoc) + + # more than once + _check_retrieve(server_url, nil, assoc) + + # Storing more than once has no ill effect + @store.store_association(server_url, assoc) + _check_retrieve(server_url, nil, assoc) + + # Removing an association that does not exist returns not present + _check_remove(server_url, assoc.handle + 'x', false) + + # Removing an association that does not exist returns not present + _check_remove(server_url + 'x', assoc.handle, false) + + # Removing an association that is present returns present + _check_remove(server_url, assoc.handle, true) + + # but not present on subsequent calls + _check_remove(server_url, assoc.handle, false) + + # Put assoc back in the store + @store.store_association(server_url, assoc) + + # More recent and expires after assoc + assoc2 = _gen_assoc(issued=1) + @store.store_association(server_url, assoc2) + + # After storing an association with a different handle, but the + # same server_url, the handle with the later expiration is returned. + _check_retrieve(server_url, nil, assoc2) + + # We can still retrieve the older association + _check_retrieve(server_url, assoc.handle, assoc) + + # Plus we can retrieve the association with the later expiration + # explicitly + _check_retrieve(server_url, assoc2.handle, assoc2) + + # More recent, and expires earlier than assoc2 or assoc. Make sure + # that we're picking the one with the latest issued date and not + # taking into account the expiration. + assoc3 = _gen_assoc(issued=2, lifetime=100) + @store.store_association(server_url, assoc3) + + _check_retrieve(server_url, nil, assoc3) + _check_retrieve(server_url, assoc.handle, assoc) + _check_retrieve(server_url, assoc2.handle, assoc2) + _check_retrieve(server_url, assoc3.handle, assoc3) + + _check_remove(server_url, assoc2.handle, true) + + _check_retrieve(server_url, nil, assoc3) + _check_retrieve(server_url, assoc.handle, assoc) + _check_retrieve(server_url, assoc2.handle, nil) + _check_retrieve(server_url, assoc3.handle, assoc3) + + _check_remove(server_url, assoc2.handle, false) + _check_remove(server_url, assoc3.handle, true) + + _check_retrieve(server_url, nil, assoc) + _check_retrieve(server_url, assoc.handle, assoc) + _check_retrieve(server_url, assoc2.handle, nil) + _check_retrieve(server_url, assoc3.handle, nil) + + _check_remove(server_url, assoc2.handle, false) + _check_remove(server_url, assoc.handle, true) + _check_remove(server_url, assoc3.handle, false) + + _check_retrieve(server_url, nil, nil) + _check_retrieve(server_url, assoc.handle, nil) + _check_retrieve(server_url, assoc2.handle, nil) + _check_retrieve(server_url, assoc3.handle, nil) + + _check_remove(server_url, assoc2.handle, false) + _check_remove(server_url, assoc.handle, false) + _check_remove(server_url, assoc3.handle, false) + + assocValid1 = _gen_assoc(-3600, 7200) + assocValid2 = _gen_assoc(-5) + assocExpired1 = _gen_assoc(-7200, 3600) + assocExpired2 = _gen_assoc(-7200, 3600) + + @store.cleanup_associations + @store.store_association(server_url + '1', assocValid1) + @store.store_association(server_url + '1', assocExpired1) + @store.store_association(server_url + '2', assocExpired2) + @store.store_association(server_url + '3', assocValid2) + + cleaned = @store.cleanup_associations() + assert_equal(2, cleaned, "cleaned up associations") + end + + def _check_use_nonce(nonce, expected, server_url, msg='') + stamp, salt = OpenID::Nonce::split_nonce(nonce) + actual = @store.use_nonce(server_url, stamp, salt) + assert_equal(expected, actual, msg) + end + + def test_nonce + server_url = "http://www.myopenid.com/openid" + [server_url, ''].each{|url| + nonce1 = OpenID::Nonce::mk_nonce + + _check_use_nonce(nonce1, true, url, "#{url}: nonce allowed by default") + _check_use_nonce(nonce1, false, url, "#{url}: nonce not allowed twice") + _check_use_nonce(nonce1, false, url, "#{url}: nonce not allowed third time") + + # old nonces shouldn't pass + old_nonce = OpenID::Nonce::mk_nonce(3600) + _check_use_nonce(old_nonce, false, url, "Old nonce #{old_nonce.inspect} passed") + + } + + now = Time.now.to_i + old_nonce1 = OpenID::Nonce::mk_nonce(now - 20000) + old_nonce2 = OpenID::Nonce::mk_nonce(now - 10000) + recent_nonce = OpenID::Nonce::mk_nonce(now - 600) + + orig_skew = OpenID::Nonce.skew + OpenID::Nonce.skew = 0 + count = @store.cleanup_nonces + OpenID::Nonce.skew = 1000000 + ts, salt = OpenID::Nonce::split_nonce(old_nonce1) + assert(@store.use_nonce(server_url, ts, salt), "oldnonce1") + ts, salt = OpenID::Nonce::split_nonce(old_nonce2) + assert(@store.use_nonce(server_url, ts, salt), "oldnonce2") + ts, salt = OpenID::Nonce::split_nonce(recent_nonce) + assert(@store.use_nonce(server_url, ts, salt), "recent_nonce") + + + OpenID::Nonce.skew = 1000 + cleaned = @store.cleanup_nonces + assert_equal(2, cleaned, "Cleaned #{cleaned} nonces") + + OpenID::Nonce.skew = 100000 + ts, salt = OpenID::Nonce::split_nonce(old_nonce1) + assert(@store.use_nonce(server_url, ts, salt), "oldnonce1 after cleanup") + ts, salt = OpenID::Nonce::split_nonce(old_nonce2) + assert(@store.use_nonce(server_url, ts, salt), "oldnonce2 after cleanup") + ts, salt = OpenID::Nonce::split_nonce(recent_nonce) + assert(!@store.use_nonce(server_url, ts, salt), "recent_nonce after cleanup") + + OpenID::Nonce.skew = orig_skew + + end +end + + +class TestARStore < Test::Unit::TestCase + include StoreTestCase + + def setup + @store = ActiveRecordStore.new + end + +end + diff --git a/vendor/gems/ruby-openid-2.1.2/examples/discover b/vendor/gems/ruby-openid-2.1.2/examples/discover new file mode 100644 index 00000000..ab985a49 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/discover @@ -0,0 +1,49 @@ +#!/usr/bin/env ruby +require "openid/consumer/discovery" +require 'openid/fetchers' + +OpenID::fetcher_use_env_http_proxy + +$names = [[:server_url, "Server URL "], + [:local_id, "Local ID "], + [:canonical_id, "Canonical ID"], + ] + +def show_services(user_input, normalized, services) + puts " Claimed identifier: #{normalized}" + if services.empty? + puts " No OpenID services found" + puts + else + puts " Discovered services:" + n = 0 + services.each do |service| + n += 1 + puts " #{n}." + $names.each do |meth, name| + val = service.send(meth) + if val + printf(" %s: %s\n", name, val) + end + end + puts " Type URIs:" + for type_uri in service.type_uris + puts " * #{type_uri}" + end + puts + end + end +end + +ARGV.each do |openid_identifier| + puts "=" * 50 + puts "Running discovery on #{openid_identifier}" + begin + normalized_identifier, services = OpenID.discover(openid_identifier) + rescue OpenID::DiscoveryFailure => why + puts "Discovery failed: #{why.message}" + puts + else + show_services(openid_identifier, normalized_identifier, services) + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/README b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/README new file mode 100644 index 00000000..cd9d0ffe --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/README @@ -0,0 +1,153 @@ +== Welcome to Rails + +Rails is a web-application and persistence framework that includes everything +needed to create database-backed web-applications according to the +Model-View-Control pattern of separation. This pattern splits the view (also +called the presentation) into "dumb" templates that are primarily responsible +for inserting pre-built data in between HTML tags. The model contains the +"smart" domain objects (such as Account, Product, Person, Post) that holds all +the business logic and knows how to persist themselves to a database. The +controller handles the incoming requests (such as Save New Account, Update +Product, Show Post) by manipulating the model and directing data to the view. + +In Rails, the model is handled by what's called an object-relational mapping +layer entitled Active Record. This layer allows you to present the data from +database rows as objects and embellish these data objects with business logic +methods. You can read more about Active Record in +link:files/vendor/rails/activerecord/README.html. + +The controller and view are handled by the Action Pack, which handles both +layers by its two parts: Action View and Action Controller. These two layers +are bundled in a single package due to their heavy interdependence. This is +unlike the relationship between the Active Record and Action Pack that is much +more separate. Each of these packages can be used independently outside of +Rails. You can read more about Action Pack in +link:files/vendor/rails/actionpack/README.html. + + +== Getting started + +1. Run the WEBrick servlet: ruby script/server (run with --help for options) + ...or if you have lighttpd installed: ruby script/lighttpd (it's faster) +2. Go to http://localhost:3000/ and get "Congratulations, you've put Ruby on Rails!" +3. Follow the guidelines on the "Congratulations, you've put Ruby on Rails!" screen + + +== Example for Apache conf + + + ServerName rails + DocumentRoot /path/application/public/ + ErrorLog /path/application/log/server.log + + + Options ExecCGI FollowSymLinks + AllowOverride all + Allow from all + Order allow,deny + + + +NOTE: Be sure that CGIs can be executed in that directory as well. So ExecCGI +should be on and ".cgi" should respond. All requests from 127.0.0.1 go +through CGI, so no Apache restart is necessary for changes. All other requests +go through FCGI (or mod_ruby), which requires a restart to show changes. + + +== Debugging Rails + +Have "tail -f" commands running on both the server.log, production.log, and +test.log files. Rails will automatically display debugging and runtime +information to these files. Debugging info will also be shown in the browser +on requests from 127.0.0.1. + + +== Breakpoints + +Breakpoint support is available through the script/breakpointer client. This +means that you can break out of execution at any point in the code, investigate +and change the model, AND then resume execution! Example: + + class WeblogController < ActionController::Base + def index + @posts = Post.find_all + breakpoint "Breaking out from the list" + end + end + +So the controller will accept the action, run the first line, then present you +with a IRB prompt in the breakpointer window. Here you can do things like: + +Executing breakpoint "Breaking out from the list" at .../webrick_server.rb:16 in 'breakpoint' + + >> @posts.inspect + => "[#nil, \"body\"=>nil, \"id\"=>\"1\"}>, + #\"Rails you know!\", \"body\"=>\"Only ten..\", \"id\"=>\"2\"}>]" + >> @posts.first.title = "hello from a breakpoint" + => "hello from a breakpoint" + +...and even better is that you can examine how your runtime objects actually work: + + >> f = @posts.first + => #nil, "body"=>nil, "id"=>"1"}> + >> f. + Display all 152 possibilities? (y or n) + +Finally, when you're ready to resume execution, you press CTRL-D + + +== Console + +You can interact with the domain model by starting the console through script/console. +Here you'll have all parts of the application configured, just like it is when the +application is running. You can inspect domain models, change values, and save to the +database. Starting the script without arguments will launch it in the development environment. +Passing an argument will specify a different environment, like console production. + + +== Description of contents + +app + Holds all the code that's specific to this particular application. + +app/controllers + Holds controllers that should be named like weblog_controller.rb for + automated URL mapping. All controllers should descend from + ActionController::Base. + +app/models + Holds models that should be named like post.rb. + Most models will descend from ActiveRecord::Base. + +app/views + Holds the template files for the view that should be named like + weblog/index.rhtml for the WeblogController#index action. All views use eRuby + syntax. This directory can also be used to keep stylesheets, images, and so on + that can be symlinked to public. + +app/helpers + Holds view helpers that should be named like weblog_helper.rb. + +config + Configuration files for the Rails environment, the routing map, the database, and other dependencies. + +components + Self-contained mini-applications that can bundle together controllers, models, and views. + +lib + Application specific libraries. Basically, any kind of custom code that doesn't + belong under controllers, models, or helpers. This directory is in the load path. + +public + The directory available for the web server. Contains subdirectories for images, stylesheets, + and javascripts. Also contains the dispatchers and the default HTML files. + +script + Helper scripts for automation and generation. + +test + Unit and functional tests along with fixtures. + +vendor + External libraries that the application depends on. Also includes the plugins subdirectory. + This directory is in the load path. diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/Rakefile b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/Rakefile new file mode 100644 index 00000000..cffd19f0 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/Rakefile @@ -0,0 +1,10 @@ +# Add your own tasks in files placed in lib/tasks ending in .rake, +# for example lib/tasks/switchtower.rake, and they will automatically be available to Rake. + +require(File.join(File.dirname(__FILE__), 'config', 'boot')) + +require 'rake' +require 'rake/testtask' +require 'rake/rdoctask' + +require 'tasks/rails' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/application.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/application.rb new file mode 100644 index 00000000..537de40d --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/application.rb @@ -0,0 +1,4 @@ +# Filters added to this controller will be run for all controllers in the application. +# Likewise, all the methods added will be available for all controllers. +class ApplicationController < ActionController::Base +end \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/consumer_controller.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/consumer_controller.rb new file mode 100644 index 00000000..37dd3bbd --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/consumer_controller.rb @@ -0,0 +1,122 @@ +require 'pathname' + +require "openid" +require 'openid/extensions/sreg' +require 'openid/extensions/pape' +require 'openid/store/filesystem' + +class ConsumerController < ApplicationController + layout nil + + def index + # render an openid form + end + + def start + begin + identifier = params[:openid_identifier] + if identifier.nil? + flash[:error] = "Enter an OpenID identifier" + redirect_to :action => 'index' + return + end + oidreq = consumer.begin(identifier) + rescue OpenID::OpenIDError => e + flash[:error] = "Discovery failed for #{identifier}: #{e}" + redirect_to :action => 'index' + return + end + if params[:use_sreg] + sregreq = OpenID::SReg::Request.new + # required fields + sregreq.request_fields(['email','nickname'], true) + # optional fields + sregreq.request_fields(['dob', 'fullname'], false) + oidreq.add_extension(sregreq) + oidreq.return_to_args['did_sreg'] = 'y' + end + if params[:use_pape] + papereq = OpenID::PAPE::Request.new + papereq.add_policy_uri(OpenID::PAPE::AUTH_PHISHING_RESISTANT) + papereq.max_auth_age = 2*60*60 + oidreq.add_extension(papereq) + oidreq.return_to_args['did_pape'] = 'y' + end + if params[:force_post] + oidreq.return_to_args['force_post']='x'*2048 + end + return_to = url_for :action => 'complete', :only_path => false + realm = url_for :action => 'index', :only_path => false + + if oidreq.send_redirect?(realm, return_to, params[:immediate]) + redirect_to oidreq.redirect_url(realm, return_to, params[:immediate]) + else + render :text => oidreq.html_markup(realm, return_to, params[:immediate], {'id' => 'openid_form'}) + end + end + + def complete + # FIXME - url_for some action is not necessarily the current URL. + current_url = url_for(:action => 'complete', :only_path => false) + parameters = params.reject{|k,v|request.path_parameters[k]} + oidresp = consumer.complete(parameters, current_url) + case oidresp.status + when OpenID::Consumer::FAILURE + if oidresp.display_identifier + flash[:error] = ("Verification of #{oidresp.display_identifier}"\ + " failed: #{oidresp.message}") + else + flash[:error] = "Verification failed: #{oidresp.message}" + end + when OpenID::Consumer::SUCCESS + flash[:success] = ("Verification of #{oidresp.display_identifier}"\ + " succeeded.") + if params[:did_sreg] + sreg_resp = OpenID::SReg::Response.from_success_response(oidresp) + sreg_message = "Simple Registration data was requested" + if sreg_resp.empty? + sreg_message << ", but none was returned." + else + sreg_message << ". The following data were sent:" + sreg_resp.data.each {|k,v| + sreg_message << "
    #{k}: #{v}" + } + end + flash[:sreg_results] = sreg_message + end + if params[:did_pape] + pape_resp = OpenID::PAPE::Response.from_success_response(oidresp) + pape_message = "A phishing resistant authentication method was requested" + if pape_resp.auth_policies.member? OpenID::PAPE::AUTH_PHISHING_RESISTANT + pape_message << ", and the server reported one." + else + pape_message << ", but the server did not report one." + end + if pape_resp.auth_time + pape_message << "
    Authentication time: #{pape_resp.auth_time} seconds" + end + if pape_resp.nist_auth_level + pape_message << "
    NIST Auth Level: #{pape_resp.nist_auth_level}" + end + flash[:pape_results] = pape_message + end + when OpenID::Consumer::SETUP_NEEDED + flash[:alert] = "Immediate request failed - Setup Needed" + when OpenID::Consumer::CANCEL + flash[:alert] = "OpenID transaction cancelled." + else + end + redirect_to :action => 'index' + end + + private + + def consumer + if @consumer.nil? + dir = Pathname.new(RAILS_ROOT).join('db').join('cstore') + store = OpenID::Store::Filesystem.new(dir) + @consumer = OpenID::Consumer.new(session, store) + end + return @consumer + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/login_controller.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/login_controller.rb new file mode 100644 index 00000000..ff7c257b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/login_controller.rb @@ -0,0 +1,45 @@ +# Controller for handling the login, logout process for "users" of our +# little server. Users have no password. This is just an example. + +require 'openid' + +class LoginController < ApplicationController + + layout 'server' + + def base_url + url_for(:controller => 'login', :action => nil, :only_path => false) + end + + def index + response.headers['X-XRDS-Location'] = url_for(:controller => "server", + :action => "idp_xrds", + :only_path => false) + @base_url = base_url + # just show the login page + end + + def submit + user = params[:username] + + # if we get a user, log them in by putting their username in + # the session hash. + unless user.nil? + session[:username] = user unless user.nil? + session[:approvals] = [] + flash[:notice] = "Your OpenID URL is #{base_url}user/#{user}

    Proceed to step 2 below." + else + flash[:error] = "Sorry, couldn't log you in. Try again." + end + + redirect_to :action => 'index' + end + + def logout + # delete the username from the session hash + session[:username] = nil + session[:approvals] = nil + redirect_to :action => 'index' + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/server_controller.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/server_controller.rb new file mode 100644 index 00000000..af0b1a7c --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/controllers/server_controller.rb @@ -0,0 +1,265 @@ +require 'pathname' + +# load the openid library, first trying rubygems +#begin +# require "rubygems" +# require_gem "ruby-openid", ">= 1.0" +#rescue LoadError +require "openid" +require "openid/consumer/discovery" +require 'openid/extensions/sreg' +require 'openid/extensions/pape' +require 'openid/store/filesystem' +#end + +class ServerController < ApplicationController + + include ServerHelper + include OpenID::Server + layout nil + + def index + begin + oidreq = server.decode_request(params) + rescue ProtocolError => e + # invalid openid request, so just display a page with an error message + render :text => e.to_s, :status => 500 + return + end + + # no openid.mode was given + unless oidreq + render :text => "This is an OpenID server endpoint." + return + end + + oidresp = nil + + if oidreq.kind_of?(CheckIDRequest) + + identity = oidreq.identity + + if oidreq.id_select + if oidreq.immediate + oidresp = oidreq.answer(false) + elsif session[:username].nil? + # The user hasn't logged in. + show_decision_page(oidreq) + return + else + # Else, set the identity to the one the user is using. + identity = url_for_user + end + end + + if oidresp + nil + elsif self.is_authorized(identity, oidreq.trust_root) + oidresp = oidreq.answer(true, nil, identity) + + # add the sreg response if requested + add_sreg(oidreq, oidresp) + # ditto pape + add_pape(oidreq, oidresp) + + elsif oidreq.immediate + server_url = url_for :action => 'index' + oidresp = oidreq.answer(false, server_url) + + else + show_decision_page(oidreq) + return + end + + else + oidresp = server.handle_request(oidreq) + end + + self.render_response(oidresp) + end + + def show_decision_page(oidreq, message="Do you trust this site with your identity?") + session[:last_oidreq] = oidreq + @oidreq = oidreq + + if message + flash[:notice] = message + end + + render :template => 'server/decide', :layout => 'server' + end + + def user_page + # Yadis content-negotiation: we want to return the xrds if asked for. + accept = request.env['HTTP_ACCEPT'] + + # This is not technically correct, and should eventually be updated + # to do real Accept header parsing and logic. Though I expect it will work + # 99% of the time. + if accept and accept.include?('application/xrds+xml') + user_xrds + return + end + + # content negotiation failed, so just render the user page + xrds_url = url_for(:controller=>'user',:action=>params[:username])+'/xrds' + identity_page = < + + +

    OpenID identity page for #{params[:username]}

    + +EOS + + # Also add the Yadis location header, so that they don't have + # to parse the html unless absolutely necessary. + response.headers['X-XRDS-Location'] = xrds_url + render :text => identity_page + end + + def user_xrds + types = [ + OpenID::OPENID_2_0_TYPE, + OpenID::OPENID_1_0_TYPE, + OpenID::SREG_URI, + ] + + render_xrds(types) + end + + def idp_xrds + types = [ + OpenID::OPENID_IDP_2_0_TYPE, + ] + + render_xrds(types) + end + + def decision + oidreq = session[:last_oidreq] + session[:last_oidreq] = nil + + if params[:yes].nil? + redirect_to oidreq.cancel_url + return + else + id_to_send = params[:id_to_send] + + identity = oidreq.identity + if oidreq.id_select + if id_to_send and id_to_send != "" + session[:username] = id_to_send + session[:approvals] = [] + identity = url_for_user + else + msg = "You must enter a username to in order to send " + + "an identifier to the Relying Party." + show_decision_page(oidreq, msg) + return + end + end + + if session[:approvals] + session[:approvals] << oidreq.trust_root + else + session[:approvals] = [oidreq.trust_root] + end + oidresp = oidreq.answer(true, nil, identity) + add_sreg(oidreq, oidresp) + add_pape(oidreq, oidresp) + return self.render_response(oidresp) + end + end + + protected + + def server + if @server.nil? + server_url = url_for :action => 'index', :only_path => false + dir = Pathname.new(RAILS_ROOT).join('db').join('openid-store') + store = OpenID::Store::Filesystem.new(dir) + @server = Server.new(store, server_url) + end + return @server + end + + def approved(trust_root) + return false if session[:approvals].nil? + return session[:approvals].member?(trust_root) + end + + def is_authorized(identity_url, trust_root) + return (session[:username] and (identity_url == url_for_user) and self.approved(trust_root)) + end + + def render_xrds(types) + type_str = "" + + types.each { |uri| + type_str += "#{uri}\n " + } + + yadis = < + + + + #{type_str} + #{url_for(:controller => 'server', :only_path => false)} + + + +EOS + + response.headers['content-type'] = 'application/xrds+xml' + render :text => yadis + end + + def add_sreg(oidreq, oidresp) + # check for Simple Registration arguments and respond + sregreq = OpenID::SReg::Request.from_openid_request(oidreq) + + return if sregreq.nil? + # In a real application, this data would be user-specific, + # and the user should be asked for permission to release + # it. + sreg_data = { + 'nickname' => session[:username], + 'fullname' => 'Mayor McCheese', + 'email' => 'mayor@example.com' + } + + sregresp = OpenID::SReg::Response.extract_response(sregreq, sreg_data) + oidresp.add_extension(sregresp) + end + + def add_pape(oidreq, oidresp) + papereq = OpenID::PAPE::Request.from_openid_request(oidreq) + return if papereq.nil? + paperesp = OpenID::PAPE::Response.new + paperesp.nist_auth_level = 0 # we don't even do auth at all! + oidresp.add_extension(paperesp) + end + + def render_response(oidresp) + if oidresp.needs_signing + signed_response = server.signatory.sign(oidresp) + end + web_response = server.encode_response(oidresp) + + case web_response.code + when HTTP_OK + render :text => web_response.body, :status => 200 + + when HTTP_REDIRECT + redirect_to web_response.headers['location'] + + else + render :text => web_response.body, :status => 400 + end + end + + +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/application_helper.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/application_helper.rb new file mode 100644 index 00000000..22a7940e --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/application_helper.rb @@ -0,0 +1,3 @@ +# Methods added to this helper will be available to all templates in the application. +module ApplicationHelper +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/login_helper.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/login_helper.rb new file mode 100644 index 00000000..a0418e32 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/login_helper.rb @@ -0,0 +1,2 @@ +module LoginHelper +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/server_helper.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/server_helper.rb new file mode 100644 index 00000000..409b2104 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/helpers/server_helper.rb @@ -0,0 +1,9 @@ + +module ServerHelper + + def url_for_user + url_for :controller => 'user', :action => session[:username] + end + +end + diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/consumer/index.rhtml b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/consumer/index.rhtml new file mode 100644 index 00000000..0cecbe8e --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/consumer/index.rhtml @@ -0,0 +1,81 @@ + + +Rails OpenID Example Relying Party + + + +

    Rails OpenID Example Relying Party

    + <% if flash[:alert] %> +
    + <%= h(flash[:alert]) %> +
    + <% end %> + <% if flash[:error] %> +
    + <%= h(flash[:error]) %> +
    + <% end %> + <% if flash[:success] %> +
    + <%= h(flash[:success]) %> +
    + <% end %> + <% if flash[:sreg_results] %> +
    + <%= flash[:sreg_results] %> +
    + <% end %> + <% if flash[:pape_results] %> +
    + <%= flash[:pape_results] %> +
    + <% end %> +
    +
    '> + Identifier: + +
    +
    +
    +
    + +
    +
    + + diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/layouts/server.rhtml b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/layouts/server.rhtml new file mode 100644 index 00000000..3dd5d786 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/layouts/server.rhtml @@ -0,0 +1,68 @@ + + OpenID Server Example + + + + + + <% if session[:username] %> +
    + Welcome, <%= session[:username] %> | <%= link_to('Log out', :controller => 'login', :action => 'logout') %>
    + <%= @base_url %>user/<%= session[:username] %> +
    + <% end %> + +

    Ruby OpenID Server Example

    + +
    + + <% if flash[:notice] or flash[:error] %> +
    + <%= flash[:error] or flash[:notice] %> +
    + <% end %> + + <%= @content_for_layout %> + + + + diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/login/index.rhtml b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/login/index.rhtml new file mode 100644 index 00000000..9990a575 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/login/index.rhtml @@ -0,0 +1,56 @@ + + +<% if session[:username].nil? %> + +
    +
    +Type a username: + + +
    + +
    + +<% end %> + +

    Welcome to the Ruby OpenID example. This code is a starting point +for developers wishing to implement an OpenID provider or relying +party. We've used the Rails +platform to demonstrate, but the library code is not Rails specific.

    + +

    To use the example provider

    +

    +

      + +
    1. Enter a username in the form above. You will be "Logged In" + to the server, at which point you may authenticate using an OpenID + consumer. Your OpenID URL will be displayed after you log + in.

      The server will automatically create an identity page for + you at <%= @base_url %>user/name

    2. + +
    3. Because WEBrick can only handle one thing at a time, you'll need to + run another instance of the example on another port if you want to use + a relying party to use with this example provider:

      +
      + script/server --port=3001 +
      + +

      (The RP needs to be able to access the provider, so unless you're + running this example on a public IP, you can't use the live example + at openidenabled.com on + your local provider.)

      +
    4. + +
    5. Point your browser to this new instance and follow the directions + below.
    6. + +
    + +

    + +

    To use the example relying party

    + +

    Visit /consumer +and enter your OpenID.

    +

    + diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/server/decide.rhtml b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/server/decide.rhtml new file mode 100644 index 00000000..5322b48a --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/app/views/server/decide.rhtml @@ -0,0 +1,26 @@ +
    + + + + + <% if @oidreq.id_select %> + + + + + + + + <% else %> + + <% end %> +
    Site:<%= @oidreq.trust_root %>
    + You entered the server identifier at the relying party. + You'll need to send an identifier of your choosing. Enter a + username below. +
    Identity to send:
    Identity:<%= @oidreq.identity %>
    + + + + +
    diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/boot.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/boot.rb new file mode 100644 index 00000000..9fcd50fe --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/boot.rb @@ -0,0 +1,19 @@ +# Don't change this file. Configuration is done in config/environment.rb and config/environments/*.rb + +unless defined?(RAILS_ROOT) + root_path = File.join(File.dirname(__FILE__), '..') + unless RUBY_PLATFORM =~ /mswin32/ + require 'pathname' + root_path = Pathname.new(root_path).cleanpath(true).to_s + end + RAILS_ROOT = root_path +end + +if File.directory?("#{RAILS_ROOT}/vendor/rails") + require "#{RAILS_ROOT}/vendor/rails/railties/lib/initializer" +else + require 'rubygems' + require 'initializer' +end + +Rails::Initializer.run(:set_load_path) diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/database.yml b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/database.yml new file mode 100644 index 00000000..1b2eb82d --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/database.yml @@ -0,0 +1,74 @@ +# MySQL (default setup). Versions 4.1 and 5.0 are recommended. +# +# Get the fast C bindings: +# gem install mysql +# (on OS X: gem install mysql -- --include=/usr/local/lib) +# And be sure to use new-style password hashing: +# http://dev.mysql.com/doc/refman/5.0/en/old-client.html +development: + adapter: sqlite3 + database: db/development.sqlite3 + +# Warning: The database defined as 'test' will be erased and +# re-generated from your development database when you run 'rake'. +# Do not set this db to the same as development or production. +test: + adapter: sqlite3 + database: ":memory:" + +production: + adapter: mysql + database: rails_server_production + username: root + password: + socket: /path/to/your/mysql.sock + + +# PostgreSQL versions 7.4 - 8.1 +# +# Get the C bindings: +# gem install postgres +# or use the pure-Ruby bindings on Windows: +# gem install postgres-pr +postgresql_example: + adapter: postgresql + database: rails_server_development + username: rails_server + password: + + # Connect on a TCP socket. Omitted by default since the client uses a + # domain socket that doesn't need configuration. + #host: remote-database + #port: 5432 + + # Schema search path. The server defaults to $user,public + #schema_search_path: myapp,sharedapp,public + + # Character set encoding. The server defaults to sql_ascii. + #encoding: UTF8 + + # Minimum log levels, in increasing order: + # debug5, debug4, debug3, debug2, debug1, + # info, notice, warning, error, log, fatal, or panic + # The server defaults to notice. + #min_messages: warning + + +# SQLite version 2.x +# gem install sqlite-ruby +sqlite_example: + adapter: sqlite + database: db/development.sqlite2 + + +# SQLite version 3.x +# gem install sqlite3-ruby +sqlite3_example: + adapter: sqlite3 + database: db/development.sqlite3 + + +# In-memory SQLite 3 database. Useful for tests. +sqlite3_in_memory_example: + adapter: sqlite3 + database: ":memory:" \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environment.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environment.rb new file mode 100644 index 00000000..0a78bf83 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environment.rb @@ -0,0 +1,54 @@ +# Be sure to restart your web server when you modify this file. + +# Uncomment below to force Rails into production mode when +# you don't control web/app server and can't set it the proper way +# ENV['RAILS_ENV'] ||= 'production' + +# Bootstrap the Rails environment, frameworks, and default configuration +require File.join(File.dirname(__FILE__), 'boot') + +Rails::Initializer.run do |config| + # Settings in config/environments/* take precedence those specified here + + # Skip frameworks you're not going to use + # config.frameworks -= [ :action_web_service, :action_mailer ] + + # Add additional load paths for your own custom dirs + # config.load_paths += %W( #{RAILS_ROOT}/extras ) + + # Force all environments to use the same logger level + # (by default production uses :info, the others :debug) + # config.log_level = :debug + + # Use the database for sessions instead of the file system + # (create the session table with 'rake create_sessions_table') + # config.action_controller.session_store = :active_record_store + + # Enable page/fragment caching by setting a file-based store + # (remember to create the caching directory and make it readable to the application) + # config.action_controller.fragment_cache_store = :file_store, "#{RAILS_ROOT}/cache" + + # Activate observers that should always be running + # config.active_record.observers = :cacher, :garbage_collector + + # Make Active Record use UTC-base instead of local time + # config.active_record.default_timezone = :utc + + # Use Active Record's schema dumper instead of SQL when creating the test database + # (enables use of different database adapters for development and test environments) + # config.active_record.schema_format = :ruby + + # See Rails::Configuration for more options +end + +# Add new inflection rules using the following format +# (all these examples are active by default): +# Inflector.inflections do |inflect| +# inflect.plural /^(ox)$/i, '\1en' +# inflect.singular /^(ox)en/i, '\1' +# inflect.irregular 'person', 'people' +# inflect.uncountable %w( fish sheep ) +# end + +# Include your application configuration below +ActionController::CgiRequest::DEFAULT_SESSION_OPTIONS[:session_key] = '_session_id_2' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/development.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/development.rb new file mode 100644 index 00000000..04b77920 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/development.rb @@ -0,0 +1,19 @@ +# Settings specified here will take precedence over those in config/environment.rb + +# In the development environment your application's code is reloaded on +# every request. This slows down response time but is perfect for development +# since you don't have to restart the webserver when you make code changes. +config.cache_classes = false + +# Log error messages when you accidentally call methods on nil. +config.whiny_nils = true + +# Enable the breakpoint server that script/breakpointer connects to +config.breakpoint_server = true + +# Show full error reports and disable caching +config.action_controller.consider_all_requests_local = true +config.action_controller.perform_caching = false + +# Don't care if the mailer can't send +config.action_mailer.raise_delivery_errors = false diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/production.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/production.rb new file mode 100644 index 00000000..c9a4396c --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/production.rb @@ -0,0 +1,19 @@ +# Settings specified here will take precedence over those in config/environment.rb + +# The production environment is meant for finished, "live" apps. +# Code is not reloaded between requests +config.cache_classes = true + +# Use a different logger for distributed setups +# config.logger = SyslogLogger.new + + +# Full error reports are disabled and caching is turned on +config.action_controller.consider_all_requests_local = false +config.action_controller.perform_caching = true + +# Enable serving of images, stylesheets, and javascripts from an asset server +# config.action_controller.asset_host = "http://assets.example.com" + +# Disable delivery errors if you bad email addresses should just be ignored +# config.action_mailer.raise_delivery_errors = false diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/test.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/test.rb new file mode 100644 index 00000000..6a4cddbd --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/environments/test.rb @@ -0,0 +1,19 @@ +# Settings specified here will take precedence over those in config/environment.rb + +# The test environment is used exclusively to run your application's +# test suite. You never need to work with it otherwise. Remember that +# your test database is "scratch space" for the test suite and is wiped +# and recreated between test runs. Don't rely on the data there! +config.cache_classes = true + +# Log error messages when you accidentally call methods on nil. +config.whiny_nils = true + +# Show full error reports and disable caching +config.action_controller.consider_all_requests_local = true +config.action_controller.perform_caching = false + +# Tell ActionMailer not to deliver emails to the real world. +# The :test delivery method accumulates sent emails in the +# ActionMailer::Base.deliveries array. +config.action_mailer.delivery_method = :test \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/routes.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/routes.rb new file mode 100644 index 00000000..d5ceed20 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/config/routes.rb @@ -0,0 +1,24 @@ +ActionController::Routing::Routes.draw do |map| + # Add your own custom routes here. + # The priority is based upon order of creation: first created -> highest priority. + + # Here's a sample route: + # map.connect 'products/:id', :controller => 'catalog', :action => 'view' + # Keep in mind you can assign values other than :controller and :action + + # You can have the root of your site routed by hooking up '' + # -- just remember to delete public/index.html. + # map.connect '', :controller => "welcome" + + map.connect '', :controller => 'login' + map.connect 'server/xrds', :controller => 'server', :action => 'idp_xrds' + map.connect 'user/:username', :controller => 'server', :action => 'user_page' + map.connect 'user/:username/xrds', :controller => 'server', :action => 'user_xrds' + + # Allow downloading Web Service WSDL as a file with an extension + # instead of a file named 'wsdl' + map.connect ':controller/service.wsdl', :action => 'wsdl' + + # Install the default route as the lowest priority. + map.connect ':controller/:action/:id' +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/doc/README_FOR_APP b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/doc/README_FOR_APP new file mode 100644 index 00000000..ac6c1491 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/doc/README_FOR_APP @@ -0,0 +1,2 @@ +Use this README file to introduce your application and point to useful places in the API for learning more. +Run "rake appdoc" to generate API documentation for your models and controllers. \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/404.html b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/404.html new file mode 100644 index 00000000..0e184561 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/404.html @@ -0,0 +1,8 @@ + + + +

    File not found

    +

    Change this error message for pages not found in public/404.html

    + + \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/500.html b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/500.html new file mode 100644 index 00000000..a1001a00 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/500.html @@ -0,0 +1,8 @@ + + + +

    Application error (Apache)

    +

    Change this error message for exceptions thrown outside of an action (like in Dispatcher setups or broken Ruby code) in public/500.html

    + + \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.cgi b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.cgi new file mode 100644 index 00000000..dfe5dc30 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.cgi @@ -0,0 +1,12 @@ +#!/usr/bin/ruby1.8 + +#!/usr/local/bin/ruby + +require File.dirname(__FILE__) + "/../config/environment" unless defined?(RAILS_ROOT) + +# If you're using RubyGems and mod_ruby, this require should be changed to an absolute path one, like: +# "/usr/local/lib/ruby/gems/1.8/gems/rails-0.8.0/lib/dispatcher" -- otherwise performance is severely impaired +require "dispatcher" + +ADDITIONAL_LOAD_PATHS.reverse.each { |dir| $:.unshift(dir) if File.directory?(dir) } if defined?(Apache::RubyRun) +Dispatcher.dispatch \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.fcgi b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.fcgi new file mode 100644 index 00000000..d02c35b8 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.fcgi @@ -0,0 +1,26 @@ +#!/usr/bin/ruby1.8 + +#!/usr/local/bin/ruby +# +# You may specify the path to the FastCGI crash log (a log of unhandled +# exceptions which forced the FastCGI instance to exit, great for debugging) +# and the number of requests to process before running garbage collection. +# +# By default, the FastCGI crash log is RAILS_ROOT/log/fastcgi.crash.log +# and the GC period is nil (turned off). A reasonable number of requests +# could range from 10-100 depending on the memory footprint of your app. +# +# Example: +# # Default log path, normal GC behavior. +# RailsFCGIHandler.process! +# +# # Default log path, 50 requests between GC. +# RailsFCGIHandler.process! nil, 50 +# +# # Custom log path, normal GC behavior. +# RailsFCGIHandler.process! '/var/log/myapp_fcgi_crash.log' +# +require File.dirname(__FILE__) + "/../config/environment" +require 'fcgi_handler' + +RailsFCGIHandler.process! diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.rb new file mode 100644 index 00000000..dfe5dc30 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/dispatch.rb @@ -0,0 +1,12 @@ +#!/usr/bin/ruby1.8 + +#!/usr/local/bin/ruby + +require File.dirname(__FILE__) + "/../config/environment" unless defined?(RAILS_ROOT) + +# If you're using RubyGems and mod_ruby, this require should be changed to an absolute path one, like: +# "/usr/local/lib/ruby/gems/1.8/gems/rails-0.8.0/lib/dispatcher" -- otherwise performance is severely impaired +require "dispatcher" + +ADDITIONAL_LOAD_PATHS.reverse.each { |dir| $:.unshift(dir) if File.directory?(dir) } if defined?(Apache::RubyRun) +Dispatcher.dispatch \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/favicon.ico b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/favicon.ico new file mode 100644 index 00000000..e69de29b diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/images/openid_login_bg.gif b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/images/openid_login_bg.gif new file mode 100644 index 0000000000000000000000000000000000000000..cde836c893f64bcfec04b9c817e3371ff122fe19 GIT binary patch literal 237 zcmVb{bmUKcqz}))c5uC(7v?)v4a2P)ZNa- z@$&T2)z|&~{r~^}A^8LV00000EC2ui01yBW000GQ;3tk`X`bk)Wk@<6#nZYULKH{p zEx|?+kif!I0vIL|#ZMubBmjWH2OtmxIFVa~6JQ7!1CK!f5W#StOTv&C3=E8h2vI1s n+#cd5;2fT3B_0kF0v!+!GARoV78n&7dMN`JIW(4+BOw4gP{MS* literal 0 HcmV?d00001 diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/controls.js b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/controls.js new file mode 100644 index 00000000..9742b691 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/controls.js @@ -0,0 +1,750 @@ +// Copyright (c) 2005 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) +// (c) 2005 Ivan Krstic (http://blogs.law.harvard.edu/ivan) +// (c) 2005 Jon Tirsen (http://www.tirsen.com) +// Contributors: +// Richard Livsey +// Rahul Bhargava +// Rob Wills +// +// See scriptaculous.js for full license. + +// Autocompleter.Base handles all the autocompletion functionality +// that's independent of the data source for autocompletion. This +// includes drawing the autocompletion menu, observing keyboard +// and mouse events, and similar. +// +// Specific autocompleters need to provide, at the very least, +// a getUpdatedChoices function that will be invoked every time +// the text inside the monitored textbox changes. This method +// should get the text for which to provide autocompletion by +// invoking this.getToken(), NOT by directly accessing +// this.element.value. This is to allow incremental tokenized +// autocompletion. Specific auto-completion logic (AJAX, etc) +// belongs in getUpdatedChoices. +// +// Tokenized incremental autocompletion is enabled automatically +// when an autocompleter is instantiated with the 'tokens' option +// in the options parameter, e.g.: +// new Ajax.Autocompleter('id','upd', '/url/', { tokens: ',' }); +// will incrementally autocomplete with a comma as the token. +// Additionally, ',' in the above example can be replaced with +// a token array, e.g. { tokens: [',', '\n'] } which +// enables autocompletion on multiple tokens. This is most +// useful when one of the tokens is \n (a newline), as it +// allows smart autocompletion after linebreaks. + +var Autocompleter = {} +Autocompleter.Base = function() {}; +Autocompleter.Base.prototype = { + baseInitialize: function(element, update, options) { + this.element = $(element); + this.update = $(update); + this.hasFocus = false; + this.changed = false; + this.active = false; + this.index = 0; + this.entryCount = 0; + + if (this.setOptions) + this.setOptions(options); + else + this.options = options || {}; + + this.options.paramName = this.options.paramName || this.element.name; + this.options.tokens = this.options.tokens || []; + this.options.frequency = this.options.frequency || 0.4; + this.options.minChars = this.options.minChars || 1; + this.options.onShow = this.options.onShow || + function(element, update){ + if(!update.style.position || update.style.position=='absolute') { + update.style.position = 'absolute'; + Position.clone(element, update, {setHeight: false, offsetTop: element.offsetHeight}); + } + Effect.Appear(update,{duration:0.15}); + }; + this.options.onHide = this.options.onHide || + function(element, update){ new Effect.Fade(update,{duration:0.15}) }; + + if (typeof(this.options.tokens) == 'string') + this.options.tokens = new Array(this.options.tokens); + + this.observer = null; + + this.element.setAttribute('autocomplete','off'); + + Element.hide(this.update); + + Event.observe(this.element, "blur", this.onBlur.bindAsEventListener(this)); + Event.observe(this.element, "keypress", this.onKeyPress.bindAsEventListener(this)); + }, + + show: function() { + if(Element.getStyle(this.update, 'display')=='none') this.options.onShow(this.element, this.update); + if(!this.iefix && + (navigator.appVersion.indexOf('MSIE')>0) && + (navigator.userAgent.indexOf('Opera')<0) && + (Element.getStyle(this.update, 'position')=='absolute')) { + new Insertion.After(this.update, + ''); + this.iefix = $(this.update.id+'_iefix'); + } + if(this.iefix) setTimeout(this.fixIEOverlapping.bind(this), 50); + }, + + fixIEOverlapping: function() { + Position.clone(this.update, this.iefix); + this.iefix.style.zIndex = 1; + this.update.style.zIndex = 2; + Element.show(this.iefix); + }, + + hide: function() { + this.stopIndicator(); + if(Element.getStyle(this.update, 'display')!='none') this.options.onHide(this.element, this.update); + if(this.iefix) Element.hide(this.iefix); + }, + + startIndicator: function() { + if(this.options.indicator) Element.show(this.options.indicator); + }, + + stopIndicator: function() { + if(this.options.indicator) Element.hide(this.options.indicator); + }, + + onKeyPress: function(event) { + if(this.active) + switch(event.keyCode) { + case Event.KEY_TAB: + case Event.KEY_RETURN: + this.selectEntry(); + Event.stop(event); + case Event.KEY_ESC: + this.hide(); + this.active = false; + Event.stop(event); + return; + case Event.KEY_LEFT: + case Event.KEY_RIGHT: + return; + case Event.KEY_UP: + this.markPrevious(); + this.render(); + if(navigator.appVersion.indexOf('AppleWebKit')>0) Event.stop(event); + return; + case Event.KEY_DOWN: + this.markNext(); + this.render(); + if(navigator.appVersion.indexOf('AppleWebKit')>0) Event.stop(event); + return; + } + else + if(event.keyCode==Event.KEY_TAB || event.keyCode==Event.KEY_RETURN) + return; + + this.changed = true; + this.hasFocus = true; + + if(this.observer) clearTimeout(this.observer); + this.observer = + setTimeout(this.onObserverEvent.bind(this), this.options.frequency*1000); + }, + + onHover: function(event) { + var element = Event.findElement(event, 'LI'); + if(this.index != element.autocompleteIndex) + { + this.index = element.autocompleteIndex; + this.render(); + } + Event.stop(event); + }, + + onClick: function(event) { + var element = Event.findElement(event, 'LI'); + this.index = element.autocompleteIndex; + this.selectEntry(); + this.hide(); + }, + + onBlur: function(event) { + // needed to make click events working + setTimeout(this.hide.bind(this), 250); + this.hasFocus = false; + this.active = false; + }, + + render: function() { + if(this.entryCount > 0) { + for (var i = 0; i < this.entryCount; i++) + this.index==i ? + Element.addClassName(this.getEntry(i),"selected") : + Element.removeClassName(this.getEntry(i),"selected"); + + if(this.hasFocus) { + this.show(); + this.active = true; + } + } else { + this.active = false; + this.hide(); + } + }, + + markPrevious: function() { + if(this.index > 0) this.index-- + else this.index = this.entryCount-1; + }, + + markNext: function() { + if(this.index < this.entryCount-1) this.index++ + else this.index = 0; + }, + + getEntry: function(index) { + return this.update.firstChild.childNodes[index]; + }, + + getCurrentEntry: function() { + return this.getEntry(this.index); + }, + + selectEntry: function() { + this.active = false; + this.updateElement(this.getCurrentEntry()); + }, + + updateElement: function(selectedElement) { + if (this.options.updateElement) { + this.options.updateElement(selectedElement); + return; + } + + var value = Element.collectTextNodesIgnoreClass(selectedElement, 'informal'); + var lastTokenPos = this.findLastToken(); + if (lastTokenPos != -1) { + var newValue = this.element.value.substr(0, lastTokenPos + 1); + var whitespace = this.element.value.substr(lastTokenPos + 1).match(/^\s+/); + if (whitespace) + newValue += whitespace[0]; + this.element.value = newValue + value; + } else { + this.element.value = value; + } + this.element.focus(); + + if (this.options.afterUpdateElement) + this.options.afterUpdateElement(this.element, selectedElement); + }, + + updateChoices: function(choices) { + if(!this.changed && this.hasFocus) { + this.update.innerHTML = choices; + Element.cleanWhitespace(this.update); + Element.cleanWhitespace(this.update.firstChild); + + if(this.update.firstChild && this.update.firstChild.childNodes) { + this.entryCount = + this.update.firstChild.childNodes.length; + for (var i = 0; i < this.entryCount; i++) { + var entry = this.getEntry(i); + entry.autocompleteIndex = i; + this.addObservers(entry); + } + } else { + this.entryCount = 0; + } + + this.stopIndicator(); + + this.index = 0; + this.render(); + } + }, + + addObservers: function(element) { + Event.observe(element, "mouseover", this.onHover.bindAsEventListener(this)); + Event.observe(element, "click", this.onClick.bindAsEventListener(this)); + }, + + onObserverEvent: function() { + this.changed = false; + if(this.getToken().length>=this.options.minChars) { + this.startIndicator(); + this.getUpdatedChoices(); + } else { + this.active = false; + this.hide(); + } + }, + + getToken: function() { + var tokenPos = this.findLastToken(); + if (tokenPos != -1) + var ret = this.element.value.substr(tokenPos + 1).replace(/^\s+/,'').replace(/\s+$/,''); + else + var ret = this.element.value; + + return /\n/.test(ret) ? '' : ret; + }, + + findLastToken: function() { + var lastTokenPos = -1; + + for (var i=0; i lastTokenPos) + lastTokenPos = thisTokenPos; + } + return lastTokenPos; + } +} + +Ajax.Autocompleter = Class.create(); +Object.extend(Object.extend(Ajax.Autocompleter.prototype, Autocompleter.Base.prototype), { + initialize: function(element, update, url, options) { + this.baseInitialize(element, update, options); + this.options.asynchronous = true; + this.options.onComplete = this.onComplete.bind(this); + this.options.defaultParams = this.options.parameters || null; + this.url = url; + }, + + getUpdatedChoices: function() { + entry = encodeURIComponent(this.options.paramName) + '=' + + encodeURIComponent(this.getToken()); + + this.options.parameters = this.options.callback ? + this.options.callback(this.element, entry) : entry; + + if(this.options.defaultParams) + this.options.parameters += '&' + this.options.defaultParams; + + new Ajax.Request(this.url, this.options); + }, + + onComplete: function(request) { + this.updateChoices(request.responseText); + } + +}); + +// The local array autocompleter. Used when you'd prefer to +// inject an array of autocompletion options into the page, rather +// than sending out Ajax queries, which can be quite slow sometimes. +// +// The constructor takes four parameters. The first two are, as usual, +// the id of the monitored textbox, and id of the autocompletion menu. +// The third is the array you want to autocomplete from, and the fourth +// is the options block. +// +// Extra local autocompletion options: +// - choices - How many autocompletion choices to offer +// +// - partialSearch - If false, the autocompleter will match entered +// text only at the beginning of strings in the +// autocomplete array. Defaults to true, which will +// match text at the beginning of any *word* in the +// strings in the autocomplete array. If you want to +// search anywhere in the string, additionally set +// the option fullSearch to true (default: off). +// +// - fullSsearch - Search anywhere in autocomplete array strings. +// +// - partialChars - How many characters to enter before triggering +// a partial match (unlike minChars, which defines +// how many characters are required to do any match +// at all). Defaults to 2. +// +// - ignoreCase - Whether to ignore case when autocompleting. +// Defaults to true. +// +// It's possible to pass in a custom function as the 'selector' +// option, if you prefer to write your own autocompletion logic. +// In that case, the other options above will not apply unless +// you support them. + +Autocompleter.Local = Class.create(); +Autocompleter.Local.prototype = Object.extend(new Autocompleter.Base(), { + initialize: function(element, update, array, options) { + this.baseInitialize(element, update, options); + this.options.array = array; + }, + + getUpdatedChoices: function() { + this.updateChoices(this.options.selector(this)); + }, + + setOptions: function(options) { + this.options = Object.extend({ + choices: 10, + partialSearch: true, + partialChars: 2, + ignoreCase: true, + fullSearch: false, + selector: function(instance) { + var ret = []; // Beginning matches + var partial = []; // Inside matches + var entry = instance.getToken(); + var count = 0; + + for (var i = 0; i < instance.options.array.length && + ret.length < instance.options.choices ; i++) { + + var elem = instance.options.array[i]; + var foundPos = instance.options.ignoreCase ? + elem.toLowerCase().indexOf(entry.toLowerCase()) : + elem.indexOf(entry); + + while (foundPos != -1) { + if (foundPos == 0 && elem.length != entry.length) { + ret.push("
  • " + elem.substr(0, entry.length) + "" + + elem.substr(entry.length) + "
  • "); + break; + } else if (entry.length >= instance.options.partialChars && + instance.options.partialSearch && foundPos != -1) { + if (instance.options.fullSearch || /\s/.test(elem.substr(foundPos-1,1))) { + partial.push("
  • " + elem.substr(0, foundPos) + "" + + elem.substr(foundPos, entry.length) + "" + elem.substr( + foundPos + entry.length) + "
  • "); + break; + } + } + + foundPos = instance.options.ignoreCase ? + elem.toLowerCase().indexOf(entry.toLowerCase(), foundPos + 1) : + elem.indexOf(entry, foundPos + 1); + + } + } + if (partial.length) + ret = ret.concat(partial.slice(0, instance.options.choices - ret.length)) + return "
      " + ret.join('') + "
    "; + } + }, options || {}); + } +}); + +// AJAX in-place editor +// +// see documentation on http://wiki.script.aculo.us/scriptaculous/show/Ajax.InPlaceEditor + +// Use this if you notice weird scrolling problems on some browsers, +// the DOM might be a bit confused when this gets called so do this +// waits 1 ms (with setTimeout) until it does the activation +Field.scrollFreeActivate = function(field) { + setTimeout(function() { + Field.activate(field); + }, 1); +} + +Ajax.InPlaceEditor = Class.create(); +Ajax.InPlaceEditor.defaultHighlightColor = "#FFFF99"; +Ajax.InPlaceEditor.prototype = { + initialize: function(element, url, options) { + this.url = url; + this.element = $(element); + + this.options = Object.extend({ + okText: "ok", + cancelText: "cancel", + savingText: "Saving...", + clickToEditText: "Click to edit", + okText: "ok", + rows: 1, + onComplete: function(transport, element) { + new Effect.Highlight(element, {startcolor: this.options.highlightcolor}); + }, + onFailure: function(transport) { + alert("Error communicating with the server: " + transport.responseText.stripTags()); + }, + callback: function(form) { + return Form.serialize(form); + }, + handleLineBreaks: true, + loadingText: 'Loading...', + savingClassName: 'inplaceeditor-saving', + loadingClassName: 'inplaceeditor-loading', + formClassName: 'inplaceeditor-form', + highlightcolor: Ajax.InPlaceEditor.defaultHighlightColor, + highlightendcolor: "#FFFFFF", + externalControl: null, + ajaxOptions: {} + }, options || {}); + + if(!this.options.formId && this.element.id) { + this.options.formId = this.element.id + "-inplaceeditor"; + if ($(this.options.formId)) { + // there's already a form with that name, don't specify an id + this.options.formId = null; + } + } + + if (this.options.externalControl) { + this.options.externalControl = $(this.options.externalControl); + } + + this.originalBackground = Element.getStyle(this.element, 'background-color'); + if (!this.originalBackground) { + this.originalBackground = "transparent"; + } + + this.element.title = this.options.clickToEditText; + + this.onclickListener = this.enterEditMode.bindAsEventListener(this); + this.mouseoverListener = this.enterHover.bindAsEventListener(this); + this.mouseoutListener = this.leaveHover.bindAsEventListener(this); + Event.observe(this.element, 'click', this.onclickListener); + Event.observe(this.element, 'mouseover', this.mouseoverListener); + Event.observe(this.element, 'mouseout', this.mouseoutListener); + if (this.options.externalControl) { + Event.observe(this.options.externalControl, 'click', this.onclickListener); + Event.observe(this.options.externalControl, 'mouseover', this.mouseoverListener); + Event.observe(this.options.externalControl, 'mouseout', this.mouseoutListener); + } + }, + enterEditMode: function(evt) { + if (this.saving) return; + if (this.editing) return; + this.editing = true; + this.onEnterEditMode(); + if (this.options.externalControl) { + Element.hide(this.options.externalControl); + } + Element.hide(this.element); + this.createForm(); + this.element.parentNode.insertBefore(this.form, this.element); + Field.scrollFreeActivate(this.editField); + // stop the event to avoid a page refresh in Safari + if (evt) { + Event.stop(evt); + } + return false; + }, + createForm: function() { + this.form = document.createElement("form"); + this.form.id = this.options.formId; + Element.addClassName(this.form, this.options.formClassName) + this.form.onsubmit = this.onSubmit.bind(this); + + this.createEditField(); + + if (this.options.textarea) { + var br = document.createElement("br"); + this.form.appendChild(br); + } + + okButton = document.createElement("input"); + okButton.type = "submit"; + okButton.value = this.options.okText; + this.form.appendChild(okButton); + + cancelLink = document.createElement("a"); + cancelLink.href = "#"; + cancelLink.appendChild(document.createTextNode(this.options.cancelText)); + cancelLink.onclick = this.onclickCancel.bind(this); + this.form.appendChild(cancelLink); + }, + hasHTMLLineBreaks: function(string) { + if (!this.options.handleLineBreaks) return false; + return string.match(/
    /i); + }, + convertHTMLLineBreaks: function(string) { + return string.replace(/
    /gi, "\n").replace(//gi, "\n").replace(/<\/p>/gi, "\n").replace(/

    /gi, ""); + }, + createEditField: function() { + var text; + if(this.options.loadTextURL) { + text = this.options.loadingText; + } else { + text = this.getText(); + } + + if (this.options.rows == 1 && !this.hasHTMLLineBreaks(text)) { + this.options.textarea = false; + var textField = document.createElement("input"); + textField.type = "text"; + textField.name = "value"; + textField.value = text; + textField.style.backgroundColor = this.options.highlightcolor; + var size = this.options.size || this.options.cols || 0; + if (size != 0) textField.size = size; + this.editField = textField; + } else { + this.options.textarea = true; + var textArea = document.createElement("textarea"); + textArea.name = "value"; + textArea.value = this.convertHTMLLineBreaks(text); + textArea.rows = this.options.rows; + textArea.cols = this.options.cols || 40; + this.editField = textArea; + } + + if(this.options.loadTextURL) { + this.loadExternalText(); + } + this.form.appendChild(this.editField); + }, + getText: function() { + return this.element.innerHTML; + }, + loadExternalText: function() { + Element.addClassName(this.form, this.options.loadingClassName); + this.editField.disabled = true; + new Ajax.Request( + this.options.loadTextURL, + Object.extend({ + asynchronous: true, + onComplete: this.onLoadedExternalText.bind(this) + }, this.options.ajaxOptions) + ); + }, + onLoadedExternalText: function(transport) { + Element.removeClassName(this.form, this.options.loadingClassName); + this.editField.disabled = false; + this.editField.value = transport.responseText.stripTags(); + }, + onclickCancel: function() { + this.onComplete(); + this.leaveEditMode(); + return false; + }, + onFailure: function(transport) { + this.options.onFailure(transport); + if (this.oldInnerHTML) { + this.element.innerHTML = this.oldInnerHTML; + this.oldInnerHTML = null; + } + return false; + }, + onSubmit: function() { + // onLoading resets these so we need to save them away for the Ajax call + var form = this.form; + var value = this.editField.value; + + // do this first, sometimes the ajax call returns before we get a chance to switch on Saving... + // which means this will actually switch on Saving... *after* we've left edit mode causing Saving... + // to be displayed indefinitely + this.onLoading(); + + new Ajax.Updater( + { + success: this.element, + // don't update on failure (this could be an option) + failure: null + }, + this.url, + Object.extend({ + parameters: this.options.callback(form, value), + onComplete: this.onComplete.bind(this), + onFailure: this.onFailure.bind(this) + }, this.options.ajaxOptions) + ); + // stop the event to avoid a page refresh in Safari + if (arguments.length > 1) { + Event.stop(arguments[0]); + } + return false; + }, + onLoading: function() { + this.saving = true; + this.removeForm(); + this.leaveHover(); + this.showSaving(); + }, + showSaving: function() { + this.oldInnerHTML = this.element.innerHTML; + this.element.innerHTML = this.options.savingText; + Element.addClassName(this.element, this.options.savingClassName); + this.element.style.backgroundColor = this.originalBackground; + Element.show(this.element); + }, + removeForm: function() { + if(this.form) { + if (this.form.parentNode) Element.remove(this.form); + this.form = null; + } + }, + enterHover: function() { + if (this.saving) return; + this.element.style.backgroundColor = this.options.highlightcolor; + if (this.effect) { + this.effect.cancel(); + } + Element.addClassName(this.element, this.options.hoverClassName) + }, + leaveHover: function() { + if (this.options.backgroundColor) { + this.element.style.backgroundColor = this.oldBackground; + } + Element.removeClassName(this.element, this.options.hoverClassName) + if (this.saving) return; + this.effect = new Effect.Highlight(this.element, { + startcolor: this.options.highlightcolor, + endcolor: this.options.highlightendcolor, + restorecolor: this.originalBackground + }); + }, + leaveEditMode: function() { + Element.removeClassName(this.element, this.options.savingClassName); + this.removeForm(); + this.leaveHover(); + this.element.style.backgroundColor = this.originalBackground; + Element.show(this.element); + if (this.options.externalControl) { + Element.show(this.options.externalControl); + } + this.editing = false; + this.saving = false; + this.oldInnerHTML = null; + this.onLeaveEditMode(); + }, + onComplete: function(transport) { + this.leaveEditMode(); + this.options.onComplete.bind(this)(transport, this.element); + }, + onEnterEditMode: function() {}, + onLeaveEditMode: function() {}, + dispose: function() { + if (this.oldInnerHTML) { + this.element.innerHTML = this.oldInnerHTML; + } + this.leaveEditMode(); + Event.stopObserving(this.element, 'click', this.onclickListener); + Event.stopObserving(this.element, 'mouseover', this.mouseoverListener); + Event.stopObserving(this.element, 'mouseout', this.mouseoutListener); + if (this.options.externalControl) { + Event.stopObserving(this.options.externalControl, 'click', this.onclickListener); + Event.stopObserving(this.options.externalControl, 'mouseover', this.mouseoverListener); + Event.stopObserving(this.options.externalControl, 'mouseout', this.mouseoutListener); + } + } +}; + +// Delayed observer, like Form.Element.Observer, +// but waits for delay after last key input +// Ideal for live-search fields + +Form.Element.DelayedObserver = Class.create(); +Form.Element.DelayedObserver.prototype = { + initialize: function(element, delay, callback) { + this.delay = delay || 0.5; + this.element = $(element); + this.callback = callback; + this.timer = null; + this.lastValue = $F(this.element); + Event.observe(this.element,'keyup',this.delayedListener.bindAsEventListener(this)); + }, + delayedListener: function(event) { + if(this.lastValue == $F(this.element)) return; + if(this.timer) clearTimeout(this.timer); + this.timer = setTimeout(this.onTimerEvent.bind(this), this.delay * 1000); + this.lastValue = $F(this.element); + }, + onTimerEvent: function() { + this.timer = null; + this.callback(this.element, $F(this.element)); + } +}; \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/dragdrop.js b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/dragdrop.js new file mode 100644 index 00000000..92d1f731 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/dragdrop.js @@ -0,0 +1,584 @@ +// Copyright (c) 2005 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) +// +// See scriptaculous.js for full license. + +/*--------------------------------------------------------------------------*/ + +var Droppables = { + drops: [], + + remove: function(element) { + this.drops = this.drops.reject(function(d) { return d.element==$(element) }); + }, + + add: function(element) { + element = $(element); + var options = Object.extend({ + greedy: true, + hoverclass: null + }, arguments[1] || {}); + + // cache containers + if(options.containment) { + options._containers = []; + var containment = options.containment; + if((typeof containment == 'object') && + (containment.constructor == Array)) { + containment.each( function(c) { options._containers.push($(c)) }); + } else { + options._containers.push($(containment)); + } + } + + if(options.accept) options.accept = [options.accept].flatten(); + + Element.makePositioned(element); // fix IE + options.element = element; + + this.drops.push(options); + }, + + isContained: function(element, drop) { + var parentNode = element.parentNode; + return drop._containers.detect(function(c) { return parentNode == c }); + }, + + isAffected: function(point, element, drop) { + return ( + (drop.element!=element) && + ((!drop._containers) || + this.isContained(element, drop)) && + ((!drop.accept) || + (Element.classNames(element).detect( + function(v) { return drop.accept.include(v) } ) )) && + Position.within(drop.element, point[0], point[1]) ); + }, + + deactivate: function(drop) { + if(drop.hoverclass) + Element.removeClassName(drop.element, drop.hoverclass); + this.last_active = null; + }, + + activate: function(drop) { + if(drop.hoverclass) + Element.addClassName(drop.element, drop.hoverclass); + this.last_active = drop; + }, + + show: function(point, element) { + if(!this.drops.length) return; + + if(this.last_active) this.deactivate(this.last_active); + this.drops.each( function(drop) { + if(Droppables.isAffected(point, element, drop)) { + if(drop.onHover) + drop.onHover(element, drop.element, Position.overlap(drop.overlap, drop.element)); + if(drop.greedy) { + Droppables.activate(drop); + throw $break; + } + } + }); + }, + + fire: function(event, element) { + if(!this.last_active) return; + Position.prepare(); + + if (this.isAffected([Event.pointerX(event), Event.pointerY(event)], element, this.last_active)) + if (this.last_active.onDrop) + this.last_active.onDrop(element, this.last_active.element, event); + }, + + reset: function() { + if(this.last_active) + this.deactivate(this.last_active); + } +} + +var Draggables = { + drags: [], + observers: [], + + register: function(draggable) { + if(this.drags.length == 0) { + this.eventMouseUp = this.endDrag.bindAsEventListener(this); + this.eventMouseMove = this.updateDrag.bindAsEventListener(this); + this.eventKeypress = this.keyPress.bindAsEventListener(this); + + Event.observe(document, "mouseup", this.eventMouseUp); + Event.observe(document, "mousemove", this.eventMouseMove); + Event.observe(document, "keypress", this.eventKeypress); + } + this.drags.push(draggable); + }, + + unregister: function(draggable) { + this.drags = this.drags.reject(function(d) { return d==draggable }); + if(this.drags.length == 0) { + Event.stopObserving(document, "mouseup", this.eventMouseUp); + Event.stopObserving(document, "mousemove", this.eventMouseMove); + Event.stopObserving(document, "keypress", this.eventKeypress); + } + }, + + activate: function(draggable) { + window.focus(); // allows keypress events if window isn't currently focused, fails for Safari + this.activeDraggable = draggable; + }, + + deactivate: function(draggbale) { + this.activeDraggable = null; + }, + + updateDrag: function(event) { + if(!this.activeDraggable) return; + var pointer = [Event.pointerX(event), Event.pointerY(event)]; + // Mozilla-based browsers fire successive mousemove events with + // the same coordinates, prevent needless redrawing (moz bug?) + if(this._lastPointer && (this._lastPointer.inspect() == pointer.inspect())) return; + this._lastPointer = pointer; + this.activeDraggable.updateDrag(event, pointer); + }, + + endDrag: function(event) { + if(!this.activeDraggable) return; + this._lastPointer = null; + this.activeDraggable.endDrag(event); + }, + + keyPress: function(event) { + if(this.activeDraggable) + this.activeDraggable.keyPress(event); + }, + + addObserver: function(observer) { + this.observers.push(observer); + this._cacheObserverCallbacks(); + }, + + removeObserver: function(element) { // element instead of observer fixes mem leaks + this.observers = this.observers.reject( function(o) { return o.element==element }); + this._cacheObserverCallbacks(); + }, + + notify: function(eventName, draggable, event) { // 'onStart', 'onEnd', 'onDrag' + if(this[eventName+'Count'] > 0) + this.observers.each( function(o) { + if(o[eventName]) o[eventName](eventName, draggable, event); + }); + }, + + _cacheObserverCallbacks: function() { + ['onStart','onEnd','onDrag'].each( function(eventName) { + Draggables[eventName+'Count'] = Draggables.observers.select( + function(o) { return o[eventName]; } + ).length; + }); + } +} + +/*--------------------------------------------------------------------------*/ + +var Draggable = Class.create(); +Draggable.prototype = { + initialize: function(element) { + var options = Object.extend({ + handle: false, + starteffect: function(element) { + new Effect.Opacity(element, {duration:0.2, from:1.0, to:0.7}); + }, + reverteffect: function(element, top_offset, left_offset) { + var dur = Math.sqrt(Math.abs(top_offset^2)+Math.abs(left_offset^2))*0.02; + element._revert = new Effect.MoveBy(element, -top_offset, -left_offset, {duration:dur}); + }, + endeffect: function(element) { + new Effect.Opacity(element, {duration:0.2, from:0.7, to:1.0}); + }, + zindex: 1000, + revert: false, + snap: false // false, or xy or [x,y] or function(x,y){ return [x,y] } + }, arguments[1] || {}); + + this.element = $(element); + + if(options.handle && (typeof options.handle == 'string')) + this.handle = Element.childrenWithClassName(this.element, options.handle)[0]; + if(!this.handle) this.handle = $(options.handle); + if(!this.handle) this.handle = this.element; + + Element.makePositioned(this.element); // fix IE + + this.delta = this.currentDelta(); + this.options = options; + this.dragging = false; + + this.eventMouseDown = this.initDrag.bindAsEventListener(this); + Event.observe(this.handle, "mousedown", this.eventMouseDown); + + Draggables.register(this); + }, + + destroy: function() { + Event.stopObserving(this.handle, "mousedown", this.eventMouseDown); + Draggables.unregister(this); + }, + + currentDelta: function() { + return([ + parseInt(this.element.style.left || '0'), + parseInt(this.element.style.top || '0')]); + }, + + initDrag: function(event) { + if(Event.isLeftClick(event)) { + // abort on form elements, fixes a Firefox issue + var src = Event.element(event); + if(src.tagName && ( + src.tagName=='INPUT' || + src.tagName=='SELECT' || + src.tagName=='BUTTON' || + src.tagName=='TEXTAREA')) return; + + if(this.element._revert) { + this.element._revert.cancel(); + this.element._revert = null; + } + + var pointer = [Event.pointerX(event), Event.pointerY(event)]; + var pos = Position.cumulativeOffset(this.element); + this.offset = [0,1].map( function(i) { return (pointer[i] - pos[i]) }); + + Draggables.activate(this); + Event.stop(event); + } + }, + + startDrag: function(event) { + this.dragging = true; + + if(this.options.zindex) { + this.originalZ = parseInt(Element.getStyle(this.element,'z-index') || 0); + this.element.style.zIndex = this.options.zindex; + } + + if(this.options.ghosting) { + this._clone = this.element.cloneNode(true); + Position.absolutize(this.element); + this.element.parentNode.insertBefore(this._clone, this.element); + } + + Draggables.notify('onStart', this, event); + if(this.options.starteffect) this.options.starteffect(this.element); + }, + + updateDrag: function(event, pointer) { + if(!this.dragging) this.startDrag(event); + Position.prepare(); + Droppables.show(pointer, this.element); + Draggables.notify('onDrag', this, event); + this.draw(pointer); + if(this.options.change) this.options.change(this); + + // fix AppleWebKit rendering + if(navigator.appVersion.indexOf('AppleWebKit')>0) window.scrollBy(0,0); + Event.stop(event); + }, + + finishDrag: function(event, success) { + this.dragging = false; + + if(this.options.ghosting) { + Position.relativize(this.element); + Element.remove(this._clone); + this._clone = null; + } + + if(success) Droppables.fire(event, this.element); + Draggables.notify('onEnd', this, event); + + var revert = this.options.revert; + if(revert && typeof revert == 'function') revert = revert(this.element); + + var d = this.currentDelta(); + if(revert && this.options.reverteffect) { + this.options.reverteffect(this.element, + d[1]-this.delta[1], d[0]-this.delta[0]); + } else { + this.delta = d; + } + + if(this.options.zindex) + this.element.style.zIndex = this.originalZ; + + if(this.options.endeffect) + this.options.endeffect(this.element); + + Draggables.deactivate(this); + Droppables.reset(); + }, + + keyPress: function(event) { + if(!event.keyCode==Event.KEY_ESC) return; + this.finishDrag(event, false); + Event.stop(event); + }, + + endDrag: function(event) { + if(!this.dragging) return; + this.finishDrag(event, true); + Event.stop(event); + }, + + draw: function(point) { + var pos = Position.cumulativeOffset(this.element); + var d = this.currentDelta(); + pos[0] -= d[0]; pos[1] -= d[1]; + + var p = [0,1].map(function(i){ return (point[i]-pos[i]-this.offset[i]) }.bind(this)); + + if(this.options.snap) { + if(typeof this.options.snap == 'function') { + p = this.options.snap(p[0],p[1]); + } else { + if(this.options.snap instanceof Array) { + p = p.map( function(v, i) { + return Math.round(v/this.options.snap[i])*this.options.snap[i] }.bind(this)) + } else { + p = p.map( function(v) { + return Math.round(v/this.options.snap)*this.options.snap }.bind(this)) + } + }} + + var style = this.element.style; + if((!this.options.constraint) || (this.options.constraint=='horizontal')) + style.left = p[0] + "px"; + if((!this.options.constraint) || (this.options.constraint=='vertical')) + style.top = p[1] + "px"; + if(style.visibility=="hidden") style.visibility = ""; // fix gecko rendering + } +} + +/*--------------------------------------------------------------------------*/ + +var SortableObserver = Class.create(); +SortableObserver.prototype = { + initialize: function(element, observer) { + this.element = $(element); + this.observer = observer; + this.lastValue = Sortable.serialize(this.element); + }, + + onStart: function() { + this.lastValue = Sortable.serialize(this.element); + }, + + onEnd: function() { + Sortable.unmark(); + if(this.lastValue != Sortable.serialize(this.element)) + this.observer(this.element) + } +} + +var Sortable = { + sortables: new Array(), + + options: function(element){ + element = $(element); + return this.sortables.detect(function(s) { return s.element == element }); + }, + + destroy: function(element){ + element = $(element); + this.sortables.findAll(function(s) { return s.element == element }).each(function(s){ + Draggables.removeObserver(s.element); + s.droppables.each(function(d){ Droppables.remove(d) }); + s.draggables.invoke('destroy'); + }); + this.sortables = this.sortables.reject(function(s) { return s.element == element }); + }, + + create: function(element) { + element = $(element); + var options = Object.extend({ + element: element, + tag: 'li', // assumes li children, override with tag: 'tagname' + dropOnEmpty: false, + tree: false, // fixme: unimplemented + overlap: 'vertical', // one of 'vertical', 'horizontal' + constraint: 'vertical', // one of 'vertical', 'horizontal', false + containment: element, // also takes array of elements (or id's); or false + handle: false, // or a CSS class + only: false, + hoverclass: null, + ghosting: false, + format: null, + onChange: Prototype.emptyFunction, + onUpdate: Prototype.emptyFunction + }, arguments[1] || {}); + + // clear any old sortable with same element + this.destroy(element); + + // build options for the draggables + var options_for_draggable = { + revert: true, + ghosting: options.ghosting, + constraint: options.constraint, + handle: options.handle }; + + if(options.starteffect) + options_for_draggable.starteffect = options.starteffect; + + if(options.reverteffect) + options_for_draggable.reverteffect = options.reverteffect; + else + if(options.ghosting) options_for_draggable.reverteffect = function(element) { + element.style.top = 0; + element.style.left = 0; + }; + + if(options.endeffect) + options_for_draggable.endeffect = options.endeffect; + + if(options.zindex) + options_for_draggable.zindex = options.zindex; + + // build options for the droppables + var options_for_droppable = { + overlap: options.overlap, + containment: options.containment, + hoverclass: options.hoverclass, + onHover: Sortable.onHover, + greedy: !options.dropOnEmpty + } + + // fix for gecko engine + Element.cleanWhitespace(element); + + options.draggables = []; + options.droppables = []; + + // make it so + + // drop on empty handling + if(options.dropOnEmpty) { + Droppables.add(element, + {containment: options.containment, onHover: Sortable.onEmptyHover, greedy: false}); + options.droppables.push(element); + } + + (this.findElements(element, options) || []).each( function(e) { + // handles are per-draggable + var handle = options.handle ? + Element.childrenWithClassName(e, options.handle)[0] : e; + options.draggables.push( + new Draggable(e, Object.extend(options_for_draggable, { handle: handle }))); + Droppables.add(e, options_for_droppable); + options.droppables.push(e); + }); + + // keep reference + this.sortables.push(options); + + // for onupdate + Draggables.addObserver(new SortableObserver(element, options.onUpdate)); + + }, + + // return all suitable-for-sortable elements in a guaranteed order + findElements: function(element, options) { + if(!element.hasChildNodes()) return null; + var elements = []; + $A(element.childNodes).each( function(e) { + if(e.tagName && e.tagName.toUpperCase()==options.tag.toUpperCase() && + (!options.only || (Element.hasClassName(e, options.only)))) + elements.push(e); + if(options.tree) { + var grandchildren = this.findElements(e, options); + if(grandchildren) elements.push(grandchildren); + } + }); + + return (elements.length>0 ? elements.flatten() : null); + }, + + onHover: function(element, dropon, overlap) { + if(overlap>0.5) { + Sortable.mark(dropon, 'before'); + if(dropon.previousSibling != element) { + var oldParentNode = element.parentNode; + element.style.visibility = "hidden"; // fix gecko rendering + dropon.parentNode.insertBefore(element, dropon); + if(dropon.parentNode!=oldParentNode) + Sortable.options(oldParentNode).onChange(element); + Sortable.options(dropon.parentNode).onChange(element); + } + } else { + Sortable.mark(dropon, 'after'); + var nextElement = dropon.nextSibling || null; + if(nextElement != element) { + var oldParentNode = element.parentNode; + element.style.visibility = "hidden"; // fix gecko rendering + dropon.parentNode.insertBefore(element, nextElement); + if(dropon.parentNode!=oldParentNode) + Sortable.options(oldParentNode).onChange(element); + Sortable.options(dropon.parentNode).onChange(element); + } + } + }, + + onEmptyHover: function(element, dropon) { + if(element.parentNode!=dropon) { + var oldParentNode = element.parentNode; + dropon.appendChild(element); + Sortable.options(oldParentNode).onChange(element); + Sortable.options(dropon).onChange(element); + } + }, + + unmark: function() { + if(Sortable._marker) Element.hide(Sortable._marker); + }, + + mark: function(dropon, position) { + // mark on ghosting only + var sortable = Sortable.options(dropon.parentNode); + if(sortable && !sortable.ghosting) return; + + if(!Sortable._marker) { + Sortable._marker = $('dropmarker') || document.createElement('DIV'); + Element.hide(Sortable._marker); + Element.addClassName(Sortable._marker, 'dropmarker'); + Sortable._marker.style.position = 'absolute'; + document.getElementsByTagName("body").item(0).appendChild(Sortable._marker); + } + var offsets = Position.cumulativeOffset(dropon); + Sortable._marker.style.left = offsets[0] + 'px'; + Sortable._marker.style.top = offsets[1] + 'px'; + + if(position=='after') + if(sortable.overlap == 'horizontal') + Sortable._marker.style.left = (offsets[0]+dropon.clientWidth) + 'px'; + else + Sortable._marker.style.top = (offsets[1]+dropon.clientHeight) + 'px'; + + Element.show(Sortable._marker); + }, + + serialize: function(element) { + element = $(element); + var sortableOptions = this.options(element); + var options = Object.extend({ + tag: sortableOptions.tag, + only: sortableOptions.only, + name: element.id, + format: sortableOptions.format || /^[^_]*_(.*)$/ + }, arguments[1] || {}); + return $(this.findElements(element, options) || []).map( function(item) { + return (encodeURIComponent(options.name) + "[]=" + + encodeURIComponent(item.id.match(options.format) ? item.id.match(options.format)[1] : '')); + }).join("&"); + } +} \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/effects.js b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/effects.js new file mode 100644 index 00000000..414398ce --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/effects.js @@ -0,0 +1,854 @@ +// Copyright (c) 2005 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) +// Contributors: +// Justin Palmer (http://encytemedia.com/) +// Mark Pilgrim (http://diveintomark.org/) +// Martin Bialasinki +// +// See scriptaculous.js for full license. + +/* ------------- element ext -------------- */ + +// converts rgb() and #xxx to #xxxxxx format, +// returns self (or first argument) if not convertable +String.prototype.parseColor = function() { + var color = '#'; + if(this.slice(0,4) == 'rgb(') { + var cols = this.slice(4,this.length-1).split(','); + var i=0; do { color += parseInt(cols[i]).toColorPart() } while (++i<3); + } else { + if(this.slice(0,1) == '#') { + if(this.length==4) for(var i=1;i<4;i++) color += (this.charAt(i) + this.charAt(i)).toLowerCase(); + if(this.length==7) color = this.toLowerCase(); + } + } + return(color.length==7 ? color : (arguments[0] || this)); +} + +Element.collectTextNodesIgnoreClass = function(element, ignoreclass) { + var children = $(element).childNodes; + var text = ''; + var classtest = new RegExp('^([^ ]+ )*' + ignoreclass+ '( [^ ]+)*$','i'); + + for (var i = 0; i < children.length; i++) { + if(children[i].nodeType==3) { + text+=children[i].nodeValue; + } else { + if((!children[i].className.match(classtest)) && children[i].hasChildNodes()) + text += Element.collectTextNodesIgnoreClass(children[i], ignoreclass); + } + } + + return text; +} + +Element.setStyle = function(element, style) { + element = $(element); + for(k in style) element.style[k.camelize()] = style[k]; +} + +Element.setContentZoom = function(element, percent) { + Element.setStyle(element, {fontSize: (percent/100) + 'em'}); + if(navigator.appVersion.indexOf('AppleWebKit')>0) window.scrollBy(0,0); +} + +Element.getOpacity = function(element){ + var opacity; + if (opacity = Element.getStyle(element, 'opacity')) + return parseFloat(opacity); + if (opacity = (Element.getStyle(element, 'filter') || '').match(/alpha\(opacity=(.*)\)/)) + if(opacity[1]) return parseFloat(opacity[1]) / 100; + return 1.0; +} + +Element.setOpacity = function(element, value){ + element= $(element); + if (value == 1){ + Element.setStyle(element, { opacity: + (/Gecko/.test(navigator.userAgent) && !/Konqueror|Safari|KHTML/.test(navigator.userAgent)) ? + 0.999999 : null }); + if(/MSIE/.test(navigator.userAgent)) + Element.setStyle(element, {filter: Element.getStyle(element,'filter').replace(/alpha\([^\)]*\)/gi,'')}); + } else { + if(value < 0.00001) value = 0; + Element.setStyle(element, {opacity: value}); + if(/MSIE/.test(navigator.userAgent)) + Element.setStyle(element, + { filter: Element.getStyle(element,'filter').replace(/alpha\([^\)]*\)/gi,'') + + 'alpha(opacity='+value*100+')' }); + } +} + +Element.getInlineOpacity = function(element){ + return $(element).style.opacity || ''; +} + +Element.childrenWithClassName = function(element, className) { + return $A($(element).getElementsByTagName('*')).select( + function(c) { return Element.hasClassName(c, className) }); +} + +Array.prototype.call = function() { + var args = arguments; + this.each(function(f){ f.apply(this, args) }); +} + +/*--------------------------------------------------------------------------*/ + +var Effect = { + tagifyText: function(element) { + var tagifyStyle = 'position:relative'; + if(/MSIE/.test(navigator.userAgent)) tagifyStyle += ';zoom:1'; + element = $(element); + $A(element.childNodes).each( function(child) { + if(child.nodeType==3) { + child.nodeValue.toArray().each( function(character) { + element.insertBefore( + Builder.node('span',{style: tagifyStyle}, + character == ' ' ? String.fromCharCode(160) : character), + child); + }); + Element.remove(child); + } + }); + }, + multiple: function(element, effect) { + var elements; + if(((typeof element == 'object') || + (typeof element == 'function')) && + (element.length)) + elements = element; + else + elements = $(element).childNodes; + + var options = Object.extend({ + speed: 0.1, + delay: 0.0 + }, arguments[2] || {}); + var masterDelay = options.delay; + + $A(elements).each( function(element, index) { + new effect(element, Object.extend(options, { delay: index * options.speed + masterDelay })); + }); + } +}; + +var Effect2 = Effect; // deprecated + +/* ------------- transitions ------------- */ + +Effect.Transitions = {} + +Effect.Transitions.linear = function(pos) { + return pos; +} +Effect.Transitions.sinoidal = function(pos) { + return (-Math.cos(pos*Math.PI)/2) + 0.5; +} +Effect.Transitions.reverse = function(pos) { + return 1-pos; +} +Effect.Transitions.flicker = function(pos) { + return ((-Math.cos(pos*Math.PI)/4) + 0.75) + Math.random()/4; +} +Effect.Transitions.wobble = function(pos) { + return (-Math.cos(pos*Math.PI*(9*pos))/2) + 0.5; +} +Effect.Transitions.pulse = function(pos) { + return (Math.floor(pos*10) % 2 == 0 ? + (pos*10-Math.floor(pos*10)) : 1-(pos*10-Math.floor(pos*10))); +} +Effect.Transitions.none = function(pos) { + return 0; +} +Effect.Transitions.full = function(pos) { + return 1; +} + +/* ------------- core effects ------------- */ + +Effect.Queue = { + effects: [], + _each: function(iterator) { + this.effects._each(iterator); + }, + interval: null, + add: function(effect) { + var timestamp = new Date().getTime(); + + switch(effect.options.queue) { + case 'front': + // move unstarted effects after this effect + this.effects.findAll(function(e){ return e.state=='idle' }).each( function(e) { + e.startOn += effect.finishOn; + e.finishOn += effect.finishOn; + }); + break; + case 'end': + // start effect after last queued effect has finished + timestamp = this.effects.pluck('finishOn').max() || timestamp; + break; + } + + effect.startOn += timestamp; + effect.finishOn += timestamp; + this.effects.push(effect); + if(!this.interval) + this.interval = setInterval(this.loop.bind(this), 40); + }, + remove: function(effect) { + this.effects = this.effects.reject(function(e) { return e==effect }); + if(this.effects.length == 0) { + clearInterval(this.interval); + this.interval = null; + } + }, + loop: function() { + var timePos = new Date().getTime(); + this.effects.invoke('loop', timePos); + } +} +Object.extend(Effect.Queue, Enumerable); + +Effect.Base = function() {}; +Effect.Base.prototype = { + position: null, + setOptions: function(options) { + this.options = Object.extend({ + transition: Effect.Transitions.sinoidal, + duration: 1.0, // seconds + fps: 25.0, // max. 25fps due to Effect.Queue implementation + sync: false, // true for combining + from: 0.0, + to: 1.0, + delay: 0.0, + queue: 'parallel' + }, options || {}); + }, + start: function(options) { + this.setOptions(options || {}); + this.currentFrame = 0; + this.state = 'idle'; + this.startOn = this.options.delay*1000; + this.finishOn = this.startOn + (this.options.duration*1000); + this.event('beforeStart'); + if(!this.options.sync) Effect.Queue.add(this); + }, + loop: function(timePos) { + if(timePos >= this.startOn) { + if(timePos >= this.finishOn) { + this.render(1.0); + this.cancel(); + this.event('beforeFinish'); + if(this.finish) this.finish(); + this.event('afterFinish'); + return; + } + var pos = (timePos - this.startOn) / (this.finishOn - this.startOn); + var frame = Math.round(pos * this.options.fps * this.options.duration); + if(frame > this.currentFrame) { + this.render(pos); + this.currentFrame = frame; + } + } + }, + render: function(pos) { + if(this.state == 'idle') { + this.state = 'running'; + this.event('beforeSetup'); + if(this.setup) this.setup(); + this.event('afterSetup'); + } + if(this.state == 'running') { + if(this.options.transition) pos = this.options.transition(pos); + pos *= (this.options.to-this.options.from); + pos += this.options.from; + this.position = pos; + this.event('beforeUpdate'); + if(this.update) this.update(pos); + this.event('afterUpdate'); + } + }, + cancel: function() { + if(!this.options.sync) Effect.Queue.remove(this); + this.state = 'finished'; + }, + event: function(eventName) { + if(this.options[eventName + 'Internal']) this.options[eventName + 'Internal'](this); + if(this.options[eventName]) this.options[eventName](this); + }, + inspect: function() { + return '#'; + } +} + +Effect.Parallel = Class.create(); +Object.extend(Object.extend(Effect.Parallel.prototype, Effect.Base.prototype), { + initialize: function(effects) { + this.effects = effects || []; + this.start(arguments[1]); + }, + update: function(position) { + this.effects.invoke('render', position); + }, + finish: function(position) { + this.effects.each( function(effect) { + effect.render(1.0); + effect.cancel(); + effect.event('beforeFinish'); + if(effect.finish) effect.finish(position); + effect.event('afterFinish'); + }); + } +}); + +Effect.Opacity = Class.create(); +Object.extend(Object.extend(Effect.Opacity.prototype, Effect.Base.prototype), { + initialize: function(element) { + this.element = $(element); + // make this work on IE on elements without 'layout' + if(/MSIE/.test(navigator.userAgent) && (!this.element.hasLayout)) + Element.setStyle(this.element, {zoom: 1}); + var options = Object.extend({ + from: Element.getOpacity(this.element) || 0.0, + to: 1.0 + }, arguments[1] || {}); + this.start(options); + }, + update: function(position) { + Element.setOpacity(this.element, position); + } +}); + +Effect.MoveBy = Class.create(); +Object.extend(Object.extend(Effect.MoveBy.prototype, Effect.Base.prototype), { + initialize: function(element, toTop, toLeft) { + this.element = $(element); + this.toTop = toTop; + this.toLeft = toLeft; + this.start(arguments[3]); + }, + setup: function() { + // Bug in Opera: Opera returns the "real" position of a static element or + // relative element that does not have top/left explicitly set. + // ==> Always set top and left for position relative elements in your stylesheets + // (to 0 if you do not need them) + Element.makePositioned(this.element); + this.originalTop = parseFloat(Element.getStyle(this.element,'top') || '0'); + this.originalLeft = parseFloat(Element.getStyle(this.element,'left') || '0'); + }, + update: function(position) { + Element.setStyle(this.element, { + top: this.toTop * position + this.originalTop + 'px', + left: this.toLeft * position + this.originalLeft + 'px' + }); + } +}); + +Effect.Scale = Class.create(); +Object.extend(Object.extend(Effect.Scale.prototype, Effect.Base.prototype), { + initialize: function(element, percent) { + this.element = $(element) + var options = Object.extend({ + scaleX: true, + scaleY: true, + scaleContent: true, + scaleFromCenter: false, + scaleMode: 'box', // 'box' or 'contents' or {} with provided values + scaleFrom: 100.0, + scaleTo: percent + }, arguments[2] || {}); + this.start(options); + }, + setup: function() { + this.restoreAfterFinish = this.options.restoreAfterFinish || false; + this.elementPositioning = Element.getStyle(this.element,'position'); + + this.originalStyle = {}; + ['top','left','width','height','fontSize'].each( function(k) { + this.originalStyle[k] = this.element.style[k]; + }.bind(this)); + + this.originalTop = this.element.offsetTop; + this.originalLeft = this.element.offsetLeft; + + var fontSize = Element.getStyle(this.element,'font-size') || '100%'; + ['em','px','%'].each( function(fontSizeType) { + if(fontSize.indexOf(fontSizeType)>0) { + this.fontSize = parseFloat(fontSize); + this.fontSizeType = fontSizeType; + } + }.bind(this)); + + this.factor = (this.options.scaleTo - this.options.scaleFrom)/100; + + this.dims = null; + if(this.options.scaleMode=='box') + this.dims = [this.element.offsetHeight, this.element.offsetWidth]; + if(/^content/.test(this.options.scaleMode)) + this.dims = [this.element.scrollHeight, this.element.scrollWidth]; + if(!this.dims) + this.dims = [this.options.scaleMode.originalHeight, + this.options.scaleMode.originalWidth]; + }, + update: function(position) { + var currentScale = (this.options.scaleFrom/100.0) + (this.factor * position); + if(this.options.scaleContent && this.fontSize) + Element.setStyle(this.element, {fontSize: this.fontSize * currentScale + this.fontSizeType }); + this.setDimensions(this.dims[0] * currentScale, this.dims[1] * currentScale); + }, + finish: function(position) { + if (this.restoreAfterFinish) Element.setStyle(this.element, this.originalStyle); + }, + setDimensions: function(height, width) { + var d = {}; + if(this.options.scaleX) d.width = width + 'px'; + if(this.options.scaleY) d.height = height + 'px'; + if(this.options.scaleFromCenter) { + var topd = (height - this.dims[0])/2; + var leftd = (width - this.dims[1])/2; + if(this.elementPositioning == 'absolute') { + if(this.options.scaleY) d.top = this.originalTop-topd + 'px'; + if(this.options.scaleX) d.left = this.originalLeft-leftd + 'px'; + } else { + if(this.options.scaleY) d.top = -topd + 'px'; + if(this.options.scaleX) d.left = -leftd + 'px'; + } + } + Element.setStyle(this.element, d); + } +}); + +Effect.Highlight = Class.create(); +Object.extend(Object.extend(Effect.Highlight.prototype, Effect.Base.prototype), { + initialize: function(element) { + this.element = $(element); + var options = Object.extend({ startcolor: '#ffff99' }, arguments[1] || {}); + this.start(options); + }, + setup: function() { + // Prevent executing on elements not in the layout flow + if(Element.getStyle(this.element, 'display')=='none') { this.cancel(); return; } + // Disable background image during the effect + this.oldStyle = { + backgroundImage: Element.getStyle(this.element, 'background-image') }; + Element.setStyle(this.element, {backgroundImage: 'none'}); + if(!this.options.endcolor) + this.options.endcolor = Element.getStyle(this.element, 'background-color').parseColor('#ffffff'); + if(!this.options.restorecolor) + this.options.restorecolor = Element.getStyle(this.element, 'background-color'); + // init color calculations + this._base = $R(0,2).map(function(i){ return parseInt(this.options.startcolor.slice(i*2+1,i*2+3),16) }.bind(this)); + this._delta = $R(0,2).map(function(i){ return parseInt(this.options.endcolor.slice(i*2+1,i*2+3),16)-this._base[i] }.bind(this)); + }, + update: function(position) { + Element.setStyle(this.element,{backgroundColor: $R(0,2).inject('#',function(m,v,i){ + return m+(Math.round(this._base[i]+(this._delta[i]*position)).toColorPart()); }.bind(this)) }); + }, + finish: function() { + Element.setStyle(this.element, Object.extend(this.oldStyle, { + backgroundColor: this.options.restorecolor + })); + } +}); + +Effect.ScrollTo = Class.create(); +Object.extend(Object.extend(Effect.ScrollTo.prototype, Effect.Base.prototype), { + initialize: function(element) { + this.element = $(element); + this.start(arguments[1] || {}); + }, + setup: function() { + Position.prepare(); + var offsets = Position.cumulativeOffset(this.element); + if(this.options.offset) offsets[1] += this.options.offset; + var max = window.innerHeight ? + window.height - window.innerHeight : + document.body.scrollHeight - + (document.documentElement.clientHeight ? + document.documentElement.clientHeight : document.body.clientHeight); + this.scrollStart = Position.deltaY; + this.delta = (offsets[1] > max ? max : offsets[1]) - this.scrollStart; + }, + update: function(position) { + Position.prepare(); + window.scrollTo(Position.deltaX, + this.scrollStart + (position*this.delta)); + } +}); + +/* ------------- combination effects ------------- */ + +Effect.Fade = function(element) { + var oldOpacity = Element.getInlineOpacity(element); + var options = Object.extend({ + from: Element.getOpacity(element) || 1.0, + to: 0.0, + afterFinishInternal: function(effect) { with(Element) { + if(effect.options.to!=0) return; + hide(effect.element); + setStyle(effect.element, {opacity: oldOpacity}); }} + }, arguments[1] || {}); + return new Effect.Opacity(element,options); +} + +Effect.Appear = function(element) { + var options = Object.extend({ + from: (Element.getStyle(element, 'display') == 'none' ? 0.0 : Element.getOpacity(element) || 0.0), + to: 1.0, + beforeSetup: function(effect) { with(Element) { + setOpacity(effect.element, effect.options.from); + show(effect.element); }} + }, arguments[1] || {}); + return new Effect.Opacity(element,options); +} + +Effect.Puff = function(element) { + element = $(element); + var oldStyle = { opacity: Element.getInlineOpacity(element), position: Element.getStyle(element, 'position') }; + return new Effect.Parallel( + [ new Effect.Scale(element, 200, + { sync: true, scaleFromCenter: true, scaleContent: true, restoreAfterFinish: true }), + new Effect.Opacity(element, { sync: true, to: 0.0 } ) ], + Object.extend({ duration: 1.0, + beforeSetupInternal: function(effect) { with(Element) { + setStyle(effect.effects[0].element, {position: 'absolute'}); }}, + afterFinishInternal: function(effect) { with(Element) { + hide(effect.effects[0].element); + setStyle(effect.effects[0].element, oldStyle); }} + }, arguments[1] || {}) + ); +} + +Effect.BlindUp = function(element) { + element = $(element); + Element.makeClipping(element); + return new Effect.Scale(element, 0, + Object.extend({ scaleContent: false, + scaleX: false, + restoreAfterFinish: true, + afterFinishInternal: function(effect) { with(Element) { + [hide, undoClipping].call(effect.element); }} + }, arguments[1] || {}) + ); +} + +Effect.BlindDown = function(element) { + element = $(element); + var oldHeight = Element.getStyle(element, 'height'); + var elementDimensions = Element.getDimensions(element); + return new Effect.Scale(element, 100, + Object.extend({ scaleContent: false, + scaleX: false, + scaleFrom: 0, + scaleMode: {originalHeight: elementDimensions.height, originalWidth: elementDimensions.width}, + restoreAfterFinish: true, + afterSetup: function(effect) { with(Element) { + makeClipping(effect.element); + setStyle(effect.element, {height: '0px'}); + show(effect.element); + }}, + afterFinishInternal: function(effect) { with(Element) { + undoClipping(effect.element); + setStyle(effect.element, {height: oldHeight}); + }} + }, arguments[1] || {}) + ); +} + +Effect.SwitchOff = function(element) { + element = $(element); + var oldOpacity = Element.getInlineOpacity(element); + return new Effect.Appear(element, { + duration: 0.4, + from: 0, + transition: Effect.Transitions.flicker, + afterFinishInternal: function(effect) { + new Effect.Scale(effect.element, 1, { + duration: 0.3, scaleFromCenter: true, + scaleX: false, scaleContent: false, restoreAfterFinish: true, + beforeSetup: function(effect) { with(Element) { + [makePositioned,makeClipping].call(effect.element); + }}, + afterFinishInternal: function(effect) { with(Element) { + [hide,undoClipping,undoPositioned].call(effect.element); + setStyle(effect.element, {opacity: oldOpacity}); + }} + }) + } + }); +} + +Effect.DropOut = function(element) { + element = $(element); + var oldStyle = { + top: Element.getStyle(element, 'top'), + left: Element.getStyle(element, 'left'), + opacity: Element.getInlineOpacity(element) }; + return new Effect.Parallel( + [ new Effect.MoveBy(element, 100, 0, { sync: true }), + new Effect.Opacity(element, { sync: true, to: 0.0 }) ], + Object.extend( + { duration: 0.5, + beforeSetup: function(effect) { with(Element) { + makePositioned(effect.effects[0].element); }}, + afterFinishInternal: function(effect) { with(Element) { + [hide, undoPositioned].call(effect.effects[0].element); + setStyle(effect.effects[0].element, oldStyle); }} + }, arguments[1] || {})); +} + +Effect.Shake = function(element) { + element = $(element); + var oldStyle = { + top: Element.getStyle(element, 'top'), + left: Element.getStyle(element, 'left') }; + return new Effect.MoveBy(element, 0, 20, + { duration: 0.05, afterFinishInternal: function(effect) { + new Effect.MoveBy(effect.element, 0, -40, + { duration: 0.1, afterFinishInternal: function(effect) { + new Effect.MoveBy(effect.element, 0, 40, + { duration: 0.1, afterFinishInternal: function(effect) { + new Effect.MoveBy(effect.element, 0, -40, + { duration: 0.1, afterFinishInternal: function(effect) { + new Effect.MoveBy(effect.element, 0, 40, + { duration: 0.1, afterFinishInternal: function(effect) { + new Effect.MoveBy(effect.element, 0, -20, + { duration: 0.05, afterFinishInternal: function(effect) { with(Element) { + undoPositioned(effect.element); + setStyle(effect.element, oldStyle); + }}}) }}) }}) }}) }}) }}); +} + +Effect.SlideDown = function(element) { + element = $(element); + Element.cleanWhitespace(element); + // SlideDown need to have the content of the element wrapped in a container element with fixed height! + var oldInnerBottom = Element.getStyle(element.firstChild, 'bottom'); + var elementDimensions = Element.getDimensions(element); + return new Effect.Scale(element, 100, Object.extend({ + scaleContent: false, + scaleX: false, + scaleFrom: 0, + scaleMode: {originalHeight: elementDimensions.height, originalWidth: elementDimensions.width}, + restoreAfterFinish: true, + afterSetup: function(effect) { with(Element) { + makePositioned(effect.element); + makePositioned(effect.element.firstChild); + if(window.opera) setStyle(effect.element, {top: ''}); + makeClipping(effect.element); + setStyle(effect.element, {height: '0px'}); + show(element); }}, + afterUpdateInternal: function(effect) { with(Element) { + setStyle(effect.element.firstChild, {bottom: + (effect.dims[0] - effect.element.clientHeight) + 'px' }); }}, + afterFinishInternal: function(effect) { with(Element) { + undoClipping(effect.element); + undoPositioned(effect.element.firstChild); + undoPositioned(effect.element); + setStyle(effect.element.firstChild, {bottom: oldInnerBottom}); }} + }, arguments[1] || {}) + ); +} + +Effect.SlideUp = function(element) { + element = $(element); + Element.cleanWhitespace(element); + var oldInnerBottom = Element.getStyle(element.firstChild, 'bottom'); + return new Effect.Scale(element, 0, + Object.extend({ scaleContent: false, + scaleX: false, + scaleMode: 'box', + scaleFrom: 100, + restoreAfterFinish: true, + beforeStartInternal: function(effect) { with(Element) { + makePositioned(effect.element); + makePositioned(effect.element.firstChild); + if(window.opera) setStyle(effect.element, {top: ''}); + makeClipping(effect.element); + show(element); }}, + afterUpdateInternal: function(effect) { with(Element) { + setStyle(effect.element.firstChild, {bottom: + (effect.dims[0] - effect.element.clientHeight) + 'px' }); }}, + afterFinishInternal: function(effect) { with(Element) { + [hide, undoClipping].call(effect.element); + undoPositioned(effect.element.firstChild); + undoPositioned(effect.element); + setStyle(effect.element.firstChild, {bottom: oldInnerBottom}); }} + }, arguments[1] || {}) + ); +} + +// Bug in opera makes the TD containing this element expand for a instance after finish +Effect.Squish = function(element) { + return new Effect.Scale(element, window.opera ? 1 : 0, + { restoreAfterFinish: true, + beforeSetup: function(effect) { with(Element) { + makeClipping(effect.element); }}, + afterFinishInternal: function(effect) { with(Element) { + hide(effect.element); + undoClipping(effect.element); }} + }); +} + +Effect.Grow = function(element) { + element = $(element); + var options = Object.extend({ + direction: 'center', + moveTransistion: Effect.Transitions.sinoidal, + scaleTransition: Effect.Transitions.sinoidal, + opacityTransition: Effect.Transitions.full + }, arguments[1] || {}); + var oldStyle = { + top: element.style.top, + left: element.style.left, + height: element.style.height, + width: element.style.width, + opacity: Element.getInlineOpacity(element) }; + + var dims = Element.getDimensions(element); + var initialMoveX, initialMoveY; + var moveX, moveY; + + switch (options.direction) { + case 'top-left': + initialMoveX = initialMoveY = moveX = moveY = 0; + break; + case 'top-right': + initialMoveX = dims.width; + initialMoveY = moveY = 0; + moveX = -dims.width; + break; + case 'bottom-left': + initialMoveX = moveX = 0; + initialMoveY = dims.height; + moveY = -dims.height; + break; + case 'bottom-right': + initialMoveX = dims.width; + initialMoveY = dims.height; + moveX = -dims.width; + moveY = -dims.height; + break; + case 'center': + initialMoveX = dims.width / 2; + initialMoveY = dims.height / 2; + moveX = -dims.width / 2; + moveY = -dims.height / 2; + break; + } + + return new Effect.MoveBy(element, initialMoveY, initialMoveX, { + duration: 0.01, + beforeSetup: function(effect) { with(Element) { + hide(effect.element); + makeClipping(effect.element); + makePositioned(effect.element); + }}, + afterFinishInternal: function(effect) { + new Effect.Parallel( + [ new Effect.Opacity(effect.element, { sync: true, to: 1.0, from: 0.0, transition: options.opacityTransition }), + new Effect.MoveBy(effect.element, moveY, moveX, { sync: true, transition: options.moveTransition }), + new Effect.Scale(effect.element, 100, { + scaleMode: { originalHeight: dims.height, originalWidth: dims.width }, + sync: true, scaleFrom: window.opera ? 1 : 0, transition: options.scaleTransition, restoreAfterFinish: true}) + ], Object.extend({ + beforeSetup: function(effect) { with(Element) { + setStyle(effect.effects[0].element, {height: '0px'}); + show(effect.effects[0].element); }}, + afterFinishInternal: function(effect) { with(Element) { + [undoClipping, undoPositioned].call(effect.effects[0].element); + setStyle(effect.effects[0].element, oldStyle); }} + }, options) + ) + } + }); +} + +Effect.Shrink = function(element) { + element = $(element); + var options = Object.extend({ + direction: 'center', + moveTransistion: Effect.Transitions.sinoidal, + scaleTransition: Effect.Transitions.sinoidal, + opacityTransition: Effect.Transitions.none + }, arguments[1] || {}); + var oldStyle = { + top: element.style.top, + left: element.style.left, + height: element.style.height, + width: element.style.width, + opacity: Element.getInlineOpacity(element) }; + + var dims = Element.getDimensions(element); + var moveX, moveY; + + switch (options.direction) { + case 'top-left': + moveX = moveY = 0; + break; + case 'top-right': + moveX = dims.width; + moveY = 0; + break; + case 'bottom-left': + moveX = 0; + moveY = dims.height; + break; + case 'bottom-right': + moveX = dims.width; + moveY = dims.height; + break; + case 'center': + moveX = dims.width / 2; + moveY = dims.height / 2; + break; + } + + return new Effect.Parallel( + [ new Effect.Opacity(element, { sync: true, to: 0.0, from: 1.0, transition: options.opacityTransition }), + new Effect.Scale(element, window.opera ? 1 : 0, { sync: true, transition: options.scaleTransition, restoreAfterFinish: true}), + new Effect.MoveBy(element, moveY, moveX, { sync: true, transition: options.moveTransition }) + ], Object.extend({ + beforeStartInternal: function(effect) { with(Element) { + [makePositioned, makeClipping].call(effect.effects[0].element) }}, + afterFinishInternal: function(effect) { with(Element) { + [hide, undoClipping, undoPositioned].call(effect.effects[0].element); + setStyle(effect.effects[0].element, oldStyle); }} + }, options) + ); +} + +Effect.Pulsate = function(element) { + element = $(element); + var options = arguments[1] || {}; + var oldOpacity = Element.getInlineOpacity(element); + var transition = options.transition || Effect.Transitions.sinoidal; + var reverser = function(pos){ return transition(1-Effect.Transitions.pulse(pos)) }; + reverser.bind(transition); + return new Effect.Opacity(element, + Object.extend(Object.extend({ duration: 3.0, from: 0, + afterFinishInternal: function(effect) { Element.setStyle(effect.element, {opacity: oldOpacity}); } + }, options), {transition: reverser})); +} + +Effect.Fold = function(element) { + element = $(element); + var oldStyle = { + top: element.style.top, + left: element.style.left, + width: element.style.width, + height: element.style.height }; + Element.makeClipping(element); + return new Effect.Scale(element, 5, Object.extend({ + scaleContent: false, + scaleX: false, + afterFinishInternal: function(effect) { + new Effect.Scale(element, 1, { + scaleContent: false, + scaleY: false, + afterFinishInternal: function(effect) { with(Element) { + [hide, undoClipping].call(effect.element); + setStyle(effect.element, oldStyle); + }} }); + }}, arguments[1] || {})); +} diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/prototype.js b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/prototype.js new file mode 100644 index 00000000..e9ccd3c8 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/javascripts/prototype.js @@ -0,0 +1,1785 @@ +/* Prototype JavaScript framework, version 1.4.0 + * (c) 2005 Sam Stephenson + * + * THIS FILE IS AUTOMATICALLY GENERATED. When sending patches, please diff + * against the source tree, available from the Prototype darcs repository. + * + * Prototype is freely distributable under the terms of an MIT-style license. + * + * For details, see the Prototype web site: http://prototype.conio.net/ + * +/*--------------------------------------------------------------------------*/ + +var Prototype = { + Version: '1.4.0', + ScriptFragment: '(?:)((\n|\r|.)*?)(?:<\/script>)', + + emptyFunction: function() {}, + K: function(x) {return x} +} + +var Class = { + create: function() { + return function() { + this.initialize.apply(this, arguments); + } + } +} + +var Abstract = new Object(); + +Object.extend = function(destination, source) { + for (property in source) { + destination[property] = source[property]; + } + return destination; +} + +Object.inspect = function(object) { + try { + if (object == undefined) return 'undefined'; + if (object == null) return 'null'; + return object.inspect ? object.inspect() : object.toString(); + } catch (e) { + if (e instanceof RangeError) return '...'; + throw e; + } +} + +Function.prototype.bind = function() { + var __method = this, args = $A(arguments), object = args.shift(); + return function() { + return __method.apply(object, args.concat($A(arguments))); + } +} + +Function.prototype.bindAsEventListener = function(object) { + var __method = this; + return function(event) { + return __method.call(object, event || window.event); + } +} + +Object.extend(Number.prototype, { + toColorPart: function() { + var digits = this.toString(16); + if (this < 16) return '0' + digits; + return digits; + }, + + succ: function() { + return this + 1; + }, + + times: function(iterator) { + $R(0, this, true).each(iterator); + return this; + } +}); + +var Try = { + these: function() { + var returnValue; + + for (var i = 0; i < arguments.length; i++) { + var lambda = arguments[i]; + try { + returnValue = lambda(); + break; + } catch (e) {} + } + + return returnValue; + } +} + +/*--------------------------------------------------------------------------*/ + +var PeriodicalExecuter = Class.create(); +PeriodicalExecuter.prototype = { + initialize: function(callback, frequency) { + this.callback = callback; + this.frequency = frequency; + this.currentlyExecuting = false; + + this.registerCallback(); + }, + + registerCallback: function() { + setInterval(this.onTimerEvent.bind(this), this.frequency * 1000); + }, + + onTimerEvent: function() { + if (!this.currentlyExecuting) { + try { + this.currentlyExecuting = true; + this.callback(); + } finally { + this.currentlyExecuting = false; + } + } + } +} + +/*--------------------------------------------------------------------------*/ + +function $() { + var elements = new Array(); + + for (var i = 0; i < arguments.length; i++) { + var element = arguments[i]; + if (typeof element == 'string') + element = document.getElementById(element); + + if (arguments.length == 1) + return element; + + elements.push(element); + } + + return elements; +} +Object.extend(String.prototype, { + stripTags: function() { + return this.replace(/<\/?[^>]+>/gi, ''); + }, + + stripScripts: function() { + return this.replace(new RegExp(Prototype.ScriptFragment, 'img'), ''); + }, + + extractScripts: function() { + var matchAll = new RegExp(Prototype.ScriptFragment, 'img'); + var matchOne = new RegExp(Prototype.ScriptFragment, 'im'); + return (this.match(matchAll) || []).map(function(scriptTag) { + return (scriptTag.match(matchOne) || ['', ''])[1]; + }); + }, + + evalScripts: function() { + return this.extractScripts().map(eval); + }, + + escapeHTML: function() { + var div = document.createElement('div'); + var text = document.createTextNode(this); + div.appendChild(text); + return div.innerHTML; + }, + + unescapeHTML: function() { + var div = document.createElement('div'); + div.innerHTML = this.stripTags(); + return div.childNodes[0] ? div.childNodes[0].nodeValue : ''; + }, + + toQueryParams: function() { + var pairs = this.match(/^\??(.*)$/)[1].split('&'); + return pairs.inject({}, function(params, pairString) { + var pair = pairString.split('='); + params[pair[0]] = pair[1]; + return params; + }); + }, + + toArray: function() { + return this.split(''); + }, + + camelize: function() { + var oStringList = this.split('-'); + if (oStringList.length == 1) return oStringList[0]; + + var camelizedString = this.indexOf('-') == 0 + ? oStringList[0].charAt(0).toUpperCase() + oStringList[0].substring(1) + : oStringList[0]; + + for (var i = 1, len = oStringList.length; i < len; i++) { + var s = oStringList[i]; + camelizedString += s.charAt(0).toUpperCase() + s.substring(1); + } + + return camelizedString; + }, + + inspect: function() { + return "'" + this.replace('\\', '\\\\').replace("'", '\\\'') + "'"; + } +}); + +String.prototype.parseQuery = String.prototype.toQueryParams; + +var $break = new Object(); +var $continue = new Object(); + +var Enumerable = { + each: function(iterator) { + var index = 0; + try { + this._each(function(value) { + try { + iterator(value, index++); + } catch (e) { + if (e != $continue) throw e; + } + }); + } catch (e) { + if (e != $break) throw e; + } + }, + + all: function(iterator) { + var result = true; + this.each(function(value, index) { + result = result && !!(iterator || Prototype.K)(value, index); + if (!result) throw $break; + }); + return result; + }, + + any: function(iterator) { + var result = true; + this.each(function(value, index) { + if (result = !!(iterator || Prototype.K)(value, index)) + throw $break; + }); + return result; + }, + + collect: function(iterator) { + var results = []; + this.each(function(value, index) { + results.push(iterator(value, index)); + }); + return results; + }, + + detect: function (iterator) { + var result; + this.each(function(value, index) { + if (iterator(value, index)) { + result = value; + throw $break; + } + }); + return result; + }, + + findAll: function(iterator) { + var results = []; + this.each(function(value, index) { + if (iterator(value, index)) + results.push(value); + }); + return results; + }, + + grep: function(pattern, iterator) { + var results = []; + this.each(function(value, index) { + var stringValue = value.toString(); + if (stringValue.match(pattern)) + results.push((iterator || Prototype.K)(value, index)); + }) + return results; + }, + + include: function(object) { + var found = false; + this.each(function(value) { + if (value == object) { + found = true; + throw $break; + } + }); + return found; + }, + + inject: function(memo, iterator) { + this.each(function(value, index) { + memo = iterator(memo, value, index); + }); + return memo; + }, + + invoke: function(method) { + var args = $A(arguments).slice(1); + return this.collect(function(value) { + return value[method].apply(value, args); + }); + }, + + max: function(iterator) { + var result; + this.each(function(value, index) { + value = (iterator || Prototype.K)(value, index); + if (value >= (result || value)) + result = value; + }); + return result; + }, + + min: function(iterator) { + var result; + this.each(function(value, index) { + value = (iterator || Prototype.K)(value, index); + if (value <= (result || value)) + result = value; + }); + return result; + }, + + partition: function(iterator) { + var trues = [], falses = []; + this.each(function(value, index) { + ((iterator || Prototype.K)(value, index) ? + trues : falses).push(value); + }); + return [trues, falses]; + }, + + pluck: function(property) { + var results = []; + this.each(function(value, index) { + results.push(value[property]); + }); + return results; + }, + + reject: function(iterator) { + var results = []; + this.each(function(value, index) { + if (!iterator(value, index)) + results.push(value); + }); + return results; + }, + + sortBy: function(iterator) { + return this.collect(function(value, index) { + return {value: value, criteria: iterator(value, index)}; + }).sort(function(left, right) { + var a = left.criteria, b = right.criteria; + return a < b ? -1 : a > b ? 1 : 0; + }).pluck('value'); + }, + + toArray: function() { + return this.collect(Prototype.K); + }, + + zip: function() { + var iterator = Prototype.K, args = $A(arguments); + if (typeof args.last() == 'function') + iterator = args.pop(); + + var collections = [this].concat(args).map($A); + return this.map(function(value, index) { + iterator(value = collections.pluck(index)); + return value; + }); + }, + + inspect: function() { + return '#'; + } +} + +Object.extend(Enumerable, { + map: Enumerable.collect, + find: Enumerable.detect, + select: Enumerable.findAll, + member: Enumerable.include, + entries: Enumerable.toArray +}); +var $A = Array.from = function(iterable) { + if (!iterable) return []; + if (iterable.toArray) { + return iterable.toArray(); + } else { + var results = []; + for (var i = 0; i < iterable.length; i++) + results.push(iterable[i]); + return results; + } +} + +Object.extend(Array.prototype, Enumerable); + +Array.prototype._reverse = Array.prototype.reverse; + +Object.extend(Array.prototype, { + _each: function(iterator) { + for (var i = 0; i < this.length; i++) + iterator(this[i]); + }, + + clear: function() { + this.length = 0; + return this; + }, + + first: function() { + return this[0]; + }, + + last: function() { + return this[this.length - 1]; + }, + + compact: function() { + return this.select(function(value) { + return value != undefined || value != null; + }); + }, + + flatten: function() { + return this.inject([], function(array, value) { + return array.concat(value.constructor == Array ? + value.flatten() : [value]); + }); + }, + + without: function() { + var values = $A(arguments); + return this.select(function(value) { + return !values.include(value); + }); + }, + + indexOf: function(object) { + for (var i = 0; i < this.length; i++) + if (this[i] == object) return i; + return -1; + }, + + reverse: function(inline) { + return (inline !== false ? this : this.toArray())._reverse(); + }, + + shift: function() { + var result = this[0]; + for (var i = 0; i < this.length - 1; i++) + this[i] = this[i + 1]; + this.length--; + return result; + }, + + inspect: function() { + return '[' + this.map(Object.inspect).join(', ') + ']'; + } +}); +var Hash = { + _each: function(iterator) { + for (key in this) { + var value = this[key]; + if (typeof value == 'function') continue; + + var pair = [key, value]; + pair.key = key; + pair.value = value; + iterator(pair); + } + }, + + keys: function() { + return this.pluck('key'); + }, + + values: function() { + return this.pluck('value'); + }, + + merge: function(hash) { + return $H(hash).inject($H(this), function(mergedHash, pair) { + mergedHash[pair.key] = pair.value; + return mergedHash; + }); + }, + + toQueryString: function() { + return this.map(function(pair) { + return pair.map(encodeURIComponent).join('='); + }).join('&'); + }, + + inspect: function() { + return '#'; + } +} + +function $H(object) { + var hash = Object.extend({}, object || {}); + Object.extend(hash, Enumerable); + Object.extend(hash, Hash); + return hash; +} +ObjectRange = Class.create(); +Object.extend(ObjectRange.prototype, Enumerable); +Object.extend(ObjectRange.prototype, { + initialize: function(start, end, exclusive) { + this.start = start; + this.end = end; + this.exclusive = exclusive; + }, + + _each: function(iterator) { + var value = this.start; + do { + iterator(value); + value = value.succ(); + } while (this.include(value)); + }, + + include: function(value) { + if (value < this.start) + return false; + if (this.exclusive) + return value < this.end; + return value <= this.end; + } +}); + +var $R = function(start, end, exclusive) { + return new ObjectRange(start, end, exclusive); +} + +var Ajax = { + getTransport: function() { + return Try.these( + function() {return new ActiveXObject('Msxml2.XMLHTTP')}, + function() {return new ActiveXObject('Microsoft.XMLHTTP')}, + function() {return new XMLHttpRequest()} + ) || false; + }, + + activeRequestCount: 0 +} + +Ajax.Responders = { + responders: [], + + _each: function(iterator) { + this.responders._each(iterator); + }, + + register: function(responderToAdd) { + if (!this.include(responderToAdd)) + this.responders.push(responderToAdd); + }, + + unregister: function(responderToRemove) { + this.responders = this.responders.without(responderToRemove); + }, + + dispatch: function(callback, request, transport, json) { + this.each(function(responder) { + if (responder[callback] && typeof responder[callback] == 'function') { + try { + responder[callback].apply(responder, [request, transport, json]); + } catch (e) {} + } + }); + } +}; + +Object.extend(Ajax.Responders, Enumerable); + +Ajax.Responders.register({ + onCreate: function() { + Ajax.activeRequestCount++; + }, + + onComplete: function() { + Ajax.activeRequestCount--; + } +}); + +Ajax.Base = function() {}; +Ajax.Base.prototype = { + setOptions: function(options) { + this.options = { + method: 'post', + asynchronous: true, + parameters: '' + } + Object.extend(this.options, options || {}); + }, + + responseIsSuccess: function() { + return this.transport.status == undefined + || this.transport.status == 0 + || (this.transport.status >= 200 && this.transport.status < 300); + }, + + responseIsFailure: function() { + return !this.responseIsSuccess(); + } +} + +Ajax.Request = Class.create(); +Ajax.Request.Events = + ['Uninitialized', 'Loading', 'Loaded', 'Interactive', 'Complete']; + +Ajax.Request.prototype = Object.extend(new Ajax.Base(), { + initialize: function(url, options) { + this.transport = Ajax.getTransport(); + this.setOptions(options); + this.request(url); + }, + + request: function(url) { + var parameters = this.options.parameters || ''; + if (parameters.length > 0) parameters += '&_='; + + try { + this.url = url; + if (this.options.method == 'get' && parameters.length > 0) + this.url += (this.url.match(/\?/) ? '&' : '?') + parameters; + + Ajax.Responders.dispatch('onCreate', this, this.transport); + + this.transport.open(this.options.method, this.url, + this.options.asynchronous); + + if (this.options.asynchronous) { + this.transport.onreadystatechange = this.onStateChange.bind(this); + setTimeout((function() {this.respondToReadyState(1)}).bind(this), 10); + } + + this.setRequestHeaders(); + + var body = this.options.postBody ? this.options.postBody : parameters; + this.transport.send(this.options.method == 'post' ? body : null); + + } catch (e) { + this.dispatchException(e); + } + }, + + setRequestHeaders: function() { + var requestHeaders = + ['X-Requested-With', 'XMLHttpRequest', + 'X-Prototype-Version', Prototype.Version]; + + if (this.options.method == 'post') { + requestHeaders.push('Content-type', + 'application/x-www-form-urlencoded'); + + /* Force "Connection: close" for Mozilla browsers to work around + * a bug where XMLHttpReqeuest sends an incorrect Content-length + * header. See Mozilla Bugzilla #246651. + */ + if (this.transport.overrideMimeType) + requestHeaders.push('Connection', 'close'); + } + + if (this.options.requestHeaders) + requestHeaders.push.apply(requestHeaders, this.options.requestHeaders); + + for (var i = 0; i < requestHeaders.length; i += 2) + this.transport.setRequestHeader(requestHeaders[i], requestHeaders[i+1]); + }, + + onStateChange: function() { + var readyState = this.transport.readyState; + if (readyState != 1) + this.respondToReadyState(this.transport.readyState); + }, + + header: function(name) { + try { + return this.transport.getResponseHeader(name); + } catch (e) {} + }, + + evalJSON: function() { + try { + return eval(this.header('X-JSON')); + } catch (e) {} + }, + + evalResponse: function() { + try { + return eval(this.transport.responseText); + } catch (e) { + this.dispatchException(e); + } + }, + + respondToReadyState: function(readyState) { + var event = Ajax.Request.Events[readyState]; + var transport = this.transport, json = this.evalJSON(); + + if (event == 'Complete') { + try { + (this.options['on' + this.transport.status] + || this.options['on' + (this.responseIsSuccess() ? 'Success' : 'Failure')] + || Prototype.emptyFunction)(transport, json); + } catch (e) { + this.dispatchException(e); + } + + if ((this.header('Content-type') || '').match(/^text\/javascript/i)) + this.evalResponse(); + } + + try { + (this.options['on' + event] || Prototype.emptyFunction)(transport, json); + Ajax.Responders.dispatch('on' + event, this, transport, json); + } catch (e) { + this.dispatchException(e); + } + + /* Avoid memory leak in MSIE: clean up the oncomplete event handler */ + if (event == 'Complete') + this.transport.onreadystatechange = Prototype.emptyFunction; + }, + + dispatchException: function(exception) { + (this.options.onException || Prototype.emptyFunction)(this, exception); + Ajax.Responders.dispatch('onException', this, exception); + } +}); + +Ajax.Updater = Class.create(); + +Object.extend(Object.extend(Ajax.Updater.prototype, Ajax.Request.prototype), { + initialize: function(container, url, options) { + this.containers = { + success: container.success ? $(container.success) : $(container), + failure: container.failure ? $(container.failure) : + (container.success ? null : $(container)) + } + + this.transport = Ajax.getTransport(); + this.setOptions(options); + + var onComplete = this.options.onComplete || Prototype.emptyFunction; + this.options.onComplete = (function(transport, object) { + this.updateContent(); + onComplete(transport, object); + }).bind(this); + + this.request(url); + }, + + updateContent: function() { + var receiver = this.responseIsSuccess() ? + this.containers.success : this.containers.failure; + var response = this.transport.responseText; + + if (!this.options.evalScripts) + response = response.stripScripts(); + + if (receiver) { + if (this.options.insertion) { + new this.options.insertion(receiver, response); + } else { + Element.update(receiver, response); + } + } + + if (this.responseIsSuccess()) { + if (this.onComplete) + setTimeout(this.onComplete.bind(this), 10); + } + } +}); + +Ajax.PeriodicalUpdater = Class.create(); +Ajax.PeriodicalUpdater.prototype = Object.extend(new Ajax.Base(), { + initialize: function(container, url, options) { + this.setOptions(options); + this.onComplete = this.options.onComplete; + + this.frequency = (this.options.frequency || 2); + this.decay = (this.options.decay || 1); + + this.updater = {}; + this.container = container; + this.url = url; + + this.start(); + }, + + start: function() { + this.options.onComplete = this.updateComplete.bind(this); + this.onTimerEvent(); + }, + + stop: function() { + this.updater.onComplete = undefined; + clearTimeout(this.timer); + (this.onComplete || Prototype.emptyFunction).apply(this, arguments); + }, + + updateComplete: function(request) { + if (this.options.decay) { + this.decay = (request.responseText == this.lastText ? + this.decay * this.options.decay : 1); + + this.lastText = request.responseText; + } + this.timer = setTimeout(this.onTimerEvent.bind(this), + this.decay * this.frequency * 1000); + }, + + onTimerEvent: function() { + this.updater = new Ajax.Updater(this.container, this.url, this.options); + } +}); +document.getElementsByClassName = function(className, parentElement) { + var children = ($(parentElement) || document.body).getElementsByTagName('*'); + return $A(children).inject([], function(elements, child) { + if (child.className.match(new RegExp("(^|\\s)" + className + "(\\s|$)"))) + elements.push(child); + return elements; + }); +} + +/*--------------------------------------------------------------------------*/ + +if (!window.Element) { + var Element = new Object(); +} + +Object.extend(Element, { + visible: function(element) { + return $(element).style.display != 'none'; + }, + + toggle: function() { + for (var i = 0; i < arguments.length; i++) { + var element = $(arguments[i]); + Element[Element.visible(element) ? 'hide' : 'show'](element); + } + }, + + hide: function() { + for (var i = 0; i < arguments.length; i++) { + var element = $(arguments[i]); + element.style.display = 'none'; + } + }, + + show: function() { + for (var i = 0; i < arguments.length; i++) { + var element = $(arguments[i]); + element.style.display = ''; + } + }, + + remove: function(element) { + element = $(element); + element.parentNode.removeChild(element); + }, + + update: function(element, html) { + $(element).innerHTML = html.stripScripts(); + setTimeout(function() {html.evalScripts()}, 10); + }, + + getHeight: function(element) { + element = $(element); + return element.offsetHeight; + }, + + classNames: function(element) { + return new Element.ClassNames(element); + }, + + hasClassName: function(element, className) { + if (!(element = $(element))) return; + return Element.classNames(element).include(className); + }, + + addClassName: function(element, className) { + if (!(element = $(element))) return; + return Element.classNames(element).add(className); + }, + + removeClassName: function(element, className) { + if (!(element = $(element))) return; + return Element.classNames(element).remove(className); + }, + + // removes whitespace-only text node children + cleanWhitespace: function(element) { + element = $(element); + for (var i = 0; i < element.childNodes.length; i++) { + var node = element.childNodes[i]; + if (node.nodeType == 3 && !/\S/.test(node.nodeValue)) + Element.remove(node); + } + }, + + empty: function(element) { + return $(element).innerHTML.match(/^\s*$/); + }, + + scrollTo: function(element) { + element = $(element); + var x = element.x ? element.x : element.offsetLeft, + y = element.y ? element.y : element.offsetTop; + window.scrollTo(x, y); + }, + + getStyle: function(element, style) { + element = $(element); + var value = element.style[style.camelize()]; + if (!value) { + if (document.defaultView && document.defaultView.getComputedStyle) { + var css = document.defaultView.getComputedStyle(element, null); + value = css ? css.getPropertyValue(style) : null; + } else if (element.currentStyle) { + value = element.currentStyle[style.camelize()]; + } + } + + if (window.opera && ['left', 'top', 'right', 'bottom'].include(style)) + if (Element.getStyle(element, 'position') == 'static') value = 'auto'; + + return value == 'auto' ? null : value; + }, + + setStyle: function(element, style) { + element = $(element); + for (name in style) + element.style[name.camelize()] = style[name]; + }, + + getDimensions: function(element) { + element = $(element); + if (Element.getStyle(element, 'display') != 'none') + return {width: element.offsetWidth, height: element.offsetHeight}; + + // All *Width and *Height properties give 0 on elements with display none, + // so enable the element temporarily + var els = element.style; + var originalVisibility = els.visibility; + var originalPosition = els.position; + els.visibility = 'hidden'; + els.position = 'absolute'; + els.display = ''; + var originalWidth = element.clientWidth; + var originalHeight = element.clientHeight; + els.display = 'none'; + els.position = originalPosition; + els.visibility = originalVisibility; + return {width: originalWidth, height: originalHeight}; + }, + + makePositioned: function(element) { + element = $(element); + var pos = Element.getStyle(element, 'position'); + if (pos == 'static' || !pos) { + element._madePositioned = true; + element.style.position = 'relative'; + // Opera returns the offset relative to the positioning context, when an + // element is position relative but top and left have not been defined + if (window.opera) { + element.style.top = 0; + element.style.left = 0; + } + } + }, + + undoPositioned: function(element) { + element = $(element); + if (element._madePositioned) { + element._madePositioned = undefined; + element.style.position = + element.style.top = + element.style.left = + element.style.bottom = + element.style.right = ''; + } + }, + + makeClipping: function(element) { + element = $(element); + if (element._overflow) return; + element._overflow = element.style.overflow; + if ((Element.getStyle(element, 'overflow') || 'visible') != 'hidden') + element.style.overflow = 'hidden'; + }, + + undoClipping: function(element) { + element = $(element); + if (element._overflow) return; + element.style.overflow = element._overflow; + element._overflow = undefined; + } +}); + +var Toggle = new Object(); +Toggle.display = Element.toggle; + +/*--------------------------------------------------------------------------*/ + +Abstract.Insertion = function(adjacency) { + this.adjacency = adjacency; +} + +Abstract.Insertion.prototype = { + initialize: function(element, content) { + this.element = $(element); + this.content = content.stripScripts(); + + if (this.adjacency && this.element.insertAdjacentHTML) { + try { + this.element.insertAdjacentHTML(this.adjacency, this.content); + } catch (e) { + if (this.element.tagName.toLowerCase() == 'tbody') { + this.insertContent(this.contentFromAnonymousTable()); + } else { + throw e; + } + } + } else { + this.range = this.element.ownerDocument.createRange(); + if (this.initializeRange) this.initializeRange(); + this.insertContent([this.range.createContextualFragment(this.content)]); + } + + setTimeout(function() {content.evalScripts()}, 10); + }, + + contentFromAnonymousTable: function() { + var div = document.createElement('div'); + div.innerHTML = '' + this.content + '
    '; + return $A(div.childNodes[0].childNodes[0].childNodes); + } +} + +var Insertion = new Object(); + +Insertion.Before = Class.create(); +Insertion.Before.prototype = Object.extend(new Abstract.Insertion('beforeBegin'), { + initializeRange: function() { + this.range.setStartBefore(this.element); + }, + + insertContent: function(fragments) { + fragments.each((function(fragment) { + this.element.parentNode.insertBefore(fragment, this.element); + }).bind(this)); + } +}); + +Insertion.Top = Class.create(); +Insertion.Top.prototype = Object.extend(new Abstract.Insertion('afterBegin'), { + initializeRange: function() { + this.range.selectNodeContents(this.element); + this.range.collapse(true); + }, + + insertContent: function(fragments) { + fragments.reverse(false).each((function(fragment) { + this.element.insertBefore(fragment, this.element.firstChild); + }).bind(this)); + } +}); + +Insertion.Bottom = Class.create(); +Insertion.Bottom.prototype = Object.extend(new Abstract.Insertion('beforeEnd'), { + initializeRange: function() { + this.range.selectNodeContents(this.element); + this.range.collapse(this.element); + }, + + insertContent: function(fragments) { + fragments.each((function(fragment) { + this.element.appendChild(fragment); + }).bind(this)); + } +}); + +Insertion.After = Class.create(); +Insertion.After.prototype = Object.extend(new Abstract.Insertion('afterEnd'), { + initializeRange: function() { + this.range.setStartAfter(this.element); + }, + + insertContent: function(fragments) { + fragments.each((function(fragment) { + this.element.parentNode.insertBefore(fragment, + this.element.nextSibling); + }).bind(this)); + } +}); + +/*--------------------------------------------------------------------------*/ + +Element.ClassNames = Class.create(); +Element.ClassNames.prototype = { + initialize: function(element) { + this.element = $(element); + }, + + _each: function(iterator) { + this.element.className.split(/\s+/).select(function(name) { + return name.length > 0; + })._each(iterator); + }, + + set: function(className) { + this.element.className = className; + }, + + add: function(classNameToAdd) { + if (this.include(classNameToAdd)) return; + this.set(this.toArray().concat(classNameToAdd).join(' ')); + }, + + remove: function(classNameToRemove) { + if (!this.include(classNameToRemove)) return; + this.set(this.select(function(className) { + return className != classNameToRemove; + }).join(' ')); + }, + + toString: function() { + return this.toArray().join(' '); + } +} + +Object.extend(Element.ClassNames.prototype, Enumerable); +var Field = { + clear: function() { + for (var i = 0; i < arguments.length; i++) + $(arguments[i]).value = ''; + }, + + focus: function(element) { + $(element).focus(); + }, + + present: function() { + for (var i = 0; i < arguments.length; i++) + if ($(arguments[i]).value == '') return false; + return true; + }, + + select: function(element) { + $(element).select(); + }, + + activate: function(element) { + element = $(element); + element.focus(); + if (element.select) + element.select(); + } +} + +/*--------------------------------------------------------------------------*/ + +var Form = { + serialize: function(form) { + var elements = Form.getElements($(form)); + var queryComponents = new Array(); + + for (var i = 0; i < elements.length; i++) { + var queryComponent = Form.Element.serialize(elements[i]); + if (queryComponent) + queryComponents.push(queryComponent); + } + + return queryComponents.join('&'); + }, + + getElements: function(form) { + form = $(form); + var elements = new Array(); + + for (tagName in Form.Element.Serializers) { + var tagElements = form.getElementsByTagName(tagName); + for (var j = 0; j < tagElements.length; j++) + elements.push(tagElements[j]); + } + return elements; + }, + + getInputs: function(form, typeName, name) { + form = $(form); + var inputs = form.getElementsByTagName('input'); + + if (!typeName && !name) + return inputs; + + var matchingInputs = new Array(); + for (var i = 0; i < inputs.length; i++) { + var input = inputs[i]; + if ((typeName && input.type != typeName) || + (name && input.name != name)) + continue; + matchingInputs.push(input); + } + + return matchingInputs; + }, + + disable: function(form) { + var elements = Form.getElements(form); + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + element.blur(); + element.disabled = 'true'; + } + }, + + enable: function(form) { + var elements = Form.getElements(form); + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + element.disabled = ''; + } + }, + + findFirstElement: function(form) { + return Form.getElements(form).find(function(element) { + return element.type != 'hidden' && !element.disabled && + ['input', 'select', 'textarea'].include(element.tagName.toLowerCase()); + }); + }, + + focusFirstElement: function(form) { + Field.activate(Form.findFirstElement(form)); + }, + + reset: function(form) { + $(form).reset(); + } +} + +Form.Element = { + serialize: function(element) { + element = $(element); + var method = element.tagName.toLowerCase(); + var parameter = Form.Element.Serializers[method](element); + + if (parameter) { + var key = encodeURIComponent(parameter[0]); + if (key.length == 0) return; + + if (parameter[1].constructor != Array) + parameter[1] = [parameter[1]]; + + return parameter[1].map(function(value) { + return key + '=' + encodeURIComponent(value); + }).join('&'); + } + }, + + getValue: function(element) { + element = $(element); + var method = element.tagName.toLowerCase(); + var parameter = Form.Element.Serializers[method](element); + + if (parameter) + return parameter[1]; + } +} + +Form.Element.Serializers = { + input: function(element) { + switch (element.type.toLowerCase()) { + case 'submit': + case 'hidden': + case 'password': + case 'text': + return Form.Element.Serializers.textarea(element); + case 'checkbox': + case 'radio': + return Form.Element.Serializers.inputSelector(element); + } + return false; + }, + + inputSelector: function(element) { + if (element.checked) + return [element.name, element.value]; + }, + + textarea: function(element) { + return [element.name, element.value]; + }, + + select: function(element) { + return Form.Element.Serializers[element.type == 'select-one' ? + 'selectOne' : 'selectMany'](element); + }, + + selectOne: function(element) { + var value = '', opt, index = element.selectedIndex; + if (index >= 0) { + opt = element.options[index]; + value = opt.value; + if (!value && !('value' in opt)) + value = opt.text; + } + return [element.name, value]; + }, + + selectMany: function(element) { + var value = new Array(); + for (var i = 0; i < element.length; i++) { + var opt = element.options[i]; + if (opt.selected) { + var optValue = opt.value; + if (!optValue && !('value' in opt)) + optValue = opt.text; + value.push(optValue); + } + } + return [element.name, value]; + } +} + +/*--------------------------------------------------------------------------*/ + +var $F = Form.Element.getValue; + +/*--------------------------------------------------------------------------*/ + +Abstract.TimedObserver = function() {} +Abstract.TimedObserver.prototype = { + initialize: function(element, frequency, callback) { + this.frequency = frequency; + this.element = $(element); + this.callback = callback; + + this.lastValue = this.getValue(); + this.registerCallback(); + }, + + registerCallback: function() { + setInterval(this.onTimerEvent.bind(this), this.frequency * 1000); + }, + + onTimerEvent: function() { + var value = this.getValue(); + if (this.lastValue != value) { + this.callback(this.element, value); + this.lastValue = value; + } + } +} + +Form.Element.Observer = Class.create(); +Form.Element.Observer.prototype = Object.extend(new Abstract.TimedObserver(), { + getValue: function() { + return Form.Element.getValue(this.element); + } +}); + +Form.Observer = Class.create(); +Form.Observer.prototype = Object.extend(new Abstract.TimedObserver(), { + getValue: function() { + return Form.serialize(this.element); + } +}); + +/*--------------------------------------------------------------------------*/ + +Abstract.EventObserver = function() {} +Abstract.EventObserver.prototype = { + initialize: function(element, callback) { + this.element = $(element); + this.callback = callback; + + this.lastValue = this.getValue(); + if (this.element.tagName.toLowerCase() == 'form') + this.registerFormCallbacks(); + else + this.registerCallback(this.element); + }, + + onElementEvent: function() { + var value = this.getValue(); + if (this.lastValue != value) { + this.callback(this.element, value); + this.lastValue = value; + } + }, + + registerFormCallbacks: function() { + var elements = Form.getElements(this.element); + for (var i = 0; i < elements.length; i++) + this.registerCallback(elements[i]); + }, + + registerCallback: function(element) { + if (element.type) { + switch (element.type.toLowerCase()) { + case 'checkbox': + case 'radio': + Event.observe(element, 'click', this.onElementEvent.bind(this)); + break; + case 'password': + case 'text': + case 'textarea': + case 'select-one': + case 'select-multiple': + Event.observe(element, 'change', this.onElementEvent.bind(this)); + break; + } + } + } +} + +Form.Element.EventObserver = Class.create(); +Form.Element.EventObserver.prototype = Object.extend(new Abstract.EventObserver(), { + getValue: function() { + return Form.Element.getValue(this.element); + } +}); + +Form.EventObserver = Class.create(); +Form.EventObserver.prototype = Object.extend(new Abstract.EventObserver(), { + getValue: function() { + return Form.serialize(this.element); + } +}); +if (!window.Event) { + var Event = new Object(); +} + +Object.extend(Event, { + KEY_BACKSPACE: 8, + KEY_TAB: 9, + KEY_RETURN: 13, + KEY_ESC: 27, + KEY_LEFT: 37, + KEY_UP: 38, + KEY_RIGHT: 39, + KEY_DOWN: 40, + KEY_DELETE: 46, + + element: function(event) { + return event.target || event.srcElement; + }, + + isLeftClick: function(event) { + return (((event.which) && (event.which == 1)) || + ((event.button) && (event.button == 1))); + }, + + pointerX: function(event) { + return event.pageX || (event.clientX + + (document.documentElement.scrollLeft || document.body.scrollLeft)); + }, + + pointerY: function(event) { + return event.pageY || (event.clientY + + (document.documentElement.scrollTop || document.body.scrollTop)); + }, + + stop: function(event) { + if (event.preventDefault) { + event.preventDefault(); + event.stopPropagation(); + } else { + event.returnValue = false; + event.cancelBubble = true; + } + }, + + // find the first node with the given tagName, starting from the + // node the event was triggered on; traverses the DOM upwards + findElement: function(event, tagName) { + var element = Event.element(event); + while (element.parentNode && (!element.tagName || + (element.tagName.toUpperCase() != tagName.toUpperCase()))) + element = element.parentNode; + return element; + }, + + observers: false, + + _observeAndCache: function(element, name, observer, useCapture) { + if (!this.observers) this.observers = []; + if (element.addEventListener) { + this.observers.push([element, name, observer, useCapture]); + element.addEventListener(name, observer, useCapture); + } else if (element.attachEvent) { + this.observers.push([element, name, observer, useCapture]); + element.attachEvent('on' + name, observer); + } + }, + + unloadCache: function() { + if (!Event.observers) return; + for (var i = 0; i < Event.observers.length; i++) { + Event.stopObserving.apply(this, Event.observers[i]); + Event.observers[i][0] = null; + } + Event.observers = false; + }, + + observe: function(element, name, observer, useCapture) { + var element = $(element); + useCapture = useCapture || false; + + if (name == 'keypress' && + (navigator.appVersion.match(/Konqueror|Safari|KHTML/) + || element.attachEvent)) + name = 'keydown'; + + this._observeAndCache(element, name, observer, useCapture); + }, + + stopObserving: function(element, name, observer, useCapture) { + var element = $(element); + useCapture = useCapture || false; + + if (name == 'keypress' && + (navigator.appVersion.match(/Konqueror|Safari|KHTML/) + || element.detachEvent)) + name = 'keydown'; + + if (element.removeEventListener) { + element.removeEventListener(name, observer, useCapture); + } else if (element.detachEvent) { + element.detachEvent('on' + name, observer); + } + } +}); + +/* prevent memory leaks in IE */ +Event.observe(window, 'unload', Event.unloadCache, false); +var Position = { + // set to true if needed, warning: firefox performance problems + // NOT neeeded for page scrolling, only if draggable contained in + // scrollable elements + includeScrollOffsets: false, + + // must be called before calling withinIncludingScrolloffset, every time the + // page is scrolled + prepare: function() { + this.deltaX = window.pageXOffset + || document.documentElement.scrollLeft + || document.body.scrollLeft + || 0; + this.deltaY = window.pageYOffset + || document.documentElement.scrollTop + || document.body.scrollTop + || 0; + }, + + realOffset: function(element) { + var valueT = 0, valueL = 0; + do { + valueT += element.scrollTop || 0; + valueL += element.scrollLeft || 0; + element = element.parentNode; + } while (element); + return [valueL, valueT]; + }, + + cumulativeOffset: function(element) { + var valueT = 0, valueL = 0; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + element = element.offsetParent; + } while (element); + return [valueL, valueT]; + }, + + positionedOffset: function(element) { + var valueT = 0, valueL = 0; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + element = element.offsetParent; + if (element) { + p = Element.getStyle(element, 'position'); + if (p == 'relative' || p == 'absolute') break; + } + } while (element); + return [valueL, valueT]; + }, + + offsetParent: function(element) { + if (element.offsetParent) return element.offsetParent; + if (element == document.body) return element; + + while ((element = element.parentNode) && element != document.body) + if (Element.getStyle(element, 'position') != 'static') + return element; + + return document.body; + }, + + // caches x/y coordinate pair to use with overlap + within: function(element, x, y) { + if (this.includeScrollOffsets) + return this.withinIncludingScrolloffsets(element, x, y); + this.xcomp = x; + this.ycomp = y; + this.offset = this.cumulativeOffset(element); + + return (y >= this.offset[1] && + y < this.offset[1] + element.offsetHeight && + x >= this.offset[0] && + x < this.offset[0] + element.offsetWidth); + }, + + withinIncludingScrolloffsets: function(element, x, y) { + var offsetcache = this.realOffset(element); + + this.xcomp = x + offsetcache[0] - this.deltaX; + this.ycomp = y + offsetcache[1] - this.deltaY; + this.offset = this.cumulativeOffset(element); + + return (this.ycomp >= this.offset[1] && + this.ycomp < this.offset[1] + element.offsetHeight && + this.xcomp >= this.offset[0] && + this.xcomp < this.offset[0] + element.offsetWidth); + }, + + // within must be called directly before + overlap: function(mode, element) { + if (!mode) return 0; + if (mode == 'vertical') + return ((this.offset[1] + element.offsetHeight) - this.ycomp) / + element.offsetHeight; + if (mode == 'horizontal') + return ((this.offset[0] + element.offsetWidth) - this.xcomp) / + element.offsetWidth; + }, + + clone: function(source, target) { + source = $(source); + target = $(target); + target.style.position = 'absolute'; + var offsets = this.cumulativeOffset(source); + target.style.top = offsets[1] + 'px'; + target.style.left = offsets[0] + 'px'; + target.style.width = source.offsetWidth + 'px'; + target.style.height = source.offsetHeight + 'px'; + }, + + page: function(forElement) { + var valueT = 0, valueL = 0; + + var element = forElement; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + + // Safari fix + if (element.offsetParent==document.body) + if (Element.getStyle(element,'position')=='absolute') break; + + } while (element = element.offsetParent); + + element = forElement; + do { + valueT -= element.scrollTop || 0; + valueL -= element.scrollLeft || 0; + } while (element = element.parentNode); + + return [valueL, valueT]; + }, + + clone: function(source, target) { + var options = Object.extend({ + setLeft: true, + setTop: true, + setWidth: true, + setHeight: true, + offsetTop: 0, + offsetLeft: 0 + }, arguments[2] || {}) + + // find page position of source + source = $(source); + var p = Position.page(source); + + // find coordinate system to use + target = $(target); + var delta = [0, 0]; + var parent = null; + // delta [0,0] will do fine with position: fixed elements, + // position:absolute needs offsetParent deltas + if (Element.getStyle(target,'position') == 'absolute') { + parent = Position.offsetParent(target); + delta = Position.page(parent); + } + + // correct by body offsets (fixes Safari) + if (parent == document.body) { + delta[0] -= document.body.offsetLeft; + delta[1] -= document.body.offsetTop; + } + + // set position + if(options.setLeft) target.style.left = (p[0] - delta[0] + options.offsetLeft) + 'px'; + if(options.setTop) target.style.top = (p[1] - delta[1] + options.offsetTop) + 'px'; + if(options.setWidth) target.style.width = source.offsetWidth + 'px'; + if(options.setHeight) target.style.height = source.offsetHeight + 'px'; + }, + + absolutize: function(element) { + element = $(element); + if (element.style.position == 'absolute') return; + Position.prepare(); + + var offsets = Position.positionedOffset(element); + var top = offsets[1]; + var left = offsets[0]; + var width = element.clientWidth; + var height = element.clientHeight; + + element._originalLeft = left - parseFloat(element.style.left || 0); + element._originalTop = top - parseFloat(element.style.top || 0); + element._originalWidth = element.style.width; + element._originalHeight = element.style.height; + + element.style.position = 'absolute'; + element.style.top = top + 'px';; + element.style.left = left + 'px';; + element.style.width = width + 'px';; + element.style.height = height + 'px';; + }, + + relativize: function(element) { + element = $(element); + if (element.style.position == 'relative') return; + Position.prepare(); + + element.style.position = 'relative'; + var top = parseFloat(element.style.top || 0) - (element._originalTop || 0); + var left = parseFloat(element.style.left || 0) - (element._originalLeft || 0); + + element.style.top = top + 'px'; + element.style.left = left + 'px'; + element.style.height = element._originalHeight; + element.style.width = element._originalWidth; + } +} + +// Safari returns margins on body which is incorrect if the child is absolutely +// positioned. For performance reasons, redefine Position.cumulativeOffset for +// KHTML/WebKit only. +if (/Konqueror|Safari|KHTML/.test(navigator.userAgent)) { + Position.cumulativeOffset = function(element) { + var valueT = 0, valueL = 0; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + if (element.offsetParent == document.body) + if (Element.getStyle(element, 'position') == 'absolute') break; + + element = element.offsetParent; + } while (element); + + return [valueL, valueT]; + } +} \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/robots.txt b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/robots.txt new file mode 100644 index 00000000..4ab9e89f --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/public/robots.txt @@ -0,0 +1 @@ +# See http://www.robotstxt.org/wc/norobots.html for documentation on how to use the robots.txt file \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/about b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/about new file mode 100644 index 00000000..7b07d46a --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/about @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/about' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/breakpointer b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/breakpointer new file mode 100644 index 00000000..64af76ed --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/breakpointer @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/breakpointer' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/console b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/console new file mode 100644 index 00000000..42f28f7d --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/console @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/console' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/destroy b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/destroy new file mode 100644 index 00000000..fa0e6fcd --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/destroy @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/destroy' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/generate b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/generate new file mode 100644 index 00000000..ef976e09 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/generate @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/generate' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/benchmarker b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/benchmarker new file mode 100644 index 00000000..c842d35d --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/benchmarker @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../../config/boot' +require 'commands/performance/benchmarker' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/profiler b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/profiler new file mode 100644 index 00000000..d855ac8b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/performance/profiler @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../../config/boot' +require 'commands/performance/profiler' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/plugin b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/plugin new file mode 100644 index 00000000..26ca64c0 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/plugin @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/plugin' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/reaper b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/reaper new file mode 100644 index 00000000..c77f0453 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/reaper @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../../config/boot' +require 'commands/process/reaper' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spawner b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spawner new file mode 100644 index 00000000..7118f398 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spawner @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../../config/boot' +require 'commands/process/spawner' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spinner b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spinner new file mode 100644 index 00000000..6816b32e --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/process/spinner @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../../config/boot' +require 'commands/process/spinner' diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/runner b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/runner new file mode 100644 index 00000000..ccc30f9d --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/runner @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/runner' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/server b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/server new file mode 100644 index 00000000..dfabcb88 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/script/server @@ -0,0 +1,3 @@ +#!/usr/bin/env ruby +require File.dirname(__FILE__) + '/../config/boot' +require 'commands/server' \ No newline at end of file diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/login_controller_test.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/login_controller_test.rb new file mode 100644 index 00000000..a21d4382 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/login_controller_test.rb @@ -0,0 +1,18 @@ +require File.dirname(__FILE__) + '/../test_helper' +require 'login_controller' + +# Re-raise errors caught by the controller. +class LoginController; def rescue_action(e) raise e end; end + +class LoginControllerTest < Test::Unit::TestCase + def setup + @controller = LoginController.new + @request = ActionController::TestRequest.new + @response = ActionController::TestResponse.new + end + + # Replace this with your real tests. + def test_truth + assert true + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/server_controller_test.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/server_controller_test.rb new file mode 100644 index 00000000..7afd69e6 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/functional/server_controller_test.rb @@ -0,0 +1,18 @@ +require File.dirname(__FILE__) + '/../test_helper' +require 'server_controller' + +# Re-raise errors caught by the controller. +class ServerController; def rescue_action(e) raise e end; end + +class ServerControllerTest < Test::Unit::TestCase + def setup + @controller = ServerController.new + @request = ActionController::TestRequest.new + @response = ActionController::TestResponse.new + end + + # Replace this with your real tests. + def test_truth + assert true + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/test_helper.rb b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/test_helper.rb new file mode 100644 index 00000000..a299c7f6 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/examples/rails_openid/test/test_helper.rb @@ -0,0 +1,28 @@ +ENV["RAILS_ENV"] = "test" +require File.expand_path(File.dirname(__FILE__) + "/../config/environment") +require 'test_help' + +class Test::Unit::TestCase + # Transactional fixtures accelerate your tests by wrapping each test method + # in a transaction that's rolled back on completion. This ensures that the + # test database remains unchanged so your fixtures don't have to be reloaded + # between every test method. Fewer database queries means faster tests. + # + # Read Mike Clark's excellent walkthrough at + # http://clarkware.com/cgi/blosxom/2005/10/24#Rails10FastTesting + # + # Every Active Record database supports transactions except MyISAM tables + # in MySQL. Turn off transactional fixtures in this case; however, if you + # don't care one way or the other, switching from MyISAM to InnoDB tables + # is recommended. + self.use_transactional_fixtures = true + + # Instantiated fixtures are slow, but give you @david where otherwise you + # would need people(:david). If you don't want to migrate your existing + # test cases which use the @david style and don't mind the speed hit (each + # instantiated fixtures translates to a database query per test method), + # then set this back to true. + self.use_instantiated_fixtures = false + + # Add more helper methods to be used by all tests here... +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/hmac/hmac.rb b/vendor/gems/ruby-openid-2.1.2/lib/hmac/hmac.rb new file mode 100644 index 00000000..e8bfa42b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/hmac/hmac.rb @@ -0,0 +1,112 @@ +# Copyright (C) 2001 Daiki Ueno +# This library is distributed under the terms of the Ruby license. + +# This module provides common interface to HMAC engines. +# HMAC standard is documented in RFC 2104: +# +# H. Krawczyk et al., "HMAC: Keyed-Hashing for Message Authentication", +# RFC 2104, February 1997 +# +# These APIs are inspired by JCE 1.2's javax.crypto.Mac interface. +# +# + +module HMAC + class Base + def initialize(algorithm, block_size, output_length, key) + @algorithm = algorithm + @block_size = block_size + @output_length = output_length + @status = STATUS_UNDEFINED + @key_xor_ipad = '' + @key_xor_opad = '' + set_key(key) unless key.nil? + end + + private + def check_status + unless @status == STATUS_INITIALIZED + raise RuntimeError, + "The underlying hash algorithm has not yet been initialized." + end + end + + public + def set_key(key) + # If key is longer than the block size, apply hash function + # to key and use the result as a real key. + key = @algorithm.digest(key) if key.size > @block_size + key_xor_ipad = "\x36" * @block_size + key_xor_opad = "\x5C" * @block_size + for i in 0 .. key.size - 1 + key_xor_ipad[i] ^= key[i] + key_xor_opad[i] ^= key[i] + end + @key_xor_ipad = key_xor_ipad + @key_xor_opad = key_xor_opad + @md = @algorithm.new + @status = STATUS_INITIALIZED + end + + def reset_key + @key_xor_ipad.gsub!(/./, '?') + @key_xor_opad.gsub!(/./, '?') + @key_xor_ipad[0..-1] = '' + @key_xor_opad[0..-1] = '' + @status = STATUS_UNDEFINED + end + + def update(text) + check_status + # perform inner H + md = @algorithm.new + md.update(@key_xor_ipad) + md.update(text) + str = md.digest + # perform outer H + md = @algorithm.new + md.update(@key_xor_opad) + md.update(str) + @md = md + end + alias << update + + def digest + check_status + @md.digest + end + + def hexdigest + check_status + @md.hexdigest + end + alias to_s hexdigest + + # These two class methods below are safer than using above + # instance methods combinatorially because an instance will have + # held a key even if it's no longer in use. + def Base.digest(key, text) + begin + hmac = self.new(key) + hmac.update(text) + hmac.digest + ensure + hmac.reset_key + end + end + + def Base.hexdigest(key, text) + begin + hmac = self.new(key) + hmac.update(text) + hmac.hexdigest + ensure + hmac.reset_key + end + end + + private_class_method :new, :digest, :hexdigest + end + + STATUS_UNDEFINED, STATUS_INITIALIZED = 0, 1 +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/hmac/sha1.rb b/vendor/gems/ruby-openid-2.1.2/lib/hmac/sha1.rb new file mode 100644 index 00000000..d2f0088a --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/hmac/sha1.rb @@ -0,0 +1,11 @@ +require 'hmac/hmac' +require 'digest/sha1' + +module HMAC + class SHA1 < Base + def initialize(key = nil) + super(Digest::SHA1, 64, 20, key) + end + public_class_method :new, :digest, :hexdigest + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/hmac/sha2.rb b/vendor/gems/ruby-openid-2.1.2/lib/hmac/sha2.rb new file mode 100644 index 00000000..0412ba40 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/hmac/sha2.rb @@ -0,0 +1,25 @@ +require 'hmac/hmac' +require 'digest/sha2' + +module HMAC + class SHA256 < Base + def initialize(key = nil) + super(Digest::SHA256, 64, 32, key) + end + public_class_method :new, :digest, :hexdigest + end + + class SHA384 < Base + def initialize(key = nil) + super(Digest::SHA384, 128, 48, key) + end + public_class_method :new, :digest, :hexdigest + end + + class SHA512 < Base + def initialize(key = nil) + super(Digest::SHA512, 128, 64, key) + end + public_class_method :new, :digest, :hexdigest + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid.rb new file mode 100644 index 00000000..de6cc6b4 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid.rb @@ -0,0 +1,20 @@ +# Copyright 2006-2007 JanRain, Inc. +# +# Licensed under the Apache License, Version 2.0 (the "License"); you +# may not use this file except in compliance with the License. You may +# obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or +# implied. See the License for the specific language governing +# permissions and limitations under the License. + +module OpenID + VERSION = "2.1.2" +end + +require "openid/consumer" +require 'openid/server' diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/association.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/association.rb new file mode 100644 index 00000000..fd2cd599 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/association.rb @@ -0,0 +1,249 @@ +require "openid/kvform" +require "openid/util" +require "openid/cryptutil" +require "openid/message" + +module OpenID + + def self.get_secret_size(assoc_type) + if assoc_type == 'HMAC-SHA1' + return 20 + elsif assoc_type == 'HMAC-SHA256' + return 32 + else + raise ArgumentError("Unsupported association type: #{assoc_type}") + end + end + + # An Association holds the shared secret between a relying party and + # an OpenID provider. + class Association + attr_reader :handle, :secret, :issued, :lifetime, :assoc_type + + FIELD_ORDER = + [:version, :handle, :secret, :issued, :lifetime, :assoc_type,] + + # Load a serialized Association + def self.deserialize(serialized) + parsed = Util.kv_to_seq(serialized) + parsed_fields = parsed.map{|k, v| k.to_sym} + if parsed_fields != FIELD_ORDER + raise ProtocolError, 'Unexpected fields in serialized association'\ + " (Expected #{FIELD_ORDER.inspect}, got #{parsed_fields.inspect})" + end + version, handle, secret64, issued_s, lifetime_s, assoc_type = + parsed.map {|field, value| value} + if version != '2' + raise ProtocolError, "Attempted to deserialize unsupported version "\ + "(#{parsed[0][1].inspect})" + end + + self.new(handle, + Util.from_base64(secret64), + Time.at(issued_s.to_i), + lifetime_s.to_i, + assoc_type) + end + + # Create an Association with an issued time of now + def self.from_expires_in(expires_in, handle, secret, assoc_type) + issued = Time.now + self.new(handle, secret, issued, expires_in, assoc_type) + end + + def initialize(handle, secret, issued, lifetime, assoc_type) + @handle = handle + @secret = secret + @issued = issued + @lifetime = lifetime + @assoc_type = assoc_type + end + + # Serialize the association to a form that's consistent across + # JanRain OpenID libraries. + def serialize + data = { + :version => '2', + :handle => handle, + :secret => Util.to_base64(secret), + :issued => issued.to_i.to_s, + :lifetime => lifetime.to_i.to_s, + :assoc_type => assoc_type, + } + + Util.assert(data.length == FIELD_ORDER.length) + + pairs = FIELD_ORDER.map{|field| [field.to_s, data[field]]} + return Util.seq_to_kv(pairs, strict=true) + end + + # The number of seconds until this association expires + def expires_in(now=nil) + if now.nil? + now = Time.now.to_i + else + now = now.to_i + end + time_diff = (issued.to_i + lifetime) - now + if time_diff < 0 + return 0 + else + return time_diff + end + end + + # Generate a signature for a sequence of [key, value] pairs + def sign(pairs) + kv = Util.seq_to_kv(pairs) + case assoc_type + when 'HMAC-SHA1' + CryptUtil.hmac_sha1(@secret, kv) + when 'HMAC-SHA256' + CryptUtil.hmac_sha256(@secret, kv) + else + raise ProtocolError, "Association has unknown type: "\ + "#{assoc_type.inspect}" + end + end + + # Generate the list of pairs that form the signed elements of the + # given message + def make_pairs(message) + signed = message.get_arg(OPENID_NS, 'signed') + if signed.nil? + raise ProtocolError, 'Missing signed list' + end + signed_fields = signed.split(',', -1) + data = message.to_post_args + signed_fields.map {|field| [field, data.fetch('openid.'+field,'')] } + end + + # Return whether the message's signature passes + def check_message_signature(message) + message_sig = message.get_arg(OPENID_NS, 'sig') + if message_sig.nil? + raise ProtocolError, "#{message} has no sig." + end + calculated_sig = get_message_signature(message) + return calculated_sig == message_sig + end + + # Get the signature for this message + def get_message_signature(message) + Util.to_base64(sign(make_pairs(message))) + end + + def ==(other) + (other.class == self.class and + other.handle == self.handle and + other.secret == self.secret and + + # The internals of the time objects seemed to differ + # in an opaque way when serializing/unserializing. + # I don't think this will be a problem. + other.issued.to_i == self.issued.to_i and + + other.lifetime == self.lifetime and + other.assoc_type == self.assoc_type) + end + + # Add a signature (and a signed list) to a message. + def sign_message(message) + if (message.has_key?(OPENID_NS, 'sig') or + message.has_key?(OPENID_NS, 'signed')) + raise ArgumentError, 'Message already has signed list or signature' + end + + extant_handle = message.get_arg(OPENID_NS, 'assoc_handle') + if extant_handle and extant_handle != self.handle + raise ArgumentError, "Message has a different association handle" + end + + signed_message = message.copy() + signed_message.set_arg(OPENID_NS, 'assoc_handle', self.handle) + message_keys = signed_message.to_post_args.keys() + + signed_list = [] + message_keys.each { |k| + if k.starts_with?('openid.') + signed_list << k[7..-1] + end + } + + signed_list << 'signed' + signed_list.sort! + + signed_message.set_arg(OPENID_NS, 'signed', signed_list.join(',')) + sig = get_message_signature(signed_message) + signed_message.set_arg(OPENID_NS, 'sig', sig) + return signed_message + end + end + + class AssociationNegotiator + attr_reader :allowed_types + + def self.get_session_types(assoc_type) + case assoc_type + when 'HMAC-SHA1' + ['DH-SHA1', 'no-encryption'] + when 'HMAC-SHA256' + ['DH-SHA256', 'no-encryption'] + else + raise ProtocolError, "Unknown association type #{assoc_type.inspect}" + end + end + + def self.check_session_type(assoc_type, session_type) + if !get_session_types(assoc_type).include?(session_type) + raise ProtocolError, "Session type #{session_type.inspect} not "\ + "valid for association type #{assoc_type.inspect}" + end + end + + def initialize(allowed_types) + self.allowed_types=(allowed_types) + end + + def copy + Marshal.load(Marshal.dump(self)) + end + + def allowed_types=(allowed_types) + allowed_types.each do |assoc_type, session_type| + self.class.check_session_type(assoc_type, session_type) + end + @allowed_types = allowed_types + end + + def add_allowed_type(assoc_type, session_type=nil) + if session_type.nil? + session_types = self.class.get_session_types(assoc_type) + else + self.class.check_session_type(assoc_type, session_type) + session_types = [session_type] + end + for session_type in session_types do + @allowed_types << [assoc_type, session_type] + end + end + + def allowed?(assoc_type, session_type) + @allowed_types.include?([assoc_type, session_type]) + end + + def get_allowed_type + @allowed_types.empty? ? nil : @allowed_types[0] + end + end + + DefaultNegotiator = + AssociationNegotiator.new([['HMAC-SHA1', 'DH-SHA1'], + ['HMAC-SHA1', 'no-encryption'], + ['HMAC-SHA256', 'DH-SHA256'], + ['HMAC-SHA256', 'no-encryption']]) + + EncryptedNegotiator = + AssociationNegotiator.new([['HMAC-SHA1', 'DH-SHA1'], + ['HMAC-SHA256', 'DH-SHA256']]) +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer.rb new file mode 100644 index 00000000..f7c52377 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer.rb @@ -0,0 +1,394 @@ +require "openid/consumer/idres.rb" +require "openid/consumer/checkid_request.rb" +require "openid/consumer/associationmanager.rb" +require "openid/consumer/responses.rb" +require "openid/consumer/discovery_manager" +require "openid/consumer/discovery" +require "openid/message" +require "openid/yadis/discovery" +require "openid/store/nonce" + +module OpenID + # OpenID support for Relying Parties (aka Consumers). + # + # This module documents the main interface with the OpenID consumer + # library. The only part of the library which has to be used and + # isn't documented in full here is the store required to create an + # Consumer instance. + # + # = OVERVIEW + # + # The OpenID identity verification process most commonly uses the + # following steps, as visible to the user of this library: + # + # 1. The user enters their OpenID into a field on the consumer's + # site, and hits a login button. + # + # 2. The consumer site discovers the user's OpenID provider using + # the Yadis protocol. + # + # 3. The consumer site sends the browser a redirect to the OpenID + # provider. This is the authentication request as described in + # the OpenID specification. + # + # 4. The OpenID provider's site sends the browser a redirect back to + # the consumer site. This redirect contains the provider's + # response to the authentication request. + # + # The most important part of the flow to note is the consumer's site + # must handle two separate HTTP requests in order to perform the + # full identity check. + # + # = LIBRARY DESIGN + # + # This consumer library is designed with that flow in mind. The + # goal is to make it as easy as possible to perform the above steps + # securely. + # + # At a high level, there are two important parts in the consumer + # library. The first important part is this module, which contains + # the interface to actually use this library. The second is + # openid/store/interface.rb, which describes the interface to use if + # you need to create a custom method for storing the state this + # library needs to maintain between requests. + # + # In general, the second part is less important for users of the + # library to know about, as several implementations are provided + # which cover a wide variety of situations in which consumers may + # use the library. + # + # The Consumer class has methods corresponding to the actions + # necessary in each of steps 2, 3, and 4 described in the overview. + # Use of this library should be as easy as creating an Consumer + # instance and calling the methods appropriate for the action the + # site wants to take. + # + # This library automatically detects which version of the OpenID + # protocol should be used for a transaction and constructs the + # proper requests and responses. Users of this library do not need + # to worry about supporting multiple protocol versions; the library + # supports them implicitly. Depending on the version of the + # protocol in use, the OpenID transaction may be more secure. See + # the OpenID specifications for more information. + # + # = SESSIONS, STORES, AND STATELESS MODE + # + # The Consumer object keeps track of two types of state: + # + # 1. State of the user's current authentication attempt. Things + # like the identity URL, the list of endpoints discovered for + # that URL, and in case where some endpoints are unreachable, the + # list of endpoints already tried. This state needs to be held + # from Consumer.begin() to Consumer.complete(), but it is only + # applicable to a single session with a single user agent, and at + # the end of the authentication process (i.e. when an OP replies + # with either id_res. or cancel it may be + # discarded. + # + # 2. State of relationships with servers, i.e. shared secrets + # (associations) with servers and nonces seen on signed messages. + # This information should persist from one session to the next + # and should not be bound to a particular user-agent. + # + # These two types of storage are reflected in the first two + # arguments of Consumer's constructor, session and + # store. session is a dict-like object and we + # hope your web framework provides you with one of these bound to + # the user agent. store is an instance of Store. + # + # Since the store does hold secrets shared between your application + # and the OpenID provider, you should be careful about how you use + # it in a shared hosting environment. If the filesystem or database + # permissions of your web host allow strangers to read from them, do + # not store your data there! If you have no safe place to store + # your data, construct your consumer with nil for the store, and it + # will operate only in stateless mode. Stateless mode may be + # slower, put more load on the OpenID provider, and trusts the + # provider to keep you safe from replay attacks. + # + # Several store implementation are provided, and the interface is + # fully documented so that custom stores can be used as well. See + # the documentation for the Consumer class for more information on + # the interface for stores. The implementations that are provided + # allow the consumer site to store the necessary data in several + # different ways, including several SQL databases and normal files + # on disk. + # + # = IMMEDIATE MODE + # + # In the flow described above, the user may need to confirm to the + # OpenID provider that it's ok to disclose his or her identity. The + # provider may draw pages asking for information from the user + # before it redirects the browser back to the consumer's site. This + # is generally transparent to the consumer site, so it is typically + # ignored as an implementation detail. + # + # There can be times, however, where the consumer site wants to get + # a response immediately. When this is the case, the consumer can + # put the library in immediate mode. In immediate mode, there is an + # extra response possible from the server, which is essentially the + # server reporting that it doesn't have enough information to answer + # the question yet. + # + # = USING THIS LIBRARY + # + # Integrating this library into an application is usually a + # relatively straightforward process. The process should basically + # follow this plan: + # + # Add an OpenID login field somewhere on your site. When an OpenID + # is entered in that field and the form is submitted, it should make + # a request to the your site which includes that OpenID URL. + # + # First, the application should instantiate a Consumer with a + # session for per-user state and store for shared state using the + # store of choice. + # + # Next, the application should call the begin method of + # Consumer instance. This method takes the OpenID URL as entered by + # the user. The begin method returns a CheckIDRequest + # object. + # + # Next, the application should call the redirect_url method on the + # CheckIDRequest object. The parameter return_to is the + # URL that the OpenID server will send the user back to after + # attempting to verify his or her identity. The realm + # parameter is the URL (or URL pattern) that identifies your web + # site to the user when he or she is authorizing it. Send a + # redirect to the resulting URL to the user's browser. + # + # That's the first half of the authentication process. The second + # half of the process is done after the user's OpenID Provider sends + # the user's browser a redirect back to your site to complete their + # login. + # + # When that happens, the user will contact your site at the URL + # given as the return_to URL to the redirect_url call made + # above. The request will have several query parameters added to + # the URL by the OpenID provider as the information necessary to + # finish the request. + # + # Get a Consumer instance with the same session and store as before + # and call its complete() method, passing in all the received query + # arguments and URL currently being handled. + # + # There are multiple possible return types possible from that + # method. These indicate the whether or not the login was + # successful, and include any additional information appropriate for + # their type. + class Consumer + attr_accessor :session_key_prefix + + # Initialize a Consumer instance. + # + # You should create a new instance of the Consumer object with + # every HTTP request that handles OpenID transactions. + # + # session: the session object to use to store request information. + # The session should behave like a hash. + # + # store: an object that implements the interface in Store. + def initialize(session, store) + @session = session + @store = store + @session_key_prefix = 'OpenID::Consumer::' + end + + # Start the OpenID authentication process. See steps 1-2 in the + # overview for the Consumer class. + # + # user_url: Identity URL given by the user. This method performs a + # textual transformation of the URL to try and make sure it is + # normalized. For example, a user_url of example.com will be + # normalized to http://example.com/ normalizing and resolving any + # redirects the server might issue. + # + # anonymous: A boolean value. Whether to make an anonymous + # request of the OpenID provider. Such a request does not ask for + # an authorization assertion for an OpenID identifier, but may be + # used with extensions to pass other data. e.g. "I don't care who + # you are, but I'd like to know your time zone." + # + # Returns a CheckIDRequest object containing the discovered + # information, with a method for building a redirect URL to the + # server, as described in step 3 of the overview. This object may + # also be used to add extension arguments to the request, using + # its add_extension_arg method. + # + # Raises DiscoveryFailure when no OpenID server can be found for + # this URL. + def begin(openid_identifier, anonymous=false) + manager = discovery_manager(openid_identifier) + service = manager.get_next_service(&method(:discover)) + + if service.nil? + raise DiscoveryFailure.new("No usable OpenID services were found "\ + "for #{openid_identifier.inspect}", nil) + else + begin_without_discovery(service, anonymous) + end + end + + # Start OpenID verification without doing OpenID server + # discovery. This method is used internally by Consumer.begin() + # after discovery is performed, and exists to provide an interface + # for library users needing to perform their own discovery. + # + # service: an OpenID service endpoint descriptor. This object and + # factories for it are found in the openid/consumer/discovery.rb + # module. + # + # Returns an OpenID authentication request object. + def begin_without_discovery(service, anonymous) + assoc = association_manager(service).get_association + checkid_request = CheckIDRequest.new(assoc, service) + checkid_request.anonymous = anonymous + + if service.compatibility_mode + rt_args = checkid_request.return_to_args + rt_args[Consumer.openid1_return_to_nonce_name] = Nonce.mk_nonce + rt_args[Consumer.openid1_return_to_claimed_id_name] = + service.claimed_id + end + + self.last_requested_endpoint = service + return checkid_request + end + + # Called to interpret the server's response to an OpenID + # request. It is called in step 4 of the flow described in the + # Consumer overview. + # + # query: A hash of the query parameters for this HTTP request. + # Note that in rails, this is not params but + # params.reject{|k,v|request.path_parameters[k]} + # because controller and action and other + # "path parameters" are included in params. + # + # current_url: Extract the URL of the current request from your + # application's web request framework and specify it here to have it + # checked against the openid.return_to value in the response. Do not + # just pass args['openid.return_to'] here; that will defeat the + # purpose of this check. (See OpenID Authentication 2.0 section 11.1.) + # + # If the return_to URL check fails, the status of the completion will be + # FAILURE. + + # + # Returns a subclass of Response. The type of response is + # indicated by the status attribute, which will be one of + # SUCCESS, CANCEL, FAILURE, or SETUP_NEEDED. + def complete(query, current_url) + message = Message.from_post_args(query) + mode = message.get_arg(OPENID_NS, 'mode', 'invalid') + begin + meth = method('complete_' + mode) + rescue NameError + meth = method(:complete_invalid) + end + response = meth.call(message, current_url) + cleanup_last_requested_endpoint + if [SUCCESS, CANCEL].member?(response.status) + cleanup_session + end + return response + end + + protected + + def session_get(name) + @session[session_key(name)] + end + + def session_set(name, val) + @session[session_key(name)] = val + end + + def session_key(suffix) + @session_key_prefix + suffix + end + + def last_requested_endpoint + session_get('last_requested_endpoint') + end + + def last_requested_endpoint=(endpoint) + session_set('last_requested_endpoint', endpoint) + end + + def cleanup_last_requested_endpoint + @session[session_key('last_requested_endpoint')] = nil + end + + def discovery_manager(openid_identifier) + DiscoveryManager.new(@session, openid_identifier, @session_key_prefix) + end + + def cleanup_session + discovery_manager(nil).cleanup(true) + end + + + def discover(identifier) + OpenID.discover(identifier) + end + + def negotiator + DefaultNegotiator + end + + def association_manager(service) + AssociationManager.new(@store, service.server_url, + service.compatibility_mode, negotiator) + end + + def handle_idres(message, current_url) + IdResHandler.new(message, current_url, @store, last_requested_endpoint) + end + + def complete_invalid(message, unused_return_to) + mode = message.get_arg(OPENID_NS, 'mode', '') + return FailureResponse.new(last_requested_endpoint, + "Invalid openid.mode: #{mode}") + end + + def complete_cancel(unused_message, unused_return_to) + return CancelResponse.new(last_requested_endpoint) + end + + def complete_error(message, unused_return_to) + error = message.get_arg(OPENID_NS, 'error') + contact = message.get_arg(OPENID_NS, 'contact') + reference = message.get_arg(OPENID_NS, 'reference') + + return FailureResponse.new(last_requested_endpoint, + error, contact, reference) + end + + def complete_setup_needed(message, unused_return_to) + if message.is_openid1 + return complete_invalid(message, nil) + else + return SetupNeededResponse.new(last_requested_endpoint, nil) + end + end + + def complete_id_res(message, current_url) + if message.is_openid1 + setup_url = message.get_arg(OPENID1_NS, 'user_setup_url') + if !setup_url.nil? + return SetupNeededResponse.new(last_requested_endpoint, setup_url) + end + end + + begin + idres = handle_idres(message, current_url) + rescue OpenIDError => why + return FailureResponse.new(last_requested_endpoint, why.message) + else + return SuccessResponse.new(idres.endpoint, message, + idres.signed_fields) + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/associationmanager.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/associationmanager.rb new file mode 100644 index 00000000..51c0f3d2 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/associationmanager.rb @@ -0,0 +1,340 @@ +require "openid/dh" +require "openid/util" +require "openid/kvpost" +require "openid/cryptutil" +require "openid/protocolerror" +require "openid/association" + +module OpenID + class Consumer + + # A superclass for implementing Diffie-Hellman association sessions. + class DiffieHellmanSession + class << self + attr_reader :session_type, :secret_size, :allowed_assoc_types, + :hashfunc + end + + def initialize(dh=nil) + if dh.nil? + dh = DiffieHellman.from_defaults + end + @dh = dh + end + + # Return the query parameters for requesting an association + # using this Diffie-Hellman association session + def get_request + args = {'dh_consumer_public' => CryptUtil.num_to_base64(@dh.public)} + if (!@dh.using_default_values?) + args['dh_modulus'] = CryptUtil.num_to_base64(@dh.modulus) + args['dh_gen'] = CryptUtil.num_to_base64(@dh.generator) + end + + return args + end + + # Process the response from a successful association request and + # return the shared secret for this association + def extract_secret(response) + dh_server_public64 = response.get_arg(OPENID_NS, 'dh_server_public', + NO_DEFAULT) + enc_mac_key64 = response.get_arg(OPENID_NS, 'enc_mac_key', NO_DEFAULT) + dh_server_public = CryptUtil.base64_to_num(dh_server_public64) + enc_mac_key = Util.from_base64(enc_mac_key64) + return @dh.xor_secret(self.class.hashfunc, + dh_server_public, enc_mac_key) + end + end + + # A Diffie-Hellman association session that uses SHA1 as its hash + # function + class DiffieHellmanSHA1Session < DiffieHellmanSession + @session_type = 'DH-SHA1' + @secret_size = 20 + @allowed_assoc_types = ['HMAC-SHA1'] + @hashfunc = CryptUtil.method(:sha1) + end + + # A Diffie-Hellman association session that uses SHA256 as its hash + # function + class DiffieHellmanSHA256Session < DiffieHellmanSession + @session_type = 'DH-SHA256' + @secret_size = 32 + @allowed_assoc_types = ['HMAC-SHA256'] + @hashfunc = CryptUtil.method(:sha256) + end + + # An association session that does not use encryption + class NoEncryptionSession + class << self + attr_reader :session_type, :allowed_assoc_types + end + @session_type = 'no-encryption' + @allowed_assoc_types = ['HMAC-SHA1', 'HMAC-SHA256'] + + def get_request + return {} + end + + def extract_secret(response) + mac_key64 = response.get_arg(OPENID_NS, 'mac_key', NO_DEFAULT) + return Util.from_base64(mac_key64) + end + end + + # An object that manages creating and storing associations for an + # OpenID provider endpoint + class AssociationManager + def self.create_session(session_type) + case session_type + when 'no-encryption' + NoEncryptionSession.new + when 'DH-SHA1' + DiffieHellmanSHA1Session.new + when 'DH-SHA256' + DiffieHellmanSHA256Session.new + else + raise ArgumentError, "Unknown association session type: "\ + "#{session_type.inspect}" + end + end + + def initialize(store, server_url, compatibility_mode=false, + negotiator=nil) + @store = store + @server_url = server_url + @compatibility_mode = compatibility_mode + @negotiator = negotiator || DefaultNegotiator + end + + def get_association + if @store.nil? + return nil + end + + assoc = @store.get_association(@server_url) + if assoc.nil? || assoc.expires_in <= 0 + assoc = negotiate_association + if !assoc.nil? + @store.store_association(@server_url, assoc) + end + end + + return assoc + end + + def negotiate_association + assoc_type, session_type = @negotiator.get_allowed_type + begin + return request_association(assoc_type, session_type) + rescue ServerError => why + supported_types = extract_supported_association_type(why, assoc_type) + if !supported_types.nil? + # Attempt to create an association from the assoc_type and + # session_type that the server told us it supported. + assoc_type, session_type = supported_types + begin + return request_association(assoc_type, session_type) + rescue ServerError => why + Util.log("Server #{@server_url} refused its suggested " \ + "association type: session_type=#{session_type}, " \ + "assoc_type=#{assoc_type}") + return nil + end + end + end + end + + protected + def extract_supported_association_type(server_error, assoc_type) + # Any error message whose code is not 'unsupported-type' should + # be considered a total failure. + if (server_error.error_code != 'unsupported-type' or + server_error.message.is_openid1) + Util.log("Server error when requesting an association from "\ + "#{@server_url}: #{server_error.error_text}") + return nil + end + + # The server didn't like the association/session type that we + # sent, and it sent us back a message that might tell us how to + # handle it. + Util.log("Unsupported association type #{assoc_type}: "\ + "#{server_error.error_text}") + + # Extract the session_type and assoc_type from the error message + assoc_type = server_error.message.get_arg(OPENID_NS, 'assoc_type') + session_type = server_error.message.get_arg(OPENID_NS, 'session_type') + + if assoc_type.nil? or session_type.nil? + Util.log("Server #{@server_url} responded with unsupported "\ + "association session but did not supply a fallback.") + return nil + elsif !@negotiator.allowed?(assoc_type, session_type) + Util.log("Server sent unsupported session/association type: "\ + "session_type=#{session_type}, assoc_type=#{assoc_type}") + return nil + else + return [assoc_type, session_type] + end + end + + # Make and process one association request to this endpoint's OP + # endpoint URL. Returns an association object or nil if the + # association processing failed. Raises ServerError when the + # remote OpenID server returns an error. + def request_association(assoc_type, session_type) + assoc_session, args = create_associate_request(assoc_type, session_type) + + begin + response = OpenID.make_kv_post(args, @server_url) + return extract_association(response, assoc_session) + rescue HTTPStatusError => why + Util.log("Got HTTP status error when requesting association: #{why}") + return nil + rescue Message::KeyNotFound => why + Util.log("Missing required parameter in response from "\ + "#{@server_url}: #{why}") + return nil + + rescue ProtocolError => why + Util.log("Protocol error processing response from #{@server_url}: "\ + "#{why}") + return nil + end + end + + # Create an association request for the given assoc_type and + # session_type. Returns a pair of the association session object + # and the request message that will be sent to the server. + def create_associate_request(assoc_type, session_type) + assoc_session = self.class.create_session(session_type) + args = { + 'mode' => 'associate', + 'assoc_type' => assoc_type, + } + + if !@compatibility_mode + args['ns'] = OPENID2_NS + end + + # Leave out the session type if we're in compatibility mode + # *and* it's no-encryption. + if !@compatibility_mode || + assoc_session.class.session_type != 'no-encryption' + args['session_type'] = assoc_session.class.session_type + end + + args.merge!(assoc_session.get_request) + message = Message.from_openid_args(args) + return assoc_session, message + end + + # Given an association response message, extract the OpenID 1.X + # session type. Returns the association type for this message + # + # This function mostly takes care of the 'no-encryption' default + # behavior in OpenID 1. + # + # If the association type is plain-text, this function will + # return 'no-encryption' + def get_openid1_session_type(assoc_response) + # If it's an OpenID 1 message, allow session_type to default + # to nil (which signifies "no-encryption") + session_type = assoc_response.get_arg(OPENID1_NS, 'session_type') + + # Handle the differences between no-encryption association + # respones in OpenID 1 and 2: + + # no-encryption is not really a valid session type for + # OpenID 1, but we'll accept it anyway, while issuing a + # warning. + if session_type == 'no-encryption' + Util.log("WARNING: #{@server_url} sent 'no-encryption'"\ + "for OpenID 1.X") + + # Missing or empty session type is the way to flag a + # 'no-encryption' response. Change the session type to + # 'no-encryption' so that it can be handled in the same + # way as OpenID 2 'no-encryption' respones. + elsif session_type == '' || session_type.nil? + session_type = 'no-encryption' + end + + return session_type + end + + def self.extract_expires_in(message) + # expires_in should be a base-10 string. + expires_in_str = message.get_arg(OPENID_NS, 'expires_in', NO_DEFAULT) + if !(/\A\d+\Z/ =~ expires_in_str) + raise ProtocolError, "Invalid expires_in field: #{expires_in_str}" + end + expires_in_str.to_i + end + + # Attempt to extract an association from the response, given the + # association response message and the established association + # session. + def extract_association(assoc_response, assoc_session) + # Extract the common fields from the response, raising an + # exception if they are not found + assoc_type = assoc_response.get_arg(OPENID_NS, 'assoc_type', + NO_DEFAULT) + assoc_handle = assoc_response.get_arg(OPENID_NS, 'assoc_handle', + NO_DEFAULT) + expires_in = self.class.extract_expires_in(assoc_response) + + # OpenID 1 has funny association session behaviour. + if assoc_response.is_openid1 + session_type = get_openid1_session_type(assoc_response) + else + session_type = assoc_response.get_arg(OPENID2_NS, 'session_type', + NO_DEFAULT) + end + + # Session type mismatch + if assoc_session.class.session_type != session_type + if (assoc_response.is_openid1 and session_type == 'no-encryption') + # In OpenID 1, any association request can result in a + # 'no-encryption' association response. Setting + # assoc_session to a new no-encryption session should + # make the rest of this function work properly for + # that case. + assoc_session = NoEncryptionSession.new + else + # Any other mismatch, regardless of protocol version + # results in the failure of the association session + # altogether. + raise ProtocolError, "Session type mismatch. Expected "\ + "#{assoc_session.class.session_type}, got "\ + "#{session_type}" + end + end + + # Make sure assoc_type is valid for session_type + if !assoc_session.class.allowed_assoc_types.member?(assoc_type) + raise ProtocolError, "Unsupported assoc_type for session "\ + "#{assoc_session.class.session_type} "\ + "returned: #{assoc_type}" + end + + # Delegate to the association session to extract the secret + # from the response, however is appropriate for that session + # type. + begin + secret = assoc_session.extract_secret(assoc_response) + rescue Message::KeyNotFound, ArgumentError => why + raise ProtocolError, "Malformed response for "\ + "#{assoc_session.class.session_type} "\ + "session: #{why.message}" + end + + + return Association.from_expires_in(expires_in, assoc_handle, secret, + assoc_type) + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/checkid_request.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/checkid_request.rb new file mode 100644 index 00000000..eb5d3979 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/checkid_request.rb @@ -0,0 +1,186 @@ +require "openid/message" +require "openid/util" + +module OpenID + class Consumer + # An object that holds the state necessary for generating an + # OpenID authentication request. This object holds the association + # with the server and the discovered information with which the + # request will be made. + # + # It is separate from the consumer because you may wish to add + # things to the request before sending it on its way to the + # server. It also has serialization options that let you encode + # the authentication request as a URL or as a form POST. + class CheckIDRequest + attr_accessor :return_to_args, :message + attr_reader :endpoint + + # Users of this library should not create instances of this + # class. Instances of this class are created by the library + # when needed. + def initialize(assoc, endpoint) + @assoc = assoc + @endpoint = endpoint + @return_to_args = {} + @message = Message.new(endpoint.preferred_namespace) + @anonymous = false + end + + attr_reader :anonymous + + # Set whether this request should be made anonymously. If a + # request is anonymous, the identifier will not be sent in the + # request. This is only useful if you are making another kind of + # request with an extension in this request. + # + # Anonymous requests are not allowed when the request is made + # with OpenID 1. + def anonymous=(is_anonymous) + if is_anonymous && @message.is_openid1 + raise ArgumentError, ("OpenID1 requests MUST include the "\ + "identifier in the request") + end + @anonymous = is_anonymous + end + + # Add an object that implements the extension interface for + # adding arguments to an OpenID message to this checkid request. + # + # extension_request: an OpenID::Extension object. + def add_extension(extension_request) + extension_request.to_message(@message) + end + + # Add an extension argument to this OpenID authentication + # request. You probably want to use add_extension and the + # OpenID::Extension interface. + # + # Use caution when adding arguments, because they will be + # URL-escaped and appended to the redirect URL, which can easily + # get quite long. + def add_extension_arg(namespace, key, value) + @message.set_arg(namespace, key, value) + end + + # Produce a OpenID::Message representing this request. + # + # Not specifying a return_to URL means that the user will not be + # returned to the site issuing the request upon its completion. + # + # If immediate mode is requested, the OpenID provider is to send + # back a response immediately, useful for behind-the-scenes + # authentication attempts. Otherwise the OpenID provider may + # engage the user before providing a response. This is the + # default case, as the user may need to provide credentials or + # approve the request before a positive response can be sent. + def get_message(realm, return_to=nil, immediate=false) + if !return_to.nil? + return_to = Util.append_args(return_to, @return_to_args) + elsif immediate + raise ArgumentError, ('"return_to" is mandatory when using '\ + '"checkid_immediate"') + elsif @message.is_openid1 + raise ArgumentError, ('"return_to" is mandatory for OpenID 1 '\ + 'requests') + elsif @return_to_args.empty? + raise ArgumentError, ('extra "return_to" arguments were specified, '\ + 'but no return_to was specified') + end + + + message = @message.copy + + mode = immediate ? 'checkid_immediate' : 'checkid_setup' + message.set_arg(OPENID_NS, 'mode', mode) + + realm_key = message.is_openid1 ? 'trust_root' : 'realm' + message.set_arg(OPENID_NS, realm_key, realm) + + if !return_to.nil? + message.set_arg(OPENID_NS, 'return_to', return_to) + end + + if not @anonymous + if @endpoint.is_op_identifier + # This will never happen when we're in OpenID 1 + # compatibility mode, as long as is_op_identifier() + # returns false whenever preferred_namespace returns + # OPENID1_NS. + claimed_id = request_identity = IDENTIFIER_SELECT + else + request_identity = @endpoint.get_local_id + claimed_id = @endpoint.claimed_id + end + + # This is true for both OpenID 1 and 2 + message.set_arg(OPENID_NS, 'identity', request_identity) + + if message.is_openid2 + message.set_arg(OPENID2_NS, 'claimed_id', claimed_id) + end + end + + if @assoc + message.set_arg(OPENID_NS, 'assoc_handle', @assoc.handle) + assoc_log_msg = "with assocication #{@assoc.handle}" + else + assoc_log_msg = 'using stateless mode.' + end + + Util.log("Generated #{mode} request to #{@endpoint.server_url} "\ + "#{assoc_log_msg}") + return message + end + + # Returns a URL with an encoded OpenID request. + # + # The resulting URL is the OpenID provider's endpoint URL with + # parameters appended as query arguments. You should redirect + # the user agent to this URL. + # + # OpenID 2.0 endpoints also accept POST requests, see + # 'send_redirect?' and 'form_markup'. + def redirect_url(realm, return_to=nil, immediate=false) + message = get_message(realm, return_to, immediate) + return message.to_url(@endpoint.server_url) + end + + # Get html for a form to submit this request to the IDP. + # + # form_tag_attrs is a hash of attributes to be added to the form + # tag. 'accept-charset' and 'enctype' have defaults that can be + # overridden. If a value is supplied for 'action' or 'method', + # it will be replaced. + def form_markup(realm, return_to=nil, immediate=false, + form_tag_attrs=nil) + message = get_message(realm, return_to, immediate) + return message.to_form_markup(@endpoint.server_url, form_tag_attrs) + end + + # Get a complete HTML document that autosubmits the request to the IDP + # with javascript. This method wraps form_markup - see that method's + # documentation for help with the parameters. + def html_markup(realm, return_to=nil, immediate=false, + form_tag_attrs=nil) + Util.auto_submit_html(form_markup(realm, + return_to, + immediate, + form_tag_attrs)) + end + + # Should this OpenID authentication request be sent as a HTTP + # redirect or as a POST (form submission)? + # + # This takes the same parameters as redirect_url or form_markup + def send_redirect?(realm, return_to=nil, immediate=false) + if @endpoint.compatibility_mode + return true + else + url = redirect_url(realm, return_to, immediate) + return url.length <= OPENID1_URL_LIMIT + end + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery.rb new file mode 100644 index 00000000..986b476f --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery.rb @@ -0,0 +1,490 @@ +# Functions to discover OpenID endpoints from identifiers. + +require 'uri' +require 'openid/util' +require 'openid/fetchers' +require 'openid/urinorm' +require 'openid/message' +require 'openid/yadis/discovery' +require 'openid/yadis/xrds' +require 'openid/yadis/xri' +require 'openid/yadis/services' +require 'openid/yadis/filters' +require 'openid/consumer/html_parse' +require 'openid/yadis/xrires' + +module OpenID + + OPENID_1_0_NS = 'http://openid.net/xmlns/1.0' + OPENID_IDP_2_0_TYPE = 'http://specs.openid.net/auth/2.0/server' + OPENID_2_0_TYPE = 'http://specs.openid.net/auth/2.0/signon' + OPENID_1_1_TYPE = 'http://openid.net/signon/1.1' + OPENID_1_0_TYPE = 'http://openid.net/signon/1.0' + + OPENID_1_0_MESSAGE_NS = OPENID1_NS + OPENID_2_0_MESSAGE_NS = OPENID2_NS + + # Object representing an OpenID service endpoint. + class OpenIDServiceEndpoint + + # OpenID service type URIs, listed in order of preference. The + # ordering of this list affects yadis and XRI service discovery. + OPENID_TYPE_URIS = [ + OPENID_IDP_2_0_TYPE, + + OPENID_2_0_TYPE, + OPENID_1_1_TYPE, + OPENID_1_0_TYPE, + ] + + # the verified identifier. + attr_accessor :claimed_id + + # For XRI, the persistent identifier. + attr_accessor :canonical_id + + attr_accessor :server_url, :type_uris, :local_id, :used_yadis + + def initialize + @claimed_id = nil + @server_url = nil + @type_uris = [] + @local_id = nil + @canonical_id = nil + @used_yadis = false # whether this came from an XRDS + @display_identifier = nil + end + + def display_identifier + return @display_identifier if @display_identifier + + return @claimed_id if @claimed_id.nil? + + begin + parsed_identifier = URI.parse(@claimed_id) + rescue URI::InvalidURIError + raise ProtocolError, "Claimed identifier #{claimed_id} is not a valid URI" + end + + return @claimed_id if not parsed_identifier.fragment + + disp = parsed_identifier + disp.fragment = nil + + return disp.to_s + end + + def display_identifier=(display_identifier) + @display_identifier = display_identifier + end + + def uses_extension(extension_uri) + return @type_uris.member?(extension_uri) + end + + def preferred_namespace + if (@type_uris.member?(OPENID_IDP_2_0_TYPE) or + @type_uris.member?(OPENID_2_0_TYPE)) + return OPENID_2_0_MESSAGE_NS + else + return OPENID_1_0_MESSAGE_NS + end + end + + def supports_type(type_uri) + # Does this endpoint support this type? + # + # I consider C{/server} endpoints to implicitly support C{/signon}. + ( + @type_uris.member?(type_uri) or + (type_uri == OPENID_2_0_TYPE and is_op_identifier()) + ) + end + + def compatibility_mode + return preferred_namespace() != OPENID_2_0_MESSAGE_NS + end + + def is_op_identifier + return @type_uris.member?(OPENID_IDP_2_0_TYPE) + end + + def parse_service(yadis_url, uri, type_uris, service_element) + # Set the state of this object based on the contents of the + # service element. + @type_uris = type_uris + @server_url = uri + @used_yadis = true + + if !is_op_identifier() + # XXX: This has crappy implications for Service elements that + # contain both 'server' and 'signon' Types. But that's a + # pathological configuration anyway, so I don't think I care. + @local_id = OpenID.find_op_local_identifier(service_element, + @type_uris) + @claimed_id = yadis_url + end + end + + def get_local_id + # Return the identifier that should be sent as the + # openid.identity parameter to the server. + if @local_id.nil? and @canonical_id.nil? + return @claimed_id + else + return (@local_id or @canonical_id) + end + end + + def self.from_basic_service_endpoint(endpoint) + # Create a new instance of this class from the endpoint object + # passed in. + # + # @return: nil or OpenIDServiceEndpoint for this endpoint object""" + + type_uris = endpoint.match_types(OPENID_TYPE_URIS) + + # If any Type URIs match and there is an endpoint URI specified, + # then this is an OpenID endpoint + if (!type_uris.nil? and !type_uris.empty?) and !endpoint.uri.nil? + openid_endpoint = self.new + openid_endpoint.parse_service( + endpoint.yadis_url, + endpoint.uri, + endpoint.type_uris, + endpoint.service_element) + else + openid_endpoint = nil + end + + return openid_endpoint + end + + def self.from_html(uri, html) + # Parse the given document as HTML looking for an OpenID + # + # @rtype: [OpenIDServiceEndpoint] + + discovery_types = [ + [OPENID_2_0_TYPE, 'openid2.provider', 'openid2.local_id'], + [OPENID_1_1_TYPE, 'openid.server', 'openid.delegate'], + ] + + link_attrs = OpenID.parse_link_attrs(html) + services = [] + discovery_types.each { |type_uri, op_endpoint_rel, local_id_rel| + + op_endpoint_url = OpenID.find_first_href(link_attrs, op_endpoint_rel) + + if !op_endpoint_url + next + end + + service = self.new + service.claimed_id = uri + service.local_id = OpenID.find_first_href(link_attrs, local_id_rel) + service.server_url = op_endpoint_url + service.type_uris = [type_uri] + + services << service + } + + return services + end + + def self.from_xrds(uri, xrds) + # Parse the given document as XRDS looking for OpenID services. + # + # @rtype: [OpenIDServiceEndpoint] + # + # @raises L{XRDSError}: When the XRDS does not parse. + return Yadis::apply_filter(uri, xrds, self) + end + + def self.from_discovery_result(discoveryResult) + # Create endpoints from a DiscoveryResult. + # + # @type discoveryResult: L{DiscoveryResult} + # + # @rtype: list of L{OpenIDServiceEndpoint} + # + # @raises L{XRDSError}: When the XRDS does not parse. + if discoveryResult.is_xrds() + meth = self.method('from_xrds') + else + meth = self.method('from_html') + end + + return meth.call(discoveryResult.normalized_uri, + discoveryResult.response_text) + end + + def self.from_op_endpoint_url(op_endpoint_url) + # Construct an OP-Identifier OpenIDServiceEndpoint object for + # a given OP Endpoint URL + # + # @param op_endpoint_url: The URL of the endpoint + # @rtype: OpenIDServiceEndpoint + service = self.new + service.server_url = op_endpoint_url + service.type_uris = [OPENID_IDP_2_0_TYPE] + return service + end + + def to_s + return sprintf("<%s server_url=%s claimed_id=%s " + + "local_id=%s canonical_id=%s used_yadis=%s>", + self.class, @server_url, @claimed_id, + @local_id, @canonical_id, @used_yadis) + end + end + + def self.find_op_local_identifier(service_element, type_uris) + # Find the OP-Local Identifier for this xrd:Service element. + # + # This considers openid:Delegate to be a synonym for xrd:LocalID + # if both OpenID 1.X and OpenID 2.0 types are present. If only + # OpenID 1.X is present, it returns the value of + # openid:Delegate. If only OpenID 2.0 is present, it returns the + # value of xrd:LocalID. If there is more than one LocalID tag and + # the values are different, it raises a DiscoveryFailure. This is + # also triggered when the xrd:LocalID and openid:Delegate tags are + # different. + + # XXX: Test this function on its own! + + # Build the list of tags that could contain the OP-Local + # Identifier + local_id_tags = [] + if type_uris.member?(OPENID_1_1_TYPE) or + type_uris.member?(OPENID_1_0_TYPE) + # local_id_tags << Yadis::nsTag(OPENID_1_0_NS, 'openid', 'Delegate') + service_element.add_namespace('openid', OPENID_1_0_NS) + local_id_tags << "openid:Delegate" + end + + if type_uris.member?(OPENID_2_0_TYPE) + # local_id_tags.append(Yadis::nsTag(XRD_NS_2_0, 'xrd', 'LocalID')) + service_element.add_namespace('xrd', Yadis::XRD_NS_2_0) + local_id_tags << "xrd:LocalID" + end + + # Walk through all the matching tags and make sure that they all + # have the same value + local_id = nil + local_id_tags.each { |local_id_tag| + service_element.each_element(local_id_tag) { |local_id_element| + if local_id.nil? + local_id = local_id_element.text + elsif local_id != local_id_element.text + format = 'More than one %s tag found in one service element' + message = sprintf(format, local_id_tag) + raise DiscoveryFailure.new(message, nil) + end + } + } + + return local_id + end + + def self.normalize_url(url) + # Normalize a URL, converting normalization failures to + # DiscoveryFailure + begin + normalized = URINorm.urinorm(url) + rescue URI::Error => why + raise DiscoveryFailure.new("Error normalizing #{url}: #{why.message}", nil) + else + defragged = URI::parse(normalized) + defragged.fragment = nil + return defragged.normalize.to_s + end + end + + def self.best_matching_service(service, preferred_types) + # Return the index of the first matching type, or something higher + # if no type matches. + # + # This provides an ordering in which service elements that contain + # a type that comes earlier in the preferred types list come + # before service elements that come later. If a service element + # has more than one type, the most preferred one wins. + preferred_types.each_with_index { |value, index| + if service.type_uris.member?(value) + return index + end + } + + return preferred_types.length + end + + def self.arrange_by_type(service_list, preferred_types) + # Rearrange service_list in a new list so services are ordered by + # types listed in preferred_types. Return the new list. + + # Build a list with the service elements in tuples whose + # comparison will prefer the one with the best matching service + prio_services = [] + + service_list.each_with_index { |s, index| + prio_services << [best_matching_service(s, preferred_types), index, s] + } + + prio_services.sort! + + # Now that the services are sorted by priority, remove the sort + # keys from the list. + (0...prio_services.length).each { |i| + prio_services[i] = prio_services[i][2] + } + + return prio_services + end + + def self.get_op_or_user_services(openid_services) + # Extract OP Identifier services. If none found, return the rest, + # sorted with most preferred first according to + # OpenIDServiceEndpoint.openid_type_uris. + # + # openid_services is a list of OpenIDServiceEndpoint objects. + # + # Returns a list of OpenIDServiceEndpoint objects. + + op_services = arrange_by_type(openid_services, [OPENID_IDP_2_0_TYPE]) + + openid_services = arrange_by_type(openid_services, + OpenIDServiceEndpoint::OPENID_TYPE_URIS) + + if !op_services.empty? + return op_services + else + return openid_services + end + end + + def self.discover_yadis(uri) + # Discover OpenID services for a URI. Tries Yadis and falls back + # on old-style discovery if Yadis fails. + # + # @param uri: normalized identity URL + # @type uri: str + # + # @return: (claimed_id, services) + # @rtype: (str, list(OpenIDServiceEndpoint)) + # + # @raises DiscoveryFailure: when discovery fails. + + # Might raise a yadis.discover.DiscoveryFailure if no document + # came back for that URI at all. I don't think falling back to + # OpenID 1.0 discovery on the same URL will help, so don't bother + # to catch it. + response = Yadis.discover(uri) + + yadis_url = response.normalized_uri + body = response.response_text + + begin + openid_services = OpenIDServiceEndpoint.from_xrds(yadis_url, body) + rescue Yadis::XRDSError + # Does not parse as a Yadis XRDS file + openid_services = [] + end + + if openid_services.empty? + # Either not an XRDS or there are no OpenID services. + + if response.is_xrds + # if we got the Yadis content-type or followed the Yadis + # header, re-fetch the document without following the Yadis + # header, with no Accept header. + return self.discover_no_yadis(uri) + end + + # Try to parse the response as HTML. + # + openid_services = OpenIDServiceEndpoint.from_html(yadis_url, body) + end + + return [yadis_url, self.get_op_or_user_services(openid_services)] + end + + def self.discover_xri(iname) + endpoints = [] + + begin + canonical_id, services = Yadis::XRI::ProxyResolver.new().query( + iname, OpenIDServiceEndpoint::OPENID_TYPE_URIS) + + if canonical_id.nil? + raise Yadis::XRDSError.new(sprintf('No CanonicalID found for XRI %s', iname)) + end + + flt = Yadis.make_filter(OpenIDServiceEndpoint) + + services.each { |service_element| + endpoints += flt.get_service_endpoints(iname, service_element) + } + rescue Yadis::XRDSError => why + Util.log('xrds error on ' + iname + ': ' + why.to_s) + end + + endpoints.each { |endpoint| + # Is there a way to pass this through the filter to the endpoint + # constructor instead of tacking it on after? + endpoint.canonical_id = canonical_id + endpoint.claimed_id = canonical_id + endpoint.display_identifier = iname + } + + # FIXME: returned xri should probably be in some normal form + return [iname, self.get_op_or_user_services(endpoints)] + end + + def self.discover_no_yadis(uri) + http_resp = OpenID.fetch(uri) + if http_resp.code != "200" and http_resp.code != "206" + raise DiscoveryFailure.new( + "HTTP Response status from identity URL host is not \"200\". "\ + "Got status #{http_resp.code.inspect}", http_resp) + end + + claimed_id = http_resp.final_url + openid_services = OpenIDServiceEndpoint.from_html( + claimed_id, http_resp.body) + return [claimed_id, openid_services] + end + + def self.discover_uri(uri) + # Hack to work around URI parsing for URls with *no* scheme. + if uri.index("://").nil? + uri = 'http://' + uri + end + + begin + parsed = URI::parse(uri) + rescue URI::InvalidURIError => why + raise DiscoveryFailure.new("URI is not valid: #{why.message}", nil) + end + + if !parsed.scheme.nil? and !parsed.scheme.empty? + if !['http', 'https'].member?(parsed.scheme) + raise DiscoveryFailure.new( + "URI scheme #{parsed.scheme} is not HTTP or HTTPS", nil) + end + end + + uri = self.normalize_url(uri) + claimed_id, openid_services = self.discover_yadis(uri) + claimed_id = self.normalize_url(claimed_id) + return [claimed_id, openid_services] + end + + def self.discover(identifier) + if Yadis::XRI::identifier_scheme(identifier) == :xri + normalized_identifier, services = discover_xri(identifier) + else + return discover_uri(identifier) + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery_manager.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery_manager.rb new file mode 100644 index 00000000..8f838117 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/discovery_manager.rb @@ -0,0 +1,123 @@ +module OpenID + class Consumer + + # A set of discovered services, for tracking which providers have + # been attempted for an OpenID identifier + class DiscoveredServices + attr_reader :current + + def initialize(starting_url, yadis_url, services) + @starting_url = starting_url + @yadis_url = yadis_url + @services = services.dup + @current = nil + end + + def next + @current = @services.shift + end + + def for_url?(url) + [@starting_url, @yadis_url].member?(url) + end + + def started? + !@current.nil? + end + + def empty? + @services.empty? + end + end + + # Manages calling discovery and tracking which endpoints have + # already been attempted. + class DiscoveryManager + def initialize(session, url, session_key_suffix=nil) + @url = url + + @session = session + @session_key_suffix = session_key_suffix || 'auth' + end + + def get_next_service + manager = get_manager + if !manager.nil? && manager.empty? + destroy_manager + manager = nil + end + + if manager.nil? + yadis_url, services = yield @url + manager = create_manager(yadis_url, services) + end + + if !manager.nil? + service = manager.next + store(manager) + else + service = nil + end + + return service + end + + def cleanup(force=false) + manager = get_manager(force) + if !manager.nil? + service = manager.current + destroy_manager(force) + else + service = nil + end + return service + end + + protected + + def get_manager(force=false) + manager = load + if force || manager.nil? || manager.for_url?(@url) + return manager + else + return nil + end + end + + def create_manager(yadis_url, services) + manager = get_manager + if !manager.nil? + raise StandardError, "There is already a manager for #{yadis_url}" + end + if services.empty? + return nil + end + manager = DiscoveredServices.new(@url, yadis_url, services) + store(manager) + return manager + end + + def destroy_manager(force=false) + if !get_manager(force).nil? + destroy! + end + end + + def session_key + 'OpenID::Consumer::DiscoveredServices::' + @session_key_suffix + end + + def store(manager) + @session[session_key] = manager + end + + def load + @session[session_key] + end + + def destroy! + @session[session_key] = nil + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/html_parse.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/html_parse.rb new file mode 100644 index 00000000..579874ca --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/html_parse.rb @@ -0,0 +1,134 @@ +require "openid/yadis/htmltokenizer" + +module OpenID + + # Stuff to remove before we start looking for tags + REMOVED_RE = / + # Comments + + + # CDATA blocks + | + + # script blocks + | ]*>.*?<\/script> + + /mixu + + def OpenID.openid_unescape(s) + s.gsub('&','&').gsub('<','<').gsub('>','>').gsub('"','"') + end + + def OpenID.unescape_hash(h) + newh = {} + h.map{|k,v| + newh[k]=openid_unescape(v) + } + newh + end + + + def OpenID.parse_link_attrs(html) + stripped = html.gsub(REMOVED_RE,'') + parser = HTMLTokenizer.new(stripped) + + links = [] + # to keep track of whether or not we are in the head element + in_head = false + in_html = false + saw_head = false + + begin + while el = parser.getTag('head', '/head', 'link', 'body', '/body', + 'html', '/html') + + # we are leaving head or have reached body, so we bail + return links if ['/head', 'body', '/body', '/html'].member?(el.tag_name) + + # enforce html > head > link + if el.tag_name == 'html' + in_html = true + end + next unless in_html + if el.tag_name == 'head' + if saw_head + return links #only allow one head + end + saw_head = true + unless el.to_s[-2] == 47 # tag ends with a /: a short tag + in_head = true + end + end + next unless in_head + + return links if el.tag_name == 'html' + + if el.tag_name == 'link' + links << unescape_hash(el.attr_hash) + end + + end + rescue Exception # just stop parsing if there's an error + end + return links + end + + def OpenID.rel_matches(rel_attr, target_rel) + # Does this target_rel appear in the rel_str? + # XXX: TESTME + rels = rel_attr.strip().split() + rels.each { |rel| + rel = rel.downcase + if rel == target_rel + return true + end + } + + return false + end + + def OpenID.link_has_rel(link_attrs, target_rel) + # Does this link have target_rel as a relationship? + + # XXX: TESTME + rel_attr = link_attrs['rel'] + return (rel_attr and rel_matches(rel_attr, target_rel)) + end + + def OpenID.find_links_rel(link_attrs_list, target_rel) + # Filter the list of link attributes on whether it has target_rel + # as a relationship. + + # XXX: TESTME + matchesTarget = lambda { |attrs| link_has_rel(attrs, target_rel) } + result = [] + + link_attrs_list.each { |item| + if matchesTarget.call(item) + result << item + end + } + + return result + end + + def OpenID.find_first_href(link_attrs_list, target_rel) + # Return the value of the href attribute for the first link tag in + # the list that has target_rel as a relationship. + + # XXX: TESTME + matches = find_links_rel(link_attrs_list, target_rel) + if !matches or matches.empty? + return nil + end + + first = matches[0] + return first['href'] + end +end + diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/idres.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/idres.rb new file mode 100644 index 00000000..ab924e29 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/idres.rb @@ -0,0 +1,523 @@ +require "openid/message" +require "openid/protocolerror" +require "openid/kvpost" +require "openid/consumer/discovery" +require "openid/urinorm" + +module OpenID + class TypeURIMismatch < ProtocolError + attr_reader :type_uri, :endpoint + + def initialize(type_uri, endpoint) + @type_uri = type_uri + @endpoint = endpoint + end + end + + class Consumer + @openid1_return_to_nonce_name = 'rp_nonce' + @openid1_return_to_claimed_id_name = 'openid1_claimed_id' + + # Set the name of the query parameter that this library will use + # to thread a nonce through an OpenID 1 transaction. It will be + # appended to the return_to URL. + def self.openid1_return_to_nonce_name=(query_arg_name) + @openid1_return_to_nonce_name = query_arg_name + end + + # See openid1_return_to_nonce_name= documentation + def self.openid1_return_to_nonce_name + @openid1_return_to_nonce_name + end + + # Set the name of the query parameter that this library will use + # to thread the requested URL through an OpenID 1 transaction (for + # use when verifying discovered information). It will be appended + # to the return_to URL. + def self.openid1_return_to_claimed_id_name=(query_arg_name) + @openid1_return_to_claimed_id_name = query_arg_name + end + + # See openid1_return_to_claimed_id_name= + def self.openid1_return_to_claimed_id_name + @openid1_return_to_claimed_id_name + end + + # Handles an openid.mode=id_res response. This object is + # instantiated and used by the Consumer. + class IdResHandler + attr_reader :endpoint, :message + + def initialize(message, current_url, store=nil, endpoint=nil) + @store = store # Fer the nonce and invalidate_handle + @message = message + @endpoint = endpoint + @current_url = current_url + @signed_list = nil + + # Start the verification process + id_res + end + + def signed_fields + signed_list.map {|x| 'openid.' + x} + end + + protected + + # This method will raise ProtocolError unless the request is a + # valid id_res response. Once it has been verified, the methods + # 'endpoint', 'message', and 'signed_fields' contain the + # verified information. + def id_res + check_for_fields + verify_return_to + verify_discovery_results + check_signature + check_nonce + end + + def server_url + @endpoint.nil? ? nil : @endpoint.server_url + end + + def openid_namespace + @message.get_openid_namespace + end + + def fetch(field, default=NO_DEFAULT) + @message.get_arg(OPENID_NS, field, default) + end + + def signed_list + if @signed_list.nil? + signed_list_str = fetch('signed', nil) + if signed_list_str.nil? + raise ProtocolError, 'Response missing signed list' + end + + @signed_list = signed_list_str.split(',', -1) + end + @signed_list + end + + def check_for_fields + # XXX: if a field is missing, we should not have to explicitly + # check that it's present, just make sure that the fields are + # actually being used by the rest of the code in + # tests. Although, which fields are signed does need to be + # checked somewhere. + basic_fields = ['return_to', 'assoc_handle', 'sig', 'signed'] + basic_sig_fields = ['return_to', 'identity'] + + case openid_namespace + when OPENID2_NS + require_fields = basic_fields + ['op_endpoint'] + require_sigs = basic_sig_fields + + ['response_nonce', 'claimed_id', 'assoc_handle',] + when OPENID1_NS + require_fields = basic_fields + ['identity'] + require_sigs = basic_sig_fields + else + raise RuntimeError, "check_for_fields doesn't know about "\ + "namespace #{openid_namespace.inspect}" + end + + require_fields.each do |field| + if !@message.has_key?(OPENID_NS, field) + raise ProtocolError, "Missing required field #{field}" + end + end + + require_sigs.each do |field| + # Field is present and not in signed list + if @message.has_key?(OPENID_NS, field) && !signed_list.member?(field) + raise ProtocolError, "#{field.inspect} not signed" + end + end + end + + def verify_return_to + begin + msg_return_to = URI.parse(URINorm::urinorm(fetch('return_to'))) + rescue URI::InvalidURIError + raise ProtocolError, ("return_to is not a valid URI") + end + + verify_return_to_args(msg_return_to) + if !@current_url.nil? + verify_return_to_base(msg_return_to) + end + end + + def verify_return_to_args(msg_return_to) + return_to_parsed_query = {} + if !msg_return_to.query.nil? + CGI.parse(msg_return_to.query).each_pair do |k, vs| + return_to_parsed_query[k] = vs[0] + end + end + query = @message.to_post_args + return_to_parsed_query.each_pair do |rt_key, rt_val| + msg_val = query[rt_key] + if msg_val.nil? + raise ProtocolError, "Message missing return_to argument '#{rt_key}'" + elsif msg_val != rt_val + raise ProtocolError, ("Parameter '#{rt_key}' value "\ + "#{msg_val.inspect} does not match "\ + "return_to's value #{rt_val.inspect}") + end + end + @message.get_args(BARE_NS).each_pair do |bare_key, bare_val| + rt_val = return_to_parsed_query[bare_key] + if not return_to_parsed_query.has_key? bare_key + # This may be caused by your web framework throwing extra + # entries in to your parameters hash that were not GET or + # POST parameters. For example, Rails has been known to + # add "controller" and "action" keys; another server adds + # at least a "format" key. + raise ProtocolError, ("Unexpected parameter (not on return_to): "\ + "'#{bare_key}'=#{rt_val.inspect})") + end + if rt_val != bare_val + raise ProtocolError, ("Parameter '#{bare_key}' value "\ + "#{bare_val.inspect} does not match "\ + "return_to's value #{rt_val.inspect}") + end + end + end + + def verify_return_to_base(msg_return_to) + begin + app_parsed = URI.parse(URINorm::urinorm(@current_url)) + rescue URI::InvalidURIError + raise ProtocolError, "current_url is not a valid URI: #{@current_url}" + end + + [:scheme, :host, :port, :path].each do |meth| + if msg_return_to.send(meth) != app_parsed.send(meth) + raise ProtocolError, "return_to #{meth.to_s} does not match" + end + end + end + + # Raises ProtocolError if the signature is bad + def check_signature + if @store.nil? + assoc = nil + else + assoc = @store.get_association(server_url, fetch('assoc_handle')) + end + + if assoc.nil? + check_auth + else + if assoc.expires_in <= 0 + # XXX: It might be a good idea sometimes to re-start the + # authentication with a new association. Doing it + # automatically opens the possibility for + # denial-of-service by a server that just returns expired + # associations (or really short-lived associations) + raise ProtocolError, "Association with #{server_url} expired" + elsif !assoc.check_message_signature(@message) + raise ProtocolError, "Bad signature in response from #{server_url}" + end + end + end + + def check_auth + Util.log("Using 'check_authentication' with #{server_url}") + begin + request = create_check_auth_request + rescue Message::KeyNotFound => why + raise ProtocolError, "Could not generate 'check_authentication' "\ + "request: #{why.message}" + end + + response = OpenID.make_kv_post(request, server_url) + + process_check_auth_response(response) + end + + def create_check_auth_request + signed_list = @message.get_arg(OPENID_NS, 'signed', NO_DEFAULT).split(',') + + # check that we got all the signed arguments + signed_list.each {|k| + @message.get_aliased_arg(k, NO_DEFAULT) + } + + ca_message = @message.copy + ca_message.set_arg(OPENID_NS, 'mode', 'check_authentication') + + return ca_message + end + + # Process the response message from a check_authentication + # request, invalidating associations if requested. + def process_check_auth_response(response) + is_valid = response.get_arg(OPENID_NS, 'is_valid', 'false') + + invalidate_handle = response.get_arg(OPENID_NS, 'invalidate_handle') + if !invalidate_handle.nil? + Util.log("Received 'invalidate_handle' from server #{server_url}") + if @store.nil? + Util.log('Unexpectedly got "invalidate_handle" without a store!') + else + @store.remove_association(server_url, invalidate_handle) + end + end + + if is_valid != 'true' + raise ProtocolError, ("Server #{server_url} responds that the "\ + "'check_authentication' call is not valid") + end + end + + def check_nonce + case openid_namespace + when OPENID1_NS + nonce = + @message.get_arg(BARE_NS, Consumer.openid1_return_to_nonce_name) + + # We generated the nonce, so it uses the empty string as the + # server URL + server_url = '' + when OPENID2_NS + nonce = @message.get_arg(OPENID2_NS, 'response_nonce') + server_url = self.server_url + else + raise StandardError, 'Not reached' + end + + if nonce.nil? + raise ProtocolError, 'Nonce missing from response' + end + + begin + time, extra = Nonce.split_nonce(nonce) + rescue ArgumentError => why + raise ProtocolError, "Malformed nonce: #{nonce.inspect}" + end + + if !@store.nil? && !@store.use_nonce(server_url, time, extra) + raise ProtocolError, ("Nonce already used or out of range: "\ + "#{nonce.inspect}") + end + end + + def verify_discovery_results + begin + case openid_namespace + when OPENID1_NS + verify_discovery_results_openid1 + when OPENID2_NS + verify_discovery_results_openid2 + else + raise StandardError, "Not reached: #{openid_namespace}" + end + rescue Message::KeyNotFound => why + raise ProtocolError, "Missing required field: #{why.message}" + end + end + + def verify_discovery_results_openid2 + to_match = OpenIDServiceEndpoint.new + to_match.type_uris = [OPENID_2_0_TYPE] + to_match.claimed_id = fetch('claimed_id', nil) + to_match.local_id = fetch('identity', nil) + to_match.server_url = fetch('op_endpoint') + + if to_match.claimed_id.nil? && !to_match.local_id.nil? + raise ProtocolError, ('openid.identity is present without '\ + 'openid.claimed_id') + elsif !to_match.claimed_id.nil? && to_match.local_id.nil? + raise ProtocolError, ('openid.claimed_id is present without '\ + 'openid.identity') + + # This is a response without identifiers, so there's really no + # checking that we can do, so return an endpoint that's for + # the specified `openid.op_endpoint' + elsif to_match.claimed_id.nil? + @endpoint = + OpenIDServiceEndpoint.from_op_endpoint_url(to_match.server_url) + return + end + + if @endpoint.nil? + Util.log('No pre-discovered information supplied') + discover_and_verify(to_match.claimed_id, [to_match]) + else + begin + verify_discovery_single(@endpoint, to_match) + rescue ProtocolError => why + Util.log("Error attempting to use stored discovery "\ + "information: #{why.message}") + Util.log("Attempting discovery to verify endpoint") + discover_and_verify(to_match.claimed_id, [to_match]) + end + end + + if @endpoint.claimed_id != to_match.claimed_id + @endpoint = @endpoint.dup + @endpoint.claimed_id = to_match.claimed_id + end + end + + def verify_discovery_results_openid1 + claimed_id = + @message.get_arg(BARE_NS, Consumer.openid1_return_to_claimed_id_name) + + if claimed_id.nil? + if @endpoint.nil? + raise ProtocolError, ("When using OpenID 1, the claimed ID must "\ + "be supplied, either by passing it through "\ + "as a return_to parameter or by using a "\ + "session, and supplied to the IdResHandler "\ + "when it is constructed.") + else + claimed_id = @endpoint.claimed_id + end + end + + to_match = OpenIDServiceEndpoint.new + to_match.type_uris = [OPENID_1_1_TYPE] + to_match.local_id = fetch('identity') + # Restore delegate information from the initiation phase + to_match.claimed_id = claimed_id + + to_match_1_0 = to_match.dup + to_match_1_0.type_uris = [OPENID_1_0_TYPE] + + if !@endpoint.nil? + begin + begin + verify_discovery_single(@endpoint, to_match) + rescue TypeURIMismatch + verify_discovery_single(@endpoint, to_match_1_0) + end + rescue ProtocolError => why + Util.log('Error attempting to use stored discovery information: ' + + why.message) + Util.log('Attempting discovery to verify endpoint') + else + return @endpoint + end + end + + # Either no endpoint was supplied or OpenID 1.x verification + # of the information that's in the message failed on that + # endpoint. + discover_and_verify(to_match.claimed_id, [to_match, to_match_1_0]) + end + + # Given an endpoint object created from the information in an + # OpenID response, perform discovery and verify the discovery + # results, returning the matching endpoint that is the result of + # doing that discovery. + def discover_and_verify(claimed_id, to_match_endpoints) + Util.log("Performing discovery on #{claimed_id}") + _, services = OpenID.discover(claimed_id) + if services.length == 0 + # XXX: this might want to be something other than + # ProtocolError. In Python, it's DiscoveryFailure + raise ProtocolError, ("No OpenID information found at "\ + "#{claimed_id}") + end + verify_discovered_services(claimed_id, services, to_match_endpoints) + end + + + def verify_discovered_services(claimed_id, services, to_match_endpoints) + # Search the services resulting from discovery to find one + # that matches the information from the assertion + failure_messages = [] + for endpoint in services + for to_match_endpoint in to_match_endpoints + begin + verify_discovery_single(endpoint, to_match_endpoint) + rescue ProtocolError => why + failure_messages << why.message + else + # It matches, so discover verification has + # succeeded. Return this endpoint. + @endpoint = endpoint + return + end + end + end + + Util.log("Discovery verification failure for #{claimed_id}") + failure_messages.each do |failure_message| + Util.log(" * Endpoint mismatch: " + failure_message) + end + + # XXX: is DiscoveryFailure in Python OpenID + raise ProtocolError, ("No matching endpoint found after "\ + "discovering #{claimed_id}") + end + + def verify_discovery_single(endpoint, to_match) + # Every type URI that's in the to_match endpoint has to be + # present in the discovered endpoint. + for type_uri in to_match.type_uris + if !endpoint.uses_extension(type_uri) + raise TypeURIMismatch.new(type_uri, endpoint) + end + end + + # Fragments do not influence discovery, so we can't compare a + # claimed identifier with a fragment to discovered information. + defragged_claimed_id = + case Yadis::XRI.identifier_scheme(endpoint.claimed_id) + when :xri + endpoint.claimed_id + when :uri + begin + parsed = URI.parse(endpoint.claimed_id) + rescue URI::InvalidURIError + endpoint.claimed_id + else + parsed.fragment = nil + parsed.to_s + end + else + raise StandardError, 'Not reached' + end + + if defragged_claimed_id != endpoint.claimed_id + raise ProtocolError, ("Claimed ID does not match (different "\ + "subjects!), Expected "\ + "#{defragged_claimed_id}, got "\ + "#{endpoint.claimed_id}") + end + + if to_match.get_local_id != endpoint.get_local_id + raise ProtocolError, ("local_id mismatch. Expected "\ + "#{to_match.get_local_id}, got "\ + "#{endpoint.get_local_id}") + end + + # If the server URL is nil, this must be an OpenID 1 + # response, because op_endpoint is a required parameter in + # OpenID 2. In that case, we don't actually care what the + # discovered server_url is, because signature checking or + # check_auth should take care of that check for us. + if to_match.server_url.nil? + if to_match.preferred_namespace != OPENID1_NS + raise StandardError, + "The code calling this must ensure that OpenID 2 "\ + "responses have a non-none `openid.op_endpoint' and "\ + "that it is set as the `server_url' attribute of the "\ + "`to_match' endpoint." + end + elsif to_match.server_url != endpoint.server_url + raise ProtocolError, ("OP Endpoint mismatch. Expected"\ + "#{to_match.server_url}, got "\ + "#{endpoint.server_url}") + end + end + + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/responses.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/responses.rb new file mode 100644 index 00000000..91262398 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/consumer/responses.rb @@ -0,0 +1,148 @@ +module OpenID + class Consumer + # Code returned when either the of the + # OpenID::OpenIDConsumer.begin_auth or OpenID::OpenIDConsumer.complete_auth + # methods return successfully. + SUCCESS = :success + + # Code OpenID::OpenIDConsumer.complete_auth + # returns when the value it received indicated an invalid login. + FAILURE = :failure + + # Code returned by OpenIDConsumer.complete_auth when the user + # cancels the operation from the server. + CANCEL = :cancel + + # Code returned by OpenID::OpenIDConsumer.complete_auth when the + # OpenIDConsumer instance is in immediate mode and ther server sends back a + # URL for the user to login with. + SETUP_NEEDED = :setup_needed + + + module Response + attr_reader :endpoint + + def status + self.class::STATUS + end + + # The identity URL that has been authenticated; the Claimed Identifier. + # See also display_identifier. + def identity_url + @endpoint ? @endpoint.claimed_id : nil + end + + # The display identifier is related to the Claimed Identifier, but the + # two are not always identical. The display identifier is something the + # user should recognize as what they entered, whereas the response's + # claimed identifier (in the identity_url attribute) may have extra + # information for better persistence. + # + # URLs will be stripped of their fragments for display. XRIs will + # display the human-readable identifier (i-name) instead of the + # persistent identifier (i-number). + # + # Use the display identifier in your user interface. Use identity_url + # for querying your database or authorization server, or other + # identifier equality comparisons. + def display_identifier + @endpoint ? @endpoint.display_identifier : nil + end + end + + # A successful acknowledgement from the OpenID server that the + # supplied URL is, indeed controlled by the requesting agent. + class SuccessResponse + include Response + + STATUS = SUCCESS + + attr_reader :message, :signed_fields + + def initialize(endpoint, message, signed_fields) + # Don't use :endpoint=, because endpoint should never be nil + # for a successfull transaction. + @endpoint = endpoint + @identity_url = endpoint.claimed_id + @message = message + @signed_fields = signed_fields + end + + # Was this authentication response an OpenID 1 authentication + # response? + def is_openid1 + @message.is_openid1 + end + + # Return whether a particular key is signed, regardless of its + # namespace alias + def signed?(ns_uri, ns_key) + @signed_fields.member?(@message.get_key(ns_uri, ns_key)) + end + + # Return the specified signed field if available, otherwise + # return default + def get_signed(ns_uri, ns_key, default=nil) + if singed?(ns_uri, ns_key) + return @message.get_arg(ns_uri, ns_key, default) + else + return default + end + end + + # Get signed arguments from the response message. Return a dict + # of all arguments in the specified namespace. If any of the + # arguments are not signed, return nil. + def get_signed_ns(ns_uri) + msg_args = @message.get_args(ns_uri) + msg_args.each_key do |key| + if !signed?(ns_uri, key) + return nil + end + end + return msg_args + end + + # Return response arguments in the specified namespace. + # If require_signed is true and the arguments are not signed, + # return nil. + def extension_response(namespace_uri, require_signed) + if require_signed + get_signed_ns(namespace_uri) + else + @message.get_args(namespace_uri) + end + end + end + + class FailureResponse + include Response + STATUS = FAILURE + + attr_reader :message, :contact, :reference + def initialize(endpoint, message, contact=nil, reference=nil) + @endpoint = endpoint + @message = message + @contact = contact + @reference = reference + end + end + + class CancelResponse + include Response + STATUS = CANCEL + def initialize(endpoint) + @endpoint = endpoint + end + end + + class SetupNeededResponse + include Response + STATUS = SETUP_NEEDED + def initialize(endpoint, setup_url) + @endpoint = endpoint + @setup_url = setup_url + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/cryptutil.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/cryptutil.rb new file mode 100644 index 00000000..d8ffead9 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/cryptutil.rb @@ -0,0 +1,97 @@ +require "openid/util" +require "digest/sha1" +require "digest/sha2" +begin + require "digest/hmac" +rescue LoadError + require "hmac/sha1" + require "hmac/sha2" +end + +module OpenID + # This module contains everything needed to perform low-level + # cryptograph and data manipulation tasks. + module CryptUtil + + # Generate a random number, doing a little extra work to make it + # more likely that it's suitable for cryptography. If your system + # doesn't have /dev/urandom then this number is not + # cryptographically safe. See + # + # for more information. max is the largest possible value of such + # a random number, where the result will be less than max. + def CryptUtil.rand(max) + Kernel.srand() + return Kernel.rand(max) + end + + def CryptUtil.sha1(text) + return Digest::SHA1.digest(text) + end + + def CryptUtil.hmac_sha1(key, text) + if Digest.const_defined? :HMAC + Digest::HMAC.new(key,Digest::SHA1).update(text).digest + else + return HMAC::SHA1.digest(key, text) + end + end + + def CryptUtil.sha256(text) + return Digest::SHA256.digest(text) + end + + def CryptUtil.hmac_sha256(key, text) + if Digest.const_defined? :HMAC + Digest::HMAC.new(key,Digest::SHA256).update(text).digest + else + return HMAC::SHA256.digest(key, text) + end + end + + # Generate a random string of the given length, composed of the + # specified characters. If chars is nil, generate a string + # composed of characters in the range 0..255. + def CryptUtil.random_string(length, chars=nil) + s = "" + + unless chars.nil? + length.times { s << chars[rand(chars.length)] } + else + length.times { s << rand(256).chr } + end + return s + end + + # Convert a number to its binary representation; return a string + # of bytes. + def CryptUtil.num_to_binary(n) + bits = n.to_s(2) + prepend = (8 - bits.length % 8) + bits = ('0' * prepend) + bits + return [bits].pack('B*') + end + + # Convert a string of bytes into a number. + def CryptUtil.binary_to_num(s) + # taken from openid-ruby 0.0.1 + s = "\000" * (4 - (s.length % 4)) + s + num = 0 + s.unpack('N*').each do |x| + num <<= 32 + num |= x + end + return num + end + + # Encode a number as a base64-encoded byte string. + def CryptUtil.num_to_base64(l) + return OpenID::Util.to_base64(num_to_binary(l)) + end + + # Decode a base64 byte string to a number. + def CryptUtil.base64_to_num(s) + return binary_to_num(OpenID::Util.from_base64(s)) + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/dh.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/dh.rb new file mode 100644 index 00000000..cbe53114 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/dh.rb @@ -0,0 +1,89 @@ +require "openid/util" +require "openid/cryptutil" + +module OpenID + + # Encapsulates a Diffie-Hellman key exchange. This class is used + # internally by both the consumer and server objects. + # + # Read more about Diffie-Hellman on wikipedia: + # http://en.wikipedia.org/wiki/Diffie-Hellman + + class DiffieHellman + + # From the OpenID specification + @@default_mod = 155172898181473697471232257763715539915724801966915404479707795314057629378541917580651227423698188993727816152646631438561595825688188889951272158842675419950341258706556549803580104870537681476726513255747040765857479291291572334510643245094715007229621094194349783925984760375594985848253359305585439638443 + @@default_gen = 2 + + attr_reader :modulus, :generator, :public + + # A new DiffieHellman object, using the modulus and generator from + # the OpenID specification + def DiffieHellman.from_defaults + DiffieHellman.new(@@default_mod, @@default_gen) + end + + def initialize(modulus=nil, generator=nil, priv=nil) + @modulus = modulus.nil? ? @@default_mod : modulus + @generator = generator.nil? ? @@default_gen : generator + set_private(priv.nil? ? OpenID::CryptUtil.rand(@modulus-2) + 1 : priv) + end + + def get_shared_secret(composite) + DiffieHellman.powermod(composite, @private, @modulus) + end + + def xor_secret(algorithm, composite, secret) + dh_shared = get_shared_secret(composite) + packed_dh_shared = OpenID::CryptUtil.num_to_binary(dh_shared) + hashed_dh_shared = algorithm.call(packed_dh_shared) + return DiffieHellman.strxor(secret, hashed_dh_shared) + end + + def using_default_values? + @generator == @@default_gen && @modulus == @@default_mod + end + + private + def set_private(priv) + @private = priv + @public = DiffieHellman.powermod(@generator, @private, @modulus) + end + + def DiffieHellman.strxor(s, t) + if s.length != t.length + raise ArgumentError, "strxor: lengths don't match. " + + "Inputs were #{s.inspect} and #{t.inspect}" + end + + if String.method_defined? :bytes + s.bytes.zip(t.bytes).map{|sb,tb| sb^tb}.pack('C*') + else + indices = 0...(s.length) + chrs = indices.collect {|i| (s[i]^t[i]).chr} + chrs.join("") + end + end + + # This code is taken from this post: + # + # by Eric Lee Green. + def DiffieHellman.powermod(x, n, q) + counter=0 + n_p=n + y_p=1 + z_p=x + while n_p != 0 + if n_p[0]==1 + y_p=(y_p*z_p) % q + end + n_p = n_p >> 1 + z_p = (z_p * z_p) % q + counter += 1 + end + return y_p + end + + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/extension.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/extension.rb new file mode 100644 index 00000000..f0f02bb5 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/extension.rb @@ -0,0 +1,39 @@ +require 'openid/message' + +module OpenID + # An interface for OpenID extensions. + class Extension < Object + + def initialize + @ns_uri = nil + @ns_alias = nil + end + + # Get the string arguments that should be added to an OpenID + # message for this extension. + def get_extension_args + raise NotImplementedError + end + + # Add the arguments from this extension to the provided + # message, or create a new message containing only those + # arguments. Returns the message with added extension args. + def to_message(message = nil) + if message.nil? +# warnings.warn('Passing None to Extension.toMessage is deprecated. ' +# 'Creating a message assuming you want OpenID 2.', +# DeprecationWarning, stacklevel=2) + Message.new(OPENID2_NS) + end + message = Message.new if message.nil? + + implicit = message.is_openid1() + + message.namespaces.add_alias(@ns_uri, @ns_alias, implicit) + # XXX python ignores keyerror if m.ns.getAlias(uri) == alias + + message.update_args(@ns_uri, get_extension_args) + return message + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/ax.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/ax.rb new file mode 100644 index 00000000..55eda8e7 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/ax.rb @@ -0,0 +1,516 @@ +# Implements the OpenID attribute exchange specification, version 1.0 + +require 'openid/extension' +require 'openid/trustroot' +require 'openid/message' + +module OpenID + module AX + + UNLIMITED_VALUES = "unlimited" + MINIMUM_SUPPORTED_ALIAS_LENGTH = 32 + + # check alias for invalid characters, raise AXError if found + def self.check_alias(name) + if name.match(/(,|\.)/) + raise Error, ("Alias #{name.inspect} must not contain a "\ + "comma or period.") + end + end + + # Raised when data does not comply with AX 1.0 specification + class Error < ArgumentError + end + + # Abstract class containing common code for attribute exchange messages + class AXMessage < Extension + attr_accessor :ns_alias, :mode, :ns_uri + + NS_URI = 'http://openid.net/srv/ax/1.0' + def initialize + @ns_alias = 'ax' + @ns_uri = NS_URI + @mode = nil + end + + protected + + # Raise an exception if the mode in the attribute exchange + # arguments does not match what is expected for this class. + def check_mode(ax_args) + actual_mode = ax_args['mode'] + if actual_mode != @mode + raise Error, "Expected mode #{mode.inspect}, got #{actual_mode.inspect}" + end + end + + def new_args + {'mode' => @mode} + end + end + + # Represents a single attribute in an attribute exchange + # request. This should be added to an Request object in order to + # request the attribute. + # + # @ivar required: Whether the attribute will be marked as required + # when presented to the subject of the attribute exchange + # request. + # @type required: bool + # + # @ivar count: How many values of this type to request from the + # subject. Defaults to one. + # @type count: int + # + # @ivar type_uri: The identifier that determines what the attribute + # represents and how it is serialized. For example, one type URI + # representing dates could represent a Unix timestamp in base 10 + # and another could represent a human-readable string. + # @type type_uri: str + # + # @ivar ns_alias: The name that should be given to this alias in the + # request. If it is not supplied, a generic name will be + # assigned. For example, if you want to call a Unix timestamp + # value 'tstamp', set its alias to that value. If two attributes + # in the same message request to use the same alias, the request + # will fail to be generated. + # @type alias: str or NoneType + class AttrInfo < Object + attr_reader :type_uri, :count, :ns_alias + attr_accessor :required + def initialize(type_uri, ns_alias=nil, required=false, count=1) + @type_uri = type_uri + @count = count + @required = required + @ns_alias = ns_alias + end + + def wants_unlimited_values? + @count == UNLIMITED_VALUES + end + end + + # Given a namespace mapping and a string containing a + # comma-separated list of namespace aliases, return a list of type + # URIs that correspond to those aliases. + # namespace_map: OpenID::NamespaceMap + def self.to_type_uris(namespace_map, alias_list_s) + return [] if alias_list_s.nil? + alias_list_s.split(',').inject([]) {|uris, name| + type_uri = namespace_map.get_namespace_uri(name) + raise IndexError, "No type defined for attribute name #{name.inspect}" if type_uri.nil? + uris << type_uri + } + end + + + # An attribute exchange 'fetch_request' message. This message is + # sent by a relying party when it wishes to obtain attributes about + # the subject of an OpenID authentication request. + class FetchRequest < AXMessage + attr_reader :requested_attributes + attr_accessor :update_url + + def initialize(update_url = nil) + super() + @mode = 'fetch_request' + @requested_attributes = {} + @update_url = update_url + end + + # Add an attribute to this attribute exchange request. + # attribute: AttrInfo, the attribute being requested + # Raises IndexError if the requested attribute is already present + # in this request. + def add(attribute) + if @requested_attributes[attribute.type_uri] + raise IndexError, "The attribute #{attribute.type_uri} has already been requested" + end + @requested_attributes[attribute.type_uri] = attribute + end + + # Get the serialized form of this attribute fetch request. + # returns a hash of the arguments + def get_extension_args + aliases = NamespaceMap.new + required = [] + if_available = [] + ax_args = new_args + @requested_attributes.each{|type_uri, attribute| + if attribute.ns_alias + name = aliases.add_alias(type_uri, attribute.ns_alias) + else + name = aliases.add(type_uri) + end + if attribute.required + required << name + else + if_available << name + end + if attribute.count != 1 + ax_args["count.#{name}"] = attribute.count.to_s + end + ax_args["type.#{name}"] = type_uri + } + + unless required.empty? + ax_args['required'] = required.join(',') + end + unless if_available.empty? + ax_args['if_available'] = if_available.join(',') + end + return ax_args + end + + # Get the type URIs for all attributes that have been marked + # as required. + def get_required_attrs + @requested_attributes.inject([]) {|required, (type_uri, attribute)| + if attribute.required + required << type_uri + else + required + end + } + end + + # Extract a FetchRequest from an OpenID message + # message: OpenID::Message + # return a FetchRequest or nil if AX arguments are not present + def self.from_openid_request(oidreq) + message = oidreq.message + ax_args = message.get_args(NS_URI) + return nil if ax_args == {} + req = new + req.parse_extension_args(ax_args) + + if req.update_url + realm = message.get_arg(OPENID_NS, 'realm', + message.get_arg(OPENID_NS, 'return_to')) + if realm.nil? or realm.empty? + raise Error, "Cannot validate update_url #{req.update_url.inspect} against absent realm" + end + tr = TrustRoot::TrustRoot.parse(realm) + unless tr.validate_url(req.update_url) + raise Error, "Update URL #{req.update_url.inspect} failed validation against realm #{realm.inspect}" + end + end + + return req + end + + def parse_extension_args(ax_args) + check_mode(ax_args) + + aliases = NamespaceMap.new + + ax_args.each{|k,v| + if k.index('type.') == 0 + name = k[5..-1] + type_uri = v + aliases.add_alias(type_uri, name) + + count_key = 'count.'+name + count_s = ax_args[count_key] + count = 1 + if count_s + if count_s == UNLIMITED_VALUES + count = count_s + else + count = count_s.to_i + if count <= 0 + raise Error, "Invalid value for count #{count_key.inspect}: #{count_s.inspect}" + end + end + end + add(AttrInfo.new(type_uri, name, false, count)) + end + } + + required = AX.to_type_uris(aliases, ax_args['required']) + required.each{|type_uri| + @requested_attributes[type_uri].required = true + } + if_available = AX.to_type_uris(aliases, ax_args['if_available']) + all_type_uris = required + if_available + + aliases.namespace_uris.each{|type_uri| + unless all_type_uris.member? type_uri + raise Error, "Type URI #{type_uri.inspect} was in the request but not present in 'required' or 'if_available'" + end + } + @update_url = ax_args['update_url'] + end + + # return the list of AttrInfo objects contained in the FetchRequest + def attributes + @requested_attributes.values + end + + # return the list of requested attribute type URIs + def requested_types + @requested_attributes.keys + end + + def member?(type_uri) + ! @requested_attributes[type_uri].nil? + end + + end + + # Abstract class that implements a message that has attribute + # keys and values. It contains the common code between + # fetch_response and store_request. + class KeyValueMessage < AXMessage + attr_reader :data + def initialize + super() + @mode = nil + @data = {} + @data.default = [] + end + + # Add a single value for the given attribute type to the + # message. If there are already values specified for this type, + # this value will be sent in addition to the values already + # specified. + def add_value(type_uri, value) + @data[type_uri] = @data[type_uri] << value + end + + # Set the values for the given attribute type. This replaces + # any values that have already been set for this attribute. + def set_values(type_uri, values) + @data[type_uri] = values + end + + # Get the extension arguments for the key/value pairs + # contained in this message. + def _get_extension_kv_args(aliases = nil) + aliases = NamespaceMap.new if aliases.nil? + + ax_args = new_args + + @data.each{|type_uri, values| + name = aliases.add(type_uri) + ax_args['type.'+name] = type_uri + ax_args['count.'+name] = values.size.to_s + + values.each_with_index{|value, i| + key = "value.#{name}.#{i+1}" + ax_args[key] = value + } + } + return ax_args + end + + # Parse attribute exchange key/value arguments into this object. + + def parse_extension_args(ax_args) + check_mode(ax_args) + aliases = NamespaceMap.new + + ax_args.each{|k, v| + if k.index('type.') == 0 + type_uri = v + name = k[5..-1] + + AX.check_alias(name) + aliases.add_alias(type_uri,name) + end + } + + aliases.each{|type_uri, name| + count_s = ax_args['count.'+name] + count = count_s.to_i + if count_s.nil? + value = ax_args['value.'+name] + if value.nil? + raise IndexError, "Missing #{'value.'+name} in FetchResponse" + elsif value.empty? + values = [] + else + values = [value] + end + elsif count_s.to_i == 0 + values = [] + else + values = (1..count).inject([]){|l,i| + key = "value.#{name}.#{i}" + v = ax_args[key] + raise IndexError, "Missing #{key} in FetchResponse" if v.nil? + l << v + } + end + @data[type_uri] = values + } + end + + # Get a single value for an attribute. If no value was sent + # for this attribute, use the supplied default. If there is more + # than one value for this attribute, this method will fail. + def get_single(type_uri, default = nil) + values = @data[type_uri] + return default if values.empty? + if values.size != 1 + raise Error, "More than one value present for #{type_uri.inspect}" + else + return values[0] + end + end + + # retrieve the list of values for this attribute + def get(type_uri) + @data[type_uri] + end + + # retrieve the list of values for this attribute + def [](type_uri) + @data[type_uri] + end + + # get the number of responses for this attribute + def count(type_uri) + @data[type_uri].size + end + + end + + # A fetch_response attribute exchange message + class FetchResponse < KeyValueMessage + attr_reader :update_url + + def initialize(update_url = nil) + super() + @mode = 'fetch_response' + @update_url = update_url + end + + # Serialize this object into arguments in the attribute + # exchange namespace + # Takes an optional FetchRequest. If specified, the response will be + # validated against this request, and empty responses for requested + # fields with no data will be sent. + def get_extension_args(request = nil) + aliases = NamespaceMap.new + zero_value_types = [] + + if request + # Validate the data in the context of the request (the + # same attributes should be present in each, and the + # counts in the response must be no more than the counts + # in the request) + @data.keys.each{|type_uri| + unless request.member? type_uri + raise IndexError, "Response attribute not present in request: #{type_uri.inspect}" + end + } + + request.attributes.each{|attr_info| + # Copy the aliases from the request so that reading + # the response in light of the request is easier + if attr_info.ns_alias.nil? + aliases.add(attr_info.type_uri) + else + aliases.add_alias(attr_info.type_uri, attr_info.ns_alias) + end + values = @data[attr_info.type_uri] + if values.empty? # @data defaults to [] + zero_value_types << attr_info + end + if attr_info.count != UNLIMITED_VALUES and attr_info.count < values.size + raise Error, "More than the number of requested values were specified for #{attr_info.type_uri.inspect}" + end + } + end + + kv_args = _get_extension_kv_args(aliases) + + # Add the KV args into the response with the args that are + # unique to the fetch_response + ax_args = new_args + + zero_value_types.each{|attr_info| + name = aliases.get_alias(attr_info.type_uri) + kv_args['type.' + name] = attr_info.type_uri + kv_args['count.' + name] = '0' + } + update_url = (request and request.update_url or @update_url) + ax_args['update_url'] = update_url unless update_url.nil? + ax_args.update(kv_args) + return ax_args + end + + def parse_extension_args(ax_args) + super + @update_url = ax_args['update_url'] + end + + # Construct a FetchResponse object from an OpenID library + # SuccessResponse object. + def self.from_success_response(success_response, signed=true) + obj = self.new + if signed + ax_args = success_response.get_signed_ns(obj.ns_uri) + else + ax_args = success_response.message.get_args(obj.ns_uri) + end + + begin + obj.parse_extension_args(ax_args) + return obj + rescue Error => e + return nil + end + end + end + + # A store request attribute exchange message representation + class StoreRequest < KeyValueMessage + def initialize + super + @mode = 'store_request' + end + + def get_extension_args(aliases=nil) + ax_args = new_args + kv_args = _get_extension_kv_args(aliases) + ax_args.update(kv_args) + return ax_args + end + end + + # An indication that the store request was processed along with + # this OpenID transaction. + class StoreResponse < AXMessage + SUCCESS_MODE = 'store_response_success' + FAILURE_MODE = 'store_response_failure' + attr_reader :error_message + + def initialize(succeeded = true, error_message = nil) + super() + if succeeded and error_message + raise Error, "Error message included in a success response" + end + if succeeded + @mode = SUCCESS_MODE + else + @mode = FAILURE_MODE + end + @error_message = error_message + end + + def succeeded? + @mode == SUCCESS_MODE + end + + def get_extension_args + ax_args = new_args + if !succeeded? and error_message + ax_args['error'] = @error_message + end + return ax_args + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/pape.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/pape.rb new file mode 100644 index 00000000..0a7413c1 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/pape.rb @@ -0,0 +1,179 @@ +# An implementation of the OpenID Provider Authentication Policy +# Extension 1.0 +# see: http://openid.net/specs/ + +require 'openid/extension' + +module OpenID + + module PAPE + NS_URI = "http://specs.openid.net/extensions/pape/1.0" + AUTH_MULTI_FACTOR_PHYSICAL = + 'http://schemas.openid.net/pape/policies/2007/06/multi-factor-physical' + AUTH_MULTI_FACTOR = + 'http://schemas.openid.net/pape/policies/2007/06/multi-factor' + AUTH_PHISHING_RESISTANT = + 'http://schemas.openid.net/pape/policies/2007/06/phishing-resistant' + TIME_VALIDATOR = /\d\d\d\d-\d\d-\d\dT\d\d:\d\d:\d\dZ/ + # A Provider Authentication Policy request, sent from a relying + # party to a provider + class Request < Extension + attr_accessor :preferred_auth_policies, :max_auth_age, :ns_alias, :ns_uri + def initialize(preferred_auth_policies=[], max_auth_age=nil) + @ns_alias = 'pape' + @ns_uri = NS_URI + @preferred_auth_policies = preferred_auth_policies + @max_auth_age = max_auth_age + end + + # Add an acceptable authentication policy URI to this request + # This method is intended to be used by the relying party to add + # acceptable authentication types to the request. + def add_policy_uri(policy_uri) + unless @preferred_auth_policies.member? policy_uri + @preferred_auth_policies << policy_uri + end + end + + def get_extension_args + ns_args = { + 'preferred_auth_policies' => @preferred_auth_policies.join(' ') + } + ns_args['max_auth_age'] = @max_auth_age.to_s if @max_auth_age + return ns_args + end + + # Instantiate a Request object from the arguments in a + # checkid_* OpenID message + # return nil if the extension was not requested. + def self.from_openid_request(oid_req) + pape_req = new + args = oid_req.message.get_args(NS_URI) + if args == {} + return nil + end + pape_req.parse_extension_args(args) + return pape_req + end + + # Set the state of this request to be that expressed in these + # PAPE arguments + def parse_extension_args(args) + @preferred_auth_policies = [] + policies_str = args['preferred_auth_policies'] + if policies_str + policies_str.split(' ').each{|uri| + add_policy_uri(uri) + } + end + + max_auth_age_str = args['max_auth_age'] + if max_auth_age_str + @max_auth_age = max_auth_age_str.to_i + else + @max_auth_age = nil + end + end + + # Given a list of authentication policy URIs that a provider + # supports, this method returns the subset of those types + # that are preferred by the relying party. + def preferred_types(supported_types) + @preferred_auth_policies.select{|uri| supported_types.member? uri} + end + end + + # A Provider Authentication Policy response, sent from a provider + # to a relying party + class Response < Extension + attr_accessor :ns_alias, :auth_policies, :auth_time, :nist_auth_level + def initialize(auth_policies=[], auth_time=nil, nist_auth_level=nil) + @ns_alias = 'pape' + @ns_uri = NS_URI + @auth_policies = auth_policies + @auth_time = auth_time + @nist_auth_level = nist_auth_level + end + + # Add a policy URI to the response + # see http://openid.net/specs/openid-provider-authentication-policy-extension-1_0-01.html#auth_policies + def add_policy_uri(policy_uri) + @auth_policies << policy_uri unless @auth_policies.member?(policy_uri) + end + + # Create a Response object from an OpenID::Consumer::SuccessResponse + def self.from_success_response(success_response) + args = success_response.get_signed_ns(NS_URI) + return nil if args.nil? + pape_resp = new + pape_resp.parse_extension_args(args) + return pape_resp + end + + # parse the provider authentication policy arguments into the + # internal state of this object + # if strict is specified, raise an exception when bad data is + # encountered + def parse_extension_args(args, strict=false) + policies_str = args['auth_policies'] + if policies_str and policies_str != 'none' + @auth_policies = policies_str.split(' ') + end + + nist_level_str = args['nist_auth_level'] + if nist_level_str + # special handling of zero to handle to_i behavior + if nist_level_str.strip == '0' + nist_level = 0 + else + nist_level = nist_level_str.to_i + # if it's zero here we have a bad value + if nist_level == 0 + nist_level = nil + end + end + if nist_level and nist_level >= 0 and nist_level < 5 + @nist_auth_level = nist_level + elsif strict + raise ArgumentError, "nist_auth_level must be an integer 0 through 4, not #{nist_level_str.inspect}" + end + end + + auth_time_str = args['auth_time'] + if auth_time_str + # validate time string + if auth_time_str =~ TIME_VALIDATOR + @auth_time = auth_time_str + elsif strict + raise ArgumentError, "auth_time must be in RFC3339 format" + end + end + end + + def get_extension_args + ns_args = {} + if @auth_policies.empty? + ns_args['auth_policies'] = 'none' + else + ns_args['auth_policies'] = @auth_policies.join(' ') + end + if @nist_auth_level + unless (0..4).member? @nist_auth_level + raise ArgumentError, "nist_auth_level must be an integer 0 through 4, not #{@nist_auth_level.inspect}" + end + ns_args['nist_auth_level'] = @nist_auth_level.to_s + end + + if @auth_time + unless @auth_time =~ TIME_VALIDATOR + raise ArgumentError, "auth_time must be in RFC3339 format" + end + ns_args['auth_time'] = @auth_time + end + return ns_args + end + + end + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/sreg.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/sreg.rb new file mode 100644 index 00000000..8dc780eb --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/extensions/sreg.rb @@ -0,0 +1,277 @@ +require 'openid/extension' +require 'openid/util' +require 'openid/message' + +module OpenID + module SReg + DATA_FIELDS = { + 'fullname'=>'Full Name', + 'nickname'=>'Nickname', + 'dob'=>'Date of Birth', + 'email'=>'E-mail Address', + 'gender'=>'Gender', + 'postcode'=>'Postal Code', + 'country'=>'Country', + 'language'=>'Language', + 'timezone'=>'Time Zone', + } + + NS_URI_1_0 = 'http://openid.net/sreg/1.0' + NS_URI_1_1 = 'http://openid.net/extensions/sreg/1.1' + NS_URI = NS_URI_1_1 + + begin + Message.register_namespace_alias(NS_URI_1_1, 'sreg') + rescue NamespaceAliasRegistrationError => e + Util.log(e) + end + + # raise ArgumentError if fieldname is not in the defined sreg fields + def OpenID.check_sreg_field_name(fieldname) + unless DATA_FIELDS.member? fieldname + raise ArgumentError, "#{fieldname} is not a defined simple registration field" + end + end + + # Does the given endpoint advertise support for simple registration? + def OpenID.supports_sreg?(endpoint) + endpoint.uses_extension(NS_URI_1_1) || endpoint.uses_extension(NS_URI_1_0) + end + + # Extract the simple registration namespace URI from the given + # OpenID message. Handles OpenID 1 and 2, as well as both sreg + # namespace URIs found in the wild, as well as missing namespace + # definitions (for OpenID 1) + def OpenID.get_sreg_ns(message) + [NS_URI_1_1, NS_URI_1_0].each{|ns| + if message.namespaces.get_alias(ns) + return ns + end + } + # try to add an alias, since we didn't find one + ns = NS_URI_1_1 + begin + message.namespaces.add_alias(ns, 'sreg') + rescue IndexError + raise NamespaceError + end + return ns + end + + # The simple registration namespace was not found and could not + # be created using the expected name (there's another extension + # using the name 'sreg') + # + # This is not illegal, for OpenID 2, although it probably + # indicates a problem, since it's not expected that other extensions + # will re-use the alias that is in use for OpenID 1. + # + # If this is an OpenID 1 request, then there is no recourse. This + # should not happen unless some code has modified the namespaces for + # the message that is being processed. + class NamespaceError < ArgumentError + end + + # An object to hold the state of a simple registration request. + class Request < Extension + attr_reader :optional, :required, :ns_uri + attr_accessor :policy_url + def initialize(required = nil, optional = nil, policy_url = nil, ns_uri = NS_URI) + super() + + @policy_url = policy_url + @ns_uri = ns_uri + @ns_alias = 'sreg' + @required = [] + @optional = [] + + if required + request_fields(required, true, true) + end + if optional + request_fields(optional, false, true) + end + end + + # Create a simple registration request that contains the + # fields that were requested in the OpenID request with the + # given arguments + # Takes an OpenID::CheckIDRequest, returns an OpenID::Sreg::Request + # return nil if the extension was not requested. + def self.from_openid_request(request) + # Since we're going to mess with namespace URI mapping, don't + # mutate the object that was passed in. + message = request.message.copy + ns_uri = OpenID::get_sreg_ns(message) + args = message.get_args(ns_uri) + return nil if args == {} + req = new(nil,nil,nil,ns_uri) + req.parse_extension_args(args) + return req + end + + # Parse the unqualified simple registration request + # parameters and add them to this object. + # + # This method is essentially the inverse of + # getExtensionArgs. This method restores the serialized simple + # registration request fields. + # + # If you are extracting arguments from a standard OpenID + # checkid_* request, you probably want to use fromOpenIDRequest, + # which will extract the sreg namespace and arguments from the + # OpenID request. This method is intended for cases where the + # OpenID server needs more control over how the arguments are + # parsed than that method provides. + def parse_extension_args(args, strict = false) + required_items = args['required'] + unless required_items.nil? or required_items.empty? + required_items.split(',').each{|field_name| + begin + request_field(field_name, true, strict) + rescue ArgumentError + raise if strict + end + } + end + + optional_items = args['optional'] + unless optional_items.nil? or optional_items.empty? + optional_items.split(',').each{|field_name| + begin + request_field(field_name, false, strict) + rescue ArgumentError + raise if strict + end + } + end + @policy_url = args['policy_url'] + end + + # A list of all of the simple registration fields that were + # requested, whether they were required or optional. + def all_requested_fields + @required + @optional + end + + # Have any simple registration fields been requested? + def were_fields_requested? + !all_requested_fields.empty? + end + + # Request the specified field from the OpenID user + # field_name: the unqualified simple registration field name + # required: whether the given field should be presented + # to the user as being a required to successfully complete + # the request + # strict: whether to raise an exception when a field is + # added to a request more than once + # Raises ArgumentError if the field_name is not a simple registration + # field, or if strict is set and a field is added more than once + def request_field(field_name, required=false, strict=false) + OpenID::check_sreg_field_name(field_name) + + if strict + if (@required + @optional).member? field_name + raise ArgumentError, 'That field has already been requested' + end + else + return if @required.member? field_name + if @optional.member? field_name + if required + @optional.delete field_name + else + return + end + end + end + if required + @required << field_name + else + @optional << field_name + end + end + + # Add the given list of fields to the request. + def request_fields(field_names, required = false, strict = false) + raise ArgumentError unless field_names.respond_to?(:each) and + field_names[0].is_a?(String) + field_names.each{|fn|request_field(fn, required, strict)} + end + + # Get a hash of unqualified simple registration arguments + # representing this request. + # This method is essentially the inverse of parse_extension_args. + # This method serializes the simple registration request fields. + def get_extension_args + args = {} + args['required'] = @required.join(',') unless @required.empty? + args['optional'] = @optional.join(',') unless @optional.empty? + args['policy_url'] = @policy_url unless @policy_url.nil? + return args + end + + def member?(field_name) + all_requested_fields.member?(field_name) + end + + end + + # Represents the data returned in a simple registration response + # inside of an OpenID id_res response. This object will be + # created by the OpenID server, added to the id_res response + # object, and then extracted from the id_res message by the Consumer. + class Response < Extension + attr_reader :ns_uri, :data + + def initialize(data = {}, ns_uri=NS_URI) + @ns_alias = 'sreg' + @data = data + @ns_uri = ns_uri + end + + # Take a Request and a hash of simple registration + # values and create a Response object containing that data. + def self.extract_response(request, data) + arf = request.all_requested_fields + resp_data = data.reject{|k,v| !arf.member?(k) || v.nil? } + new(resp_data, request.ns_uri) + end + + # Create an Response object from an + # OpenID::Consumer::SuccessResponse from consumer.complete + # If you set the signed_only parameter to false, unsigned data from + # the id_res message from the server will be processed. + def self.from_success_response(success_response, signed_only = true) + ns_uri = OpenID::get_sreg_ns(success_response.message) + if signed_only + args = success_response.get_signed_ns(ns_uri) + return nil if args.nil? # No signed args, so fail + else + args = success_response.message.get_args(ns_uri) + end + args.reject!{|k,v| !DATA_FIELDS.member?(k) } + new(args, ns_uri) + end + + # Get the fields to put in the simple registration namespace + # when adding them to an id_res message. + def get_extension_args + return @data + end + + # Read-only hashlike interface. + # Raises an exception if the field name is bad + def [](field_name) + OpenID::check_sreg_field_name(field_name) + data[field_name] + end + + def empty? + @data.empty? + end + # XXX is there more to a hashlike interface I should add? + end + end +end + diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/extras.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/extras.rb new file mode 100644 index 00000000..0d9560ab --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/extras.rb @@ -0,0 +1,11 @@ +class String + def starts_with?(other) + head = self[0, other.length] + head == other + end + + def ends_with?(other) + tail = self[-1 * other.length, other.length] + tail == other + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/fetchers.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/fetchers.rb new file mode 100644 index 00000000..b194a66b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/fetchers.rb @@ -0,0 +1,239 @@ +require 'net/http' +require 'openid' +require 'openid/util' + +begin + require 'net/https' +rescue LoadError + OpenID::Util.log('WARNING: no SSL support found. Will not be able ' + + 'to fetch HTTPS URLs!') + require 'net/http' +end + +MAX_RESPONSE_KB = 1024 + +module Net + class HTTP + def post_connection_check(hostname) + check_common_name = true + cert = @socket.io.peer_cert + cert.extensions.each { |ext| + next if ext.oid != "subjectAltName" + ext.value.split(/,\s+/).each{ |general_name| + if /\ADNS:(.*)/ =~ general_name + check_common_name = false + reg = Regexp.escape($1).gsub(/\\\*/, "[^.]+") + return true if /\A#{reg}\z/i =~ hostname + elsif /\AIP Address:(.*)/ =~ general_name + check_common_name = false + return true if $1 == hostname + end + } + } + if check_common_name + cert.subject.to_a.each{ |oid, value| + if oid == "CN" + reg = Regexp.escape(value).gsub(/\\\*/, "[^.]+") + return true if /\A#{reg}\z/i =~ hostname + end + } + end + raise OpenSSL::SSL::SSLError, "hostname does not match" + end + end +end + +module OpenID + # Our HTTPResponse class extends Net::HTTPResponse with an additional + # method, final_url. + class HTTPResponse + attr_accessor :final_url + + attr_accessor :_response + + def self._from_net_response(response, final_url, headers=nil) + me = self.new + me._response = response + me.final_url = final_url + return me + end + + def method_missing(method, *args) + @_response.send(method, *args) + end + + def body=(s) + @_response.instance_variable_set('@body', s) + # XXX Hack to work around ruby's HTTP library behavior. @body + # is only returned if it has been read from the response + # object's socket, but since we're not using a socket in this + # case, we need to set the @read flag to true to avoid a bug in + # Net::HTTPResponse.stream_check when @socket is nil. + @_response.instance_variable_set('@read', true) + end + end + + class FetchingError < OpenIDError + end + + class HTTPRedirectLimitReached < FetchingError + end + + class SSLFetchingError < FetchingError + end + + @fetcher = nil + + def self.fetch(url, body=nil, headers=nil, + redirect_limit=StandardFetcher::REDIRECT_LIMIT) + return fetcher.fetch(url, body, headers, redirect_limit) + end + + def self.fetcher + if @fetcher.nil? + @fetcher = StandardFetcher.new + end + + return @fetcher + end + + def self.fetcher=(fetcher) + @fetcher = fetcher + end + + # Set the default fetcher to use the HTTP proxy defined in the environment + # variable 'http_proxy'. + def self.fetcher_use_env_http_proxy + proxy_string = ENV['http_proxy'] + return unless proxy_string + + proxy_uri = URI.parse(proxy_string) + @fetcher = StandardFetcher.new(proxy_uri.host, proxy_uri.port, + proxy_uri.user, proxy_uri.password) + end + + class StandardFetcher + + USER_AGENT = "ruby-openid/#{OpenID::VERSION} (#{RUBY_PLATFORM})" + + REDIRECT_LIMIT = 5 + TIMEOUT = 60 + + attr_accessor :ca_file + attr_accessor :timeout + + # I can fetch through a HTTP proxy; arguments are as for Net::HTTP::Proxy. + def initialize(proxy_addr=nil, proxy_port=nil, + proxy_user=nil, proxy_pass=nil) + @ca_file = nil + @proxy = Net::HTTP::Proxy(proxy_addr, proxy_port, proxy_user, proxy_pass) + @timeout = TIMEOUT + end + + def supports_ssl?(conn) + return conn.respond_to?(:use_ssl=) + end + + def make_http(uri) + http = @proxy.new(uri.host, uri.port) + http.read_timeout = @timeout + http.open_timeout = @timeout + return http + end + + def set_verified(conn, verify) + if verify + conn.verify_mode = OpenSSL::SSL::VERIFY_PEER + else + conn.verify_mode = OpenSSL::SSL::VERIFY_NONE + end + end + + def make_connection(uri) + conn = make_http(uri) + + if !conn.is_a?(Net::HTTP) + raise RuntimeError, sprintf("Expected Net::HTTP object from make_http; got %s", + conn.class) + end + + if uri.scheme == 'https' + if supports_ssl?(conn) + + conn.use_ssl = true + + if @ca_file + set_verified(conn, true) + conn.ca_file = @ca_file + else + Util.log("WARNING: making https request to #{uri} without verifying " + + "server certificate; no CA path was specified.") + set_verified(conn, false) + end + else + raise RuntimeError, "SSL support not found; cannot fetch #{uri}" + end + end + + return conn + end + + def fetch(url, body=nil, headers=nil, redirect_limit=REDIRECT_LIMIT) + unparsed_url = url.dup + url = URI::parse(url) + if url.nil? + raise FetchingError, "Invalid URL: #{unparsed_url}" + end + + headers ||= {} + headers['User-agent'] ||= USER_AGENT + headers['Range'] ||= "0-#{MAX_RESPONSE_KB*1024}" + + begin + conn = make_connection(url) + response = nil + + response = conn.start { + # Check the certificate against the URL's hostname + if supports_ssl?(conn) and conn.use_ssl? + conn.post_connection_check(url.host) + end + + if body.nil? + conn.request_get(url.request_uri, headers) + else + headers["Content-type"] ||= "application/x-www-form-urlencoded" + conn.request_post(url.request_uri, body, headers) + end + } + rescue RuntimeError => why + raise why + rescue OpenSSL::SSL::SSLError => why + raise SSLFetchingError, "Error connecting to SSL URL #{url}: #{why}" + rescue FetchingError => why + raise why + rescue Exception => why + # Things we've caught here include a Timeout::Error, which descends + # from SignalException. + raise FetchingError, "Error fetching #{url}: #{why}" + end + + case response + when Net::HTTPRedirection + if redirect_limit <= 0 + raise HTTPRedirectLimitReached.new( + "Too many redirects, not fetching #{response['location']}") + end + begin + return fetch(response['location'], body, headers, redirect_limit - 1) + rescue HTTPRedirectLimitReached => e + raise e + rescue FetchingError => why + raise FetchingError, "Error encountered in redirect from #{url}: #{why}" + end + else + return HTTPResponse._from_net_response(response, unparsed_url) + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/kvform.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/kvform.rb new file mode 100644 index 00000000..c534d203 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/kvform.rb @@ -0,0 +1,136 @@ + +module OpenID + + class KVFormError < Exception + end + + module Util + + def Util.seq_to_kv(seq, strict=false) + # Represent a sequence of pairs of strings as newline-terminated + # key:value pairs. The pairs are generated in the order given. + # + # @param seq: The pairs + # + # returns a string representation of the sequence + err = lambda { |msg| + msg = "seq_to_kv warning: #{msg}: #{seq.inspect}" + if strict + raise KVFormError, msg + else + Util.log(msg) + end + } + + lines = [] + seq.each { |k, v| + if !k.is_a?(String) + err.call("Converting key to string: #{k.inspect}") + k = k.to_s + end + + if !k.index("\n").nil? + raise KVFormError, "Invalid input for seq_to_kv: key contains newline: #{k.inspect}" + end + + if !k.index(":").nil? + raise KVFormError, "Invalid input for seq_to_kv: key contains colon: #{k.inspect}" + end + + if k.strip() != k + err.call("Key has whitespace at beginning or end: #{k.inspect}") + end + + if !v.is_a?(String) + err.call("Converting value to string: #{v.inspect}") + v = v.to_s + end + + if !v.index("\n").nil? + raise KVFormError, "Invalid input for seq_to_kv: value contains newline: #{v.inspect}" + end + + if v.strip() != v + err.call("Value has whitespace at beginning or end: #{v.inspect}") + end + + lines << k + ":" + v + "\n" + } + + return lines.join("") + end + + def Util.kv_to_seq(data, strict=false) + # After one parse, seq_to_kv and kv_to_seq are inverses, with no + # warnings: + # + # seq = kv_to_seq(s) + # seq_to_kv(kv_to_seq(seq)) == seq + err = lambda { |msg| + msg = "kv_to_seq warning: #{msg}: #{data.inspect}" + if strict + raise KVFormError, msg + else + Util.log(msg) + end + } + + lines = data.split("\n") + if data.length == 0 + return [] + end + + if data[-1].chr != "\n" + err.call("Does not end in a newline") + # We don't expect the last element of lines to be an empty + # string because split() doesn't behave that way. + end + + pairs = [] + line_num = 0 + lines.each { |line| + line_num += 1 + + # Ignore blank lines + if line.strip() == "" + next + end + + pair = line.split(':', 2) + if pair.length == 2 + k, v = pair + k_s = k.strip() + if k_s != k + msg = "In line #{line_num}, ignoring leading or trailing whitespace in key #{k.inspect}" + err.call(msg) + end + + if k_s.length == 0 + err.call("In line #{line_num}, got empty key") + end + + v_s = v.strip() + if v_s != v + msg = "In line #{line_num}, ignoring leading or trailing whitespace in value #{v.inspect}" + err.call(msg) + end + + pairs << [k_s, v_s] + else + err.call("Line #{line_num} does not contain a colon") + end + } + + return pairs + end + + def Util.dict_to_kv(d) + return seq_to_kv(d.entries.sort) + end + + def Util.kv_to_dict(s) + seq = kv_to_seq(s) + return Hash[*seq.flatten] + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/kvpost.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/kvpost.rb new file mode 100644 index 00000000..1495afe7 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/kvpost.rb @@ -0,0 +1,58 @@ +require "openid/message" +require "openid/fetchers" + +module OpenID + # Exception that is raised when the server returns a 400 response + # code to a direct request. + class ServerError < OpenIDError + attr_reader :error_text, :error_code, :message + + def initialize(error_text, error_code, message) + super(error_text) + @error_text = error_text + @error_code = error_code + @message = message + end + + def self.from_message(msg) + error_text = msg.get_arg(OPENID_NS, 'error', + '') + error_code = msg.get_arg(OPENID_NS, 'error_code') + return self.new(error_text, error_code, msg) + end + end + + class KVPostNetworkError < OpenIDError + end + class HTTPStatusError < OpenIDError + end + + class Message + def self.from_http_response(response, server_url) + msg = self.from_kvform(response.body) + case response.code.to_i + when 200 + return msg + when 206 + return msg + when 400 + raise ServerError.from_message(msg) + else + error_message = "bad status code from server #{server_url}: "\ + "#{response.code}" + raise HTTPStatusError.new(error_message) + end + end + end + + # Send the message to the server via HTTP POST and receive and parse + # a response in KV Form + def self.make_kv_post(request_message, server_url) + begin + http_response = self.fetch(server_url, request_message.to_url_encoded) + rescue Exception + raise KVPostNetworkError.new("Unable to contact OpenID server: #{$!.to_s}") + end + return Message.from_http_response(http_response, server_url) + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/message.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/message.rb new file mode 100644 index 00000000..8700378b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/message.rb @@ -0,0 +1,553 @@ +require 'openid/util' +require 'openid/kvform' + +module OpenID + + IDENTIFIER_SELECT = 'http://specs.openid.net/auth/2.0/identifier_select' + + # URI for Simple Registration extension, the only commonly deployed + # OpenID 1.x extension, and so a special case. + SREG_URI = 'http://openid.net/sreg/1.0' + + # The OpenID 1.x namespace URIs + OPENID1_NS = 'http://openid.net/signon/1.0' + OPENID11_NS = 'http://openid.net/signon/1.1' + OPENID1_NAMESPACES = [OPENID1_NS, OPENID11_NS] + + # The OpenID 2.0 namespace URI + OPENID2_NS = 'http://specs.openid.net/auth/2.0' + + # The namespace consisting of pairs with keys that are prefixed with + # "openid." but not in another namespace. + NULL_NAMESPACE = :null_namespace + + # The null namespace, when it is an allowed OpenID namespace + OPENID_NS = :openid_namespace + + # The top-level namespace, excluding all pairs with keys that start + # with "openid." + BARE_NS = :bare_namespace + + # Limit, in bytes, of identity provider and return_to URLs, + # including response payload. See OpenID 1.1 specification, + # Appendix D. + OPENID1_URL_LIMIT = 2047 + + # All OpenID protocol fields. Used to check namespace aliases. + OPENID_PROTOCOL_FIELDS = [ + 'ns', 'mode', 'error', 'return_to', + 'contact', 'reference', 'signed', + 'assoc_type', 'session_type', + 'dh_modulus', 'dh_gen', + 'dh_consumer_public', 'claimed_id', + 'identity', 'realm', 'invalidate_handle', + 'op_endpoint', 'response_nonce', 'sig', + 'assoc_handle', 'trust_root', 'openid', + ] + + # Sentinel used for Message implementation to indicate that getArg + # should raise an exception instead of returning a default. + NO_DEFAULT = :no_default + + # Raised if the generic OpenID namespace is accessed when there + # is no OpenID namespace set for this message. + class UndefinedOpenIDNamespace < Exception; end + + # Raised when an alias or namespace URI has already been registered. + class NamespaceAliasRegistrationError < Exception; end + + # Raised if openid.ns is not a recognized value. + # See Message class variable @@allowed_openid_namespaces + class InvalidOpenIDNamespace < Exception; end + + class Message + attr_reader :namespaces + + # Raised when key lookup fails + class KeyNotFound < IndexError ; end + + # Namespace / alias registration map. See + # register_namespace_alias. + @@registered_aliases = {} + + # Registers a (namespace URI, alias) mapping in a global namespace + # alias map. Raises NamespaceAliasRegistrationError if either the + # namespace URI or alias has already been registered with a + # different value. This function is required if you want to use a + # namespace with an OpenID 1 message. + def Message.register_namespace_alias(namespace_uri, alias_) + if @@registered_aliases[alias_] == namespace_uri + return + end + + if @@registered_aliases.values.include?(namespace_uri) + raise NamespaceAliasRegistrationError, + 'Namespace uri #{namespace_uri} already registered' + end + + if @@registered_aliases.member?(alias_) + raise NamespaceAliasRegistrationError, + 'Alias #{alias_} already registered' + end + + @@registered_aliases[alias_] = namespace_uri + end + + @@allowed_openid_namespaces = [OPENID1_NS, OPENID2_NS, OPENID11_NS] + + # Raises InvalidNamespaceError if you try to instantiate a Message + # with a namespace not in the above allowed list + def initialize(openid_namespace=nil) + @args = {} + @namespaces = NamespaceMap.new + if openid_namespace + implicit = OPENID1_NAMESPACES.member? openid_namespace + self.set_openid_namespace(openid_namespace, implicit) + else + @openid_ns_uri = nil + end + end + + # Construct a Message containing a set of POST arguments. + # Raises InvalidNamespaceError if you try to instantiate a Message + # with a namespace not in the above allowed list + def Message.from_post_args(args) + m = Message.new + openid_args = {} + args.each do |key,value| + if value.is_a?(Array) + raise ArgumentError, "Query dict must have one value for each key, " + + "not lists of values. Query is #{args.inspect}" + end + + prefix, rest = key.split('.', 2) + + if prefix != 'openid' or rest.nil? + m.set_arg(BARE_NS, key, value) + else + openid_args[rest] = value + end + end + + m._from_openid_args(openid_args) + return m + end + + # Construct a Message from a parsed KVForm message. + # Raises InvalidNamespaceError if you try to instantiate a Message + # with a namespace not in the above allowed list + def Message.from_openid_args(openid_args) + m = Message.new + m._from_openid_args(openid_args) + return m + end + + # Raises InvalidNamespaceError if you try to instantiate a Message + # with a namespace not in the above allowed list + def _from_openid_args(openid_args) + ns_args = [] + + # resolve namespaces + openid_args.each { |rest, value| + ns_alias, ns_key = rest.split('.', 2) + if ns_key.nil? + ns_alias = NULL_NAMESPACE + ns_key = rest + end + + if ns_alias == 'ns' + @namespaces.add_alias(value, ns_key) + elsif ns_alias == NULL_NAMESPACE and ns_key == 'ns' + set_openid_namespace(value, false) + else + ns_args << [ns_alias, ns_key, value] + end + } + + # implicitly set an OpenID 1 namespace + unless get_openid_namespace + set_openid_namespace(OPENID1_NS, true) + end + + # put the pairs into the appropriate namespaces + ns_args.each { |ns_alias, ns_key, value| + ns_uri = @namespaces.get_namespace_uri(ns_alias) + unless ns_uri + ns_uri = _get_default_namespace(ns_alias) + unless ns_uri + ns_uri = get_openid_namespace + ns_key = "#{ns_alias}.#{ns_key}" + else + @namespaces.add_alias(ns_uri, ns_alias, true) + end + end + self.set_arg(ns_uri, ns_key, value) + } + end + + def _get_default_namespace(mystery_alias) + # only try to map an alias to a default if it's an + # OpenID 1.x namespace + if is_openid1 + @@registered_aliases[mystery_alias] + end + end + + def set_openid_namespace(openid_ns_uri, implicit) + if !@@allowed_openid_namespaces.include?(openid_ns_uri) + raise InvalidOpenIDNamespace, "Invalid null namespace: #{openid_ns_uri}" + end + @namespaces.add_alias(openid_ns_uri, NULL_NAMESPACE, implicit) + @openid_ns_uri = openid_ns_uri + end + + def get_openid_namespace + return @openid_ns_uri + end + + def is_openid1 + return OPENID1_NAMESPACES.member?(@openid_ns_uri) + end + + def is_openid2 + return @openid_ns_uri == OPENID2_NS + end + + # Create a message from a KVForm string + def Message.from_kvform(kvform_string) + return Message.from_openid_args(Util.kv_to_dict(kvform_string)) + end + + def copy + return Marshal.load(Marshal.dump(self)) + end + + # Return all arguments with "openid." in from of namespaced arguments. + def to_post_args + args = {} + + # add namespace defs to the output + @namespaces.each { |ns_uri, ns_alias| + if @namespaces.implicit?(ns_uri) + next + end + if ns_alias == NULL_NAMESPACE + ns_key = 'openid.ns' + else + ns_key = 'openid.ns.' + ns_alias + end + args[ns_key] = ns_uri + } + + @args.each { |k, value| + ns_uri, ns_key = k + key = get_key(ns_uri, ns_key) + args[key] = value + } + + return args + end + + # Return all namespaced arguments, failing if any non-namespaced arguments + # exist. + def to_args + post_args = self.to_post_args + kvargs = {} + post_args.each { |k,v| + if !k.starts_with?('openid.') + raise ArgumentError, "This message can only be encoded as a POST, because it contains arguments that are not prefixed with 'openid.'" + else + kvargs[k[7..-1]] = v + end + } + return kvargs + end + + # Generate HTML form markup that contains the values in this + # message, to be HTTP POSTed as x-www-form-urlencoded UTF-8. + def to_form_markup(action_url, form_tag_attrs=nil, submit_text='Continue') + form_tag_attr_map = {} + + if form_tag_attrs + form_tag_attrs.each { |name, attr| + form_tag_attr_map[name] = attr + } + end + + form_tag_attr_map['action'] = action_url + form_tag_attr_map['method'] = 'post' + form_tag_attr_map['accept-charset'] = 'UTF-8' + form_tag_attr_map['enctype'] = 'application/x-www-form-urlencoded' + + markup = "

    #{key} not in this message" + else + default + end + } + end + + # Get the arguments that are defined for this namespace URI. + def get_args(namespace) + namespace = _fix_ns(namespace) + args = {} + @args.each { |k,v| + pair_ns, ns_key = k + args[ns_key] = v if pair_ns == namespace + } + return args + end + + # Set multiple key/value pairs in one call. + def update_args(namespace, updates) + namespace = _fix_ns(namespace) + updates.each {|k,v| set_arg(namespace, k, v)} + end + + # Set a single argument in this namespace + def set_arg(namespace, key, value) + namespace = _fix_ns(namespace) + @args[[namespace, key].freeze] = value + if namespace != BARE_NS + @namespaces.add(namespace) + end + end + + # Remove a single argument from this namespace. + def del_arg(namespace, key) + namespace = _fix_ns(namespace) + _key = [namespace, key] + @args.delete(_key) + end + + def ==(other) + other.is_a?(self.class) && @args == other.instance_eval { @args } + end + + def get_aliased_arg(aliased_key, default=nil) + if aliased_key == 'ns' + return get_openid_namespace() + end + + ns_alias, key = aliased_key.split('.', 2) + if ns_alias == 'ns' + uri = @namespaces.get_namespace_uri(key) + if uri.nil? and default == NO_DEFAULT + raise KeyNotFound, "Namespace #{key} not defined when looking "\ + "for #{aliased_key}" + else + return (uri.nil? ? default : uri) + end + end + + if key.nil? + key = aliased_key + ns = nil + else + ns = @namespaces.get_namespace_uri(ns_alias) + end + + if ns.nil? + key = aliased_key + ns = get_openid_namespace + end + + return get_arg(ns, key, default) + end + end + + + # Maintains a bidirectional map between namespace URIs and aliases. + class NamespaceMap + + def initialize + @alias_to_namespace = {} + @namespace_to_alias = {} + @implicit_namespaces = [] + end + + def get_alias(namespace_uri) + @namespace_to_alias[namespace_uri] + end + + def get_namespace_uri(namespace_alias) + @alias_to_namespace[namespace_alias] + end + + # Add an alias from this namespace URI to the alias. + def add_alias(namespace_uri, desired_alias, implicit=false) + # Check that desired_alias is not an openid protocol field as + # per the spec. + Util.assert(!OPENID_PROTOCOL_FIELDS.include?(desired_alias), + "#{desired_alias} is not an allowed namespace alias") + + # check that there is not a namespace already defined for the + # desired alias + current_namespace_uri = @alias_to_namespace.fetch(desired_alias, nil) + if current_namespace_uri and current_namespace_uri != namespace_uri + raise IndexError, "Cannot map #{namespace_uri} to alias #{desired_alias}. #{current_namespace_uri} is already mapped to alias #{desired_alias}" + end + + # Check that desired_alias does not contain a period as per the + # spec. + if desired_alias.is_a?(String) + Util.assert(desired_alias.index('.').nil?, + "#{desired_alias} must not contain a dot") + end + + # check that there is not already a (different) alias for this + # namespace URI. + _alias = @namespace_to_alias[namespace_uri] + if _alias and _alias != desired_alias + raise IndexError, "Cannot map #{namespace_uri} to alias #{desired_alias}. It is already mapped to alias #{_alias}" + end + + @alias_to_namespace[desired_alias] = namespace_uri + @namespace_to_alias[namespace_uri] = desired_alias + @implicit_namespaces << namespace_uri if implicit + return desired_alias + end + + # Add this namespace URI to the mapping, without caring what alias + # it ends up with. + def add(namespace_uri) + # see if this namepace is already mapped to an alias + _alias = @namespace_to_alias[namespace_uri] + return _alias if _alias + + # Fall back to generating a numberical alias + i = 0 + while true + _alias = 'ext' + i.to_s + begin + add_alias(namespace_uri, _alias) + rescue IndexError + i += 1 + else + return _alias + end + end + + raise StandardError, 'Unreachable' + end + + def member?(namespace_uri) + @namespace_to_alias.has_key?(namespace_uri) + end + + def each + @namespace_to_alias.each {|k,v| yield k,v} + end + + def namespace_uris + # Return an iterator over the namespace URIs + return @namespace_to_alias.keys() + end + + def implicit?(namespace_uri) + return @implicit_namespaces.member?(namespace_uri) + end + + def aliases + # Return an iterator over the aliases + return @alias_to_namespace.keys() + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/protocolerror.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/protocolerror.rb new file mode 100644 index 00000000..2aad0e4a --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/protocolerror.rb @@ -0,0 +1,8 @@ +require 'openid/util' + +module OpenID + + # An error in the OpenID protocol + class ProtocolError < OpenIDError + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/server.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/server.rb new file mode 100644 index 00000000..53aa68a2 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/server.rb @@ -0,0 +1,1544 @@ + +require 'openid/cryptutil' +require 'openid/util' +require 'openid/dh' +require 'openid/store/nonce' +require 'openid/trustroot' +require 'openid/association' +require 'openid/message' + +require 'time' + +module OpenID + + module Server + + HTTP_OK = 200 + HTTP_REDIRECT = 302 + HTTP_ERROR = 400 + + BROWSER_REQUEST_MODES = ['checkid_setup', 'checkid_immediate'] + + ENCODE_KVFORM = ['kvform'].freeze + ENCODE_URL = ['URL/redirect'].freeze + ENCODE_HTML_FORM = ['HTML form'].freeze + + UNUSED = nil + + class OpenIDRequest + attr_accessor :message, :mode + + # I represent an incoming OpenID request. + # + # Attributes: + # mode:: The "openid.mode" of this request + def initialize + @mode = nil + @message = nil + end + + def namespace + if @message.nil? + raise RuntimeError, "Request has no message" + else + return @message.get_openid_namespace + end + end + end + + # A request to verify the validity of a previous response. + # + # See OpenID Specs, Verifying Directly with the OpenID Provider + # + class CheckAuthRequest < OpenIDRequest + + # The association handle the response was signed with. + attr_accessor :assoc_handle + + # The message with the signature which wants checking. + attr_accessor :signed + + # An association handle the client is asking about the validity + # of. May be nil. + attr_accessor :invalidate_handle + + attr_accessor :sig + + # Construct me. + # + # These parameters are assigned directly as class attributes. + # + # Parameters: + # assoc_handle:: the association handle for this request + # signed:: The signed message + # invalidate_handle:: An association handle that the relying + # party is checking to see if it is invalid + def initialize(assoc_handle, signed, invalidate_handle=nil) + super() + + @mode = "check_authentication" + @required_fields = ["identity", "return_to", "response_nonce"].freeze + + @sig = nil + @assoc_handle = assoc_handle + @signed = signed + @invalidate_handle = invalidate_handle + end + + # Construct me from an OpenID::Message. + def self.from_message(message, op_endpoint=UNUSED) + assoc_handle = message.get_arg(OPENID_NS, 'assoc_handle') + invalidate_handle = message.get_arg(OPENID_NS, 'invalidate_handle') + + signed = message.copy() + # openid.mode is currently check_authentication because + # that's the mode of this request. But the signature + # was made on something with a different openid.mode. + # http://article.gmane.org/gmane.comp.web.openid.general/537 + if signed.has_key?(OPENID_NS, "mode") + signed.set_arg(OPENID_NS, "mode", "id_res") + end + + obj = self.new(assoc_handle, signed, invalidate_handle) + obj.message = message + obj.sig = message.get_arg(OPENID_NS, 'sig') + + if !obj.assoc_handle or + !obj.sig + msg = sprintf("%s request missing required parameter from message %s", + obj.mode, message) + raise ProtocolError.new(message, msg) + end + + return obj + end + + # Respond to this request. + # + # Given a Signatory, I can check the validity of the signature + # and the invalidate_handle. I return a response with an + # is_valid (and, if appropriate invalidate_handle) field. + def answer(signatory) + is_valid = signatory.verify(@assoc_handle, @signed) + # Now invalidate that assoc_handle so it this checkAuth + # message cannot be replayed. + signatory.invalidate(@assoc_handle, dumb=true) + response = OpenIDResponse.new(self) + valid_str = is_valid ? "true" : "false" + response.fields.set_arg(OPENID_NS, 'is_valid', valid_str) + + if @invalidate_handle + assoc = signatory.get_association(@invalidate_handle, false) + if !assoc + response.fields.set_arg( + OPENID_NS, 'invalidate_handle', @invalidate_handle) + end + end + + return response + end + + def to_s + ih = nil + + if @invalidate_handle + ih = sprintf(" invalidate? %s", @invalidate_handle) + else + ih = "" + end + + s = sprintf("<%s handle: %s sig: %s: signed: %s%s>", + self.class, @assoc_handle, + @sig, @signed, ih) + return s + end + end + + class BaseServerSession + attr_reader :session_type + + def initialize(session_type, allowed_assoc_types) + @session_type = session_type + @allowed_assoc_types = allowed_assoc_types.dup.freeze + end + + def allowed_assoc_type?(typ) + @allowed_assoc_types.member?(typ) + end + end + + # An object that knows how to handle association requests with + # no session type. + # + # See OpenID Specs, Section 8: Establishing Associations + # + class PlainTextServerSession < BaseServerSession + # The session_type for this association session. There is no + # type defined for plain-text in the OpenID specification, so we + # use 'no-encryption'. + attr_reader :session_type + + def initialize + super('no-encryption', ['HMAC-SHA1', 'HMAC-SHA256']) + end + + def self.from_message(unused_request) + return self.new + end + + def answer(secret) + return {'mac_key' => Util.to_base64(secret)} + end + end + + # An object that knows how to handle association requests with the + # Diffie-Hellman session type. + # + # See OpenID Specs, Section 8: Establishing Associations + # + class DiffieHellmanSHA1ServerSession < BaseServerSession + + # The Diffie-Hellman algorithm values for this request + attr_accessor :dh + + # The public key sent by the consumer in the associate request + attr_accessor :consumer_pubkey + + # The session_type for this association session. + attr_reader :session_type + + def initialize(dh, consumer_pubkey) + super('DH-SHA1', ['HMAC-SHA1']) + + @hash_func = CryptUtil.method('sha1') + @dh = dh + @consumer_pubkey = consumer_pubkey + end + + # Construct me from OpenID Message + # + # Raises ProtocolError when parameters required to establish the + # session are missing. + def self.from_message(message) + dh_modulus = message.get_arg(OPENID_NS, 'dh_modulus') + dh_gen = message.get_arg(OPENID_NS, 'dh_gen') + if ((!dh_modulus and dh_gen) or + (!dh_gen and dh_modulus)) + + if !dh_modulus + missing = 'modulus' + else + missing = 'generator' + end + + raise ProtocolError.new(message, + sprintf('If non-default modulus or generator is ' + + 'supplied, both must be supplied. Missing %s', + missing)) + end + + if dh_modulus or dh_gen + dh_modulus = CryptUtil.base64_to_num(dh_modulus) + dh_gen = CryptUtil.base64_to_num(dh_gen) + dh = DiffieHellman.new(dh_modulus, dh_gen) + else + dh = DiffieHellman.from_defaults() + end + + consumer_pubkey = message.get_arg(OPENID_NS, 'dh_consumer_public') + if !consumer_pubkey + raise ProtocolError.new(message, + sprintf("Public key for DH-SHA1 session " + + "not found in message %s", message)) + end + + consumer_pubkey = CryptUtil.base64_to_num(consumer_pubkey) + + return self.new(dh, consumer_pubkey) + end + + def answer(secret) + mac_key = @dh.xor_secret(@hash_func, + @consumer_pubkey, + secret) + return { + 'dh_server_public' => CryptUtil.num_to_base64(@dh.public), + 'enc_mac_key' => Util.to_base64(mac_key), + } + end + end + + class DiffieHellmanSHA256ServerSession < DiffieHellmanSHA1ServerSession + def initialize(*args) + super(*args) + @session_type = 'DH-SHA256' + @hash_func = CryptUtil.method('sha256') + @allowed_assoc_types = ['HMAC-SHA256'].freeze + end + end + + # A request to establish an association. + # + # See OpenID Specs, Section 8: Establishing Associations + # + class AssociateRequest < OpenIDRequest + # An object that knows how to handle association requests of a + # certain type. + attr_accessor :session + + # The type of association. Supported values include HMAC-SHA256 + # and HMAC-SHA1 + attr_accessor :assoc_type + + @@session_classes = { + 'no-encryption' => PlainTextServerSession, + 'DH-SHA1' => DiffieHellmanSHA1ServerSession, + 'DH-SHA256' => DiffieHellmanSHA256ServerSession, + } + + # Construct me. + # + # The session is assigned directly as a class attribute. See my + # class documentation for its description. + def initialize(session, assoc_type) + super() + @session = session + @assoc_type = assoc_type + + @mode = "associate" + end + + # Construct me from an OpenID Message. + def self.from_message(message, op_endpoint=UNUSED) + if message.is_openid1() + session_type = message.get_arg(OPENID_NS, 'session_type') + if session_type == 'no-encryption' + Util.log('Received OpenID 1 request with a no-encryption ' + + 'association session type. Continuing anyway.') + elsif !session_type + session_type = 'no-encryption' + end + else + session_type = message.get_arg(OPENID2_NS, 'session_type') + if !session_type + raise ProtocolError.new(message, + text="session_type missing from request") + end + end + + session_class = @@session_classes[session_type] + + if !session_class + raise ProtocolError.new(message, + sprintf("Unknown session type %s", session_type)) + end + + begin + session = session_class.from_message(message) + rescue ArgumentError => why + # XXX + raise ProtocolError.new(message, + sprintf('Error parsing %s session: %s', + session_type, why)) + end + + assoc_type = message.get_arg(OPENID_NS, 'assoc_type', 'HMAC-SHA1') + if !session.allowed_assoc_type?(assoc_type) + msg = sprintf('Session type %s does not support association type %s', + session_type, assoc_type) + raise ProtocolError.new(message, msg) + end + + obj = self.new(session, assoc_type) + obj.message = message + return obj + end + + # Respond to this request with an association. + # + # assoc:: The association to send back. + # + # Returns a response with the association information, encrypted + # to the consumer's public key if appropriate. + def answer(assoc) + response = OpenIDResponse.new(self) + response.fields.update_args(OPENID_NS, { + 'expires_in' => sprintf('%d', assoc.expires_in()), + 'assoc_type' => @assoc_type, + 'assoc_handle' => assoc.handle, + }) + response.fields.update_args(OPENID_NS, + @session.answer(assoc.secret)) + unless (@session.session_type == 'no-encryption' and + @message.is_openid1) + response.fields.set_arg( + OPENID_NS, 'session_type', @session.session_type) + end + + return response + end + + # Respond to this request indicating that the association type + # or association session type is not supported. + def answer_unsupported(message, preferred_association_type=nil, + preferred_session_type=nil) + if @message.is_openid1() + raise ProtocolError.new(@message) + end + + response = OpenIDResponse.new(self) + response.fields.set_arg(OPENID_NS, 'error_code', 'unsupported-type') + response.fields.set_arg(OPENID_NS, 'error', message) + + if preferred_association_type + response.fields.set_arg( + OPENID_NS, 'assoc_type', preferred_association_type) + end + + if preferred_session_type + response.fields.set_arg( + OPENID_NS, 'session_type', preferred_session_type) + end + + return response + end + end + + # A request to confirm the identity of a user. + # + # This class handles requests for openid modes + # +checkid_immediate+ and +checkid_setup+ . + class CheckIDRequest < OpenIDRequest + + # Provided in smart mode requests, a handle for a previously + # established association. nil for dumb mode requests. + attr_accessor :assoc_handle + + # Is this an immediate-mode request? + attr_accessor :immediate + + # The URL to send the user agent back to to reply to this + # request. + attr_accessor :return_to + + # The OP-local identifier being checked. + attr_accessor :identity + + # The claimed identifier. Not present in OpenID 1.x + # messages. + attr_accessor :claimed_id + + # This URL identifies the party making the request, and the user + # will use that to make her decision about what answer she + # trusts them to have. Referred to as "realm" in OpenID 2.0. + attr_accessor :trust_root + + # mode:: +checkid_immediate+ or +checkid_setup+ + attr_accessor :mode + + attr_accessor :op_endpoint + + # These parameters are assigned directly as attributes, + # see the #CheckIDRequest class documentation for their + # descriptions. + # + # Raises #MalformedReturnURL when the +return_to+ URL is not + # a URL. + def initialize(identity, return_to, op_endpoint, trust_root=nil, + immediate=false, assoc_handle=nil) + @assoc_handle = assoc_handle + @identity = identity + @claimed_id = identity + @return_to = return_to + @trust_root = trust_root or return_to + @op_endpoint = op_endpoint + @message = nil + + if immediate + @immediate = true + @mode = "checkid_immediate" + else + @immediate = false + @mode = "checkid_setup" + end + + if @return_to and + !TrustRoot::TrustRoot.parse(@return_to) + raise MalformedReturnURL.new(nil, @return_to) + end + + if !trust_root_valid() + raise UntrustedReturnURL.new(nil, @return_to, @trust_root) + end + end + + # Construct me from an OpenID message. + # + # message:: An OpenID checkid_* request Message + # + # op_endpoint:: The endpoint URL of the server that this + # message was sent to. + # + # Raises: + # ProtocolError:: When not all required parameters are present + # in the message. + # + # MalformedReturnURL:: When the +return_to+ URL is not a URL. + # + # UntrustedReturnURL:: When the +return_to+ URL is + # outside the +trust_root+. + def self.from_message(message, op_endpoint) + obj = self.allocate + obj.message = message + obj.op_endpoint = op_endpoint + mode = message.get_arg(OPENID_NS, 'mode') + if mode == "checkid_immediate" + obj.immediate = true + obj.mode = "checkid_immediate" + else + obj.immediate = false + obj.mode = "checkid_setup" + end + + obj.return_to = message.get_arg(OPENID_NS, 'return_to') + if message.is_openid1 and !obj.return_to + msg = sprintf("Missing required field 'return_to' from %s", + message) + raise ProtocolError.new(message, msg) + end + + obj.identity = message.get_arg(OPENID_NS, 'identity') + obj.claimed_id = message.get_arg(OPENID_NS, 'claimed_id') + if message.is_openid1() + if !obj.identity + s = "OpenID 1 message did not contain openid.identity" + raise ProtocolError.new(message, s) + end + else + if obj.identity and not obj.claimed_id + s = ("OpenID 2.0 message contained openid.identity but not " + + "claimed_id") + raise ProtocolError.new(message, s) + elsif obj.claimed_id and not obj.identity + s = ("OpenID 2.0 message contained openid.claimed_id but not " + + "identity") + raise ProtocolError.new(message, s) + end + end + + # There's a case for making self.trust_root be a TrustRoot + # here. But if TrustRoot isn't currently part of the "public" + # API, I'm not sure it's worth doing. + if message.is_openid1 + trust_root_param = 'trust_root' + else + trust_root_param = 'realm' + end + trust_root = message.get_arg(OPENID_NS, trust_root_param) + trust_root = obj.return_to if (trust_root.nil? || trust_root.empty?) + obj.trust_root = trust_root + + if !message.is_openid1 and !obj.return_to and !obj.trust_root + raise ProtocolError.new(message, "openid.realm required when " + + "openid.return_to absent") + end + + obj.assoc_handle = message.get_arg(OPENID_NS, 'assoc_handle') + + # Using TrustRoot.parse here is a bit misleading, as we're not + # parsing return_to as a trust root at all. However, valid + # URLs are valid trust roots, so we can use this to get an + # idea if it is a valid URL. Not all trust roots are valid + # return_to URLs, however (particularly ones with wildcards), + # so this is still a little sketchy. + if obj.return_to and \ + !TrustRoot::TrustRoot.parse(obj.return_to) + raise MalformedReturnURL.new(message, obj.return_to) + end + + # I first thought that checking to see if the return_to is + # within the trust_root is premature here, a + # logic-not-decoding thing. But it was argued that this is + # really part of data validation. A request with an invalid + # trust_root/return_to is broken regardless of application, + # right? + if !obj.trust_root_valid() + raise UntrustedReturnURL.new(message, obj.return_to, obj.trust_root) + end + + return obj + end + + # Is the identifier to be selected by the IDP? + def id_select + # So IDPs don't have to import the constant + return @identity == IDENTIFIER_SELECT + end + + # Is my return_to under my trust_root? + def trust_root_valid + if !@trust_root + return true + end + + tr = TrustRoot::TrustRoot.parse(@trust_root) + if !tr + raise MalformedTrustRoot.new(@message, @trust_root) + end + + if @return_to + return tr.validate_url(@return_to) + else + return true + end + end + + # Does the relying party publish the return_to URL for this + # response under the realm? It is up to the provider to set a + # policy for what kinds of realms should be allowed. This + # return_to URL verification reduces vulnerability to + # data-theft attacks based on open proxies, + # corss-site-scripting, or open redirectors. + # + # This check should only be performed after making sure that + # the return_to URL matches the realm. + # + # Raises DiscoveryFailure if the realm + # URL does not support Yadis discovery (and so does not + # support the verification process). + # + # Returns true if the realm publishes a document with the + # return_to URL listed + def return_to_verified + return TrustRoot.verify_return_to(@trust_root, @return_to) + end + + # Respond to this request. + # + # allow:: Allow this user to claim this identity, and allow the + # consumer to have this information? + # + # server_url:: DEPRECATED. Passing op_endpoint to the + # #Server constructor makes this optional. + # + # When an OpenID 1.x immediate mode request does + # not succeed, it gets back a URL where the request + # may be carried out in a not-so-immediate fashion. + # Pass my URL in here (the fully qualified address + # of this server's endpoint, i.e. + # http://example.com/server), and I will + # use it as a base for the URL for a new request. + # + # Optional for requests where + # #CheckIDRequest.immediate is false or +allow+ is + # true. + # + # identity:: The OP-local identifier to answer with. Only for use + # when the relying party requested identifier selection. + # + # claimed_id:: The claimed identifier to answer with, + # for use with identifier selection in the case where the + # claimed identifier and the OP-local identifier differ, + # i.e. when the claimed_id uses delegation. + # + # If +identity+ is provided but this is not, + # +claimed_id+ will default to the value of +identity+. + # When answering requests that did not ask for identifier + # selection, the response +claimed_id+ will default to + # that of the request. + # + # This parameter is new in OpenID 2.0. + # + # Returns an OpenIDResponse object containing a OpenID id_res message. + # + # Raises NoReturnToError if the return_to is missing. + # + # Version 2.0 deprecates +server_url+ and adds +claimed_id+. + def answer(allow, server_url=nil, identity=nil, claimed_id=nil) + if !@return_to + raise NoReturnToError + end + + if !server_url + if @message.is_openid2 and !@op_endpoint + # In other words, that warning I raised in + # Server.__init__? You should pay attention to it now. + raise RuntimeError, ("#{self} should be constructed with "\ + "op_endpoint to respond to OpenID 2.0 "\ + "messages.") + end + + server_url = @op_endpoint + end + + if allow + mode = 'id_res' + elsif @message.is_openid1 + if @immediate + mode = 'id_res' + else + mode = 'cancel' + end + else + if @immediate + mode = 'setup_needed' + else + mode = 'cancel' + end + end + + response = OpenIDResponse.new(self) + + if claimed_id and @message.is_openid1 + raise VersionError, ("claimed_id is new in OpenID 2.0 and not "\ + "available for #{@message.get_openid_namespace}") + end + + if identity and !claimed_id + claimed_id = identity + end + + if allow + if @identity == IDENTIFIER_SELECT + if !identity + raise ArgumentError, ("This request uses IdP-driven "\ + "identifier selection.You must supply "\ + "an identifier in the response.") + end + + response_identity = identity + response_claimed_id = claimed_id + + elsif @identity + if identity and (@identity != identity) + raise ArgumentError, ("Request was for identity #{@identity}, "\ + "cannot reply with identity #{identity}") + end + + response_identity = @identity + response_claimed_id = @claimed_id + else + if identity + raise ArgumentError, ("This request specified no identity "\ + "and you supplied #{identity}") + end + response_identity = nil + end + + if @message.is_openid1 and !response_identity + raise ArgumentError, ("Request was an OpenID 1 request, so "\ + "response must include an identifier.") + end + + response.fields.update_args(OPENID_NS, { + 'mode' => mode, + 'op_endpoint' => server_url, + 'return_to' => @return_to, + 'response_nonce' => Nonce.mk_nonce(), + }) + + if response_identity + response.fields.set_arg(OPENID_NS, 'identity', response_identity) + if @message.is_openid2 + response.fields.set_arg(OPENID_NS, + 'claimed_id', response_claimed_id) + end + end + else + response.fields.set_arg(OPENID_NS, 'mode', mode) + if @immediate + if @message.is_openid1 and !server_url + raise ArgumentError, ("setup_url is required for allow=false "\ + "in OpenID 1.x immediate mode.") + end + + # Make a new request just like me, but with + # immediate=false. + setup_request = self.class.new(@identity, @return_to, + @op_endpoint, @trust_root, false, + @assoc_handle) + setup_request.message = Message.new(@message.get_openid_namespace) + setup_url = setup_request.encode_to_url(server_url) + response.fields.set_arg(OPENID_NS, 'user_setup_url', setup_url) + end + end + + return response + end + + def encode_to_url(server_url) + # Encode this request as a URL to GET. + # + # server_url:: The URL of the OpenID server to make this + # request of. + if !@return_to + raise NoReturnToError + end + + # Imported from the alternate reality where these classes are + # used in both the client and server code, so Requests are + # Encodable too. That's right, code imported from alternate + # realities all for the love of you, id_res/user_setup_url. + q = {'mode' => @mode, + 'identity' => @identity, + 'claimed_id' => @claimed_id, + 'return_to' => @return_to} + + if @trust_root + if @message.is_openid1 + q['trust_root'] = @trust_root + else + q['realm'] = @trust_root + end + end + + if @assoc_handle + q['assoc_handle'] = @assoc_handle + end + + response = Message.new(@message.get_openid_namespace) + response.update_args(@message.get_openid_namespace, q) + return response.to_url(server_url) + end + + def cancel_url + # Get the URL to cancel this request. + # + # Useful for creating a "Cancel" button on a web form so that + # operation can be carried out directly without another trip + # through the server. + # + # (Except you may want to make another trip through the + # server so that it knows that the user did make a decision.) + # + # Returns a URL as a string. + if !@return_to + raise NoReturnToError + end + + if @immediate + raise ArgumentError.new("Cancel is not an appropriate response to " + + "immediate mode requests.") + end + + response = Message.new(@message.get_openid_namespace) + response.set_arg(OPENID_NS, 'mode', 'cancel') + return response.to_url(@return_to) + end + + def to_s + return sprintf('<%s id:%s im:%s tr:%s ah:%s>', self.class, + @identity, + @immediate, + @trust_root, + @assoc_handle) + end + end + + # I am a response to an OpenID request. + # + # Attributes: + # signed:: A list of the names of the fields which should be signed. + # + # Implementer's note: In a more symmetric client/server + # implementation, there would be more types of #OpenIDResponse + # object and they would have validated attributes according to + # the type of response. But as it is, Response objects in a + # server are basically write-only, their only job is to go out + # over the wire, so this is just a loose wrapper around + # #OpenIDResponse.fields. + class OpenIDResponse + # The #OpenIDRequest I respond to. + attr_accessor :request + + # An #OpenID::Message with the data to be returned. + # Keys are parameter names with no + # leading openid. e.g. identity and mac_key + # never openid.identity. + attr_accessor :fields + + def initialize(request) + # Make a response to an OpenIDRequest. + @request = request + @fields = Message.new(request.namespace) + end + + def to_s + return sprintf("%s for %s: %s", + self.class, + @request.class, + @fields) + end + + # form_tag_attrs is a hash of attributes to be added to the form + # tag. 'accept-charset' and 'enctype' have defaults that can be + # overridden. If a value is supplied for 'action' or 'method', + # it will be replaced. + # Returns the form markup for this response. + def to_form_markup(form_tag_attrs=nil) + return @fields.to_form_markup(@request.return_to, form_tag_attrs) + end + + # Wraps the form tag from to_form_markup in a complete HTML document + # that uses javascript to autosubmit the form. + def to_html(form_tag_attrs=nil) + return Util.auto_submit_html(to_form_markup(form_tag_attrs)) + end + + def render_as_form + # Returns true if this response's encoding is + # ENCODE_HTML_FORM. Convenience method for server authors. + return self.which_encoding == ENCODE_HTML_FORM + end + + def needs_signing + # Does this response require signing? + return @fields.get_arg(OPENID_NS, 'mode') == 'id_res' + end + + # implements IEncodable + + def which_encoding + # How should I be encoded? + # returns one of ENCODE_URL or ENCODE_KVFORM. + if BROWSER_REQUEST_MODES.member?(@request.mode) + if @fields.is_openid2 and + encode_to_url.length > OPENID1_URL_LIMIT + return ENCODE_HTML_FORM + else + return ENCODE_URL + end + else + return ENCODE_KVFORM + end + end + + def encode_to_url + # Encode a response as a URL for the user agent to GET. + # You will generally use this URL with a HTTP redirect. + return @fields.to_url(@request.return_to) + end + + def add_extension(extension_response) + # Add an extension response to this response message. + # + # extension_response:: An object that implements the + # #OpenID::Extension interface for adding arguments to an OpenID + # message. + extension_response.to_message(@fields) + end + + def encode_to_kvform + # Encode a response in key-value colon/newline format. + # + # This is a machine-readable format used to respond to + # messages which came directly from the consumer and not + # through the user agent. + # + # see: OpenID Specs, + # Key-Value Colon/Newline format + return @fields.to_kvform + end + + def copy + return Marshal.load(Marshal.dump(self)) + end + end + + # I am a response to an OpenID request in terms a web server + # understands. + # + # I generally come from an #Encoder, either directly or from + # #Server.encodeResponse. + class WebResponse + + # The HTTP code of this response as an integer. + attr_accessor :code + + # #Hash of headers to include in this response. + attr_accessor :headers + + # The body of this response. + attr_accessor :body + + def initialize(code=HTTP_OK, headers=nil, body="") + # Construct me. + # + # These parameters are assigned directly as class attributes, + # see my class documentation for their + # descriptions. + @code = code + if headers + @headers = headers + else + @headers = {} + end + @body = body + end + end + + # I sign things. + # + # I also check signatures. + # + # All my state is encapsulated in a store, which means I'm not + # generally pickleable but I am easy to reconstruct. + class Signatory + # The number of seconds a secret remains valid. Defaults to 14 days. + attr_accessor :secret_lifetime + + # keys have a bogus server URL in them because the filestore + # really does expect that key to be a URL. This seems a little + # silly for the server store, since I expect there to be only + # one server URL. + @@_normal_key = 'http://localhost/|normal' + @@_dumb_key = 'http://localhost/|dumb' + + def self._normal_key + @@_normal_key + end + + def self._dumb_key + @@_dumb_key + end + + attr_accessor :store + + # Create a new Signatory. store is The back-end where my + # associations are stored. + def initialize(store) + Util.assert(store) + @store = store + @secret_lifetime = 14 * 24 * 60 * 60 + end + + # Verify that the signature for some data is valid. + def verify(assoc_handle, message) + assoc = get_association(assoc_handle, true) + if !assoc + Util.log(sprintf("failed to get assoc with handle %s to verify " + + "message %s", assoc_handle, message)) + return false + end + + begin + valid = assoc.check_message_signature(message) + rescue StandardError => ex + Util.log(sprintf("Error in verifying %s with %s: %s", + message, assoc, ex)) + return false + end + + return valid + end + + # Sign a response. + # + # I take an OpenIDResponse, create a signature for everything in + # its signed list, and return a new copy of the response object + # with that signature included. + def sign(response) + signed_response = response.copy + assoc_handle = response.request.assoc_handle + if assoc_handle + # normal mode disabling expiration check because even if the + # association is expired, we still need to know some + # properties of the association so that we may preserve + # those properties when creating the fallback association. + assoc = get_association(assoc_handle, false, false) + + if !assoc or assoc.expires_in <= 0 + # fall back to dumb mode + signed_response.fields.set_arg( + OPENID_NS, 'invalidate_handle', assoc_handle) + assoc_type = assoc ? assoc.assoc_type : 'HMAC-SHA1' + if assoc and assoc.expires_in <= 0 + # now do the clean-up that the disabled checkExpiration + # code didn't get to do. + invalidate(assoc_handle, false) + end + assoc = create_association(true, assoc_type) + end + else + # dumb mode. + assoc = create_association(true) + end + + begin + signed_response.fields = assoc.sign_message(signed_response.fields) + rescue KVFormError => err + raise EncodingError, err + end + return signed_response + end + + # Make a new association. + def create_association(dumb=true, assoc_type='HMAC-SHA1') + secret = CryptUtil.random_string(OpenID.get_secret_size(assoc_type)) + uniq = Util.to_base64(CryptUtil.random_string(4)) + handle = sprintf('{%s}{%x}{%s}', assoc_type, Time.now.to_i, uniq) + + assoc = Association.from_expires_in( + secret_lifetime, handle, secret, assoc_type) + + if dumb + key = @@_dumb_key + else + key = @@_normal_key + end + + @store.store_association(key, assoc) + return assoc + end + + # Get the association with the specified handle. + def get_association(assoc_handle, dumb, checkExpiration=true) + # Hmm. We've created an interface that deals almost entirely + # with assoc_handles. The only place outside the Signatory + # that uses this (and thus the only place that ever sees + # Association objects) is when creating a response to an + # association request, as it must have the association's + # secret. + + if !assoc_handle + raise ArgumentError.new("assoc_handle must not be None") + end + + if dumb + key = @@_dumb_key + else + key = @@_normal_key + end + + assoc = @store.get_association(key, assoc_handle) + if assoc and assoc.expires_in <= 0 + Util.log(sprintf("requested %sdumb key %s is expired (by %s seconds)", + (!dumb) ? 'not-' : '', + assoc_handle, assoc.expires_in)) + if checkExpiration + @store.remove_association(key, assoc_handle) + assoc = nil + end + end + + return assoc + end + + # Invalidates the association with the given handle. + def invalidate(assoc_handle, dumb) + if dumb + key = @@_dumb_key + else + key = @@_normal_key + end + + @store.remove_association(key, assoc_handle) + end + end + + # I encode responses in to WebResponses. + # + # If you don't like WebResponses, you can do + # your own handling of OpenIDResponses with + # OpenIDResponse.whichEncoding, + # OpenIDResponse.encodeToURL, and + # OpenIDResponse.encodeToKVForm. + class Encoder + @@responseFactory = WebResponse + + # Encode a response to a WebResponse. + # + # Raises EncodingError when I can't figure out how to encode + # this message. + def encode(response) + encode_as = response.which_encoding() + if encode_as == ENCODE_KVFORM + wr = @@responseFactory.new(HTTP_OK, nil, + response.encode_to_kvform()) + if response.is_a?(Exception) + wr.code = HTTP_ERROR + end + elsif encode_as == ENCODE_URL + location = response.encode_to_url() + wr = @@responseFactory.new(HTTP_REDIRECT, + {'location' => location}) + elsif encode_as == ENCODE_HTML_FORM + wr = @@responseFactory.new(HTTP_OK, nil, + response.to_form_markup()) + else + # Can't encode this to a protocol message. You should + # probably render it to HTML and show it to the user. + raise EncodingError.new(response) + end + + return wr + end + end + + # I encode responses in to WebResponses, signing + # them when required. + class SigningEncoder < Encoder + + attr_accessor :signatory + + # Create a SigningEncoder given a Signatory + def initialize(signatory) + @signatory = signatory + end + + # Encode a response to a WebResponse, signing it first if + # appropriate. + # + # Raises EncodingError when I can't figure out how to encode this + # message. + # + # Raises AlreadySigned when this response is already signed. + def encode(response) + # the is_a? is a bit of a kludge... it means there isn't + # really an adapter to make the interfaces quite match. + if !response.is_a?(Exception) and response.needs_signing() + if !@signatory + raise ArgumentError.new( + sprintf("Must have a store to sign this request: %s", + response), response) + end + + if response.fields.has_key?(OPENID_NS, 'sig') + raise AlreadySigned.new(response) + end + + response = @signatory.sign(response) + end + + return super(response) + end + end + + # I decode an incoming web request in to a OpenIDRequest. + class Decoder + + @@handlers = { + 'checkid_setup' => CheckIDRequest.method('from_message'), + 'checkid_immediate' => CheckIDRequest.method('from_message'), + 'check_authentication' => CheckAuthRequest.method('from_message'), + 'associate' => AssociateRequest.method('from_message'), + } + + attr_accessor :server + + # Construct a Decoder. The server is necessary because some + # replies reference their server. + def initialize(server) + @server = server + end + + # I transform query parameters into an OpenIDRequest. + # + # If the query does not seem to be an OpenID request at all, I + # return nil. + # + # Raises ProtocolError when the query does not seem to be a valid + # OpenID request. + def decode(query) + if query.nil? or query.length == 0 + return nil + end + + begin + message = Message.from_post_args(query) + rescue InvalidOpenIDNamespace => e + query = query.dup + query['openid.ns'] = OPENID2_NS + message = Message.from_post_args(query) + raise ProtocolError.new(message, e.to_s) + end + + mode = message.get_arg(OPENID_NS, 'mode') + if !mode + msg = sprintf("No mode value in message %s", message) + raise ProtocolError.new(message, msg) + end + + handler = @@handlers.fetch(mode, self.method('default_decoder')) + return handler.call(message, @server.op_endpoint) + end + + # Called to decode queries when no handler for that mode is + # found. + # + # This implementation always raises ProtocolError. + def default_decoder(message, server) + mode = message.get_arg(OPENID_NS, 'mode') + msg = sprintf("Unrecognized OpenID mode %s", mode) + raise ProtocolError.new(message, msg) + end + end + + # I handle requests for an OpenID server. + # + # Some types of requests (those which are not checkid requests) + # may be handed to my handleRequest method, and I will take care + # of it and return a response. + # + # For your convenience, I also provide an interface to + # Decoder.decode and SigningEncoder.encode through my methods + # decodeRequest and encodeResponse. + # + # All my state is encapsulated in an store, which means I'm not + # generally pickleable but I am easy to reconstruct. + class Server + @@signatoryClass = Signatory + @@encoderClass = SigningEncoder + @@decoderClass = Decoder + + # The back-end where my associations and nonces are stored. + attr_accessor :store + + # I'm using this for associate requests and to sign things. + attr_accessor :signatory + + # I'm using this to encode things. + attr_accessor :encoder + + # I'm using this to decode things. + attr_accessor :decoder + + # I use this instance of OpenID::AssociationNegotiator to + # determine which kinds of associations I can make and how. + attr_accessor :negotiator + + # My URL. + attr_accessor :op_endpoint + + # op_endpoint is new in library version 2.0. + def initialize(store, op_endpoint) + @store = store + @signatory = @@signatoryClass.new(@store) + @encoder = @@encoderClass.new(@signatory) + @decoder = @@decoderClass.new(self) + @negotiator = DefaultNegotiator.copy() + @op_endpoint = op_endpoint + end + + # Handle a request. + # + # Give me a request, I will give you a response. Unless it's a + # type of request I cannot handle myself, in which case I will + # raise RuntimeError. In that case, you can handle it yourself, + # or add a method to me for handling that request type. + def handle_request(request) + begin + handler = self.method('openid_' + request.mode) + rescue NameError + raise RuntimeError.new( + sprintf("%s has no handler for a request of mode %s.", + self, request.mode)) + end + + return handler.call(request) + end + + # Handle and respond to check_authentication requests. + def openid_check_authentication(request) + return request.answer(@signatory) + end + + # Handle and respond to associate requests. + def openid_associate(request) + assoc_type = request.assoc_type + session_type = request.session.session_type + if @negotiator.allowed?(assoc_type, session_type) + assoc = @signatory.create_association(false, + assoc_type) + return request.answer(assoc) + else + message = sprintf('Association type %s is not supported with ' + + 'session type %s', assoc_type, session_type) + preferred_assoc_type, preferred_session_type = @negotiator.get_allowed_type() + return request.answer_unsupported(message, + preferred_assoc_type, + preferred_session_type) + end + end + + # Transform query parameters into an OpenIDRequest. + # query should contain the query parameters as a Hash with + # each key mapping to one value. + # + # If the query does not seem to be an OpenID request at all, I + # return nil. + def decode_request(query) + return @decoder.decode(query) + end + + # Encode a response to a WebResponse, signing it first if + # appropriate. + # + # Raises EncodingError when I can't figure out how to encode this + # message. + # + # Raises AlreadySigned When this response is already signed. + def encode_response(response) + return @encoder.encode(response) + end + end + + # A message did not conform to the OpenID protocol. + class ProtocolError < Exception + # The query that is failing to be a valid OpenID request. + attr_accessor :openid_message + attr_accessor :reference + attr_accessor :contact + + # text:: A message about the encountered error. + def initialize(message, text=nil, reference=nil, contact=nil) + @openid_message = message + @reference = reference + @contact = contact + Util.assert(!message.is_a?(String)) + super(text) + end + + # Get the return_to argument from the request, if any. + def get_return_to + if @openid_message.nil? + return nil + else + return @openid_message.get_arg(OPENID_NS, 'return_to') + end + end + + # Did this request have a return_to parameter? + def has_return_to + return !get_return_to.nil? + end + + # Generate a Message object for sending to the relying party, + # after encoding. + def to_message + namespace = @openid_message.get_openid_namespace() + reply = Message.new(namespace) + reply.set_arg(OPENID_NS, 'mode', 'error') + reply.set_arg(OPENID_NS, 'error', self.to_s) + + if @contact + reply.set_arg(OPENID_NS, 'contact', @contact.to_s) + end + + if @reference + reply.set_arg(OPENID_NS, 'reference', @reference.to_s) + end + + return reply + end + + # implements IEncodable + + def encode_to_url + return to_message().to_url(get_return_to()) + end + + def encode_to_kvform + return to_message().to_kvform() + end + + def to_form_markup + return to_message().to_form_markup(get_return_to()) + end + + def to_html + return Util.auto_submit_html(to_form_markup) + end + + # How should I be encoded? + # + # Returns one of ENCODE_URL, ENCODE_KVFORM, or None. If None, + # I cannot be encoded as a protocol message and should be + # displayed to the user. + def which_encoding + if has_return_to() + if @openid_message.is_openid2 and + encode_to_url().length > OPENID1_URL_LIMIT + return ENCODE_HTML_FORM + else + return ENCODE_URL + end + end + + if @openid_message.nil? + return nil + end + + mode = @openid_message.get_arg(OPENID_NS, 'mode') + if mode + if !BROWSER_REQUEST_MODES.member?(mode) + return ENCODE_KVFORM + end + end + + # If your request was so broken that you didn't manage to + # include an openid.mode, I'm not going to worry too much + # about returning you something you can't parse. + return nil + end + end + + # Raised when an operation was attempted that is not compatible + # with the protocol version being used. + class VersionError < Exception + end + + # Raised when a response to a request cannot be generated + # because the request contains no return_to URL. + class NoReturnToError < Exception + end + + # Could not encode this as a protocol message. + # + # You should probably render it and show it to the user. + class EncodingError < Exception + # The response that failed to encode. + attr_reader :response + + def initialize(response) + super(response) + @response = response + end + end + + # This response is already signed. + class AlreadySigned < EncodingError + end + + # A return_to is outside the trust_root. + class UntrustedReturnURL < ProtocolError + attr_reader :return_to, :trust_root + + def initialize(message, return_to, trust_root) + super(message) + @return_to = return_to + @trust_root = trust_root + end + + def to_s + return sprintf("return_to %s not under trust_root %s", + @return_to, + @trust_root) + end + end + + # The return_to URL doesn't look like a valid URL. + class MalformedReturnURL < ProtocolError + attr_reader :return_to + + def initialize(openid_message, return_to) + @return_to = return_to + super(openid_message) + end + end + + # The trust root is not well-formed. + class MalformedTrustRoot < ProtocolError + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/store/filesystem.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/filesystem.rb new file mode 100644 index 00000000..e2993eea --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/filesystem.rb @@ -0,0 +1,271 @@ +require 'fileutils' +require 'pathname' +require 'tempfile' + +require 'openid/util' +require 'openid/store/interface' +require 'openid/association' + +module OpenID + module Store + class Filesystem < Interface + @@FILENAME_ALLOWED = "0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ.-".split("") + + # Create a Filesystem store instance, putting all data in +directory+. + def initialize(directory) + p_dir = Pathname.new(directory) + @nonce_dir = p_dir.join('nonces') + @association_dir = p_dir.join('associations') + @temp_dir = p_dir.join('temp') + + self.ensure_dir(@nonce_dir) + self.ensure_dir(@association_dir) + self.ensure_dir(@temp_dir) + end + + # Create a unique filename for a given server url and handle. The + # filename that is returned will contain the domain name from the + # server URL for ease of human inspection of the data dir. + def get_association_filename(server_url, handle) + unless server_url.index('://') + raise ArgumentError, "Bad server URL: #{server_url}" + end + + proto, rest = server_url.split('://', 2) + domain = filename_escape(rest.split('/',2)[0]) + url_hash = safe64(server_url) + if handle + handle_hash = safe64(handle) + else + handle_hash = '' + end + filename = [proto,domain,url_hash,handle_hash].join('-') + @association_dir.join(filename) + end + + # Store an association in the assoc directory + def store_association(server_url, association) + assoc_s = association.serialize + filename = get_association_filename(server_url, association.handle) + f, tmp = mktemp + + begin + begin + f.write(assoc_s) + f.fsync + ensure + f.close + end + + begin + File.rename(tmp, filename) + rescue Errno::EEXIST + + begin + File.unlink(filename) + rescue Errno::ENOENT + # do nothing + end + + File.rename(tmp, filename) + end + + rescue + self.remove_if_present(tmp) + raise + end + end + + # Retrieve an association + def get_association(server_url, handle=nil) + # the filename with empty handle is the prefix for the associations + # for a given server url + filename = get_association_filename(server_url, handle) + if handle + return _get_association(filename) + end + assoc_filenames = Dir.glob(filename.to_s + '*') + + assocs = assoc_filenames.collect do |f| + _get_association(f) + end + + assocs = assocs.find_all { |a| not a.nil? } + assocs = assocs.sort_by { |a| a.issued } + + return nil if assocs.empty? + return assocs[-1] + end + + def _get_association(filename) + begin + assoc_file = File.open(filename, "r") + rescue Errno::ENOENT + return nil + else + begin + assoc_s = assoc_file.read + ensure + assoc_file.close + end + + begin + association = Association.deserialize(assoc_s) + rescue + self.remove_if_present(filename) + return nil + end + + # clean up expired associations + if association.expires_in == 0 + self.remove_if_present(filename) + return nil + else + return association + end + end + end + + # Remove an association if it exists, otherwise do nothing. + def remove_association(server_url, handle) + assoc = get_association(server_url, handle) + + if assoc.nil? + return false + else + filename = get_association_filename(server_url, handle) + return self.remove_if_present(filename) + end + end + + # Return whether the nonce is valid + def use_nonce(server_url, timestamp, salt) + return false if (timestamp - Time.now.to_i).abs > Nonce.skew + + if server_url and !server_url.empty? + proto, rest = server_url.split('://',2) + else + proto, rest = '','' + end + raise "Bad server URL" unless proto && rest + + domain = filename_escape(rest.split('/',2)[0]) + url_hash = safe64(server_url) + salt_hash = safe64(salt) + + nonce_fn = '%08x-%s-%s-%s-%s'%[timestamp, proto, domain, url_hash, salt_hash] + + filename = @nonce_dir.join(nonce_fn) + + begin + fd = File.new(filename, File::CREAT | File::EXCL | File::WRONLY, 0200) + fd.close + return true + rescue Errno::EEXIST + return false + end + end + + # Remove expired entries from the database. This is potentially expensive, + # so only run when it is acceptable to take time. + def cleanup + cleanup_associations + cleanup_nonces + end + + def cleanup_associations + association_filenames = Dir[@association_dir.join("*").to_s] + count = 0 + association_filenames.each do |af| + begin + f = File.open(af, 'r') + rescue Errno::ENOENT + next + else + begin + assoc_s = f.read + ensure + f.close + end + begin + association = OpenID::Association.deserialize(assoc_s) + rescue StandardError + self.remove_if_present(af) + next + else + if association.expires_in == 0 + self.remove_if_present(af) + count += 1 + end + end + end + end + return count + end + + def cleanup_nonces + nonces = Dir[@nonce_dir.join("*").to_s] + now = Time.now.to_i + + count = 0 + nonces.each do |filename| + nonce = filename.split('/')[-1] + timestamp = nonce.split('-', 2)[0].to_i(16) + nonce_age = (timestamp - now).abs + if nonce_age > Nonce.skew + self.remove_if_present(filename) + count += 1 + end + end + return count + end + + protected + + # Create a temporary file and return the File object and filename. + def mktemp + f = Tempfile.new('tmp', @temp_dir) + [f, f.path] + end + + # create a safe filename from a url + def filename_escape(s) + s = '' if s.nil? + filename_chunks = [] + s.split('').each do |c| + if @@FILENAME_ALLOWED.index(c) + filename_chunks << c + else + filename_chunks << sprintf("_%02X", c[0]) + end + end + filename_chunks.join("") + end + + def safe64(s) + s = OpenID::CryptUtil.sha1(s) + s = OpenID::Util.to_base64(s) + s.gsub!('+', '_') + s.gsub!('/', '.') + s.gsub!('=', '') + return s + end + + # remove file if present in filesystem + def remove_if_present(filename) + begin + File.unlink(filename) + rescue Errno::ENOENT + return false + end + return true + end + + # ensure that a path exists + def ensure_dir(dir_name) + FileUtils::mkdir_p(dir_name) + end + end + end +end + diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/store/interface.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/interface.rb new file mode 100644 index 00000000..50819f6f --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/interface.rb @@ -0,0 +1,75 @@ +require 'openid/util' + +module OpenID + + # Stores for Associations and nonces. Used by both the Consumer and + # the Server. If you have a database abstraction layer or other + # state storage in your application or framework already, you can + # implement the store interface. + module Store + # Abstract Store + # Changes in 2.0: + # * removed store_nonce, get_auth_key, is_dumb + # * changed use_nonce to support one-way nonces + # * added cleanup_nonces, cleanup_associations, cleanup + class Interface < Object + + # Put a Association object into storage. + # When implementing a store, don't assume that there are any limitations + # on the character set of the server_url. In particular, expect to see + # unescaped non-url-safe characters in the server_url field. + def store_association(server_url, association) + raise NotImplementedError + end + + # Returns a Association object from storage that matches + # the server_url. Returns nil if no such association is found or if + # the one matching association is expired. (Is allowed to GC expired + # associations when found.) + def get_association(server_url, handle=nil) + raise NotImplementedError + end + + # If there is a matching association, remove it from the store and + # return true, otherwise return false. + def remove_association(server_url, handle) + raise NotImplementedError + end + + # Return true if the nonce has not been used before, and store it + # for a while to make sure someone doesn't try to use the same value + # again. Return false if the nonce has already been used or if the + # timestamp is not current. + # You can use OpenID::Store::Nonce::SKEW for your timestamp window. + # server_url: URL of the server from which the nonce originated + # timestamp: time the nonce was created in seconds since unix epoch + # salt: A random string that makes two nonces issued by a server in + # the same second unique + def use_nonce(server_url, timestamp, salt) + raise NotImplementedError + end + + # Remove expired nonces from the store + # Discards any nonce that is old enough that it wouldn't pass use_nonce + # Not called during normal library operation, this method is for store + # admins to keep their storage from filling up with expired data + def cleanup_nonces + raise NotImplementedError + end + + # Remove expired associations from the store + # Not called during normal library operation, this method is for store + # admins to keep their storage from filling up with expired data + def cleanup_associations + raise NotImplementedError + end + + # Remove expired nonces and associations from the store + # Not called during normal library operation, this method is for store + # admins to keep their storage from filling up with expired data + def cleanup + return cleanup_nonces, cleanup_associations + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/store/memory.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/memory.rb new file mode 100644 index 00000000..58455b95 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/memory.rb @@ -0,0 +1,84 @@ +require 'openid/store/interface' +module OpenID + module Store + # An in-memory implementation of Store. This class is mainly used + # for testing, though it may be useful for long-running single + # process apps. Note that this store is NOT thread-safe. + # + # You should probably be looking at OpenID::Store::Filesystem + class Memory < Interface + + def initialize + @associations = {} + @associations.default = {} + @nonces = {} + end + + def store_association(server_url, assoc) + assocs = @associations[server_url] + @associations[server_url] = assocs.merge({assoc.handle => deepcopy(assoc)}) + end + + def get_association(server_url, handle=nil) + assocs = @associations[server_url] + assoc = nil + if handle + assoc = assocs[handle] + else + assoc = assocs.values.sort{|a,b| a.issued <=> b.issued}[-1] + end + + return assoc + end + + def remove_association(server_url, handle) + assocs = @associations[server_url] + if assocs.delete(handle) + return true + else + return false + end + end + + def use_nonce(server_url, timestamp, salt) + return false if (timestamp - Time.now.to_i).abs > Nonce.skew + nonce = [server_url, timestamp, salt].join('') + return false if @nonces[nonce] + @nonces[nonce] = timestamp + return true + end + + def cleanup_associations + count = 0 + @associations.each{|server_url, assocs| + assocs.each{|handle, assoc| + if assoc.expires_in == 0 + assocs.delete(handle) + count += 1 + end + } + } + return count + end + + def cleanup_nonces + count = 0 + now = Time.now.to_i + @nonces.each{|nonce, timestamp| + if (timestamp - now).abs > Nonce.skew + @nonces.delete(nonce) + count += 1 + end + } + return count + end + + protected + + def deepcopy(o) + Marshal.load(Marshal.dump(o)) + end + + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/store/nonce.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/nonce.rb new file mode 100644 index 00000000..08a9e529 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/store/nonce.rb @@ -0,0 +1,68 @@ +require 'openid/cryptutil' +require 'date' +require 'time' + +module OpenID + module Nonce + DEFAULT_SKEW = 60*60*5 + TIME_FMT = '%Y-%m-%dT%H:%M:%SZ' + TIME_STR_LEN = '0000-00-00T00:00:00Z'.size + @@NONCE_CHRS = "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789" + TIME_VALIDATOR = /\d\d\d\d-\d\d-\d\dT\d\d:\d\d:\d\dZ/ + + @skew = DEFAULT_SKEW + + # The allowed nonce time skew in seconds. Defaults to 5 hours. + # Used for checking nonce validity, and by stores' cleanup methods. + def Nonce.skew + @skew + end + + def Nonce.skew=(new_skew) + @skew = new_skew + end + + # Extract timestamp from a nonce string + def Nonce.split_nonce(nonce_str) + timestamp_str = nonce_str[0...TIME_STR_LEN] + raise ArgumentError if timestamp_str.size < TIME_STR_LEN + raise ArgumentError unless timestamp_str.match(TIME_VALIDATOR) + ts = Time.parse(timestamp_str).to_i + raise ArgumentError if ts < 0 + return ts, nonce_str[TIME_STR_LEN..-1] + end + + # Is the timestamp that is part of the specified nonce string + # within the allowed clock-skew of the current time? + def Nonce.check_timestamp(nonce_str, allowed_skew=nil, now=nil) + allowed_skew = skew if allowed_skew.nil? + begin + stamp, foo = split_nonce(nonce_str) + rescue ArgumentError # bad timestamp + return false + end + now = Time.now.to_i unless now + + # times before this are too old + past = now - allowed_skew + + # times newer than this are too far in the future + future = now + allowed_skew + + return (past <= stamp and stamp <= future) + end + + # generate a nonce with the specified timestamp (defaults to now) + def Nonce.mk_nonce(time = nil) + salt = CryptUtil::random_string(6, @@NONCE_CHRS) + if time.nil? + t = Time.now.getutc + else + t = Time.at(time).getutc + end + time_str = t.strftime(TIME_FMT) + return time_str + salt + end + + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/trustroot.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/trustroot.rb new file mode 100644 index 00000000..16695f05 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/trustroot.rb @@ -0,0 +1,349 @@ +require 'uri' +require 'openid/urinorm' + +module OpenID + + class RealmVerificationRedirected < Exception + # Attempting to verify this realm resulted in a redirect. + def initialize(relying_party_url, rp_url_after_redirects) + @relying_party_url = relying_party_url + @rp_url_after_redirects = rp_url_after_redirects + end + + def to_s + return "Attempting to verify #{@relying_party_url} resulted in " + + "redirect to #{@rp_url_after_redirects}" + end + end + + module TrustRoot + TOP_LEVEL_DOMAINS = %w' + ac ad ae aero af ag ai al am an ao aq ar arpa as asia at + au aw ax az ba bb bd be bf bg bh bi biz bj bm bn bo br bs bt + bv bw by bz ca cat cc cd cf cg ch ci ck cl cm cn co com coop + cr cu cv cx cy cz de dj dk dm do dz ec edu ee eg er es et eu + fi fj fk fm fo fr ga gb gd ge gf gg gh gi gl gm gn gov gp gq + gr gs gt gu gw gy hk hm hn hr ht hu id ie il im in info int + io iq ir is it je jm jo jobs jp ke kg kh ki km kn kp kr kw + ky kz la lb lc li lk lr ls lt lu lv ly ma mc md me mg mh mil + mk ml mm mn mo mobi mp mq mr ms mt mu museum mv mw mx my mz + na name nc ne net nf ng ni nl no np nr nu nz om org pa pe pf + pg ph pk pl pm pn pr pro ps pt pw py qa re ro rs ru rw sa sb + sc sd se sg sh si sj sk sl sm sn so sr st su sv sy sz tc td + tel tf tg th tj tk tl tm tn to tp tr travel tt tv tw tz ua + ug uk us uy uz va vc ve vg vi vn vu wf ws xn--0zwm56d + xn--11b5bs3a9aj6g xn--80akhbyknj4f xn--9t4b11yi5a + xn--deba0ad xn--g6w251d xn--hgbk6aj7f53bba + xn--hlcj6aya9esc7a xn--jxalpdlp xn--kgbechtv xn--zckzah ye + yt yu za zm zw' + + ALLOWED_PROTOCOLS = ['http', 'https'] + + # The URI for relying party discovery, used in realm verification. + # + # XXX: This should probably live somewhere else (like in + # OpenID or OpenID::Yadis somewhere) + RP_RETURN_TO_URL_TYPE = 'http://specs.openid.net/auth/2.0/return_to' + + # If the endpoint is a relying party OpenID return_to endpoint, + # return the endpoint URL. Otherwise, return None. + # + # This function is intended to be used as a filter for the Yadis + # filtering interface. + # + # endpoint: An XRDS BasicServiceEndpoint, as returned by + # performing Yadis dicovery. + # + # returns the endpoint URL or None if the endpoint is not a + # relying party endpoint. + def TrustRoot._extract_return_url(endpoint) + if endpoint.matchTypes([RP_RETURN_TO_URL_TYPE]) + return endpoint.uri + else + return nil + end + end + + # Is the return_to URL under one of the supplied allowed + # return_to URLs? + def TrustRoot.return_to_matches(allowed_return_to_urls, return_to) + allowed_return_to_urls.each { |allowed_return_to| + # A return_to pattern works the same as a realm, except that + # it's not allowed to use a wildcard. We'll model this by + # parsing it as a realm, and not trying to match it if it has + # a wildcard. + + return_realm = TrustRoot.parse(allowed_return_to) + if (# Parses as a trust root + !return_realm.nil? and + + # Does not have a wildcard + !return_realm.wildcard and + + # Matches the return_to that we passed in with it + return_realm.validate_url(return_to) + ) + return true + end + } + + # No URL in the list matched + return false + end + + # Given a relying party discovery URL return a list of return_to + # URLs. + def TrustRoot.get_allowed_return_urls(relying_party_url) + rp_url_after_redirects, return_to_urls = services.get_service_endpoints( + relying_party_url, _extract_return_url) + + if rp_url_after_redirects != relying_party_url + # Verification caused a redirect + raise RealmVerificationRedirected.new( + relying_party_url, rp_url_after_redirects) + end + + return return_to_urls + end + + # Verify that a return_to URL is valid for the given realm. + # + # This function builds a discovery URL, performs Yadis discovery + # on it, makes sure that the URL does not redirect, parses out + # the return_to URLs, and finally checks to see if the current + # return_to URL matches the return_to. + # + # raises DiscoveryFailure when Yadis discovery fails returns + # true if the return_to URL is valid for the realm + def TrustRoot.verify_return_to(realm_str, return_to, _vrfy=nil) + # _vrfy parameter is there to make testing easier + if _vrfy.nil? + _vrfy = self.method('get_allowed_return_urls') + end + + if !(_vrfy.is_a?(Proc) or _vrfy.is_a?(Method)) + raise ArgumentError, "_vrfy must be a Proc or Method" + end + + realm = TrustRoot.parse(realm_str) + if realm.nil? + # The realm does not parse as a URL pattern + return false + end + + begin + allowable_urls = _vrfy.call(realm.build_discovery_url()) + rescue RealmVerificationRedirected => err + Util.log(err.to_s) + return false + end + + if return_to_matches(allowable_urls, return_to) + return true + else + Util.log("Failed to validate return_to #{return_to} for " + + "realm #{realm_str}, was not in #{allowable_urls}") + return false + end + end + + class TrustRoot + + attr_reader :unparsed, :proto, :wildcard, :host, :port, :path + + @@empty_re = Regexp.new('^http[s]*:\/\/\*\/$') + + def TrustRoot._build_path(path, query=nil, frag=nil) + s = path.dup + + frag = nil if frag == '' + query = nil if query == '' + + if query + s << "?" << query + end + + if frag + s << "#" << frag + end + + return s + end + + def TrustRoot._parse_url(url) + begin + url = URINorm.urinorm(url) + rescue URI::InvalidURIError => err + nil + end + + begin + parsed = URI::parse(url) + rescue URI::InvalidURIError + return nil + end + + path = TrustRoot._build_path(parsed.path, + parsed.query, + parsed.fragment) + + return [parsed.scheme || '', parsed.host || '', + parsed.port || '', path || ''] + end + + def TrustRoot.parse(trust_root) + trust_root = trust_root.dup + unparsed = trust_root.dup + + # look for wildcard + wildcard = (not trust_root.index('://*.').nil?) + trust_root.sub!('*.', '') if wildcard + + # handle http://*/ case + if not wildcard and @@empty_re.match(trust_root) + proto = trust_root.split(':')[0] + port = proto == 'http' ? 80 : 443 + return new(unparsed, proto, true, '', port, '/') + end + + parts = TrustRoot._parse_url(trust_root) + return nil if parts.nil? + + proto, host, port, path = parts + + # check for URI fragment + if path and !path.index('#').nil? + return nil + end + + return nil unless ['http', 'https'].member?(proto) + return new(unparsed, proto, wildcard, host, port, path) + end + + def TrustRoot.check_sanity(trust_root_string) + trust_root = TrustRoot.parse(trust_root_string) + if trust_root.nil? + return false + else + return trust_root.sane? + end + end + + # quick func for validating a url against a trust root. See the + # TrustRoot class if you need more control. + def self.check_url(trust_root, url) + tr = self.parse(trust_root) + return (!tr.nil? and tr.validate_url(url)) + end + + # Return a discovery URL for this realm. + # + # This function does not check to make sure that the realm is + # valid. Its behaviour on invalid inputs is undefined. + # + # return_to:: The relying party return URL of the OpenID + # authentication request + # + # Returns the URL upon which relying party discovery should be + # run in order to verify the return_to URL + def build_discovery_url + if self.wildcard + # Use "www." in place of the star + www_domain = 'www.' + @host + port = (!@port.nil? and ![80, 443].member?(@port)) ? (":" + @port.to_s) : '' + return "#{@proto}://#{www_domain}#{port}#{@path}" + else + return @unparsed + end + end + + def initialize(unparsed, proto, wildcard, host, port, path) + @unparsed = unparsed + @proto = proto + @wildcard = wildcard + @host = host + @port = port + @path = path + end + + def sane? + return true if @host == 'localhost' + + host_parts = @host.split('.') + + # a note: ruby string split does not put an empty string at + # the end of the list if the split element is last. for + # example, 'foo.com.'.split('.') => ['foo','com']. Mentioned + # because the python code differs here. + + return false if host_parts.length == 0 + + # no adjacent dots + return false if host_parts.member?('') + + # last part must be a tld + tld = host_parts[-1] + return false unless TOP_LEVEL_DOMAINS.member?(tld) + + return false if host_parts.length == 1 + + if @wildcard + if tld.length == 2 and host_parts[-2].length <= 3 + # It's a 2-letter tld with a short second to last segment + # so there needs to be more than two segments specified + # (e.g. *.co.uk is insane) + return host_parts.length > 2 + end + end + + return true + end + + def validate_url(url) + parts = TrustRoot._parse_url(url) + return false if parts.nil? + + proto, host, port, path = parts + + return false unless proto == @proto + return false unless port == @port + return false unless host.index('*').nil? + + if !@wildcard + if host != @host + return false + end + elsif ((@host != '') and + (!host.ends_with?('.' + @host)) and + (host != @host)) + return false + end + + if path != @path + path_len = @path.length + trust_prefix = @path[0...path_len] + url_prefix = path[0...path_len] + + # must be equal up to the length of the path, at least + if trust_prefix != url_prefix + return false + end + + # These characters must be on the boundary between the end + # of the trust root's path and the start of the URL's path. + if !@path.index('?').nil? + allowed = '&' + else + allowed = '?/' + end + + return (!allowed.index(@path[-1]).nil? or + !allowed.index(path[path_len]).nil?) + end + + return true + end + end + end +end + diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/urinorm.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/urinorm.rb new file mode 100644 index 00000000..f30893ea --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/urinorm.rb @@ -0,0 +1,75 @@ +require 'uri' + +require "openid/extras" + +module OpenID + + module URINorm + public + def URINorm.urinorm(uri) + uri = URI.parse(uri) + + raise URI::InvalidURIError.new('no scheme') unless uri.scheme + uri.scheme = uri.scheme.downcase + unless ['http','https'].member?(uri.scheme) + raise URI::InvalidURIError.new('Not an HTTP or HTTPS URI') + end + + raise URI::InvalidURIError.new('no host') unless uri.host + uri.host = uri.host.downcase + + uri.path = remove_dot_segments(uri.path) + uri.path = '/' if uri.path.length == 0 + + uri = uri.normalize.to_s + uri = uri.gsub(PERCENT_ESCAPE_RE) { + sub = $&[1..2].to_i(16).chr + reserved(sub) ? $&.upcase : sub + } + + return uri + end + + private + RESERVED_RE = /[A-Za-z0-9._~-]/ + PERCENT_ESCAPE_RE = /%[0-9a-zA-Z]{2}/ + + def URINorm.reserved(chr) + not RESERVED_RE =~ chr + end + + def URINorm.remove_dot_segments(path) + result_segments = [] + + while path.length > 0 + if path.starts_with?('../') + path = path[3..-1] + elsif path.starts_with?('./') + path = path[2..-1] + elsif path.starts_with?('/./') + path = path[2..-1] + elsif path == '/.' + path = '/' + elsif path.starts_with?('/../') + path = path[3..-1] + result_segments.pop if result_segments.length > 0 + elsif path == '/..' + path = '/' + result_segments.pop if result_segments.length > 0 + elsif path == '..' or path == '.' + path = '' + else + i = 0 + i = 1 if path[0].chr == '/' + i = path.index('/', i) + i = path.length if i.nil? + result_segments << path[0...i] + path = path[i..-1] + end + end + + return result_segments.join('') + end + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/util.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/util.rb new file mode 100644 index 00000000..c5a6716b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/util.rb @@ -0,0 +1,110 @@ +require "cgi" +require "uri" +require "logger" + +require "openid/extras" + +# See OpenID::Consumer or OpenID::Server modules, as well as the store classes +module OpenID + class AssertionError < Exception + end + + # Exceptions that are raised by the library are subclasses of this + # exception type, so if you want to catch all exceptions raised by + # the library, you can catch OpenIDError + class OpenIDError < StandardError + end + + module Util + + BASE64_CHARS = ('ABCDEFGHIJKLMNOPQRSTUVWXYZ' \ + 'abcdefghijklmnopqrstuvwxyz0123456789+/') + BASE64_RE = Regexp.compile(" + \\A + ([#{BASE64_CHARS}]{4})* + ([#{BASE64_CHARS}]{2}==| + [#{BASE64_CHARS}]{3}=)? + \\Z", Regexp::EXTENDED) + + def Util.assert(value, message=nil) + if not value + raise AssertionError, message or value + end + end + + def Util.to_base64(s) + [s].pack('m').gsub("\n", "") + end + + def Util.from_base64(s) + without_newlines = s.gsub(/[\r\n]+/, '') + if !BASE64_RE.match(without_newlines) + raise ArgumentError, "Malformed input: #{s.inspect}" + end + without_newlines.unpack('m').first + end + + def Util.urlencode(args) + a = [] + args.each do |key, val| + val = '' unless val + a << (CGI::escape(key) + "=" + CGI::escape(val)) + end + a.join("&") + end + + def Util.parse_query(qs) + query = {} + CGI::parse(qs).each {|k,v| query[k] = v[0]} + return query + end + + def Util.append_args(url, args) + url = url.dup + return url if args.length == 0 + + if args.respond_to?('each_pair') + args = args.sort + end + + url << (url.include?("?") ? "&" : "?") + url << Util.urlencode(args) + end + + @@logger = Logger.new(STDERR) + @@logger.progname = "OpenID" + + def Util.logger=(logger) + @@logger = logger + end + + def Util.logger + @@logger + end + + # change the message below to do whatever you like for logging + def Util.log(message) + logger.info(message) + end + + def Util.auto_submit_html(form, title='OpenID transaction in progress') + return " + + + #{title} + + +#{form} + + + +" + end + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/accept.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/accept.rb new file mode 100644 index 00000000..a1657482 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/accept.rb @@ -0,0 +1,148 @@ +module OpenID + + module Yadis + + # Generate an accept header value + # + # [str or (str, float)] -> str + def self.generate_accept_header(*elements) + parts = [] + elements.each { |element| + if element.is_a?(String) + qs = "1.0" + mtype = element + else + mtype, q = element + q = q.to_f + if q > 1 or q <= 0 + raise ArgumentError.new("Invalid preference factor: #{q}") + end + qs = sprintf("%0.1f", q) + end + + parts << [qs, mtype] + } + + parts.sort! + chunks = [] + parts.each { |q, mtype| + if q == '1.0' + chunks << mtype + else + chunks << sprintf("%s; q=%s", mtype, q) + end + } + + return chunks.join(', ') + end + + def self.parse_accept_header(value) + # Parse an accept header, ignoring any accept-extensions + # + # returns a list of tuples containing main MIME type, MIME + # subtype, and quality markdown. + # + # str -> [(str, str, float)] + chunks = value.split(',', -1).collect { |v| v.strip } + accept = [] + chunks.each { |chunk| + parts = chunk.split(";", -1).collect { |s| s.strip } + + mtype = parts.shift + if mtype.index('/').nil? + # This is not a MIME type, so ignore the bad data + next + end + + main, sub = mtype.split('/', 2) + + q = nil + parts.each { |ext| + if !ext.index('=').nil? + k, v = ext.split('=', 2) + if k == 'q' + q = v.to_f + end + end + } + + q = 1.0 if q.nil? + + accept << [q, main, sub] + } + + accept.sort! + accept.reverse! + + return accept.collect { |q, main, sub| [main, sub, q] } + end + + def self.match_types(accept_types, have_types) + # Given the result of parsing an Accept: header, and the + # available MIME types, return the acceptable types with their + # quality markdowns. + # + # For example: + # + # >>> acceptable = parse_accept_header('text/html, text/plain; q=0.5') + # >>> matchTypes(acceptable, ['text/plain', 'text/html', 'image/jpeg']) + # [('text/html', 1.0), ('text/plain', 0.5)] + # + # Type signature: ([(str, str, float)], [str]) -> [(str, float)] + if accept_types.nil? or accept_types == [] + # Accept all of them + default = 1 + else + default = 0 + end + + match_main = {} + match_sub = {} + accept_types.each { |main, sub, q| + if main == '*' + default = [default, q].max + next + elsif sub == '*' + match_main[main] = [match_main.fetch(main, 0), q].max + else + match_sub[[main, sub]] = [match_sub.fetch([main, sub], 0), q].max + end + } + + accepted_list = [] + order_maintainer = 0 + have_types.each { |mtype| + main, sub = mtype.split('/', 2) + if match_sub.member?([main, sub]) + q = match_sub[[main, sub]] + else + q = match_main.fetch(main, default) + end + + if q != 0 + accepted_list << [1 - q, order_maintainer, q, mtype] + order_maintainer += 1 + end + } + + accepted_list.sort! + return accepted_list.collect { |_, _, q, mtype| [mtype, q] } + end + + def self.get_acceptable(accept_header, have_types) + # Parse the accept header and return a list of available types + # in preferred order. If a type is unacceptable, it will not be + # in the resulting list. + # + # This is a convenience wrapper around matchTypes and + # parse_accept_header + # + # (str, [str]) -> [str] + accepted = self.parse_accept_header(accept_header) + preferred = self.match_types(accepted, have_types) + return preferred.collect { |mtype, _| mtype } + end + + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/constants.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/constants.rb new file mode 100644 index 00000000..99b58b13 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/constants.rb @@ -0,0 +1,21 @@ + +require 'openid/yadis/accept' + +module OpenID + + module Yadis + + YADIS_HEADER_NAME = 'X-XRDS-Location' + YADIS_CONTENT_TYPE = 'application/xrds+xml' + + # A value suitable for using as an accept header when performing + # YADIS discovery, unless the application has special requirements + YADIS_ACCEPT_HEADER = generate_accept_header( + ['text/html', 0.3], + ['application/xhtml+xml', 0.5], + [YADIS_CONTENT_TYPE, 1.0] + ) + + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/discovery.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/discovery.rb new file mode 100644 index 00000000..55d6f09b --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/discovery.rb @@ -0,0 +1,153 @@ + +require 'openid/util' +require 'openid/fetchers' +require 'openid/yadis/constants' +require 'openid/yadis/parsehtml' + +module OpenID + + # Raised when a error occurs in the discovery process + class DiscoveryFailure < OpenIDError + attr_accessor :identity_url, :http_response + + def initialize(message, http_response) + super(message) + @identity_url = nil + @http_response = http_response + end + end + + module Yadis + + # Contains the result of performing Yadis discovery on a URI + class DiscoveryResult + + # The result of following redirects from the request_uri + attr_accessor :normalize_uri + + # The URI from which the response text was returned (set to + # nil if there was no XRDS document found) + attr_accessor :xrds_uri + + # The content-type returned with the response_text + attr_accessor :content_type + + # The document returned from the xrds_uri + attr_accessor :response_text + + attr_accessor :request_uri, :normalized_uri + + def initialize(request_uri) + # Initialize the state of the object + # + # sets all attributes to None except the request_uri + @request_uri = request_uri + @normalized_uri = nil + @xrds_uri = nil + @content_type = nil + @response_text = nil + end + + # Was the Yadis protocol's indirection used? + def used_yadis_location? + return @normalized_uri != @xrds_uri + end + + # Is the response text supposed to be an XRDS document? + def is_xrds + return (used_yadis_location?() or + @content_type == YADIS_CONTENT_TYPE) + end + end + + # Discover services for a given URI. + # + # uri: The identity URI as a well-formed http or https URI. The + # well-formedness and the protocol are not checked, but the + # results of this function are undefined if those properties do + # not hold. + # + # returns a DiscoveryResult object + # + # Raises DiscoveryFailure when the HTTP response does not have + # a 200 code. + def self.discover(uri) + result = DiscoveryResult.new(uri) + begin + resp = OpenID.fetch(uri, nil, {'Accept' => YADIS_ACCEPT_HEADER}) + rescue Exception + raise DiscoveryFailure.new("Failed to fetch identity URL #{uri} : #{$!}", $!) + end + if resp.code != "200" and resp.code != "206" + raise DiscoveryFailure.new( + "HTTP Response status from identity URL host is not \"200\"."\ + "Got status #{resp.code.inspect} for #{resp.final_url}", resp) + end + + # Note the URL after following redirects + result.normalized_uri = resp.final_url + + # Attempt to find out where to go to discover the document or if + # we already have it + result.content_type = resp['content-type'] + + result.xrds_uri = self.where_is_yadis?(resp) + + if result.xrds_uri and result.used_yadis_location? + begin + resp = OpenID.fetch(result.xrds_uri) + rescue + raise DiscoveryFailure.new("Failed to fetch Yadis URL #{result.xrds_uri} : #{$!}", $!) + end + if resp.code != "200" and resp.code != "206" + exc = DiscoveryFailure.new( + "HTTP Response status from Yadis host is not \"200\". " + + "Got status #{resp.code.inspect} for #{resp.final_url}", resp) + exc.identity_url = result.normalized_uri + raise exc + end + + result.content_type = resp['content-type'] + end + + result.response_text = resp.body + return result + end + + # Given a HTTPResponse, return the location of the Yadis + # document. + # + # May be the URL just retrieved, another URL, or None, if I + # can't find any. + # + # [non-blocking] + def self.where_is_yadis?(resp) + # Attempt to find out where to go to discover the document or if + # we already have it + content_type = resp['content-type'] + + # According to the spec, the content-type header must be an + # exact match, or else we have to look for an indirection. + if (!content_type.nil? and !content_type.to_s.empty? and + content_type.split(';', 2)[0].downcase == YADIS_CONTENT_TYPE) + return resp.final_url + else + # Try the header + yadis_loc = resp[YADIS_HEADER_NAME.downcase] + + if yadis_loc.nil? + # Parse as HTML if the header is missing. + # + # XXX: do we want to do something with content-type, like + # have a whitelist or a blacklist (for detecting that it's + # HTML)? + yadis_loc = Yadis.html_yadis_location(resp.body) + end + end + + return yadis_loc + end + + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/filters.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/filters.rb new file mode 100644 index 00000000..90f350ea --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/filters.rb @@ -0,0 +1,205 @@ +# This file contains functions and classes used for extracting +# endpoint information out of a Yadis XRD file using the REXML +# XML parser. + +# +module OpenID + module Yadis + class BasicServiceEndpoint + attr_reader :type_uris, :yadis_url, :uri, :service_element + + # Generic endpoint object that contains parsed service + # information, as well as a reference to the service element + # from which it was generated. If there is more than one + # xrd:Type or xrd:URI in the xrd:Service, this object represents + # just one of those pairs. + # + # This object can be used as a filter, because it implements + # fromBasicServiceEndpoint. + # + # The simplest kind of filter you can write implements + # fromBasicServiceEndpoint, which takes one of these objects. + def initialize(yadis_url, type_uris, uri, service_element) + @type_uris = type_uris + @yadis_url = yadis_url + @uri = uri + @service_element = service_element + end + + # Query this endpoint to see if it has any of the given type + # URIs. This is useful for implementing other endpoint classes + # that e.g. need to check for the presence of multiple + # versions of a single protocol. + def match_types(type_uris) + return @type_uris & type_uris + end + + # Trivial transform from a basic endpoint to itself. This + # method exists to allow BasicServiceEndpoint to be used as a + # filter. + # + # If you are subclassing this object, re-implement this function. + def self.from_basic_service_endpoint(endpoint) + return endpoint + end + + # A hack to make both this class and its instances respond to + # this message since Ruby doesn't support static methods. + def from_basic_service_endpoint(endpoint) + return self.class.from_basic_service_endpoint(endpoint) + end + + end + + # Take a list of basic filters and makes a filter that + # transforms the basic filter into a top-level filter. This is + # mostly useful for the implementation of make_filter, which + # should only be needed for special cases or internal use by + # this library. + # + # This object is useful for creating simple filters for services + # that use one URI and are specified by one Type (we expect most + # Types will fit this paradigm). + # + # Creates a BasicServiceEndpoint object and apply the filter + # functions to it until one of them returns a value. + class TransformFilterMaker + attr_reader :filter_procs + + # Initialize the filter maker's state + # + # filter_functions are the endpoint transformer + # Procs to apply to the basic endpoint. These are called in + # turn until one of them does not return nil, and the result + # of that transformer is returned. + def initialize(filter_procs) + @filter_procs = filter_procs + end + + # Returns an array of endpoint objects produced by the + # filter procs. + def get_service_endpoints(yadis_url, service_element) + endpoints = [] + + # Do an expansion of the service element by xrd:Type and + # xrd:URI + Yadis::expand_service(service_element).each { |type_uris, uri, _| + # Create a basic endpoint object to represent this + # yadis_url, Service, Type, URI combination + endpoint = BasicServiceEndpoint.new( + yadis_url, type_uris, uri, service_element) + + e = apply_filters(endpoint) + if !e.nil? + endpoints << e + end + } + return endpoints + end + + def apply_filters(endpoint) + # Apply filter procs to an endpoint until one of them returns + # non-nil. + @filter_procs.each { |filter_proc| + e = filter_proc.call(endpoint) + if !e.nil? + # Once one of the filters has returned an endpoint, do not + # apply any more. + return e + end + } + + return nil + end + end + + class CompoundFilter + attr_reader :subfilters + + # Create a new filter that applies a set of filters to an + # endpoint and collects their results. + def initialize(subfilters) + @subfilters = subfilters + end + + # Generate all endpoint objects for all of the subfilters of + # this filter and return their concatenation. + def get_service_endpoints(yadis_url, service_element) + endpoints = [] + @subfilters.each { |subfilter| + endpoints += subfilter.get_service_endpoints(yadis_url, service_element) + } + return endpoints + end + end + + # Exception raised when something is not able to be turned into a + # filter + @@filter_type_error = TypeError.new( + 'Expected a filter, an endpoint, a callable or a list of any of these.') + + # Convert a filter-convertable thing into a filter + # + # parts should be a filter, an endpoint, a callable, or a list of + # any of these. + def self.make_filter(parts) + # Convert the parts into a list, and pass to mk_compound_filter + if parts.nil? + parts = [BasicServiceEndpoint] + end + + if parts.is_a?(Array) + return mk_compound_filter(parts) + else + return mk_compound_filter([parts]) + end + end + + # Create a filter out of a list of filter-like things + # + # Used by make_filter + # + # parts should be a list of things that can be passed to make_filter + def self.mk_compound_filter(parts) + + if !parts.respond_to?('each') + raise TypeError, "#{parts.inspect} is not iterable" + end + + # Separate into a list of callables and a list of filter objects + transformers = [] + filters = [] + parts.each { |subfilter| + if !subfilter.is_a?(Array) + # If it's not an iterable + if subfilter.respond_to?('get_service_endpoints') + # It's a full filter + filters << subfilter + elsif subfilter.respond_to?('from_basic_service_endpoint') + # It's an endpoint object, so put its endpoint conversion + # attribute into the list of endpoint transformers + transformers << subfilter.method('from_basic_service_endpoint') + elsif subfilter.respond_to?('call') + # It's a proc, so add it to the list of endpoint + # transformers + transformers << subfilter + else + raise @@filter_type_error + end + else + filters << mk_compound_filter(subfilter) + end + } + + if transformers.length > 0 + filters << TransformFilterMaker.new(transformers) + end + + if filters.length == 1 + return filters[0] + else + return CompoundFilter.new(filters) + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/htmltokenizer.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/htmltokenizer.rb new file mode 100644 index 00000000..b2081097 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/htmltokenizer.rb @@ -0,0 +1,305 @@ +# = HTMLTokenizer +# +# Author:: Ben Giddings (mailto:bg-rubyforge@infofiend.com) +# Copyright:: Copyright (c) 2004 Ben Giddings +# License:: Distributes under the same terms as Ruby +# +# +# This is a partial port of the functionality behind Perl's TokeParser +# Provided a page it progressively returns tokens from that page +# +# $Id: htmltokenizer.rb,v 1.7 2005/06/07 21:05:53 merc Exp $ + +# +# A class to tokenize HTML. +# +# Example: +# +# page = " +# +# This is the title +# +# +# +#

    This is the header

    +#

    +# This is the paragraph, it contains +# links, +# images
+#        are
+#        really cool. Ok, here is some more text and +# another link. +#

    +# +# +# " +# toke = HTMLTokenizer.new(page) +# +# assert("

    " == toke.getTag("h1", "h2", "h3").to_s.downcase) +# assert(HTMLTag.new("") == toke.getTag("IMG", "A")) +# assert("links" == toke.getTrimmedText) +# assert(toke.getTag("IMG", "A").attr_hash['optional']) +# assert("_blank" == toke.getTag("IMG", "A").attr_hash['target']) +# +class HTMLTokenizer + @@version = 1.0 + + # Get version of HTMLTokenizer lib + def self.version + @@version + end + + attr_reader :page + + # Create a new tokenizer, based on the content, used as a string. + def initialize(content) + @page = content.to_s + @cur_pos = 0 + end + + # Reset the parser, setting the current position back at the stop + def reset + @cur_pos = 0 + end + + # Look at the next token, but don't actually grab it + def peekNextToken + if @cur_pos == @page.length then return nil end + + if ?< == @page[@cur_pos] + # Next token is a tag of some kind + if '!--' == @page[(@cur_pos + 1), 3] + # Token is a comment + tag_end = @page.index('-->', (@cur_pos + 1)) + if tag_end.nil? + raise HTMLTokenizerError, "No end found to started comment:\n#{@page[@cur_pos,80]}" + end + # p @page[@cur_pos .. (tag_end+2)] + HTMLComment.new(@page[@cur_pos .. (tag_end + 2)]) + else + # Token is a html tag + tag_end = @page.index('>', (@cur_pos + 1)) + if tag_end.nil? + raise HTMLTokenizerError, "No end found to started tag:\n#{@page[@cur_pos,80]}" + end + # p @page[@cur_pos .. tag_end] + HTMLTag.new(@page[@cur_pos .. tag_end]) + end + else + # Next token is text + text_end = @page.index('<', @cur_pos) + text_end = text_end.nil? ? -1 : (text_end - 1) + # p @page[@cur_pos .. text_end] + HTMLText.new(@page[@cur_pos .. text_end]) + end + end + + # Get the next token, returns an instance of + # * HTMLText + # * HTMLToken + # * HTMLTag + def getNextToken + token = peekNextToken + if token + # @page = @page[token.raw.length .. -1] + # @page.slice!(0, token.raw.length) + @cur_pos += token.raw.length + end + #p token + #print token.raw + return token + end + + # Get a tag from the specified set of desired tags. + # For example: + # foo = toke.getTag("h1", "h2", "h3") + # Will return the next header tag encountered. + def getTag(*sought_tags) + sought_tags.collect! {|elm| elm.downcase} + + while (tag = getNextToken) + if tag.kind_of?(HTMLTag) and + (0 == sought_tags.length or sought_tags.include?(tag.tag_name)) + break + end + end + tag + end + + # Get all the text between the current position and the next tag + # (if specified) or a specific later tag + def getText(until_tag = nil) + if until_tag.nil? + if ?< == @page[@cur_pos] + # Next token is a tag, not text + "" + else + # Next token is text + getNextToken.text + end + else + ret_str = "" + + while (tag = peekNextToken) + if tag.kind_of?(HTMLTag) and tag.tag_name == until_tag + break + end + + if ("" != tag.text) + ret_str << (tag.text + " ") + end + getNextToken + end + + ret_str + end + end + + # Like getText, but squeeze all whitespace, getting rid of + # leading and trailing whitespace, and squeezing multiple + # spaces into a single space. + def getTrimmedText(until_tag = nil) + getText(until_tag).strip.gsub(/\s+/m, " ") + end + +end + +class HTMLTokenizerError < Exception +end + +# The parent class for all three types of HTML tokens +class HTMLToken + attr_accessor :raw + + # Initialize the token based on the raw text + def initialize(text) + @raw = text + end + + # By default, return exactly the string used to create the text + def to_s + raw + end + + # By default tokens have no text representation + def text + "" + end + + def trimmed_text + text.strip.gsub(/\s+/m, " ") + end + + # Compare to another based on the raw source + def ==(other) + raw == other.to_s + end +end + +# Class representing text that isn't inside a tag +class HTMLText < HTMLToken + def text + raw + end +end + +# Class representing an HTML comment +class HTMLComment < HTMLToken + attr_accessor :contents + def initialize(text) + super(text) + temp_arr = text.scan(/^$/m) + if temp_arr[0].nil? + raise HTMLTokenizerError, "Text passed to HTMLComment.initialize is not a comment" + end + + @contents = temp_arr[0][0] + end +end + +# Class representing an HTML tag +class HTMLTag < HTMLToken + attr_reader :end_tag, :tag_name + def initialize(text) + super(text) + if ?< != text[0] or ?> != text[-1] + raise HTMLTokenizerError, "Text passed to HTMLComment.initialize is not a comment" + end + + @attr_hash = Hash.new + @raw = text + + tag_name = text.scan(/[\w:-]+/)[0] + if tag_name.nil? + raise HTMLTokenizerError, "Error, tag is nil: #{tag_name}" + end + + if ?/ == text[1] + # It's an end tag + @end_tag = true + @tag_name = '/' + tag_name.downcase + else + @end_tag = false + @tag_name = tag_name.downcase + end + + @hashed = false + end + + # Retrieve a hash of all the tag's attributes. + # Lazily done, so that if you don't look at a tag's attributes + # things go quicker + def attr_hash + # Lazy initialize == don't build the hash until it's needed + if !@hashed + if !@end_tag + # Get the attributes + attr_arr = @raw.scan(/<[\w:-]+\s+(.*?)\/?>/m)[0] + if attr_arr.kind_of?(Array) + # Attributes found, parse them + attrs = attr_arr[0] + attr_arr = attrs.scan(/\s*([\w:-]+)(?:\s*=\s*("[^"]*"|'[^']*'|([^"'>][^\s>]*)))?/m) + # clean up the array by: + # * setting all nil elements to true + # * removing enclosing quotes + attr_arr.each { + |item| + val = if item[1].nil? + item[0] + elsif '"'[0] == item[1][0] or '\''[0] == item[1][0] + item[1][1 .. -2] + else + item[1] + end + @attr_hash[item[0].downcase] = val + } + end + end + @hashed = true + end + + #p self + + @attr_hash + end + + # Get the 'alt' text for a tag, if it exists, or an empty string otherwise + def text + if !end_tag + case tag_name + when 'img' + if !attr_hash['alt'].nil? + return attr_hash['alt'] + end + when 'applet' + if !attr_hash['alt'].nil? + return attr_hash['alt'] + end + end + end + return '' + end +end + diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/parsehtml.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/parsehtml.rb new file mode 100644 index 00000000..9074ab6c --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/parsehtml.rb @@ -0,0 +1,44 @@ +require "openid/yadis/htmltokenizer" +require 'cgi' + +module OpenID + module Yadis + def Yadis.html_yadis_location(html) + parser = HTMLTokenizer.new(html) + + # to keep track of whether or not we are in the head element + in_head = false + + begin + while el = parser.getTag('head', '/head', 'meta', 'body', '/body', + 'html', 'script') + + # we are leaving head or have reached body, so we bail + return nil if ['/head', 'body', '/body'].member?(el.tag_name) + + if el.tag_name == 'head' + unless el.to_s[-2] == ?/ # tag ends with a /: a short tag + in_head = true + end + end + next unless in_head + + if el.tag_name == 'script' + unless el.to_s[-2] == ?/ # tag ends with a /: a short tag + parser.getTag('/script') + end + end + + return nil if el.tag_name == 'html' + + if el.tag_name == 'meta' and (equiv = el.attr_hash['http-equiv']) + if ['x-xrds-location','x-yadis-location'].member?(equiv.downcase) + return CGI::unescapeHTML(el.attr_hash['content']) + end + end + end + rescue HTMLTokenizerError # just stop parsing if there's an error + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/services.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/services.rb new file mode 100644 index 00000000..e3b3e0f6 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/services.rb @@ -0,0 +1,42 @@ + +require 'openid/yadis/filters' +require 'openid/yadis/discovery' +require 'openid/yadis/xrds' + +module OpenID + module Yadis + def Yadis.get_service_endpoints(input_url, flt=nil) + # Perform the Yadis protocol on the input URL and return an + # iterable of resulting endpoint objects. + # + # @param flt: A filter object or something that is convertable + # to a filter object (using mkFilter) that will be used to + # generate endpoint objects. This defaults to generating + # BasicEndpoint objects. + result = Yadis.discover(input_url) + begin + endpoints = Yadis.apply_filter(result.normalized_uri, + result.response_text, flt) + rescue XRDSError => err + raise DiscoveryFailure.new(err.to_s, nil) + end + + return [result.normalized_uri, endpoints] + end + + def Yadis.apply_filter(normalized_uri, xrd_data, flt=nil) + # Generate an iterable of endpoint objects given this input data, + # presumably from the result of performing the Yadis protocol. + + flt = Yadis.make_filter(flt) + et = Yadis.parseXRDS(xrd_data) + + endpoints = [] + each_service(et) { |service_element| + endpoints += flt.get_service_endpoints(normalized_uri, service_element) + } + + return endpoints + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrds.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrds.rb new file mode 100644 index 00000000..0ebf34ab --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrds.rb @@ -0,0 +1,155 @@ +require 'rexml/document' +require 'rexml/element' +require 'rexml/xpath' + +require 'openid/yadis/xri' + +module OpenID + module Yadis + + XRD_NS_2_0 = 'xri://$xrd*($v*2.0)' + XRDS_NS = 'xri://$xrds' + + XRDS_NAMESPACES = { + 'xrds' => XRDS_NS, + 'xrd' => XRD_NS_2_0, + } + + class XRDSError < StandardError; end + + # Raised when there's an assertion in the XRDS that it does not + # have the authority to make. + class XRDSFraud < XRDSError + end + + def Yadis::get_canonical_id(iname, xrd_tree) + # Return the CanonicalID from this XRDS document. + # + # @param iname: the XRI being resolved. + # @type iname: unicode + # + # @param xrd_tree: The XRDS output from the resolver. + # + # @returns: The XRI CanonicalID or None. + # @returntype: unicode or None + + xrd_list = [] + REXML::XPath::match(xrd_tree.root, '/xrds:XRDS/xrd:XRD', XRDS_NAMESPACES).each { |el| + xrd_list << el + } + + xrd_list.reverse! + + cid_elements = [] + + if !xrd_list.empty? + xrd_list[0].elements.each { |e| + if !e.respond_to?('name') + next + end + if e.name == 'CanonicalID' + cid_elements << e + end + } + end + + cid_element = cid_elements[0] + + if !cid_element + return nil + end + + canonicalID = XRI.make_xri(cid_element.text) + + childID = canonicalID.downcase + + xrd_list[1..-1].each { |xrd| + parent_sought = childID[0...childID.rindex('!')] + + parent = XRI.make_xri(xrd.elements["CanonicalID"].text) + + if parent_sought != parent.downcase + raise XRDSFraud.new(sprintf("%s can not come from %s", parent_sought, + parent)) + end + + childID = parent_sought + } + + root = XRI.root_authority(iname) + if not XRI.provider_is_authoritative(root, childID) + raise XRDSFraud.new(sprintf("%s can not come from root %s", childID, root)) + end + + return canonicalID + end + + class XRDSError < StandardError + end + + def Yadis::parseXRDS(text) + if text.nil? + raise XRDSError.new("Not an XRDS document.") + end + + begin + d = REXML::Document.new(text) + rescue RuntimeError => why + raise XRDSError.new("Not an XRDS document. Failed to parse XML.") + end + + if is_xrds?(d) + return d + else + raise XRDSError.new("Not an XRDS document.") + end + end + + def Yadis::is_xrds?(xrds_tree) + xrds_root = xrds_tree.root + return (!xrds_root.nil? and + xrds_root.name == 'XRDS' and + xrds_root.namespace == XRDS_NS) + end + + def Yadis::get_yadis_xrd(xrds_tree) + REXML::XPath.each(xrds_tree.root, + '/xrds:XRDS/xrd:XRD[last()]', + XRDS_NAMESPACES) { |el| + return el + } + raise XRDSError.new("No XRD element found.") + end + + # aka iterServices in Python + def Yadis::each_service(xrds_tree, &block) + xrd = get_yadis_xrd(xrds_tree) + xrd.each_element('Service', &block) + end + + def Yadis::services(xrds_tree) + s = [] + each_service(xrds_tree) { |service| + s << service + } + return s + end + + def Yadis::expand_service(service_element) + es = service_element.elements + uris = es.each('URI') { |u| } + uris = prio_sort(uris) + types = es.each('Type/text()') + # REXML::Text objects are not strings. + types = types.collect { |t| t.to_s } + uris.collect { |uri| [types, uri.text, service_element] } + end + + # Sort a list of elements that have priority attributes. + def Yadis::prio_sort(elements) + elements.sort { |a,b| + a.attribute('priority').to_s.to_i <=> b.attribute('priority').to_s.to_i + } + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xri.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xri.rb new file mode 100644 index 00000000..89dd99af --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xri.rb @@ -0,0 +1,90 @@ +require 'openid/yadis/xrds' +require 'openid/fetchers' + +module OpenID + module Yadis + module XRI + + # The '(' is for cross-reference authorities, and hopefully has a + # matching ')' somewhere. + XRI_AUTHORITIES = ["!", "=", "@", "+", "$", "("] + + def self.identifier_scheme(identifier) + if (!identifier.nil? and + identifier.length > 0 and + (identifier.match('^xri://') or + XRI_AUTHORITIES.member?(identifier[0].chr))) + return :xri + else + return :uri + end + end + + # Transform an XRI reference to an IRI reference. Note this is + # not not idempotent, so do not apply this to an identifier more + # than once. XRI Syntax section 2.3.1 + def self.to_iri_normal(xri) + iri = xri.dup + iri.insert(0, 'xri://') if not iri.match('^xri://') + return escape_for_iri(iri) + end + + # Note this is not not idempotent, so do not apply this more than + # once. XRI Syntax section 2.3.2 + def self.escape_for_iri(xri) + esc = xri.dup + # encode all % + esc.gsub!(/%/, '%25') + esc.gsub!(/\((.*?)\)/) { |xref_match| + xref_match.gsub(/[\/\?\#]/) { |char_match| + CGI::escape(char_match) + } + } + return esc + end + + # Transform an XRI reference to a URI reference. Note this is not + # not idempotent, so do not apply this to an identifier more than + # once. XRI Syntax section 2.3.1 + def self.to_uri_normal(xri) + return iri_to_uri(to_iri_normal(xri)) + end + + # RFC 3987 section 3.1 + def self.iri_to_uri(iri) + uri = iri.dup + # for char in ucschar or iprivate + # convert each char to %HH%HH%HH (as many %HH as octets) + return uri + end + + def self.provider_is_authoritative(provider_id, canonical_id) + lastbang = canonical_id.rindex('!') + return false unless lastbang + parent = canonical_id[0...lastbang] + return parent == provider_id + end + + def self.root_authority(xri) + xri = xri[6..-1] if xri.index('xri://') == 0 + authority = xri.split('/', 2)[0] + if authority[0].chr == '(' + root = authority[0...authority.index(')')+1] + elsif XRI_AUTHORITIES.member?(authority[0].chr) + root = authority[0].chr + else + root = authority.split(/[!*]/)[0] + end + + self.make_xri(root) + end + + def self.make_xri(xri) + if xri.index('xri://') != 0 + xri = 'xri://' + xri + end + return xri + end + end + end +end diff --git a/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrires.rb b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrires.rb new file mode 100644 index 00000000..39439119 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/lib/openid/yadis/xrires.rb @@ -0,0 +1,106 @@ +require "cgi" +require "openid/yadis/xri" +require "openid/yadis/xrds" +require "openid/fetchers" + +module OpenID + + module Yadis + + module XRI + + class XRIHTTPError < StandardError; end + + class ProxyResolver + + DEFAULT_PROXY = 'http://proxy.xri.net/' + + def initialize(proxy_url=nil) + if proxy_url + @proxy_url = proxy_url + else + @proxy_url = DEFAULT_PROXY + end + + @proxy_url += '/' unless @proxy_url.match('/$') + end + + def query_url(xri, service_type=nil) + # URI normal form has a leading xri://, but we need to strip + # that off again for the QXRI. This is under discussion for + # XRI Resolution WD 11. + qxri = XRI.to_uri_normal(xri)[6..-1] + hxri = @proxy_url + qxri + args = {'_xrd_r' => 'application/xrds+xml'} + if service_type + args['_xrd_t'] = service_type + else + # don't perform service endpoint selection + args['_xrd_r'] += ';sep=false' + end + + return XRI.append_args(hxri, args) + end + + def query(xri, service_types) + # these can be query args or http headers, needn't be both. + # headers = {'Accept' => 'application/xrds+xml;sep=true'} + canonicalID = nil + + services = service_types.collect { |service_type| + url = self.query_url(xri, service_type) + begin + response = OpenID.fetch(url) + rescue + raise XRIHTTPError, ["Could not fetch #{xri}", $!] + end + raise XRIHTTPError, "Could not fetch #{xri}" if response.nil? + + xrds = Yadis::parseXRDS(response.body) + canonicalID = Yadis::get_canonical_id(xri, xrds) + + Yadis::services(xrds) unless xrds.nil? + } + # TODO: + # * If we do get hits for multiple service_types, we're almost + # certainly going to have duplicated service entries and + # broken priority ordering. + services = services.inject([]) { |flatter, some_services| + flatter += some_services unless some_services.nil? + } + + return canonicalID, services + end + end + + def self.urlencode(args) + a = [] + args.each do |key, val| + a << (CGI::escape(key) + "=" + CGI::escape(val)) + end + a.join("&") + end + + def self.append_args(url, args) + return url if args.length == 0 + + # rstrip question marks + rstripped = url.dup + while rstripped[-1].chr == '?' + rstripped = rstripped[0...rstripped.length-1] + end + + if rstripped.index('?') + sep = '&' + else + sep = '?' + end + + return url + sep + XRI.urlencode(args) + end + + end + + end + +end diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/accept.txt b/vendor/gems/ruby-openid-2.1.2/test/data/accept.txt new file mode 100644 index 00000000..884ff662 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/accept.txt @@ -0,0 +1,124 @@ +# Accept: [Accept: header value from RFC2616, +# http://www.w3.org/Protocols/rfc2616/rfc2616-sec14.html] +# Available: [whitespace-separated content types] +# Expected: [Accept-header like list, containing the available content +# types with their q-values] + +Accept: */* +Available: text/plain +Expected: text/plain; q=1.0 + +Accept: */* +Available: text/plain, text/html +Expected: text/plain; q=1.0, text/html; q=1.0 + +# The order matters +Accept: */* +Available: text/html, text/plain +Expected: text/html; q=1.0, text/plain; q=1.0 + +Accept: text/*, */*; q=0.9 +Available: text/plain, image/jpeg +Expected: text/plain; q=1.0, image/jpeg; q=0.9 + +Accept: text/*, */*; q=0.9 +Available: image/jpeg, text/plain +Expected: text/plain; q=1.0, image/jpeg; q=0.9 + +# wildcard subtypes still reject differing main types +Accept: text/* +Available: image/jpeg, text/plain +Expected: text/plain; q=1.0 + +Accept: text/html +Available: text/html +Expected: text/html; q=1.0 + +Accept: text/html, text/* +Available: text/html +Expected: text/html; q=1.0 + +Accept: text/html, text/* +Available: text/plain, text/html +Expected: text/plain; q=1.0, text/html; q=1.0 + +Accept: text/html, text/*; q=0.9 +Available: text/plain, text/html +Expected: text/html; q=1.0, text/plain; q=0.9 + +# If a more specific type has a higher q-value, then the higher value wins +Accept: text/*; q=0.9, text/html +Available: text/plain, text/html +Expected: text/html; q=1.0, text/plain; q=0.9 + +Accept: */*, text/*; q=0.9, text/html; q=0.1 +Available: text/plain, text/html, image/monkeys +Expected: image/monkeys; q=1.0, text/plain; q=0.9, text/html; q=0.1 + +Accept: text/*, text/html; q=0 +Available: text/html +Expected: + +Accept: text/*, text/html; q=0 +Available: text/html, text/plain +Expected: text/plain; q=1.0 + +Accept: text/html +Available: text/plain +Expected: + +Accept: application/xrds+xml, text/html; q=0.9 +Available: application/xrds+xml, text/html +Expected: application/xrds+xml; q=1.0, text/html; q=0.9 + +Accept: application/xrds+xml, */*; q=0.9 +Available: application/xrds+xml, text/html +Expected: application/xrds+xml; q=1.0, text/html; q=0.9 + +Accept: application/xrds+xml, application/xhtml+xml; q=0.9, text/html; q=0.8, text/xml; q=0.7 +Available: application/xrds+xml, text/html +Expected: application/xrds+xml; q=1.0, text/html; q=0.8 + +# See http://www.rfc-editor.org/rfc/rfc3023.txt, section A.13 +Accept: application/xrds +Available: application/xrds+xml +Expected: + +Accept: application/xrds+xml +Available: application/xrds +Expected: + +Accept: application/xml +Available: application/xrds+xml +Expected: + +Available: application/xrds+xml +Accept: application/xml +Expected: + +Available: +Accept: not_a_content_type +Expected: + +Available: text/html +Accept: not_a_content_type, text/html +Expected: text/html; q=1.0 + +################################################# +# The tests below this line are documentation of how this library +# works. If the implementation changes, it's acceptable to change the +# test to reflect that. These are specified so that we can make sure +# that the current implementation actually works the way that we +# expect it to given these inputs. + +Accept: text/html;level=1 +Available: text/html +Expected: text/html; q=1.0 + +Accept: text/html; level=1, text/html; level=9; q=0.1 +Available: text/html +Expected: text/html; q=1.0 + +Accept: text/html; level=9; q=0.1, text/html; level=1 +Available: text/html +Expected: text/html; q=1.0 diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/dh.txt b/vendor/gems/ruby-openid-2.1.2/test/data/dh.txt new file mode 100644 index 00000000..0fa52314 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/dh.txt @@ -0,0 +1,29 @@ +130706940119084053627151828062879423433929180135817317038378606310097533503449582079984816816837125851552273641820339909167103200910805078308128174143174269944095368580519322913514764528012639683546377014716235962867583443566164615728897857285824741767070432119909660645255499710701356135207437699643611094585 139808169914464096465921128085565621767096724855516655439365028496569658038844954238931647642811548254956660405394116677296461848124300258439895306367561416289126854788101396379292925819850897858045772500578222021901631436550118958972312221974009238050517034542286574826081826542722270952769078386418682059418 +91966407878983240112417790733941098492087186469785726449910011271065622315680646030230288265496017310433513856308693810812043160919214636748486185212617634222158204354206411031403206076739932806412551605172319515223573351072757800448643935018534945933808900467686115619932664888581913179496050117713298715475 88086484332488517006277516020842172054013692832175783214603951240851750819999098631851571207693874357651112736088114133607400684776234181681933311972926752846692615822043533641407510569745606256772455614745111122033229877596984718963046218854103292937700694160593653595134512369959987897086639788909618660591 +94633950701209990078055218830969910271587805983595045023718108184189787131629772007048606080263109446462048743696369276578815611098215686598630889831104860221067872883514840819381234786050098278403321905311637820524177879167250981289318356078312300538871435101338967079907049912435983871847334104247675360099 136836393035803488129856151345450008294260680733328546556640578838845312279198933806383329293483852515700876505956362639881210101974254765087350842271260064592406308509078284840473735904755203614987286456952991025347168970462354352741159076541157478949094536405618626397435745496863324654768971213730622037771 +24685127248019769965088146297942173464487677364928435784091685260262292485380918213538979925891771204729738138857126454465630594391449913947358655368215901119137728648638547728497517587701248406019427282237279437409508871300675355166059811431191200555457304463617727969228965042729205402243355816702436970430 103488011917988946858248200111251786178288940265978921633592888293430082248387786443813155999158786903216094876295371112716734481877806417714913656921169196196571699893360825510307056269738593971532017994987406325068886420548597161498019372380511676314312298122272401348856314619382867707981701472607230523868 +116791045850880292989786005885944774698035781824784400772676299590038746153860847252706167458966356897309533614849402276819438194497464696186624618374179812548893947178936305721131565012344462048549467883494038577857638815386798694225798517783768606048713198211730870155881426709644960689953998714045816205549 25767875422998856261320430397505398614439586659207416236135894343577952114994718158163212134503751463610021489053571733974769536157057815413209619147486931502025658987681202196476489081257777148377685478756033509708349637895740799542063593586769082830323796978935454479273531157121440998804334199442003857410 +75582226959658406842894734694860761896800153014775231713388264961517169436476322183886891849966756849783437334069692683523296295601533803799559985845105706728538458624387103621364117548643541824878550074680443708148686601108223917493525070861593238005735446708555769966855130921562955491250908613793521520082 51100990616369611694975829054222013346248289055987940844427061856603230021472379888102172458517294080775792439385531234808129302064303666640376750139242970123503857186428797403843206765926798353022284672682073397573130625177187185114726049347844460311761033584101482859992951420083621362870301150543916815123 +22852401165908224137274273646590366934616265607879280260563022941455466297431255072303172649495519837876946233272420969249841381161312477263365567831938496555136366981954001163034914812189448922853839616662859772087929140818377228980710884492996109434435597500854043325062122184466315338260530734979159890875 35017410720028595029711778101507729481023945551700945988329114663345341120595162378885287946069695772429641825579528116641336456773227542256911497084242947904528367986325800537695079726856460817606404224094336361853766354225558025931211551975334149258299477750615397616908655079967952372222383056221992235704 +37364490883518159794654045194678325635036705086417851509136183713863262621334636905291385255662750747808690129471989906644041585863034419130023070856805511017402434123099100618568335168939301014148587149578150068910141065808373976114927339040964292334109797421173369274978107389084873550233108940239410902552 40916262212189137562350357241447034318002130016858244002788189310078477605649010031339865625243230798681216437501833540185827501244378529230150467789369234869122179247196276164931090039290879808162629109742198951942358028123056268054775108592325500609335947248599688175189333996086475013450537086042387719925 +42030470670714872936404499074069849778147578537708230270030877866700844337372497704027708080369726758812896818567830863540507961487472657570488625639077418109017434494794778542739932765561706796300920251933107517954265066804108669800167526425723377411855061131982689717887180411017924173629124764378241885274 124652439272864857598747946875599560379786580730218192165733924418687522301721706620565030507816884907589477351553268146177293719586287258662025940181301472851649975563004543250656807255226609296537922304346339513054316391667044301386950180277940536542183725690479451746977789001659540839582630251935163344393 +33176766914206542084736303652243484580303865879984981189372762326078776390896986743451688462101732968104375838228070296418541745483112261133079756514082093269959937647525005374035326747696591842313517634077723301677759648869372517403529488493581781546743147639937580084065663597330159470577639629864369972900 67485835091897238609131069363014775606263390149204621594445803179810038685760826651889895397414961195533694176706808504447269558421955735607423135937153901140512527504198912146656610630396284977496295289999655140295415981288181545277299615922576281262872097567020980675200178329219970170480653040350512964539 +131497983897702298481056962402569646971797912524360547236788650961059980711719600424210346263081838703940277066368168874781981151411096949736205282734026497995296147418292226818536168555712128736975034272678008697869326747592750850184857659420541708058277866000692785617873742438060271311159568468507825422571 5400380840349873337222394910303409203226429752629134721503171858543984393161548520471799318518954232197106728096866840965784563043721652790856860155702760027304915133166173298206604451826182024471262142046935060360564569939062438160049193241369468208458085699995573492688298015026628427440418009025072261296 +83265103005695640943261961853521077357830295830250157593141844209296716788437615940096402365505416686459260302419338241462783388722843946886845478224048360927114533590583464979009731440049610985062455108831881153988321298531365779084012803908832525921630534096740755274371500276660832724874701671184539131864 141285570207910287798371174771658911045525474449663877845558585668334618068814605961306961485855329182957174312715910923324965889174835444049526313968571611940626279733302104955951067959291852710640374412577070764165811275030632465290729619533330733368808295932659463215921521905553936914975786500018720073003 +68435028583616495789148116911096163791710022987677894923742899873596891423986951658100606742052014161171185231735413902875605720814417622409817842932759492013585936536452615480700628719795872201528559780249210820284350401473564919576289210869896327937002173624497942136329576506818749730506884927872345019446 134655528287263100540003157571441260698452262106680191153945271167894435782028803135774578949200580551016388918860856991026082917835209212892423567114480975540305860034439015788120390011692862968771136814777768281366591257663821495720134621172848947971117885754539770645621669309650476331439675400544167728223 +97765390064836080322590528352647421920257073063706996347334558390461274981996865736612531330863478931481491964338380362350271734683183807511097331539820133036984271653285063355715726806139083282458695728902452215405696318402583540317419929113959816258829534543044153959951908676300847164682178008704099351835 92552521881196975294401505656851872247567784546370503402756239533783651371688190302773864319828182042605239246779598629409815474038541272600580320815319709309111399294952620375093803971373108792300726524826209329889463854451846561437729676142864421966497641824498079067929811613947148353921163336822026640804 +145767094672933012300753301037546647564595762930138884463767054235112032706630891961371504668013023047595721138624016493638510710257541241706724342585654715468628355455898091951826598092812212209834746162089753649871544789379424903025374228231365026585872808685759231756517703720396301355299998059523896918448 116669462839999965355861187716880953863237226719689755457884414384663576662696981997535568446560375442532084973721539944428004043491468494548231348032618218312515409944970197902589794303562379864012797605284844016184274353252071642511293089390472576498394410829972525726474727579603392265177009323768966538608 +34172517877854802711907683049441723730724885305592620486269966708379625109832852005775048584124451699198484092407720344962116726808090368739361658889584507734617844212547181476646725256303630128954338675520938806905779837227983648887192531356390902975904503218654196581612781227843742951241442641220856414232 126013077261793777773236390821108423367648447987653714614732477073177878509574051196587476846560696305938891953527959347566502332765820074506907037627115954790645652211088723122982633069089920979477728376746424256704724173255656757918995039125823421607024407307091796807227896314403153380323770001854211384322 +9979624731056222925878866378063961280844793874828281622845276060532093809300121084179730782833657205171434732875093693074415298975346410131191865198158876447591891117577190438695367929923494177555818480377241891190442070100052523008290671797937772993634966511431668500154258765510857129203107386972819651767 76559085024395996164590986654274454741199399364851956129137304209855150918182685643729981600389513229011956888957763987167398150792454613751473654448162776379362213885827651020309844507723069713820393068520302223477225569348080362344052033711960892643036147232270133731530049660264526964146237693063093765111 +18162696663677410793062235946366423954875282212790518677684260521370996677183041664345920941714064628111537529793170736292618705900247450994864220481135611781148410617609559050220262121494712903009168783279356915189941268264177631458029177102542745167475619936272581126346266816618866806564180995726437177435 63244550218824945129624987597134280916829928261688093445040235408899092619821698537312158783367974202557699994650667088974727356690181336666077506063310290098995215324552449858513870629176838494348632073938023916155113126203791709810160925798130199717340478393420816876665127594623142175853115698049952126277 +4817943161362708117912118300716778687157593557807116683477307391846133734701449509121209661982298574607233039490570567781316652698287671086985501523197566560479906850423709894582834963398034434055472063156147829131181965140631257939036683622084290629927807369457311894970308590034407761706800045378158588657 61612160237840981966750225147965256022861527286827877531373888434780789812764688703260066154973576040405676432586962624922734102370509771313805122788566405984830112657060375568510809122230960988304085950306616401218206390412815884549481965750553137717475620505076144744211331973240555181377832337912951699135 +36363324947629373144612372870171042343590861026293829791335153646774927623889458346817049419803031378037141773848560341251355283891019532059644644509836766167835557471311319194033709837770615526356168418160386395260066262292757953919140150454538786106958252854181965875293629955562111756775391296856504912587 86831561031659073326747216166881733513938228972332631084118628692228329095617884068498116676787029033973607066377816508795286358748076949738854520048303930186595481606562375516134920902325649683618195251332651685732712539073110524182134321873838204219194459231650917098791250048469346563303077080880339797744 +26406869969418301728540993821409753036653370247174689204659006239823766914991146853283367848649039747728229875444327879875275718711878211919734397349994000106499628652960403076186651083084423734034070082770589453774926850920776427074440483233447839259180467805375782600203654373428926653730090468535611335253 100139935381469543084506312717977196291289016554846164338908226931204624582010530255955411615528804421371905642197394534614355186795223905217732992497673429554618838376065777445760355552020655667172127543653684405493978325270279321013143828897100500212200358450649158287605846102419527584313353072518101626851 +92613116984760565837109105383781193800503303131143575169488835702472221039082994091847595094556327985517286288659598094631489552181233202387028607421487026032402972597880028640156629614572656967808446397456622178472130864873587747608262139844319805074476178618930354824943672367046477408898479503054125369731 30023391082615178562263328892343821010986429338255434046051061316154579824472412477397496718186615690433045030046315908170615910505869972621853946234911296439134838951047107272129711854649412919542407760508235711897489847951451200722151978578883748353566191421685659370090024401368356823252748749449302536931 +31485815361342085113278193504381994806529237123359718043079410511224607873725611862217941085749929342777366642477711445011074784469367917758629403998067347054115844421430072631339788256386509261291675080191633908849638316409182455648806133048549359800886124554879661473112614246869101243501787363247762961784 114503770698890543429251666713050844656853278831559195214556474458830029271801818536133531843456707474500106283648085144619097572354066554819887152106174400667929098257361286338795493838820850475790977445807435511982704395422526800272723708548541616513134676140304653112325071112865020365664833601046215694089 +76882090884790547431641385530818076533805072109483843307806375918023300052767710853172670987385376253156912268523505310624133905633437815297307463917718596711590885553760690350221265675690787249135345226947453988081566088302642706234126002514517416493192624887800567412565527886687096028028124049522890448168 15056463217273240496622619354104573042767532856243223052125822509781815362480522535564283485059790932505429110157271454207173426525345813426696743168079246510944969446574354255284952839036431873039487144279164893710061580467579842173706653409487110282515691099753380094215805485573768509475850463001549608836 +52345178981230648108672997265819959243255047568833938156267924185186047373470984278294897653277996726416846430969793375429223610099546622112048283560483136389901514170116723365811871938630317974150540909650396429631704968748113009366339718498979597226137532343384889080245796447593572468846438769413505393967 32148494517199936472358017244372701214529606506776255341152991328091526865643069587953759877295255050519124541457805199596762210567333445908166076384465183589342153762720515477404466193879418014196727238972417616122646440870364200208488239778452378059236162633837824948613596114768455832408342040970780086 +41095268619128788015767564971105114602454449306041732792746397800275041704886345704294273937217484580365505320134717320083763349380629342859670693445658118959823430378844830923452105707338162448974869312012791385772125813291388247857971218575518319578818336960572244046567099555399203328678654466958536663208 92166550199033418923713824997841892577149715275633481076285269142670107687867024550593869464613175882141630640739938334001211714884975032600306279287443909448541179109981755796752132502127330056736913454039526413284519137059580845856736918773597087836203497066909257930043736166431682872083389105176299181629 +40049143661018504441607875135884755310012910557581028447435354354754245291878800571089144452035026644953322330676651798951447670184106450649737772686119714700743396359069052813433030118630105307022867200053964644574786137276428546712005171080129190959914708907200288299169344380390093918556722227705114244981 108159089972386282154772900619022507336076619354549601813179459338897131937353741544606392560724999980281424266891537298473163753022749859939445293926707568015958367188089915420630082556748668489756475027008449860889202622698060097015044886961901650857610841562477736791450080980702347705778074391774667412741 +69905259478181995876884927656894491893594530150260951315109404530530357998889589977208787140430938039028941393673520799460431992051993157468616168400324834880926190141581037597526917869362292931957289043707855837933490285814769110495657056206391880865972389421774822461752702336812585852278453803972600333734 71821415380277072313878763768684432371552628204186742842154591000123020597011744840460964835414360968627162765288463383113375595799297552681618876474019263288277398833725479226930770694271622605114061622753165584075733358178384410640349907375170170910499615355511313349300918885560131539570707695789106185664 +26945345439378873515011714350080059082081595419023056538696949766471272811362104837806324694947413603019863785876836706911406330379274553386254346050697348395574746891556054334903838949157798006141473389066020212044825140294048709654273698482867946522782450500680195477050110145664069582549935651920545151500 80313315938584480048642653013876614091607852535582224914294013785054094052454758327935781971746329853786568549510067442145637007308960551652864942042189241081946607011847245280773379099020221884296226818685556430275385068764313042226925852500883894269809033380734632866477789520106865758504064806906234130588 diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/example-xrds.xml b/vendor/gems/ruby-openid-2.1.2/test/data/example-xrds.xml new file mode 100644 index 00000000..101ba3bd --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/example-xrds.xml @@ -0,0 +1,14 @@ + + + + + + + http://example.com/ + http://www.openidenabled.com/ + + + + diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/linkparse.txt b/vendor/gems/ruby-openid-2.1.2/test/data/linkparse.txt new file mode 100644 index 00000000..2fa38cde --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/linkparse.txt @@ -0,0 +1,587 @@ +Num Tests: 72 + +OpenID link parsing test cases +Copyright (C) 2005-2008, JanRain, Inc. +See COPYING for license information. + +File format +----------- + +All text before the first triple-newline (this chunk) should be ignored. + +This file may be interpreted as Latin-1 or UTF-8. + +Test cases separated by three line separators (`\n\n\n'). The test +cases consist of a headers section followed by a data block. These are +separated by a double newline. The headers consist of the header name, +followed by a colon, a space, the value, and a newline. There must be +one, and only one, `Name' header for a test case. There may be zero or +more link headers. The `Link' header consists of whitespace-separated +attribute pairs. A link header with an empty string as a value +indicates an empty but present link tag. The attribute pairs are `=' +separated and not quoted. + +Optional Links and attributes have a trailing `*'. A compilant +implementation may produce this as output or may not. A compliant +implementation will not produce any output that is absent from this +file. + + +Name: No link tag at all + + + + + + + +Name: Link element first + + + + +Name: Link inside HTML, not head + + + + + +Name: Link inside head, not html + + + + + +Name: Link inside html, after head + + + + + + + +Name: Link inside html, before head + + + + + + +Name: Link before html and head + + + + + + +Name: Link after html document with head + + + + + + + + +Name: Link inside html inside head, inside another html + + + + + + + +Name: Link inside html inside head + + + + + + +Name: link inside body inside head inside html + + + + + + + +Name: Link inside head inside head inside html + + + + + + + +Name: Link inside script inside head inside html + + + + + + +Name: Link inside comment inside head inside html + + + + + + +Name: Link inside of head after short head + + + + + + + +Name: Plain vanilla +Link: + + + + + + +Name: Ignore tags in the namespace +Link*: + + + + + + + + +Name: Short link tag +Link: + + + + + + +Name: Spaces in the HTML tag +Link: + + + + + + +Name: Spaces in the head tag +Link: + + + + + + +Name: Spaces in the link tag +Link: + + + + + + +Name: No whitespace +Link: + + + + +Name: Closed head tag +Link: + + + + + + + +Name: One good, one bad (after close head) +Link: + + + + + + + + +Name: One good, one bad (after open body) +Link: + + + + + + + + +Name: ill formed (missing close head) +Link: + + + + + + + +Name: Ill formed (no close head, link after ) +Link: + + + + + + + + +Name: Ignore random tags inside of html +Link: + + + + + +<link> + + +Name: case-folding +Link*: + +<HtMl> +<hEaD> +<LiNk> + + +Name: unexpected tags +Link: + +<butternut> +<html> +<summer> +<head> +<turban> +<link> + + +Name: un-closed script tags +Link*: + +<html> +<head> +<script> +<link> + + +Name: un-closed script tags (no whitespace) +Link*: + +<html><head><script><link> + + +Name: un-closed comment +Link*: + +<html> +<head> +<!-- +<link> + + +Name: un-closed CDATA +Link*: + +<html> +<head> +<![CDATA[ +<link> + + +Name: cdata-like +Link*: + +<html> +<head> +<![ACORN[ +<link> +]]> + + +Name: comment close only +Link: + +<html> +<head> +<link> +--> + + +Name: Vanilla, two links +Link: +Link: + +<html> +<head> +<link> +<link> + + +Name: extra tag, two links +Link: +Link: + +<html> +<gold nugget> +<head> +<link> +<link> + + +Name: case-fold, body ends, two links +Link: +Link*: + +<html> +<head> +<link> +<LiNk> +<body> +<link> + + +Name: simple, non-quoted rel +Link: rel=openid.server + +<html><head><link rel=openid.server> + + +Name: short tag has rel +Link: rel=openid.server + +<html><head><link rel=openid.server/> + + +Name: short tag w/space has rel +Link: rel=openid.server + +<html><head><link rel=openid.server /> + + +Name: extra non-attribute, has rel +Link: rel=openid.server hubbard*=hubbard + +<html><head><link hubbard rel=openid.server> + + +Name: non-attr, has rel, short +Link: rel=openid.server hubbard*=hubbard + +<html><head><link hubbard rel=openid.server/> + + +Name: non-attr, has rel, short, space +Link: rel=openid.server hubbard*=hubbard + +<html><head><link hubbard rel=openid.server /> + + +Name: misplaced slash has rel +Link: rel=openid.server + +<html><head><link / rel=openid.server> + + +Name: quoted rel +Link: rel=openid.server + +<html><head><link rel="openid.server"> + + +Name: single-quoted rel +Link: rel=openid.server + +<html><head><link rel='openid.server'> + + +Name: two links w/ rel +Link: x=y +Link: a=b + +<html><head><link x=y><link a=b> + + +Name: non-entity +Link: x=&y + +<html><head><link x=&y> + + +Name: quoted non-entity +Link: x=&y + +<html><head><link x="&y"> + + +Name: quoted entity +Link: x=& + +<html><head><link x="&"> + + +Name: entity not processed +Link: x= + +<html><head><link x=""> + + +Name: < +Link: x=< + +<html><head><link x="<"> + + +Name: > +Link: x=> + +<html><head><link x=">"> + + +Name: " +Link: x=" + +<html><head><link x="""> + + +Name: &" +Link: x=&" + +<html><head><link x="&""> + + +Name: mixed entity and non-entity +Link: x=&"…> + +<html><head><link x="&"…>"> + + +Name: mixed entity and non-entity (w/normal chars) +Link: x=x&"…>x + +<html><head><link x="x&"…>x"> + + +Name: broken tags +Link*: x=y +Link*: x=y< + +<html><head><link x=y<> + + +Name: missing close pointy +Link*: x=y +Link*: x=y<link z=y +Link*: z=y + +<html><head><link x=y<link z=y /> + + +Name: missing attribute value +Link: x=y y*=y +Link: x=y + +<html><head><link x=y y=><link x=y /> + + +Name: Missing close pointy (no following) +Link*: x=y + +<html><head><link x=y + + +Name: Should be quoted +Link*: x=< + +<html><head><link x="<"> + + +Name: Should be quoted (2) +Link*: x=> +Link*: x=x + +<html><head><link x=">"> + + +Name: Repeated attribute +Link: x=y + +<html><head><link x=z x=y> + + +Name: Repeated attribute (2) +Link: x=y + +<html><head><link x=y x=y> + + +Name: Two attributes +Link: x=y y=z + +<html><head><link x=y y=z> + + +Name: Well-formed link rel="openid.server" +Link: rel=openid.server href=http://www.myopenid.com/server + +<html> + <head> + <link rel="openid.server" + href="http://www.myopenid.com/server" /> + </head> +</html> + + +Name: Well-formed link rel="openid.server" and "openid.delegate" +Link: rel=openid.server href=http://www.myopenid.com/server +Link: rel=openid.delegate href=http://example.myopenid.com/ + +<html><head><link rel="openid.server" + href="http://www.myopenid.com/server" /> + <link rel="openid.delegate" href="http://example.myopenid.com/" /> +</head></html> + + +Name: from brian's livejournal page +Link: rel=stylesheet href=http://www.livejournal.com/~serotta/res/319998/stylesheet?1130478711 type=text/css +Link: rel=openid.server href=http://www.livejournal.com/openid/server.bml + +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" + "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <link rel="stylesheet" + href="http://www.livejournal.com/~serotta/res/319998/stylesheet?1130478711" + type="text/css" /> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> + <meta name="foaf:maker" + content="foaf:mbox_sha1sum '12f8abdacb5b1a806711e23249da592c0d316260'" /> + <meta name="robots" content="noindex, nofollow, noarchive" /> + <meta name="googlebot" content="nosnippet" /> + <link rel="openid.server" + href="http://www.livejournal.com/openid/server.bml" /> + <title>Brian + + + +Name: non-ascii (Latin-1 or UTF8) +Link: x=® + + + + diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/n2b64 b/vendor/gems/ruby-openid-2.1.2/test/data/n2b64 new file mode 100644 index 00000000..b12a2460 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/n2b64 @@ -0,0 +1,650 @@ +AA== 0 +AQ== 1 +Ag== 2 +Aw== 3 +BA== 4 +BQ== 5 +Bg== 6 +Bw== 7 +CA== 8 +CQ== 9 +Cg== 10 +Cw== 11 +DA== 12 +DQ== 13 +Dg== 14 +Dw== 15 +EA== 16 +EQ== 17 +Eg== 18 +Ew== 19 +FA== 20 +FQ== 21 +Fg== 22 +Fw== 23 +GA== 24 +GQ== 25 +Gg== 26 +Gw== 27 +HA== 28 +HQ== 29 +Hg== 30 +Hw== 31 +IA== 32 +IQ== 33 +Ig== 34 +Iw== 35 +JA== 36 +JQ== 37 +Jg== 38 +Jw== 39 +KA== 40 +KQ== 41 +Kg== 42 +Kw== 43 +LA== 44 +LQ== 45 +Lg== 46 +Lw== 47 +MA== 48 +MQ== 49 +Mg== 50 +Mw== 51 +NA== 52 +NQ== 53 +Ng== 54 +Nw== 55 +OA== 56 +OQ== 57 +Og== 58 +Ow== 59 +PA== 60 +PQ== 61 +Pg== 62 +Pw== 63 +QA== 64 +QQ== 65 +Qg== 66 +Qw== 67 +RA== 68 +RQ== 69 +Rg== 70 +Rw== 71 +SA== 72 +SQ== 73 +Sg== 74 +Sw== 75 +TA== 76 +TQ== 77 +Tg== 78 +Tw== 79 +UA== 80 +UQ== 81 +Ug== 82 +Uw== 83 +VA== 84 +VQ== 85 +Vg== 86 +Vw== 87 +WA== 88 +WQ== 89 +Wg== 90 +Ww== 91 +XA== 92 +XQ== 93 +Xg== 94 +Xw== 95 +YA== 96 +YQ== 97 +Yg== 98 +Yw== 99 +ZA== 100 +ZQ== 101 +Zg== 102 +Zw== 103 +aA== 104 +aQ== 105 +ag== 106 +aw== 107 +bA== 108 +bQ== 109 +bg== 110 +bw== 111 +cA== 112 +cQ== 113 +cg== 114 +cw== 115 +dA== 116 +dQ== 117 +dg== 118 +dw== 119 +eA== 120 +eQ== 121 +eg== 122 +ew== 123 +fA== 124 +fQ== 125 +fg== 126 +fw== 127 +AIA= 128 +AIE= 129 +AII= 130 +AIM= 131 +AIQ= 132 +AIU= 133 +AIY= 134 +AIc= 135 +AIg= 136 +AIk= 137 +AIo= 138 +AIs= 139 +AIw= 140 +AI0= 141 +AI4= 142 +AI8= 143 +AJA= 144 +AJE= 145 +AJI= 146 +AJM= 147 +AJQ= 148 +AJU= 149 +AJY= 150 +AJc= 151 +AJg= 152 +AJk= 153 +AJo= 154 +AJs= 155 +AJw= 156 +AJ0= 157 +AJ4= 158 +AJ8= 159 +AKA= 160 +AKE= 161 +AKI= 162 +AKM= 163 +AKQ= 164 +AKU= 165 +AKY= 166 +AKc= 167 +AKg= 168 +AKk= 169 +AKo= 170 +AKs= 171 +AKw= 172 +AK0= 173 +AK4= 174 +AK8= 175 +ALA= 176 +ALE= 177 +ALI= 178 +ALM= 179 +ALQ= 180 +ALU= 181 +ALY= 182 +ALc= 183 +ALg= 184 +ALk= 185 +ALo= 186 +ALs= 187 +ALw= 188 +AL0= 189 +AL4= 190 +AL8= 191 +AMA= 192 +AME= 193 +AMI= 194 +AMM= 195 +AMQ= 196 +AMU= 197 +AMY= 198 +AMc= 199 +AMg= 200 +AMk= 201 +AMo= 202 +AMs= 203 +AMw= 204 +AM0= 205 +AM4= 206 +AM8= 207 +ANA= 208 +ANE= 209 +ANI= 210 +ANM= 211 +ANQ= 212 +ANU= 213 +ANY= 214 +ANc= 215 +ANg= 216 +ANk= 217 +ANo= 218 +ANs= 219 +ANw= 220 +AN0= 221 +AN4= 222 +AN8= 223 +AOA= 224 +AOE= 225 +AOI= 226 +AOM= 227 +AOQ= 228 +AOU= 229 +AOY= 230 +AOc= 231 +AOg= 232 +AOk= 233 +AOo= 234 +AOs= 235 +AOw= 236 +AO0= 237 +AO4= 238 +AO8= 239 +APA= 240 +APE= 241 +API= 242 +APM= 243 +APQ= 244 +APU= 245 +APY= 246 +APc= 247 +APg= 248 +APk= 249 +APo= 250 +APs= 251 +APw= 252 +AP0= 253 +AP4= 254 +AP8= 255 +AQA= 256 +AQE= 257 +AQI= 258 +AQM= 259 +AQQ= 260 +AQU= 261 +AQY= 262 +AQc= 263 +AQg= 264 +AQk= 265 +AQo= 266 +AQs= 267 +AQw= 268 +AQ0= 269 +AQ4= 270 +AQ8= 271 +ARA= 272 +ARE= 273 +ARI= 274 +ARM= 275 +ARQ= 276 +ARU= 277 +ARY= 278 +ARc= 279 +ARg= 280 +ARk= 281 +ARo= 282 +ARs= 283 +ARw= 284 +AR0= 285 +AR4= 286 +AR8= 287 +ASA= 288 +ASE= 289 +ASI= 290 +ASM= 291 +ASQ= 292 +ASU= 293 +ASY= 294 +ASc= 295 +ASg= 296 +ASk= 297 +ASo= 298 +ASs= 299 +ASw= 300 +AS0= 301 +AS4= 302 +AS8= 303 +ATA= 304 +ATE= 305 +ATI= 306 +ATM= 307 +ATQ= 308 +ATU= 309 +ATY= 310 +ATc= 311 +ATg= 312 +ATk= 313 +ATo= 314 +ATs= 315 +ATw= 316 +AT0= 317 +AT4= 318 +AT8= 319 +AUA= 320 +AUE= 321 +AUI= 322 +AUM= 323 +AUQ= 324 +AUU= 325 +AUY= 326 +AUc= 327 +AUg= 328 +AUk= 329 +AUo= 330 +AUs= 331 +AUw= 332 +AU0= 333 +AU4= 334 +AU8= 335 +AVA= 336 +AVE= 337 +AVI= 338 +AVM= 339 +AVQ= 340 +AVU= 341 +AVY= 342 +AVc= 343 +AVg= 344 +AVk= 345 +AVo= 346 +AVs= 347 +AVw= 348 +AV0= 349 +AV4= 350 +AV8= 351 +AWA= 352 +AWE= 353 +AWI= 354 +AWM= 355 +AWQ= 356 +AWU= 357 +AWY= 358 +AWc= 359 +AWg= 360 +AWk= 361 +AWo= 362 +AWs= 363 +AWw= 364 +AW0= 365 +AW4= 366 +AW8= 367 +AXA= 368 +AXE= 369 +AXI= 370 +AXM= 371 +AXQ= 372 +AXU= 373 +AXY= 374 +AXc= 375 +AXg= 376 +AXk= 377 +AXo= 378 +AXs= 379 +AXw= 380 +AX0= 381 +AX4= 382 +AX8= 383 +AYA= 384 +AYE= 385 +AYI= 386 +AYM= 387 +AYQ= 388 +AYU= 389 +AYY= 390 +AYc= 391 +AYg= 392 +AYk= 393 +AYo= 394 +AYs= 395 +AYw= 396 +AY0= 397 +AY4= 398 +AY8= 399 +AZA= 400 +AZE= 401 +AZI= 402 +AZM= 403 +AZQ= 404 +AZU= 405 +AZY= 406 +AZc= 407 +AZg= 408 +AZk= 409 +AZo= 410 +AZs= 411 +AZw= 412 +AZ0= 413 +AZ4= 414 +AZ8= 415 +AaA= 416 +AaE= 417 +AaI= 418 +AaM= 419 +AaQ= 420 +AaU= 421 +AaY= 422 +Aac= 423 +Aag= 424 +Aak= 425 +Aao= 426 +Aas= 427 +Aaw= 428 +Aa0= 429 +Aa4= 430 +Aa8= 431 +AbA= 432 +AbE= 433 +AbI= 434 +AbM= 435 +AbQ= 436 +AbU= 437 +AbY= 438 +Abc= 439 +Abg= 440 +Abk= 441 +Abo= 442 +Abs= 443 +Abw= 444 +Ab0= 445 +Ab4= 446 +Ab8= 447 +AcA= 448 +AcE= 449 +AcI= 450 +AcM= 451 +AcQ= 452 +AcU= 453 +AcY= 454 +Acc= 455 +Acg= 456 +Ack= 457 +Aco= 458 +Acs= 459 +Acw= 460 +Ac0= 461 +Ac4= 462 +Ac8= 463 +AdA= 464 +AdE= 465 +AdI= 466 +AdM= 467 +AdQ= 468 +AdU= 469 +AdY= 470 +Adc= 471 +Adg= 472 +Adk= 473 +Ado= 474 +Ads= 475 +Adw= 476 +Ad0= 477 +Ad4= 478 +Ad8= 479 +AeA= 480 +AeE= 481 +AeI= 482 +AeM= 483 +AeQ= 484 +AeU= 485 +AeY= 486 +Aec= 487 +Aeg= 488 +Aek= 489 +Aeo= 490 +Aes= 491 +Aew= 492 +Ae0= 493 +Ae4= 494 +Ae8= 495 +AfA= 496 +AfE= 497 +AfI= 498 +AfM= 499 +AfQ= 500 +AfU= 501 +AfY= 502 +Afc= 503 +Afg= 504 +Afk= 505 +Afo= 506 +Afs= 507 +Afw= 508 +Af0= 509 +Af4= 510 +Af8= 511 +AgA= 512 +ALDs7paJl5xPh6ORH61iDA6pONpV0rTjGiTkLEW2JsVsRKaRiS4AGn2PTR1UZXP0vXAmRXwdSegQgWPUp3Hm3RofRcDh1SykZBLif7ulau1hVO+rhwRyKc7F8F+7LcMf/v+s73eOXUDbbI2r52wfr7skZy/IELhsC8EK6HzhACI3 124241322153253947064453752054205174382289463089695815605736438952932114700118408072544073767229325045596832952652232288773280299665950768731398747700657715829631597019676014848183966683866396215048196276450953653433516126074463193382764063985175903718735372053536664711482497859539116009770850968340298474039 +AOzgU1s6Pd2IkrJlvGND8legXTe50nyDCocI5mwT9rW0YsisY5jaaEOcu51BAq9MmXBPeVX0k/jlXwH4Pn3mCpUAU1rEOsTdcmSJp35siKliDdhTZHHdZNMW+igfXGX5OCsA/BaBcGnE6NnrGWXKyTOoVUGQLEkL2T5yhNUaCT83 166340174936369324883416612727439279977041963320514134445183426741643586944819834936989524033374309932122967866930503619179389342537723598234062828695747850043368572301869699886931403612266216965783079972698791813140295203826980649434652168563255385527187360027803388963151668338040517316899628026707657178935 +AO8hrpw+lDiJ13JahLtCb1RenupQcNd0wlTSck9OLL8wB/x6gAoj0PTLV05eZIbz43N3GUSDmmckjlxdHXiBJ9rsoB0P95l1CWIV+4rXblCqxmOdmlm6VZ13bqbI0x7l0cjeMrkmk+yJ067WqUolqQBlUWMTuJVfkxALJYH5xr/C 167923899524385316022824282304301434707626789716026029252173742527362300338760906999615029022863637963070711762128687835779073122264515776657475985362344360699359591353388569856862973447791264902182048648600267737826849280828116753682917256540180401899752566540869918949003470368970029744573140084219550547906 +QxAn7yrdVs5tlHV+Glbqdaj67c6Ni8am3bBLOL8PV5HbdrLf2xIPmNugo6MfUwFSnT+ZPJ51+VTOsItaNwCFju0Eh1cqyP3JWyLRPE7emKuo6xRhf+5ik0pTg77LEF4JXW6ofDqirpR4alFi0G2d9yImQPphsYJwYGF/nNT8u0Q= 47093316905427544098193936500644355852669366083115552072584429220248776817916430034648347490325490701471113667554329499736495877969341478442613611948220957798780043076906836236556612316544460763366275536846463456405604189392790111985912854476264292503164100482712281088955640964034295834935468665872932715332 +AI9PVzrbJUvmCihwSFans1lBKwudGEZpWWu8pkSK2zVgzGhMvUoGgMp6TG2zsUd1tV8zv7KsVD2t6pXmjT1wPUynufq97GVHI06SGpflDTt30WboYRh3DgYxvso1sOjUXpnDezcaqc2Aiz4nV5MSShkBlyBjA8z2worHDE+uXqw0 100635651531872121827765663065728398779771663753008344681972226973080394359405041113312675686974926993279775427390065833081040771269307007695807025882757371805607979134114890454059957194316765342461291139168706134406917264848659448693866813989352429841300235734400772946895458374870482441457514575059390213172 +FiinVicXOqqRLpxcGTorQpSAGeQ/PfDOuzYK9ViFtmPv6D0cYPfhUH4qXEHOejvmX+0b4lfaX8MWPVZxlqpfXiU9BhG76HJxkLF4ysipukeOvhoHzvcxE5bnhSF1i//bOSifATBLBEZInwqSVg5tHHPuuCkwTL91NqhOulp7Lsk= 15560440884463435471963622630292643727112462888414585143143739400703889930416938984547754943252935620248108237258540176511252143752416771350868493435174026287082706690332705481726295797196444796135827460509780634261726494455068460028424141500629527968240913757449787164107068039175831847071025316475940056777 +aYrxyQN/hkBne2ayqo2/iDLF3DZGgk080SOMJfsj9h3Z1OfFZM7TJA+y+/O7niqatosvKrfHrAw+Qs7c6tCZ6NPwYJ4QJLOF9bqH2u2a3fkI954voNUctlUagYUJsZXV8hdhLM6NwUyIZ3ZFkPcpTZp7nKQQ84tr1a8VjDIT5/o= 74114640794666001532816944350975062126079079113921109750255283189037502412929005615388097912507598112836936032143435813588205939470002911374442844578739574773399427907766548612582213272643279263782396527705126350063372192910060171635870872236876399794128383338399728947176692692942605589343038282957050865658 +AMpCUeKUX/vtRslWiUUuXNl1KA9uDAWjMUkTrdsxxRDESI7iZIn3TR9lW+0kV5fzkLF18iYLAwSGBmX1PS/T0UVFmoBPJ9yS7yktNL0lpQ3noyGFn8HHZ6XB3FkH3jegIfGbvwwhnhhFzpHPrXlpO5iU5Y+rexzp2XHWt4yJGuIL 142031143422642739313498629438991149460874309300342349421794421544918823888598660275343727563280565210534243383322796489809683834300630555650331646026843796764549231159336347965502383849513994449309613369541991287590422095953275586374371960367000083487965487661436037637475372929033613295072397262739084075531 +AIMIQVz0JIEKEI+PREu94m3v9XoiU/Q0CpsSuqkwSSje+Wyul5ea9oU5qgtOpdkMUOW91BJo0DW/GMZ8v3C4qyyP29TtjCcAHObJi9hfLSlnTSuzXZnDStooYYKqzfToLToCaAJKCXiXAVW0vWtapLnyqafrf/KgyGZ5u4HfXKY0 92013973253053602863003242446596060337454881568126916916519869242232429836082762281129448384605359749247852792606718908482332975424967542242332487707042773885428473061056052851768940900752317020681189773407893371297668591494665352294885305475871917069040377145530889271334616499701769138948975263435137525300 +ANfP+zPBTR27afneyac1KJhOB5Pq3AXB+SoAXJvQI/GkSoNhw5KdfqoIkLcoJi8wClCm424Gm1AdrdGwDFOM/iKTSPkrvMag93+b2EbQGX66/n2X3YRFNkgq/Gtb+2M8oCcAL054Z/iiMD67aU5RWzjqS64ePHsn01bJ7dqLgpMO 151548639867177154896951257541227014781655576169318283047778755573323724856619156348444192550664853912434681577093459933599575436686424046466113215132845213008587152894642577278656978304699131916299275797578171518984206145555369576872231567191579337901913492071976578289189524123204040497290426960375042970382 +AK0kHtacLGu1NFWMADq2rG8hpzM4UEYyPOL+aMJbnwXcUYptRIxb0YFZg35RN/RiZs4lQsiq+kEJKzMMV71TsJq59vMkIZhZoB3t8g9ZqBZuq0JYcTICDwRpNSttJidVpJ6P9sR3s1xPMYKdlSwt6EEc9htOXfZU+yHKYgn98X60 121583812047864398969816595368193171848971298823388059338224714026742264861090347096116404814514279627148994345584790617974476594451626305761040465570524035369799925437276511604752129817947910677564301623631349399504187314174538914591944778074509068973226322566160587813128746039859381466427380402262866230964 +W3sZlWW1Aev3x/DiH9MzwCAZzBj++x9cknLfGAHwgFqkLH6vimEH/r8hi85hzlCOG5CjwhoZ0D/Hsfr26ZJ3X4chG84byrfDnek1V9mm1++v+clJvlYgcuVgn2Opsba2TILTm1MDB+Ujs9brJ2AAKrE9+ep5nvtQVeG9PUGtdlo= 64240043913835461386212515483198059541440539167395859777194837833769712010594411295323900074066077107346806786205590345517755715510695858065925747020336398305793661773798243627926904542715123849691490667964262778804487343218972081260210371192903128886030021862362141928329650003493687310970684093289133340250 +FTQRk9/BIj21gbLwI22fHJWYj+8Ghdcc613hOtJ+/hQmh73HwTXLpaGK9aCptxVbpjW0r/bxaRjmgxu9u1CCZh5yRd7Z46Wk/LIPXGd3ycQzqRMFB7TISFQGJIcFoxRp3Eb5wa2OyrUg7c/D+kb7oFJq9P7mEwIh8TpLzwmu4SU= 14889529068556301710329043521845510156960298822469914567758538023025100741826628180855835334285179977296740667353391766487166458692144569279381035582718738461626140662441222061900764829681913534146898551570916312642104487829660946024590782808750587095559047648957238487820069966851521487428624726655438348581 +APYXO6uGvs9qWiEAkcWsaCaCrGJJCP2Z1g++XlJ67oZIgEoWITn3T/R2/c4edAfwUUzNHAYZN1h2dSrRoqlrRXrbxFtGOuRCUrXcGLFFcEbTrtm+z5z8xGRfcorx7Cu3FIBPMK5XcGPcbRZdyP1gBkeDMvuBNAo0/To+LP/dhCNM 172810804474418448604443090732221483571611665465870520701624598983692130272337358406272727413570938793741430131635927237320173996217984860203754686741782921346604605228620148450611724714868551781003004492587584071978757421616871762681049508123223983431502852926521520561941051298696758046005573332373854233420 +AIDNxhnDEe1kTJ3XGfTS8zKXeXPRdw5yifm8j8Ibzj/quExy7hFPtKct8hRskPR2qwTlMiW9Ra8Npg2USsqHV0rBoIkX7E3psxq5LBfp/q00l3SEBuLL4K2FGR87bPgU+Duk3RVrNMnColiTcnAR5XkoeWhn/r9MfJMIN9Y0FEh8 90449107125498302548188660544012777357148118984122992664008792590422284061463729084479315745509706793674355738023180454297730948397413371686013210006834869294564190666543874617716180411178090109573192518129248278410216362657350215009192850017507998797754539132540293137589672869131300859207213449571846080636 +AIRWavxYRsGlH0Yr0DudwrpYtbrByf9ZsDawKom7ubiRfepqYzcBlwt4adMMnkYSaXeYtOsD4KBm2ZvLKN3++RkYNmxgkyarORBEg7ERyiThBj7Ksw57pNHCAoHtBEhH7Wp9mHhuZtPvPgCEptmwCu9rYhLt4zZp+Zq8a02dkXvM 92930601962515884925250459851491509622611227724602941760145671636277317511265759558869239180653492283311584982044597979173761619470326096725838197524704577188104121460089235709339932110663536557497112887112782062772810759971739760085128369628777812332518137107605855679096146402427144185104230596200130247628 +AMNJGLcAiJtL5fUfkesWKYJurdYSnvsOZeZcrg7bemkEVjF6S9CcojimUl+ncr/YY5/EXnU0mg84fObtDxWWdJ7z7l0CFcoALTyEatDYKshT0xvdKY3u+LUShxIAyk8EcGnf+KoEaa4Mx3tg2oTBnVegXClOakNTWw8bu2ItagoQ 137134165107366719462230252606689766470445826753581409513106273517221906418464863733870948759313279128624638614534848890858250894834883265387344539280755177217350585564186248554307335197387734431939154077778003706720017441895613190141376534460438929588407764609772857975000507660651583780079804513519571438096 +BmGPZt8XqqI1PuLN4K1/PZMi2rfOYtHEMrcwZdSjKRm5qTkd0Pbb/5zPV07TnM0uLRvIQYTLloEY+GYyn0K5gDTEZpEtQ8ee6Y87zYGDwcf20eqYNxkA7FVV71vqCP/Uw3Oi6B+hMvsWZbvv2vH6MkAeADCrezOtwqVS+irftyc= 4480956865245875120472829476982311611308898564405318773810939350829150182630548948231116574193987272498161864310429976564278532538229396846813874244969927890037756969704618336242255039858182439641759659872128285423988638335967412040624105824571426792562334458751137508116412821914961236269913776304372561703 +APqFgCIYbJWuRyEGuOStPvcprj2PILQ0JpgwQ2jLKn3DvkWSd83qh7PWGKozGavsjh803K+ZzI7P2wP+Nc0r0El3q4nzaHvKaCtVRyMwbXv9wYLFZICeM6J1l9ljUMts4tbDoPzkIy3ScU7pYxarBWqMkcBU8qL6NN1vEdkeu0fW 175922170410080716883576123079908758276229469783745771772401183721225804343343063277676406040455068452258961299511343441961963941297631097736305638850193978800615558067791016294285848963023036905095022181004058235239390870177623185946205281141386416867569004073524130001309977475780893497185890756991672600534 +APA/rCcGeH6A+6ZwaBBDM6mB6tTD8mjkrOWEo/pK3MCZ+rrErMBnFp2S19GhlLOfuY8BHS+D834Fdm8+3wKYkWnXZpGb+e3v8ofOQ34G1HvzULOYtrEiC4ISZRt2SSyz2hU+PBXjVnplsHWTRxZDmBxTJdgli4ItAqxGCxj/aJ9m 168708388929747822981923386197903561880341990893945097067702518857172133291360611402092714329372304718329568897960770488377524912057166920574319430820488930520807742026377043178502591886293565177404635365772829346030773275726024973460121300339258054215286249329967181244588558220467488638468686270735376228198 +AKmwrLP108dCGWOWxE/6woJVLRi/Kra/DvdsPkkrZQmWIlUT7IvwM4gU6bUr4f6wpT08cIQls2cGh7dbSEaO0xLa3mmtKhPiAlzSnz0wuifF3JT9U3uXgUfCZuFtE0z7Oi7WTOrpl3k3GA7JFvXnY0lwblIQALVf6oWyNETnajGl 119160465301384937485959146028591622947513292915838943629387700439301197965652871741710280647524383590817798553034250156068573474278225305190573334054718387045488098320076877626430189054572361967283632592181431701411266656256255758079114072932140551282607247364388070762970060420036793573956057551235306893733 +VTe3rCzAL1Sljo3QAXEkAdBy1ZARHZwtrj6ZNRa5ttqd6/l21g4z3iHCeGo4rnE2F8wYTy+NlugjXw86OS+XojW5y6UzTtx0HX5IJ4POqN64aXWmaklGzroBEYWeuFFKcgQN3NOxkuJoDQ6VElP7Epz69kj5CsKJUwL0SjbNrFY= 59841866347633473702601462509811342285929528424012250265905695635971518533504187799047710303717472950129869674786231155102509311322791323986824635569605105662070745033595366004805920086888891275288347907772640070278731650628917037915863439204501060041944275512863990729926528905725569467329169134226609384534 +AIZt1xGhC/HrvpPASsvVIVdsu//tn0noyJmVYh3FdQ6yIh1uce47iCsrV1yvYqx5ZTbC0vnfnbjFcWqH+HtLX/DelgvhEwzqJ8hwQrfE1ShLG4ZjAVo1Z4GCjrDcEUMlwKcunuSJssuxeQuXwTLS92+q6QeBSS7OmfxPX29CLb4B 94399298271083745508290936113986978382457275531684761701599029877008571741877683365769553170771833981099580359640421358853566501815723434822307977440496208486103754978934472597505865596938563438311337045817621762649604204720249750058676095769230214181772215323235427976398686727606000594646472236822594174465 +NIhTPpWXS82VTA0LTd6TfM+HgLgUcmvnMYtLqPpuqCKZwalAycwl0XFYNyVvaY21J94j92ts/lRYgVtHDhk7/9nLXq5js/lsUnG8rWPHJo11JTxvW+df88aX0pw8u+biOWt87vc1MW1dsMTTsJFJAeBx77qU/Cwto95IVqM7vSE= 36889590210230649939994518345793530042252563793069578097360569338647730438860274349862767107939590441616825589851005429465345268710487649366046960918184701290985280638488938340668212498212581853679035928093386035688597446809895381618260692378376844452061580510108168030682664507293277674052032318576713776417 +KXdi4A2Z7tSiiX9YGtDtxUXIfQvPhcc48rUH+Q2SnXL7fLNmr+F4Rf3RiFBRiHKocPfE94pothop5qQJ5X221/DbEKWK6s+ChfQ636jvRxojoLMab3dPtaAPpDJHrfZMxbT4ZaDJT0tpA2e+zZrzBuDs+UUgCpty9nxtdm1gS7A= 29118662951481660380477444121362422614202367719725087486810943918529894738076273660245405874301505615796632229852040910511025841576465052938308369421493312085081188509808322692130449282585522349552501983296872614029139293444558468751646868108213623606366977549477663987815308260383403466635254115908032940976 +AIOTBZQR2EJJRmoWdRNFLG4fceoS3KnRTHRpPdllhHODqdg+QxTOcOvqIzBqgdD0JgO12SuNAjLQOiz0jhd02qkXw9Y1adGuKvL97ARFtNEuJiNzFAj7KpDLy2zk2rPJp4Lp7cjQs0fe8BQYnTzTsNRGm+4ybln/gse1YWu9w8y5 92394618277596007469808288231093678404089765494062813665106014405059399079199990128824492247005602685377185496959522609467906358619318009231448503013528692450191782140091818984176967246749464502089280153086163239846744554575017530385347720563798041108608545014076448155956762636929707905789978331102411214009 +NzfbJRBF4pqEeborJrjoknJgpfK+DZh2k9cE5dcElMPZ2Zn9im7desWGiBSQnu3KbTO4L/t4+m6nFTNcbIJnqbVSMDHdsfG72rG/t89aOuECQw0HMVVgONNNa6i/mw0jZSWnRLD4fa1YgbUlMd8jeqO9XcBDB4mVtDTxyeGa3vU= 38775530011374537813502898274019389132620116890266344603221997943675706375698597061571989090674289834838060050848545748579361837989319487970580969082824601965845786771062335733318139530316825802589479118956745739691326447349403950997231306042638797277408335778415717988679050762936401945487285814799382535925 +Y4BVPZ6necuLSwaqYEPeZp0lt9tTGFl/WCJJbwg7XpyvuwYKtzagC1NLzY5ymBfwGFw1yRlQuyGsYd9mBfC99DuVCIeh0JNrhJN1bNfoSzy5UO5+dmTr+dm66VGSRS0tFcViDTfCIleTV+zxo/xuZT+Bjxq7kZue8zGkjp42Kmo= 69872189501616471647606976308259279995249122669120675885925763529037695584466011511740991152346215507625265226811128801733353566555339153627478941716586678793853828514394269931890370517258825006937741437480128878717892485074131232336852490940507703859793477547154689914725314529986438108117871674332626168426 +AKCP9Mto4q/a2xNqM4N7PekbKspwt48OGPre+iqVwPrSP/jWKxg3CvvLNZzN5P+/FiUGIklMMFJ8w76OaHIPqKuwckj1gvCLECJEE+UAZWrNKPmpzd/ootN9/kQhNMuloTFCyhXAUUOXJ7Z0WVLb2u6fn4zroszSMBoWQEKC6lcq 112750701794692134675959811050012620191158543234019977304167102486465198271340022889272244811582365901584420008564301920174477182946432553537794834985703732129975734658113610563794129371053853971031300761815004524681756388784922001759202643614966614186697992611399618828963452661554240362943588548146868410154 +APOTAFA2waoAODECaGNgCHa8dNN+cjMnD01M+IeQFytzo9RLMzzzg/gpTUFpyLtFMcfbCkDYQMLXwE4crTimdz5sVvjGQ+5fSFQjoDY6Bw7MO6NAcLzlV/sI/1WyNBKaLQbcl2720n16tdUcdckQNnV+cC2J48CVxYM1c7QQlxA0 171043636512232272455501595416608280460445723238023572475354665686544174728784633443479486247342724860289312593374524429736857970220153680852977711594899595712511352458264354251161579203922747468321999465061463474727943140910084880926005209538535217464825087114791420210981711903880998556269523363208766099508 +AMGpxRlB8WVnsGqyyiy3/mzrPymtJW1o1HcDErK11ZwQV5PwTF3c0THwlnxDmcziLWHSWgPQwfRddVDCXMGW9BffJn+XO6aTcWDPmDAh+1DbWJPE1aqApGbHvQ8HONy90dQMZf1ayuwceWCVTuU1wnHdo9F/sIsRbuu7ic2OJDzY 135994898408425255747055209966103741651849229328236418804928584233229830656742052333413774490626915784901255640138520158698845938184666683995579777154437927013722740366497459963753542029774185193376253885864514386760437194444013834088425088260658670140534670789371556026135595577395047002643901630053097946328 +AJAw4uDYdSYkOrjtwJVWLv3pi1+UxWge4RmkWKqVquTsAVcT2tRZ+MFdHM457Hl7fmFIyxvGZQy4c2v1AbHEfPR8ID2sCRQpdcfrxEUZPMDqxfnHHm0ziny6W4X6ggdBzMp/sBWaVNTBL0e61/pELBGYNRGFMzGws7HQkr/sro1D 101254336834199527040756567675327011562230719161388328289463594628690618298993695452746353237675715087353241661592074446889034411683413957950360025295995263477031608845241728493807755308798509893719674568267846671753070163272328014412744008880395248474446310603301447848026040555910147467745595720879397834051 +AM09TdtXgYL4FI5CGNiVjf0T/AN/pZ5zZsBOi1MAUKMURiXnc1x8VKYTqM9Xb86mqNBBqphynIQG6/3e/YbGJgHlsSdrmKbo+P9daMr02I/7Z76/7Osa8+7Ky6lhVCbU3F0tBH4WvopkCQmuJ267afgvDD5kB+9uNr28deMH00cY 144124056591600568767398029380314564902309327093641173350205276895603332085753288682409279238417493662029954512382520307259348748813767324609446500382301421328754981718014234615523158887865271179104711373675849713359713282937065993613915015084108700238420759344034475478243507306107546245540340758766909867800 +AKDhK+/BKGXbrbBh2vM61OP8LN81YwlJKe68KNwUu4tjXlQg7i49Jis7QKPI/YFPUpSNTu5N2iCgeMnCX4+r3NAfivOao9lw4N3nc9bi839SIWdlokhwBHBYmCIgjehUeBAdkU4jKqlE06pIrpRmSvBtn7O4aWTbT+C++ViYAcGF 112973480670453665543892521898882856059335781900313607790238402438320486344365203510769919022496690291280873287383392088872774202832124927485754495093552572232234532821756395965072330282810574669371524103814871172318519695921477775100282448247625395376072233777533359104085023946019406729587713120941266551173 +ALxDiSxHjfxvP8ETvpE+SyDPTS7q3o3zCK519WTepygC58KSRfvDnIVIyV3toQKzgqD50kF1Ni5D/wuaSs62y3zg3kELX1g+WuBCc8+x50+kDtbHXa1Me3et/OqVS/QeppkcjK1UZMU29fXze6P/w6aQfvKQkE7koeQtZBKkYc0p 132203344567902304830160099595561253300484092355345272411265169562971473393256361094745618829297250316196312398486598077249124198329075791740755862221465178128527292695331061023291345396067863215552021206609309872689233899464919108147533679134727064586730810633196817136739658243232643507412032417747255282985 +VF0YUTvy8Mfi5o6X06DEvLm87r72mAtTdyyLNr0/GXlk0Xj3L2Oi2bVUMtcXQNRXg/mkdGP88pgdaP/eMzqkUU++vJ7t3UgOC1i3SHegpiBhhZh+aZHH/wjFV8Mz2XZB5z8MpMgN+QwALK1TT2Pyt/feQTsOy0imVanB5+OvCeQ= 59242171319056188000481457618922567543461456096441095927600135114274111606802456239311634638536207588762066940095527920532936960549439269891703098017342732142860571277442598349453761561189719823290643146391349978698217357430495238876700400634593256155537598291759795109752990651995982467695091946768443574756 +ezpwBt0N6QhTusiPcKrBvSB6yuk/KShTLUFQHdf5J1u1fgDYrp+aOWuXOFVfOd0bweiG4UxBQNXB2IDFWfYON0fBoaDqNk/41YyqXBSkKbiNWLi1y3zPmwTAiwK0PzYp2EPfk/t/j0HsDbvebu0ygcxb2tPqj4EQ1TXEdD007kU= 86533835313999945727720083706940213467453975054116752898416709637030456504024135513972566184073843025739226187558143854850980654667596935003124034699919861200483994576288766702308068265526535622439762454501169018136389983894783905946543636163866717367545972667876983557989192393479830223914708619684891389509 +U8BT26zT46tTZnkmTNxGUAlXbJhk5cNi4AMSd8fSvZHm55siMFGJ8Jl7mtdzEFR1UFAyEztf2fUhxdtMLe8ei/OJgM0j7myQ9STucEwnsShT7QS/DjBmfvcC42sl1CRpXkb0ZLrEJCPf+crtLKGrG7ExS1oawIAgALBiMQIL6mE= 58812148564290791415180898639607206220554150794356494356250223429674091688305329629529905854147200457536549527135776329004085047145097927266797668252160196098870200925284256433894773392353678965699083286106628662506590268955650280670838340651598082083455821825076016227525614626726458235627297885815646710369 +HfYii3U1SIkBZl09RHaGGA7H3np+qxyNeeCNY07PDl8LwZAaaYk/bHPeBVboan0I2X4o78zCD/gFXFBJ4rxwwUsVjHEioyO2JcpV2/oDOelJBD//78WzBMMSWt7ZKbJV9uYr9ZUM0BUD3fsk1esFCEdnDJdr86U0UMmiig2R+ME= 21039655953870571289679214995029926285040274249531458675115179004718812090027267801012507748013357317597416722235988917212676802092082137617336199787762782958420742299451435320649616271885264333948336627286638368859041172783505464468640994920853000441536629081040963398001710173320125308624362209157720438977 +AICOlee3daFyqTrTdtWjVb5M2rclh9BpIo1CRvKo2bF7NYcjrU0/VvbOnTVXDwdeGMLupbi76f0BrfDxYtkzMXvIZlgoTit4g5ennnklDHFBC5cogaGlri8U28w4/h5oMunZ1O4ezdpRgVJe9nTP/sSEMYiNS5IA7Zshdvm/XccF 90275777798511290102824338787811725003177532250296755103300529948194832904403489332420505850668003332750291879153080212231952155092379375422537931240723308384652734942204313672973885652497290433943089371705605128843469306776615573873479312715317072986990219294942040272550822460408702072075001377245051602693 +L0QUSVIjxvE201b1ztRZyOOxy8vkUz6626TH4tbLwXjjc+AhmrvplaVlavnOgHqve+/L18XNuAYP4BqdxIcWTx+yxBKm4ZS92dRJdcAtccvZpEJtYjdJvI6qbL5Ph6HluaVZwp4dyFyXuZOJGTfYdTb7PUWM0jNT/xsqyjxSQ2U= 33191267986826803728285073844005357792766429917696698533494382218509532051029343127452480789088572904364699220151221680328978554239767633887572649589456766209242252549993823283929686430100804479376247660556781589549613316880150951333982646510273364068770923588389668733632648346075516618646974067295703417701 +APlD9ECKJuACUmQUsbd2GTOpb2PgQVT08C/5hyNEVdA5bWoICX7epmoCKCybdolk+cfEBP6fSz33j+Vn8MbeiHBLdmF6ETbmcyOjldJ902MDvU8dqAa8IgEZN5Uh5x/xzN+3dqk9o0ji7yi291u90rpfIh85PPpDat2B4l5zs9i5 175040148659257809883308984693597046378367187659749953472629929701758633206586720399909808941145946314755491399962797299295431089674294356220216615950668954164397362123668926410543898553191541662075745481299747832013627018846822876386760538344447600390187421938699064459451308870669878673306013635576901916857 +KB7N0tE+A5vFhyrd/m6Qe1wTihkjqmBn+rinfmMAzRlvtxIBSyDLzQsOQs7L4oTG64ABU+YwcWVijvoeZNamaxGl4hatAH1pRqmC/r8FMvC4vqiFTbFHzQhkjM7uoHD1aKnxyBVgjMj0E0KZjrRxydZjIR2p13FXjLP3UQSFtII= 28173452509830313810392326357601136401754938805266458365469366750775669869895498658593356375710132149836430968810246171974040975430205200958564616924399794768861923079158311829444850822144940112488994119845741191519421434257276977333662656888696213514226866147767570046232093727585815615828360199830275208322 +bxFgV7eXwnbQScl4VzS3RTdcMW+NY6pcGkT1UsqHIeDVyBb8DnH/2/Z+DX3zniR1iW6FPdvhJJeQyPIax1ohILa11R27C1TLxGvTrRBGUycxjEcBIxamHveBsXbECWusYLEakeSDg9x4BTWMz1rTQajkorBoeEjYuW+xBxQtXME= 77994515143740690952370766995249847650881300682406161400195705464876513409097078624084133111941171517535435606295232558665316819077765607639545069239931096306624817379462598756505457054433358548941076472902905065316335603665413114267741896000877284610377452471067725794013283338924419969559537339967562669249 +AOH6E2eBzD76QdTJ6QbR/7OeF7AagUif9pEYx7fMqrIsXCJKKpLV/RHIItCDYP2WO4URCaVueoAJe3M/Shj4o6efvH9pf5Q8MLM0rn5MTHWhThivqYQDwjCp1ZsPgq1VFS+gcnmwgHhj2W7XzJxiNPeRXlxI2vL+XTT/wPBYhqEP 158686346608862569574095184731081143351413141116869402750758091813874232272198082464382169470744476593016502816563462778075467588097653320101723165887488327616477297401486647183409348122990505635004320879840358339260797834264972100385692477324858942142372580281421734058008608134075577990829273447077276721423 +ANDDgNXOB/rXwmS4KEjiHj7RCDocVrMv5SU0aw6AJzNTBfseFngqidXx2AJKOEeG7RDDN2gzn4K4qJktF0AIPG2JbELlLUu0MFlpOLxamp586qyp67Cl9OuPq3UZTyQhIsSIE3VQkvxuQkGsaV1owDV3BKIWQbQEqMQI3yT4ELHm 146598844784260148346676185962272439320781765598895126402049215152385925250917998794921584290777625240122575975327405909800121511343265147922400813488099624745229653124857224399973509428158163452130086943873214460600035260925149630502192183407327427517292065083168010281295559088633086659209316582810260124134 +Vprr6oBnWuxIzyTZjuxlKSdZhBc0upeNBHVIlXpQEnN1Q+XURKzp4/6Vg/koITftr3SMSgGpE7LkrERMGFgYaqM5XZ1RXYFKT9dRJnz9VRDITVZtdkDrU04bqo2Ur+jvZhvg/oHBDTgQ4nPLJfHO3+GEmUtck+g/wOVozMMgufY= 60816213163057201559480662231646403262735082707152897397414589876256824040344252799972529759737904461369360580708093117244392116003622336721789703580184437841209963565058475060017600871779929808204093448248984201640754565635410002090180110910120481044515630478472999135146756643143415057403006410330361346550 +do4LGsm0afQLHl9alWF2RVyEKPxLIErsf4pTPgScRE7ZiTSVErbCDeyzd/KHzhBLQs/DhHHcw+OXj541cIRm6jaLVKiT8EwLW/dVG0AkVli83sFh2f56Kk+bCGSKvfGEQcGLY2k7nQ06zoMlYR/xbZCka6Q6kSq4YBDQgigQ1lU= 83252051731120517035090523892596419800592471447735288551342681962005778435125655090199060145942826521644585427683714084736143440310518046334877897672493531918539106001203807757254797471481884534543367685912500572052457610702790097953420236852480969038388056545966568595395722585797418296411673622376893961813 +OL2Qoj4xkqRrQmuuLwrABG3BMMBNGjfBtVBNTdBf7g027Ghkk/z3aK3jKT1EPpdiOdn8zXYBSO1mTRGyK3n7Jo8ICOcnlBOF6cZtDsb9bvSVE26MOD2wzl6irU7vzS+s3vGBkN3AazrxPD4czk3xezA9y13DJVnNzgAgIQHEols= 39844525812817530522650122383059885756573694015271773938493414420875846359054562126060762455794481186614035892021706051863945033061233991184379580556219478200155757966121832613842937722944431875100059046588723473670448006803481527981834627086055642349130254917244469014754132003347635357123155857820000494171 +Ljgn+3Hcg5DOf6usRumk7P+ZrdTBRmo968HdZU1mS7LwLW3Hii2KNkwMV7J77zA0P1pnvhMSEEeh1RbCUjLtSIbt3RIcOEoc+aO0eINF8r99l83xF57CBI3MDA3AAbtaYATy/NUXSC2h4W5kdsQuR88139MFi5y8E5njqxHu3UI= 32456338403763561215581247445990611953939298888251578685087656354454727113846722731945605696397627662593375001096230320486703167389461057538581895745078593206660798580358701927596287363374862536765135996838944212622199018632046955402325290145163082309469649329852148345837780541107029165352782710901375425858 +AMt5/u+ZUNm+Xsucr4RQPUu6ExAOq/Jbcjm/Kb2YIAaEQ1czIL82wsu6YmpHcfMaxLjY+EnaaF+eCWQPeGd1av919+QFbQPeh5DT7ZT9klK7BFyVsN0nEDJQ3AMMJqq6lm4sUeVxDVTmMypYnkzRl7jqzyCRY1MHA+o2LyMECdOg 142886089970163885609957244378225169093559131065687633458877059657380607541767850701139140472705242750285722732461954100519608059127637509286558848391554697942686619832870045594188204522385787253648018847569919409782188708374165437385572046835539379151066214153911415525465041951116179326632238059135825466272 +AMvXeHCaa+zk5VdB27KoS8XpjSUngaw7Gwlq6e2RrkEOxBhU2rGWGJ3fhq1HBNRxDf0quqfYTMd1speisaEr3cIyx9BhYwB6A+Nex/Sf9DSixezhcgEz6c5CfwUYP0QTTOiZDqzz+GcjKikjN7DKJTO0WSXMRG8qX8FBbH0rlc9l 143142496664357119491819741364830737485524654099662921673419335301323845847085335210884201567922636945282124120681371777665458057821603161276185071778040317947168899788341482064834489328957963447735297898161379277478278414388733161844053774747425459239004132791029364174047523473372650441001639174571312926565 +AMxoMXHfE2i4khsAkv/lPtLQhbWUjP3kxYmlJkpacpicBB6z/TmG5zjmTC/sqzBvBn3J4UvMzKYFyk9/l7Wnuc480500a3S4HRVtMtirPueV8v/SPktL67eN2zoj1VZA/Rex0aRGjW2CzEKGwEn3G2bZSgdT8hKv7AypF69ppjz6 143539479941314279463880342636704987025205547180882175105616955926182352311179043850344463145750154442573797875223178075233807385237935671604701513551125937539235111702655902037518920150424691586943553275517626347557879039695678271564616114192941679606063184290901862703975921261779714258077775731727612132602 +ODvOKg7l9RCn5CePG1FfMitkR5l9+7JK67eU+WeA5p1YXCcKS8GbYAKCtXPD2QfxmQcrNYfAc6Yb/kksaq29oW7MzZuTDzK0HXY5xBc/fJzEuvU51gaI0PR3cuU1qRlLqwmIlyt16gto+2E64BgPgIKJcAjx+TfH/EqNeJ77/W4= 39488587053253042573878502921384752550143716864908041972426777545317969264945056510991363961916339225192727727267483337259701961148978214005913510275048195308792987888118270387288989623193626554910652030960235845935461155296845475356011099372367616732243132816329531758943935324760665826550992788664237161838 +AKkznyQtB+PGvbVroM5nUIzhJUjiNj7q4fC9sSFbmDgvehnwPElVlie6PimH2FKonGV4GSaxZ+osil+9omfkb4rO3pq8fy5KcFSw/gs09X/U2eEEcUt/4oSbjs2NaMIxQftM2CauULiwfkWdkMFTBkHnh7Bbyocc8dtmrBDdoI8a 118817437232756222334188081193205110010964766506378146125932730686679941224328135190204402802650523704343176483564284220367074983943319572348376466341132480772885833789613392397284313483009178508647973749522358005819092779831781339778163122774381387989185969990310049504391258988402795259963134610905036263194 +AJfwWA7XnYbTjlJt+9hO/Q/OubHkUkyMYrN6Jd0cN5MG9Rg8W3i8U6oJxT18p4XozkiOgPlF1lE7hIAW9KRKJKGTue+iw0okLq5UNMu2Ha6l5/wzKi0QzRVTBnQm2zjPlQpgUorBBty5mcbt/B/Y3vOE4I3iVXklVtjQ7zIBHaNK 106695084438708194568048926154027115609888551145480521213711726807296356271397749432698558860759334362315257102647885062353922543502466463770991058956633500180245599467233361812610650830611712448187310827443315947425061886163301613989593906515923245020641415290300558869209909418659128196109640872398602216266 +aCXItk5XhuNrbrqJr1Qm04U4y4AzSKDMms11PgVcdf5fCGdizibh6/oZqx5OitM26nRz2vob8F+ZIP0CIyIJU0T1M50dVTbbpwuVNdv/XI6gHekQt0d2g34x1TQJIcsT1VWwGWTPNMtht1hezBAYxwv105AGKnqdLiz04YAdEk0= 73134927546833985031652237686088635686032103401394612286045377544136784429757461671691980910279873140130943470029643791712859175007885735170485461366406852784845528918253441791024065848540598601036357817496637108534035807393364939272891745520961269029038360205258229770737579266643408540634722493263322616397 +APNeoaWlyNa554OtHP8F7GAY5V9F7LMoF2ssg5wBmsgGFktrRH1C4FdyD0COrzIb0Vcko1/HiTnA9JXlfGKc3gTHEnO0gxBSDjK41L+EIgUfR0EhAD9iftTaCoBM7qZN3R1MYrSz3sevQZNMFOOnRrzwWEXnJaPKAZXvsqPzOIF9 170899982929163229592439208307232242235219591108657660041403142612622997092685093132858257827585941687488772925553142105567685213341947938835403410054637382864108739466539574004149772568683507025358331323655651148107044968424043673850583150424463706583215452211942132017052425497789362680979074312857823248765 +ALhwBfBYpOk1pfJcNut0C2fEAd4hhYU03/ZQBqVe/7MgpEDjro7oMvSdba5kjH/VBssmZVqpvuZ5lG+vI9lXLukhwRKJg7m67HG8lZXvjDmjU/PCjxBPNt5r8/DziETYmMa+fhaMTw4hedZcwDe37t1VPIflvM94sBKu6be9yJAn 129516480651398210587505113546142851617282590236388547627336279692965778911450075230961856270046942312918567973875005814982283590898552829322178788678196583244198944578081007477482775130405341039067711963061287597331433268366003672643052056973656674139309732186091974604170508497340243515339072325943686631463 +c9vpoiZvtnj71b8XguD67WayOF57QgOX4V4L++nG2u/RY9VT2+0tJ/C4NIawVa7ScQZAPVLuhV4J50HJX7FZgtY5n+lwMzNo0av7i0IqTS+1BBO8eNJy2wkCbWWBxNybuNnF6OK7eXdPb2Mmwm2OmhN2/j7HAr0cD7rK/Hnif7I= 81358980280155473712258342299472964374474635149963153129588784719499494479288254287754874893180126149146558961101860327826747785201363745989346818037655063262173536227595206355647880155693272153902647256175878517626925488264893732295267833614283963802283320574654949992393798458265266551024756663538388467634 +APArEXNLzDydcHrieLDReJryWxFzcsN1dxjpJIVGeJp6itsJOrUtnmXVnETtaZhWsmN3/Zh0R7TgJ253f7PZ/Z2xCEdqF0hs2MmnERSywdWZQ0a0McbDUUaDjBNYFht1wvS6djbI1b8RfayrnEZ0miYdzrrP1ntU+5cM1QBAvj6T 168651870043094856205824264282870999215855903395882323164614939540734011037112413507417141209480771157672307388419164831992909066097194364645695794831939514470650008210390333649278806163193463937050083854756730458780288720541495880958909249273048328511615821480782977316719631334570687241232556472064072892051 +RhGyx6xibf0OvY1XjnmX5na3G7emG8PWbvEa1kIjR6pK6K1MrMZnxFefXpHWInFS7ADESNI9LHjZB8VW5QrjRVPMksgdEAlkhY7MyQxaclUlShFl2AfKYBfIIro+vg7mUMzMctD+07BLk+jejRHtPVIxHmNnZrZYds80ve5z3Xw= 49204219353786910100605282012781696579642953908541693903348594981245301165936599174304121350092894937817100350990938057159324959104937469442065996667276651025661016077514839755853073999975805394464570132481314896694678249282338429544941873047382467276103868995474424700207571657816852575364781281563515280764 +AKbFfU3GL6NILVyONPVD/X0tffk5HS//7FBp7n6JKMXu3VXvWnfTl32R0WyVHk2yP0iIyi6SUusSicOH9ncO8KJHmaoMGN9Fn+Zq94FTFqZne5NxHmCtwRAbFNDVGg4FeemGXEe1S5Kk1VcvWqnp+QgY0uwa7RtT8C7/T+1pZlwq 117110890075563714812929271250884717870581483065920538069845585667296154465072587148155060755111295509684258790280104272121160614620669593483929827848744548171793187278583947500205314283462739235860439216105116687015890394925743036369717346234391524403038196640934551590543386844279091801685432977718405127210 +AJ0xZ9dfRc6P4W31bMHBymgOq+38ETEIMvMtr+wB5WTcsquZY1IUB4IVkrHaOo3W2SIr479IfJOOQhmvyRS4iB05yDI88Z/fJfXarkH53gDivECuo+5+JmV7e0S6gCvOuVamwoQjlK3G32bCV2946ry4EyIsVZ6Alk9xk7X5HfGU 110384671994603894282707302829898242894456931176497230904862171369974466400767175784681299142670706023468915238955836087425993929524341269289746060546848852729416925808186253355106621584826213979718185296723694190658548757311188764342751280681935289121682174507629679900374674992438818324999211250580434317716 +fjzmb1D+YBU5Wn1GlwhxjiJS07k+fXxjeNRbOv5SjktzxOXmautO8xZ5ACOlYrTt5G2gzW2PU6sYNfByQ0xoUSyutOuQlD2r+8MnDrxCo6RxT3P0dUSX7q0IVj+oLK4GPbscnKLfe6KqUcYLMgKnDYnc+ztFD+csL6BQnM9WMLk= 88647261832601702291191332432291274285041869480562430895152086741320122435409959711452438332192792226899741738806447713240934608106883094466050154088410020909933636902495700779087737304255058561688767369900548260278700135161077055869478387490726087630962098228537973426295306997128615315548440548541717688505 +YDg99aHkQSh9RjytWknbXzcgLD8MrWUEHF46yQLHYANKXaQYyf3yGM9TYPCDUqWbOapqQe+XfOCoACLyRg7vVDsnOPRDI9ZFUgCQBNG06ZOxzktEhnNJoRC99da8jyodFqqk2f9UD1lVa8tsQdatjUDocwgJaDAOpYEyGnUlbXo= 67567767932654827067250684965667741848878457020992905661955722020937161710030993261011062929936964216357930453809610708591260182295097124272956485574313839759737390934220465669626974544253750900911093325004172643146669082793591441922014060981070503803266774197958528843445580649512373693546027107823355522426 +ANdsfO+cNtWsbT/QJHGkYAL2WCHWVPrX6oEz78pO8lUwiigVEow5roLI5Tm7GP7XffjF95z5WDxzpoam+Bfp4za75D6ZEHQmuFnpWQAmNLUHdKUE6UcsWN1rbV1uY+x+Nr5Vni/M7PfQi1yRTTJTYav40tFPb9rY48FsUotivoxd 151275723772668372472508916060743043308364940375633847663054782759325087560768667906829087958412643723335046123025802453213225972572697773468957759328009026531148112732519692142632237595562259864125679649273054426879080697360204352423668940795473103047320116317252295126635024518179060076282921965794883439709 +D2Z8YA0G/vzEVVQ6itLPUC92r9n9FKRpf6lDPWIgpZOOfIkukPp7zzTlo9Ej5IsBrZBbtGz/eYmlHeZ8Y9pQj8HFW24HeKYqjmR0ujbNxI0QgoE+VUwPVg0HhoQsOGmq47zpXpkDwpOAZbMh/t1Bafq6r2zM0qmiwOacJ8KFUas= 10814483230552506566705634583020057064935800294861277580077052473134972003523900930560478187758928889017740705417070994563709463926267126567504805864719383185267204810142444719634360655595490833208838383875687102074846353850310954150927702228780599083427768247170427544730791038729428517279760042619935478187 +XoZpSMHqlOyPYJS7dWSRNDJHCkjbo6+DECzu0FpB9O8bftcxan/06Twbo5d1lEqPlLx3w0XeWtrmCSCaeVcXVtlY3QuPjdKPv8LBnnhslPOVcbGyflaTPXU+ITWE6rwnIF+yWQl3NIwCV4EBtCT+3U//Dt/Ebif9gzfKpKltD6U= 66377743237695515693282032069691369056215169443985727092982918806809030742478033317158686828712146024066618073633406428345129492010236994055590530566431286733776441810601990431112187030942086686719669823512292071202675269428014136307286941704297995292544712278047959299939833088742083527714893795660235870117 +QUbbkyJQ0Nru9c/nPbphM6VxHp5DWlai6407KIDbTGvUReVYI7de1gO/BFphL9GA7gDareYoMuej3/SVp8lEujXywtXzjiI+j2TzR3YYiMBAMhsJO1wU9pxy69Cj5xeFFlrOycjE9sPS9nrqnEEEFNPiK/GDDTHj0KuNbWSCLrI= 45838919357034925862751142472777409057791233610959872523563363744902783251621354580995921495295078179996083468819097423327554678806691589090814275138081407920379810144694354354954459732280968086760894209634364189264517251735804373673532012530665557440070501687207620525228416650281363557992436992284712644274 +F+uI7ARCeAlnPLO1YR7RJj8LyhtE/EJMcY45lsNMff0YeENe8KOITZVxNA55FcxDYpg9sKi1UV3/ASqkqpH8MOxWpBdT2UwSX3oBkp6ETfJKqiag0C4MS8cQVsfcKF39BJ6KUE7X6KUEj11j2YIIRREmLPyZ0LatG7dN7Rmv2iI= 16797235966984072293396362937533957334369977688369659112225970370748312376722010874726300554329794854683394163379447263409228872034356195791733533528404245739693397078461712458035888813157166614479153484688995068722288153129390850561042173295997770817893349738328312152341860704179681230323810266038959856162 +ALkEoXznA7BJlBIfA3Avl9kygQcxexEMApwduVRiXeYG0uEXMQU4rgMJBlPqs+ly8LTIcLFaLnJAG2KFQn2GXz2TNa7w4xkegkrslIJEtBWX/lc7VzRtcLbhaXEs0Ci1ValnW9Up7dYOj3Qw9eNo/9M9b1fD9TI+0QXFtp1ge728 129924120553920201168632484268654219915712271781591182777925696006023100660478316445751842982460082888615429513674356810187315558964251402722465707617058251479494744427428152566665405423424700027316505872162698141109433045594670140335040479559124757490095995568556894332243767736124299898808796118800328801724 +Ki3FNTEE870E9GaNtbT418CLSmf++s6Di3hzAy8NgiDOFo+uuicJa54V3JNRxOBc99sl/chfZuaBQt14BFOQ0i+9rm2KD82okNABd+SNfXOb0Ow2taZX8CpkVJYDyphFPyHbPIKmzwMShNx9X2z9w4++tJgzBzGcFTPv1nhAlxc= 29618953883711174042338818332957726953262658484143534778541769862244883781157097499904047532839425875312731531093860721544220959674634750905085721866390609141599426547378130082409488797303960018348798930232014390380383063108812922828160584483043190739354817699497573863286563890071313017508437166939160221463 +AJq8tcSnAq6M32ViO4hVGiHY7Tb08cLVyxpl/v0Y5adYblvjrbsFcCmsNDi5PnBOBl5awR7KZdQ1xgq6jIs+SQbccEMvJvGUZW5MgcHrXBj9XVd+8oB0z0eahqXpgYBqLDeHLU6238xR3dJYFf+Xrcrzjg8swx66OmQKkAQVJtdq 108660120968150664552423780971948386965268856900017812123107864829782135741514930439461240950044759098603910762272795612101834680870627850178371693837566833495418727543557712057554231215186486008080050486837716071537742708913279026303380104388546316647349432118287628353129105425052237438199445863950767806314 +AI3mfrgcRwtE3mA12gSoQV1xyIGy/YA4pCCvja4mTjvzQOAfiZL0efadxZH5awohCC1SpZDCFsE9yYp4LugHKu/A8zMcp4k5ena8sTPDkSod1yucjybgmVJ5h17Pru28AzHQ/YUmCnojQv55aV2+AUhxzIfojY+NT2PKRqr+vuf+ 99645829268436288676280252226747461064597487404802430565833102291706103139410465131373666856042539909746769688396958963177805479987372681967013633920910376342526433530508868114301205524789149997372160919406352823342811006288909548557622230243808373083272214426118230701324879006645047374853535922112549545982 +TmXQ+D8XFKSclXwnTIH8d+sb1IV0gfm7GagJahaFL6A9rvYaZ0NTizkG5DQ0RmXyo0wPmLork/296whsdNdUxVAwnGFlWWvMV0ftR1fOvN9KoT0WtVZ4Rmu6Fuc7q1PskAZzIp7MkOAxILO4iX5dNuVC+GLZYIbpTel3Ga8fXuU= 55052751096768041533898435453266875315629605001878362193939750978427494147944918632414581744895066623527980497732722163665712245580312596487741856071020477624754815927936394948233480228964159047139170955663289543349257377302556035170334384320502468579367401821986660515827461352578142560630318492817238744805 +EF6KIBWQiQoHOnBdJs1p+WIcAv9ILt0cnQVo+o/2niOtI0C+eFBSiNgeddhotkQFgHvGUjq8BPYgtLC8A5IFKGzXu4SYj5ziagka0hqfhVs9zVHKNx2NUoMhPDG5R7+giwEGGPOayGHVNbsBf1FBYG91+mwy8hnNbhcHSnvLGk4= 11494909948912248031301686864833544028186348338729984264372557659364976118965740281229664413031002362633393381744365783802034700038490736736266032000546393704814403638058993380993275865674190555703046732456017652317200288968188655019374159412919163798248766655991273308390043613040731449231289437754791500366 +AL7wCh8tkFe07qChFAzRkrnNehvda/Teroj65X1Bmcr14+/zeJlZDObYRYBOm8YYSYNgJekcL3o9lLFE34sCMbSJgm4dGwpEVexiLVi+zc8ndnqBDSAnRqtC+3jbInm/v8l6cUvuzrUNtzXIQ/H4FrmPMiVy0EMerkMtkfw5GBsd 134080980697158076909534078193319899756347955848461100874771253577754225619652121295523443912922220564492468474647193062555347746840044705102003079330399499915801536721237211615317000955332058281901995149084303143543150689010335818219129745452688372571010816270728441637278434982752674030696337642893239393053 +APunLhlblRi3bbRBwSV8dsw8h5SvT8ncAmXPnca+e1dLzrQZzL7P2OhFope0mW1MCDl2kJPiGTdK3SiYJVsAFeR3r/0z96g3oq+8uS66T6VaJym0QToMsqQF4/fUMaTo9HsukyPyOgjVIU+6TiFd3SxQKIu1/GpQWVQIP2pkHFKM 176716779397275986910036615967409090183531310366246043951791503601618945774743601662530806467045971394247287367421508126613573039423674729894091424105133906122821596079925540513892022311039293333114333317886304014722168786051080135090242879622144693440448171583324154550086458411590240882982297314605229953676 +MM6B5AgdJKe5OLlPzcXwi9WhqQjx5KsnBYxxa3kWdGNTdk/IN6TVd4Ptn8lWkLm78mw3DXP4Ol1sQbIfkHRoKFUN6TaWg5aDCJBDXyHSTZI2FDc1di0Te1SwziYn0sIOe+R+rfuLuHlcT1xaZBgL6+dDLAZaZza36UEjn5i/pTs= 34273208848307582992498656582721015257885595139328466874135636009184357438445251703533153492315835793684794951576799764181908090765379592683793969576893243386892292517067596035059342970830813419330530731370385186653239446376170533147020072285887964430731437765184844167400169982662183791828762458682426369339 +AJK1dx77ZA4F0sYCgRL1LKSTvjGTKBHd4QBeVnE6FKJxIow82puqtsVZ7TBxbECex+LkLQPrEbuQaVr3giUDjg0aJCE0D9ZVXCUS06qulqcCCdWgGFHXDOQzTWDn6TlJCGxtTEMbMxSlUq1q0iKZ19kwMHiT3GydBn8/G7tIYd23 103022457217861194294329435482792508957642944252832971366936865663608381648431732294396977429863681671686490913575377744795372643599438468695483808375208871881849232129651519218503507811863794426234594709451104684234156597418383183271923307418704786548452806494411689822939919114966188329657999811363991575991 +fPZNsqUYBbVGA2FAiglnByxGJOZkVSpj8Y4QNW5wq6o/1e/PRwp0TLYJXIoCJRs82pAj0QDpQbHl5lCZmNxEIQP8o8xI//HCPxPIdgBJmSfm3VGetrOpqEGU0KJJqK4IsjoVpAfPFMUMOpGNz9CSvCHGk1AKrtYvrTJEKmETuig= 87751387019308584846595931543798879607048239290774788042055795835726250309378365187899578817976976035304304847968410200168743967600896348021636654074952051821111673620467434295067182213181329543946368332581250062140819766061014427755090798550122401239987766844126425179573454145697756278292448630509686471208 +EmT6DUd0bxcdprYhAnycQaxm89kltJOlIOGFFRmEK90H3RhzBGr5PRVTJVqemFVpVliO1gy1nPHgqDGVNIE1GXhrhyFJU6m+HJeNcduippRe38xPCiuraRkXao79X7WAiVYUq6RIH+UIRnfTvHBgzTwjrOvKJ5853hYmGaanjh0= 12917015385266582065020051081997430892582163827812227349569911846746592973268746845211126663077128575098045461893559476227689488349263954564361736197688317585888118974603264677576027836032271531903881104937422976121352854003385726888601980526287956222142458858211589791399646989299770657341412683499692330525 +APtOYyWzdY1A/YU0SGrtjPdMZA5E50Y3hJVXppwuuSk04TjXzcbu2Sqp7sMnKYbToRW4nB5p2UnaLPhTRy0yszOd1auLngW+0ttCybD6nTcVoP65gYOwXGfSEQysqKLb1OfV8kYq5Ba92Efn+CcWWWuS0wEr97W5M/Hccx9bGu0r 176473215292413922394356058789571494026727424839036665031567966488209592078148711908841964690807374236235612412767651029865069639786447019874344449598703213025389428836803984245755885691094364960118900160737925054803955567361126391353868279642836569627177281508980029006921064654964339077608785831304875404587 +Vs6bjpYfFA1R/QTeCfhMuZLZ+Zxo6wxq1jFZpi5SBR1LaUwAtOAj38OJC8L7zmxSOj/RGEmJHkulI3E1MH7P7xlWbY468/azfot5fX9BgHrtptV6Q0dkBUg7H91+tcxdbm4/V0HGQGa2rZp+XK1rO+U/d0ki6iNbsCsCR+OeyvI= 60957991334776853645581868230398759578123373154273044785333939425321390401088800849629483265841435899835570419798325123273632247193463641611211088549152950252041797959644227170492417662363676228611376046334386877555777556575818860902071813120592757466883038430756577949025778080997296219236534786815367760626 +GiauT9A+wmwJsFbS2OPIM6ultIbU+kT2NgACn1jFAy+vNBahdfHMCH0jJdCs5TbmKTCeiEf3ITc5TV1OSvIejJ0GRkTf80nY47TAhiP1aehZvMAv59NQHHTDUE1U4TPVYKIyFpm1V1A+JBHKJzuGrB4lvqB2ed7k4m/ZD5lFLMM= 18363925023885496669420377869542744504974590667921570026763131637088916425434675950812384919000566852243714758512996458727914094904422651029609645299422563453163291342992902510788457007623888307499601267675322986672697397389663297565071582648674012080122614260400848960757021864980761735684874056409664531651 +AL/9KOZLtZu4+ZQYQsmOgbST8F4RV4N/Z+l8qsbCFlHdXHqTTkcN0chsccE/3KkVTZsAnAyJqogbAvB/RZqttaK5a8iKlOEoerUS92FVQw/42WhsVaFggR9cHVuvCD6QqclZjSBQKQzUMy0YWPWlycAZDIv96tooA+V+Fk0jbcFs 134819194171226950171930028888667967094069342154233489571728632904658607624703819928943642011918061760802468868660586005724399808048609316802502143143910585363214684061242274402109137825176291816945489430125510625857564490981683683589784133305376252294774711594646923226452625156299996630452243345104727556460 +AK5x2N/4+PKlsW/fNrw76CnE+nS76Rd7Ugo3IKhMTB/IuCc5xG4MQHo5MlWE0oVkZ+Gs4CxUpvD/WCCjHHFlSxKG4mC6ehz3NVLglBt+f1RWfPkF28JPd0UaIOG3um8kG4J3JDN48PXOPP86A0H8ZYbE5+ImmXsGAcwvScUQRInU 122499245103202714319465533564374494931278163571999934877854825659720649344163774228004853964635693562785966889622928722984134944784141208867445419597834322541679973956606275877526560988151196822256754309120410807075405427166696093800381410682490767468563176131997424692783482903880902119461752084196789357012 +ALZ12i0hqFhwRAikcoahYzH/BUolhgZ9Jz6adLvvTO4wk6LLOpNC/zCz+LjM7HazZomT1SqeYJ2X+WeGFLADHuWo+Gp/I3S0UEneYHKJxoU7OoOtE0mB0BCncLckHao/LmbpnQpS+Lx5bRsr0yE6oWNea6gbyRm/R0to74MI3/KK 128128022342420083856194424802390993133863171077961467523372211039771843125192435716337829530528063182315478279257832480290950255315151577221042903861075751839976362752440630888566422581799720709574650482021111126414843635330535518992034746102956214991673417580508389225948159518319625680855827280146399752842 +APXxvLifWgehdwdTRAJP5KrchRzgbUsyMWKcPGm2ZkwGDJjoTl2LIOOGVFiL4CyPBxahkEHf0nMxBN5oNGX/Y4W4PuOAC8gMgHzdLkPWkpnTcyoe5DD+fQsqNuKVw9nvyB15fx8k0d6b056nfFjnnRqgybby7MSllAWSKRYRdxVm 172707950911363219032118650562553641123743396229371815589867086054370029540557395298194067635069298952836929253340374819975848769009260895874615676938511747311585257140973518651959463416682165208985512233703837931718385346209362040743041262031997793519095342415901373534535662377972036003546589624834285049190 +O+9ohtZ9SzGLJoZM8IRQAjhc/GPt2X5G+M22ZidYjx9WgOTrZDXorSyxLuHxay6djsJSgjxYMj8MuanYSn/DzPWBB1Gn4cDmIsfeYuzO+vUJ4l6d0nIvBg9Iqs61/PGFd46YxhnDiVQ9HEznyTjzESnNqc0+/OkQVJcwNHAcZBg= 42087920806448980363073662127262313840530298932643042322138035915324224188032438119079107631420338701086802583985117830416851550991102672642532160807467909040086448764318690465254898516502941122327185894900817634110254371864896139724173087625913998657136384357741816102965779105122269429701537815263708996632 +VJOZmvqrqsIUTQSSJpZPhbQIYN2tsfBhAciWnfAYpwjK9/ts7OP4Qgdp6T/V2EsSRPnfZ0VKdLg1CnEWDhfcODo+/BZcUrJ0AviFAEtdeUhoMSWXtjel9Ln2guHY4s33z2cN70+e8gfjes65lCzrxUIXEF4nKxzKBnScoooQP5k= 59391682001673484862915842850714742391303140646889359425353339320546979084250010101273851580028171449840778038774656177449549941659895629203970455580974953864068394275066532699748911169800076515776388213090834432354601344176559839798153004796057709798368011673585434643656820656931921831615507416411999846297 +FRyJCOgPziO6RDHX1JgYGZRcSAuoQFIZM4niD/B0twK3l+TRpmVigKZAJnZZFtmX+0JQkDwQn3lcBGQIL6mgy+j0hD58U2/Wd6xebuHSzf4OHVGo1cYoqZLplszA+hVCoDVTHi2YAZ+GtfQEggumcNVxqfEZd6D9Nu//hm0t21M= 14824975573460749317081504809641216868382341402512168178334301409725840669112911061147252565570697788806398498723577368905065980113760265945344671897779830912242224090954834750057278285419880820811348943398148063418809729356397202526234113316098584002071850758705282845646489058224513019380757604894853946195 +dUk5LyS7mduFJlvh5o8R73kJIeeTh0Zli/y3XjtIXfCaNRf+wDlD/pX91JEwsQ5Mvj8yq/Uq13QyWhoNwsPpXVcJtJ+02wtIn5darsBDfzcD/LbWhl7zTRUeMjZ72gAWi1djx94SWjrZJS2oWZU92Og1yOyKRG+ua0AhHfYYh6g= 82361050315899968537319599868832189063658136463903643442673674137187842597528653416212822014359684261704550279153006971937114135373937934986951573613797195556144113400128502946618028800530164890707031379614952207482505803377774320259789692177752930767589642007257364960987343146063216186985472686575891023784 +AI6rejwEznR35rIPuIz0CP2aWyhRUR3unJ90YfxyuVYxrqOJQGSDTSf6SGDDw5MqpZXa9pWuwpyrb6smOq4ZtC3Er7lipJfXDjhy+0k1qcfMjmqbATUscwXGpgW+MO71cttccEz6vhbjndi8gvG5M/vfL2l1jA8nXuBd4e254dbz 100186164434910864539376019601151338080943067893748898987236087770762310617199833479771711726248130012472861788210345311298499515751355424063761182369333224929721733015910055321263016834247318907562652286587380604998130368845939290804442878127169587599285040969551065995197981341260363722618429042861484922611 +AJ5vLZX0fSs8dUSBqd5hki48T9cYuR0atxR+qv7cRu9nD1vP8uNVR8dLitg3XH0RARt3ZmOgi/AuggZt6tTxuIBg+9JhBY9WW+BLL5CnYWHC3AKMi7MQBWciLtmBpyF152bDaEcV1PXxtml2KxX0Ba0C+hGVDmJSdi8Kjd4AkfU6 111256341508463539324514225759801553679558662737345522765042612717818066374840372549356543720386819501973783940451033901079765311790026584654529398345993992144903839534037331533660672892487693477412528974248713261092693018326068480417183236210881306241164169849090833681510163753605662526243408192127670285626 +ZhXtSzn1GiFfHHnSKUYZiTcEWqlI8owyCKFjCQ+VEvkdk50m8uN7RCQ6ZhI545tN7Uy0WdLstJhgJETBYLHHIoWsJn07mgPxuyO0XsqNroICMQEOO/YWQFk1c0VqZifcohQAwJj7fONzM7hTcA22/7gVigJ3iLq178jZOJsEPQs= 71686982768953132894579286530164112027530221141251507987469672039995314435159469907420372652392376452531392493658576814100773556880394271726970628960571077839124343525055625420896355363707908511865700866168843075071778015504724409171911254647909938237551680861008772396291072284353858575645679153885560978699 +Vc8Cw5m5yI+bJ5sUJYm/F2wyZ5x3D4ydyL0uU/3eVF2ZJu55OOlC9pUyyv7WGExClHvWpR9mhMnsqCLyseLfM2Q/YXJ7cjGPKp2xd+fvwHa4hRi1FdOxs96rJnb+HUt9hTwQByXgzpnUfs7AqrqaNf4WSlBNMu0IOOqDdB4iVHU= 60256873326783629723455608618518793848697944184579877638436234491615392142659293975260290798403892159720925893207048153291000664050780029732557737984085196691225472664027706406879051455184548871511448456651238810812870905640934953489289909009741493031472382758586341375517766302753448531830002512912250459253 +QmeUn6cbpE8YrDfMETz/+KVFaK+d4NHHzcdj/MnjcmqQSLpP/XwCW/aeudlN3SfKd6rNo1XZefunZO/ek+PHEIy899WzjiJaajhf2X05fl9WuPEaMES3Yrr+ClogFNQ+9jL8+7L+J8lDuqQzvchT0U0RPay5HSNZw+ZouVCiQ18= 46630904037845609335515965570673490721137364238213103678233212262384415738654627185220187275286458759154841820256007930773120637898228224906635911124921895934056288121005350040349882413280772888907627838315559544636626856478316691755270725623680935763476199888127096014398699432042227882284223578563208692575 +ALUBYIShA4w5kRUa6iNF8S33DqaprdOWjVBnO+j9CCGtUh+NNwfpKR8AKf536MtuFFtwaQvRIlkLpaTYXuRxzyU/YG2+UfRQF3pEmXQhcMxJqFzqZ5nWCIWlJ/KtYS4lcC/B7hD2UGAktnIdjVUTSxX60VzA+zxeunV2iBZXQlEs 127106299687401374061881872616647348819431126560557369258073443762502337592227172639640997680536372567116568811258505773087926491911004324918919511363985868314578663758269650473780772688462266790559846182685481907703974916356209771821075179827563487466641669110315430790405454641953880582274165368514679034156 +ANyAdMnVCVjmUZGiVdyvGE5mUQpKoJOJINqMAfzVUGvvxXFmGdoAx+xsDRNAP4KoijpXk6E3yPBPBZEWyhiHnyjEkktK/gX6gnb745afS0QIlsjhKCk/W/BHXkzC862Llnc1ZGAIsERnGceEoZHdICfDUh/7nMFp5WuSMzPB7nEO 154841617115465511611746667401422322067517612306328612547616471923266281876818466022676728696273611923942543658633762267658490816264271663863494188027433799849037906883352478212451733963905925106470599843045599411842850386623187980045961158399934160107237440980574028985561404965317132715808604373199725949198 +AJ4nfhDe+HojR2YrprDHW9FVUxsZvoIekwlNL2iKFRFcTB9IcEdh6QnGcaRinev7yEYUsL6saSxUj39uWlqo8udJFdszuuQUmnloIi34L5uj0m1OpLy2dawpFQr8pqyA7go4ugMMj6XCtiVnISUcK8wjHgY3Jed/EKK8k5ce0Jxt 111059703393618496515021583605572584329116596402705082562306930876194742195701060137568030171429700588269665205795898835699633817098262654446852249498668467827435829513531633390969638488553144849154126899372953755511962841193763362947708260103832329116485114451074371844037650417731807385491783373627950406765 +AL+heSTflb2MkRYFTKghfzqlVQ1oE5vcx0eCIsy9NJ2NGFXCRRvoGDVoB8UEsUWIRnaA+MIpwDKGpbOS8kRQrvBvPe/xM/t3jrGkaS6pN064+bCBx8Y/Jq31ZXNG8oUol+y1Eo6fkUKNl4EOetmZWK8VmhVwol5YngDffj4Q8ned 134567692290185631768518572983694048149859804864902017394351513816079806629664302312927579302025923096596995134868068794900003728293470554490807959649153000914807604036531509869958441069678002226922395630284261949256022972967357884468325217602330254290548618134453007903724438628204981673400911693835033278365 +AI272d2sbYIi637kHZC+6lievgcDvT5VKaCnus3fHwm2vfao7oYu31P4st9DlqPWJ635X6QtLkU5HgvVSy66MDj2fcOfwVL09ffkZYnoGNdhMADVgOq62Ro5cCpOdw8Ko0cCyVpVIaSysPuqY7kiClf9GTdyZz/uYHDgwWeNrc4R 99528854246023003959943182132914587584844397870416002887630245681136432049666385367430032197518895755482367603560037194955739661569172773017279832774100155646116233705958563163070414171045438199561777058338188494271322834524386565519620661180246416329082614115142485663975718653564590519408413408765689056785 +AN9S8vPzo4SkyKsk07nfyD0um1riJzRqqWF9KCL+kWMHajurgPACikYzu61tL7l1mNEaIU16Ndz541o+y76DgsTLYszu4KXUOEt1Gu3eHy05Fq18zCDlNesSVjkZjPmuJr2ku+p0cP0TLLMn7/KuVOm4GlEVc6OvBNZuEzRriSYZ 156823459768092337875922818543729136404805918580285507923139232733465414368775678369646914249412830351437211620056021568154043505276475345347569200977945836210758870414054407438380975491139001471954448623922841964684437333066353208837709613982022690623722155151315252634380695513434502419141555410441456920089 +AMc5H8kywLgiT4zz5xgoI90jejsHorbqUGtBeX9wke7zyvEKyWxRKScZwzRbinjDZzN48eg/30qTZOV2Rw97JFg+EA63iZ0vqfF8jErIt3hODniKX8zayCuNmiSb5kiZL0UDU1SNh8ER4m6o5vshBKkmqs0PeozfCGQtR3bZXlx4 139899247405256530335276706333424670310599977544642091674186635734421385499036688803073040921114325725234673132788498809189814711681909865484671959982394306416477300458309408833281654917008031099378445580498219376391819745965887864647387211647794422908411100892195529730435423964537342228510107659017578765432 +AKv+3H/TruTX3wdMWnLzD05em8u/QMl6lCHT4VkK+uZwBXoLeji54Tcs/hZIhj0Bdj0URrRt+7JdGSTy4Sr986AtVFxBJZA3lT+JT4JSrq3oY1Tv+tX/yg8ZodQmbpQyyfaFg3BgeHNmsUoCrdqhj4IwBqEXoOBRIXnzaTuqqSEw 120779384043726135670909127168686589868907326577918074234323699599475436892003731971700278391108690400460261929381703781833059801757700386671579819341589048987186473249926590758009001670959004477454905417357202448886738669226760846888369186457452643053236389556969071303251275912453385963613554945645058007344 +ANXIB+HxOyJd3YYsscMpqZpi/eYjZi5q6A0MohU4BiWEJK/E4uIObLJDH5yd4ng+hn7UMhc+R/AxG88hIdOc5NyG/QyFs95ZLUC26F9rkRifu2CBkgqR5EQi2cgwC8jGxQOkC62YND6cAn/ILsKTYaH0iavtO9Tz04vQp9Ypc82H 150122383481070201614242107655752525590609186454390549085509458064289390813495886095936526832230958746095739308601699615024239939948911472291507190108935262129646691795733786714291498653838550751365834947465294261687773081563139416397262227609481906371677917295227469553787085145970923979142676551778927103367 +ZQLFoW+dJ7vrHdMlcLRGKY6T6PZKnE2L3NjXymS/55my2CDBLdDf3oXwLlRjVt9KnEiXyQzLhyY2PrFA4k3N/3P5lVDLHero5c36TMshbHgbIKRGN2CGWPEFeQ4j040IwVbQCPJeuF3jL5ikCxWZFXfeEnTL6TqumLfD9yLQfKA= 70932215714423143395949105745758445705072524008235214324766464113352968998429901322485575506330607802260244612268338586532462314021433435523464635419846126736185176246740838082062856583684393425704173881940108783636582561707441482446854068022535943408999200681879161519209676205165680598258447492092651404448 +LzzvPw0FdtM2G/RRiqoajJiIH+Lw3jpL4H+08yOpp1bNITR2Aq0beu2nP0H4o2Z1/FNr2hzuGakkAhVbmmRXc8keoOkeaAQAP/8OYxHpjrqou3WPWaKx+vUCTSqVYYf8gnVKpAAC2cD+3lW+/ZJ538o+c0ovbUKNu1u1j1OBtA0= 33171669664542509840621265032202455391098253465550501094201777336478104142847268103467889435377685359857979277521589539506627375165485879405453566052091202280471235979376217319335800766353336252760793484157724210008639813552207624049019149744883918494762511376489708611103181576211531366514802868659603747853 +APrGj1lIIlxA57DNh+bTEAFbJK2Y2P3MxLShb4fPx2aY6j88k3umoe07ISQLf9PzNPeml4/0I3w0KNd2x4s9KHbj7NsIT64lhO6eQSEteqZXZGXUYUyNzhrTbAjt+Q9LVKItQhsTkTW2HTQ5RQZfGrkL118b/I18J4P+T8CGZdDz 176100632478477421621142147788721746818712752858710594712903769452749028606541677227413333567013253138397373757811889654342173021761934591400685421771460440213093509170325205622261487145789848227404883040799927313402244625239515162996390018403365063394514244196976794479529075569412676472840544017222373593331 +Fvcl/LemWk29I5LCjU1QedTjGlkvFF/kZXNkRJv+vNZ7qgq6pX8WB9yVkk6AoclDYAhCRfKTKuEpR23iafVuHpprPfNXcqBH8n01kq3U27xqIy2hS+D6BRBK67PQaekq31EB0aOcEb/DuNaXakS9+mtTMx6BKt+WoEY+NkzHK6c= 16126868736093163702771491576570380743773057522016869811780571865928979861357811080042796140032050364543242385458140594532945509386155523162799601656485075247603490060565663264947465987286983338572455184901756399862440455644131755848583379822279676555143231305246033911608913609591095831135803702269767527335 +AKW8tvaB8YZ7J5W2lmquBniJzUhRfqFdPZPqvBoMzR4cRh1CMNdSFsYsnsaF3KolNzogdsxFpHAaEMG6zSvpNJAoi4nixCqb5SETXrSLASXvNjI9MvCoE2JCRq7kMbjPL7cem+mBPWZITGUI6KVlJPLxQngHYSFxukqlx7jznwJH 116384596458828069344020651216200368975621068920641012055593076864629080375946542748377736186556382088448816531408136815533164209947323588157210859294774679831647934533061547276394884474877353537242203645373945111105805934070657589374883764420038511061919092743520704686962593876316976299391579463759429567047 +D5N2P4FrqDf7/2Z2BJsqah4SjUtolic/yNqdNzvNEogDKZKAJyGq4zhnHvkYXkEm2ueU/FDPJRqisszG0oULdU6c7p8acirEwsGLVh4RamnFRgmQSK1vbiYB3bR+P+iFX/bZ+TWjN2Y3YMa5UB//I6Zb5kEIjmTpjY2LEPI1e6s= 10937855369372570149476727082965401421189236366492771695094788039313362971972373068736123833330006002198346944149230147444718818161877123407713821100752433128205189334393732633989950841577315682292180735057952587083688644195300641998709155269462601925653013312848413290208844194513502358901613104779186502571 +V/A1ktS0xrcwlI8xrYqvlLCFYrdVp8tEzZaZ9iNNpPH/pzVsA0WbnnUeHbdilkje+4OdoX9C4U2xaOuWOfvqLR0c7GeCkSffCqyf4ZsBmjy/BQL6rCpxMF0gIHXO5O8aJ1h17hy9LTuNzWm4zVh4pNFuHC9L6nAcf92udMiIQzk= 61752386563628388546439207444896778638632243226541303179646524864765343154194512297447627825411023405896612559648434895675553567405277169056807223959390559391191382555701580549902639604424290133917402316755076644943742815711432111554988540913643347167948778404861099845961151998728662878854088239266688156473 +APoPgEKA0/r1FYmt/Iso6ChYK6dDU62Y+vH5h/LVE00biBYG1f7aL3GdllUTN+XQSHpqlDw8CD+9xojwZIMfgpgjOwLbbe7Aso460zLrg3R8aHBpbVt8iZUgjACwPYr5UyKbFzIAWaXcnYYQ+tCO9aDIuOz+/7eIF62C81zXFJVZ 175598490446477604563905754135475294999639698464908622773037381109011373179895295130424828038708319325919451724985361900259676699137657615076219968061941008972496322083528922054390781811699677037439989404270415929836486610353098273115864435328533577114470407444852521009919911888840405368858409835197558461785 +cL54ymLJhRx3U20Y9aUTIsXy9Ags+XHy4qk3F7uJyO46eiXSL7VrrR9vTQXAbETbu1YiVWfslsPht810eUDUVaVir6yLnXkywn46Ci42FEvVoTEFjO22uYcCh8nqB8H589w/+lVSlNrcILugwfdfCvK1iZzVimOO6l3qzfXToOU= 79171550718114578361958369278761819285111811576818442980166457146638966315793211967882077899426611721874954146020093740153495693185472340728106727284441726113022873005252623222594060645383105757498856463065370975867121188445567981809371870213273555432308279508351518168027875538720367440153667708369625129189 +QdQN4qW2QZq8/fmSaqlRiPSoDbhmF0oYjaY29HcKYGHdlOH0AMJb+RUIq1aszvVtjh7AYay2TNhaZMWQ6Qi3c42SNk3A1MVknT6zqiRCGjNFfxf/matbRLbTFQF832MAId708vrFLF/o2HpekMkc5hcHB6bkUUhEI1NLcMXwGck= 46226230186280253581676626651942823886592433541360244612432763620730826574920825070086312767146345247802570752482654580909236388357139147786783758670999083804670979821212991224400629053427330483809790366665043598754931511997925850227997764381723288657884346974360232490075739442406431704368767588177525348809 +cxHvCK/dyVDvaqCCQyLeaiBGA36mV5el+1lc2eUTkHGUzX5gU0QQCEp+iSXNJhIOON8VFpKOFsziuV0Z+3cegWRw/VnxnjXcBh6IDKdupzOPB+Yl8MA1ti/GrQjLC6ikcNYNjQT0ZThL7KTqEvvZJH68WYmD0IuK26swjNGIGaI= 80804939616399473443737611589382762718815989847332356984276911837267997590368701684135326680567847542004499684038240485603420973682522792156533112356849436451918522884749244246467852622918805139990256619014116276456718693703261686778030658826952213058982142604346352178078750879100976710761147710018148637090 +AIQ3OIZevkYoRGBmsFaXJobSfLeInuKKReVYNjP5VEPoMq0mXTltY6l09/rQ3d1JjsMD1PfA7emhxex+H9t3leBIfCi6Ux34GQEjXWpQc4awuiy9tbR077HaJyecvb8Qy1FTnOHoH5C043QJzrKYT/sFXjgB60piI8Y0R/hwxO4r 92845026347218330987427785323244729176754623818531419911990153715676845614711324345879159989637824921793015074978358052562420379797956750450245721653716740651389924718711940869162230097839047895842495414221110468446944827052871968998907462191349838598297775847512250220907563815783358238473966349820476321323 +LoG6ib5lUh57rdmSkZSWzBoudytFohS4uoU/uly6OaQDOi34GeNVxu/yr6RszJyL9JWkGNgFaBIv/HirH5zA9VQAL/6kpL93a0/GQ/nuHkHy3GWZPF/2+yJ0PfazQ40fWhHZfRxBngWslbguFPjj1XaJ37YzpQAYb/+QcUai9ic= 32658152290878644668906121702816147999633088014476055330179597550087921141413344679134407016170035735846077181424615228657687216737432274043674411132745299610950657139041836412322040866250189120286839287690983293111362228893996267791120043532014262644480689231457941173330523718758287779526551822788227954215 +AKu2jgOQCCfYZ3CLkXEH44aO4TtwMPeK/eq4FtNj9HZ9FxT0LLNJh0ZXPOaPJjgznvIw5C7/hNm7rUs1JeV8I8dj3nbS3EVERQz1gc/ckYB3H1bViWREOD5+TScDusi86YO/z4ar3dauKkg5kT1kKDuU/OP5kNMWvtJjHc4Vd3L3 120581042599355202025471829872601846477331097842315143148145881424071317426176264583672725691485724160094190478865850305422057632110749683552966861219554215519032344086824849470294473808177223497912069335635933312949412445851201918768630656712413082629164792850095444166888072453190903931430551124946191872759 +ANLs7OsR7oBM5jSjVADrk+Mx9d0TeieTIkxwWiJ5STKNQmW2EzPOjgbfcLhbYEhzzDFJveXO2dzz6/c8V5oW2yqg7VMx88DzEbpQnQpk/rOQRw9jbI4fxXNJHkNZCeysEVvFfLJb4ecsGA0xJ3Aylny/jP10ahPv2z5K99edGZSU 148116916208650944522110872759145096907599612943009577897396622287067669897712748449324334650112672914917664881091633448764667172850435775162090891556266912697811031318228334453406561952979778127173704706529448647577013482442758465809198730066784986763500579667100246958959793527011919373534159474250508506260 +AL+Er3n1qj+SBsZVtOMJYg4m0CN+DE6gRnC1F7nPvd2XnBe+QE0+LKfcpUDHVNxoydW4BDzNVwnUNbyjXZ+iuddPtO9hchVEI36UiuL0ydeldFpOZ9mtHJaAF6abd0MlHw4vXRf8CbOvXb5N4s76ggijlZBjRtU563sSmBcyq6Zt 134488725667189507159811764480908602790838430340670328479145818969651133017546803581865897303917708192047926432630297993507146075655594931523561067937580218599890162311074002344315818494246433967228889645359283635389151927472221799543158424012020308449895562192866672439712148770104592027035768027605661099629 +AK/04XOBSjjPpuFXTDF82RNWnKqZz9mJQbS2B5bn0ehFnBa6j+B+MazX+AxXTL/d5+hPLT1uexcnSMl3DcGGwKipOXg7Dtuj3pfJXHTrCqXAUYrIXI+8vKVQO55yQPGfzIg9SVgetwW1sDk+a28ZhJ5a9OddqNoi5C+dLce7ZtNb 123560902006294001923570614486104726169564351074482936927091682096999779538353161007361361829586988452098646362280351148131540524964916445100589671458589346440250329883789099771417949746709217272531950438336245613419967556433467843237384555807236658182067742367748737224684334525934210197178231424396818830171 +PzOEGHlihiveoWFAALY+LOfkRJfm0NUF/uR6cSU/tbpGAq4onNpr+iZIzEP5o3JBLOtDC595/NBPI0fzaXl0vQvgJs6KG8iKANjsLKQjIpZBkoKhdbG9MzTVQuAeuDW0w3sn2iMZ/v2dgAzRwfqmQYXJr3I2BbcwWraIJuZXw5A= 44381416070253681813077725822442106641846565789204187691647505370231831464947935035197059366680327425453811558282831465960889061956588244308214943856009686127871667376028831540813257349779756631357122923723235595360268572998278795110672666089470210929411514949652537714634611421849780859192966935514197771152 +APnuduN01GS9dO2m2uCLs400AR2lX7elOnIPC5U6e17qbukxWYzNhilZlM4kdGXAIeYpzFdSIW/gxRMZe6TXq9krFWRaaPyT2QwRfGHYnazS9F1QNYmW1zXdt+qVp0JGxmh5PyDstbP8Z3x50/E8Mb0gLLPhNAvzY2Jnr9A8Q1Hy 175507868985304663005133968393406051624825489142498103948374797086106732382869120248515993626061853699363294022457032257026588816021007648668265488426495800459085474654859258116280251546902009156490112550154951965894022789029787886785376415437170872937201839249103828294508088966180386198213606090453461193202 +QHEhL4iVzNdUsfG0izTEepwTOvxka8t/9MwuF1Ey6kxsI+ry4g4sJPgR2xMnbtOmvQn2NitAkfvA8JPCiL7a8+gmf+DVRDjKDfpfrtgAVmo+3rH+uJYTrKhAp8R7ggU2xIrvbIrgeUj7ieThPI3Rtap+IdkPCL853JC/+oKtytM= 45252649968839515171157821292772647085425694172492111870169593872127007254353374581972876464918186509502070064028725519394859148593053614163356612260257013360168930649423732336969778875205250872728821432415158634190866775855521719727700464116412886964736859295086745723651735554245035077902615220578218265299 +APeaekK4mVhEShCfM0mkRebcg1Iq5CgrFIEGOoh1nHzgebr5A9Wrhm9yD1Vd3e+fFD9urDRB4y5MHPJHX1U2NFToC+H8nQkFXL8bfd/9Wl2c7y8m0Mxwi53pLIdzETLbbfeOOtJvuSYYT3n8+/PeMnJ46UD8OfqtnFuS0/bVpFLS 173873040145444066957050580959132871919216036714423404143335635770937773583761934638398867981658394368476005882852706046614562314432695052874974848076542261910660410561876043187368112065303981001507235893831108658530338308496461162623683138693880482650786841100027392293758260448606244283355655751440485602002 +FqC/wgZDPTUoObPFSH5w4QR79zj/O+ZiHGTEnsBMwNZD3Gl/ClRDIsFMDDupNLgwgXsqCQbpwSOHOtAvUuAFwRpzt5B7lwIgtP5ism/AZRno5p+9WVSmUAM3glHsNtvYydz2MkXtnXzSMIR1ZVoLrdwMnckE4pbMzggqz+JZqxw= 15889870005716350976759704672045310928616256175405784574141006779373730686049218680335525720670897894546334915362899913262232170795516176419192840427996647372619000239408311568577050460995518058850793096827271653902583271225799114408537346367483775593212272587811309978019791973449354003275559762102731778844 +AJXNbv2AMWadF5h99ZAUy5gLnVK/hMaakFo0ZedtPNRJobxPmwj+h52G+Czd0U48G0V0wpdeUJC9v/4BhjzhCvNhNsdAT1+vQXDuteYQ1aspsEKLQ6b+NknO88QSbRJw53+KeOY2xe7PKOa4V89XnFFBF7wljRnIYrM8vvcqVQDk 105194875227030598769888785590198577650278341586165110611689226597424766274486797264032300493674927704016605741286512271390703088626381669060095573361828932336327125438452066548897528158329044309005232090053420259033538936293519762277428283316506398965916381374819450858053512398634116052299066189424983605476 +AIDRnUpBHepjBqYAlU4MG/8JxzX1mPxVNHpWvnEVgvqTQx/bisFPpXrYs3jAKIR/lzevYwhH0K/8Vvw4NK9iTMFqgSnU44AZztKsoxUXsEsl1UU56UscY5C7ciKU6vjjWI7nm/uHNOXdE82TQXkk2WX8ferNqZU5DaLFCb+zxb7w 90459642084794142567976043425270153270545560059973413835786695756473295513758287577749768786155290305189883600338986370836806413936196854410098516254596146039255388020628703824195128439558127783534033672712705194483515442668075394018677699876614329419492391568463215822656901183478205197671375262145069825776 +AIdvVNzJqWPgAShvi3GhbhMQft+SLigKGrhoqas2Saz/bA9u9Td6fAxa2LjrAqshW6cnm2aalc3Yv6RW/Y8vg7Ho31NSaRjT4zMUenykcC0/Y88UNxREi85wdnHwGytms6Lq49H8/7EFGJIyL1PLRWPmZn6XFkegscI/HUq/hiKm 95105613103051650721863964216778532448106311156426028879315612217763044797186635476805213120469258258125661666950525364331551671653846368977016286153840829836509696804585927581668281228810410814602664419962214359687545209312836366693384158782798559255789953908588601637765910472073600954502095647132310971046 +DdchOPjXrI6lpV84IdKCisPmdqZan8AARXRLADEhixsfXCYuO+WhNatI/fM1vgv+/TxwwIQjIfG1vOZcB36JUfjHYdItYQ70vUXaVFdpqvoBGyfOTU50Ds/11iGPCF8mWiQwR30/XAXytqDZtaVJVWsgHD3RigBSnSHhnvZAWYg= 9719024770319024562623340689338530708271347986326272393419504304391837979619189392867902307307106771234732135400958362219711925045600118964223238147375808749507928768896918369395426933218443166133187066167663170936604731896932630589251946733237697936733924510107175304126061649311812536190882160340308613512 +I+Z6rdTOt26/v3dtUP1plITb15fjb6aMDvqFS3AD1+nxBqnnk7ISGE9j6dv762EIWQpMzcCG5NCCq35KOHEwRXP28zup6olOMt3CBFgYVcBE2pWOpGiO19G/iFweYZXZPY5HgIkex7HBbb7l6HhomPc2sLL/IRhh2oogyHx2JMM= 25210054612455888156900839678249806510561198051210010474517915819801056434402727631042894881559517808906460418029149538469607239850657781476308872923928122553395468026744382526167194202058040459679991391557937527079948356545086684521068912222036707113005006607012596093923970784177288565193670152033981048003 +ALbBoyelCs4UkfnPjMT3S67ujhBHBEE0uxLx6kSGZq2IOMU/QdWYPFElRgYC/y++334FSEycjS6NAJJo2ITpZCO5AjNJ93J3WYgbDLiwu1VzKHX6ItfFNEk45km+QTi07+pDKcKNd1k0mxqpLd/PuZd5hRpPDDoKBb6i+mrCb2yF 128335905497646745013379107761994003743181143126608677203818152878840562628631384684712779135591095534911406031545494164782375276574093777950840330452805743803067864740000758175436633463846967335728314347497013853264454015790847388463800323796888198433722196292529074568758149650782323407298620158495364705413 +ANwlxEkeqmqYTxw1ZwMi1v2wo4ntPaEYZYoTLTJQfa+kuIksnHW9va243HAiOixd+rviVdm1dEwzESBbX0wiJNtRBpP+bnRxy4xOBjNoOB0c/tfka5JVwu5eeskyHx4V3inLviUaj86Yck42n5NaJFMfBvhzVftZ/YF9WBITI8g6 154592850289860621115358362871905683265658659789986179554827712019629689749439795961607030363152337159590319622241556795951071651584979664762468782303706550885785493534656062553770262954861884613383561063525714923031691298088562054236178003658891902606245782350998076658704876516153027797371814038658244397114 diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/test1-discover.txt b/vendor/gems/ruby-openid-2.1.2/test/data/test1-discover.txt new file mode 100644 index 00000000..7ec9b878 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/test1-discover.txt @@ -0,0 +1,137 @@ +equiv +Status: 200 OK +Content-Type: text/html + + + + +Joe Schmoe's Homepage + + +

    Joe Schmoe's Homepage

    +

    Blah blah blah blah blah blah blah

    + + + +header +Status: 200 OK +Content-Type: text/html +YADIS_HEADER: URL_BASE/xrds + + + +Joe Schmoe's Homepage + + +

    Joe Schmoe's Homepage

    +

    Blah blah blah blah blah blah blah

    + + +xrds +Status: 200 OK +Content-Type: application/xrds+xml + + + +xrds_ctparam +Status: 200 OK +Content-Type: application/xrds+xml; charset=UTF8 + + + +xrds_ctcase +Status: 200 OK +Content-Type: appliCATION/XRDS+xml + + + +xrds_html +Status: 200 OK +Content-Type: text/html + + + +redir_equiv +Status: 302 Found +Content-Type: text/plain +Location: URL_BASE/equiv + +You are presently being redirected. + +redir_header +Status: 302 Found +Content-Type: text/plain +Location: URL_BASE/header + +You are presently being redirected. + +redir_xrds +Status: 302 Found +Content-Type: application/xrds+xml +Location: URL_BASE/xrds + + + +redir_xrds_html +Status: 302 Found +Content-Type: text/plain +Location: URL_BASE/xrds_html + +You are presently being redirected. + +redir_redir_equiv +Status: 302 Found +Content-Type: text/plain +Location: URL_BASE/redir_equiv + +You are presently being redirected. + +lowercase_header +Status: 200 OK +Content-Type: text/html +x-xrds-location: URL_BASE/xrds + + + +Joe Schmoe's Homepage + + +

    Joe Schmoe's Homepage

    +

    Blah blah blah blah blah blah blah

    + + +404_server_response +Status: 404 Not Found + +EEk! + +500_server_response +Status: 500 Server error + +EEk! + +201_server_response +Status: 201 Created + +EEk! + +404_with_header +Status: 404 Not Found +YADIS_HEADER: URL_BASE/xrds + +EEk! + +404_with_meta +Status: 404 Not Found +Content-Type: text/html + + + + +Joe Schmoe's Homepage + + +

    Joe Schmoe's Homepage

    +

    Blah blah blah blah blah blah blah

    + + diff --git a/vendor/gems/ruby-openid-2.1.2/test/data/test1-parsehtml.txt b/vendor/gems/ruby-openid-2.1.2/test/data/test1-parsehtml.txt new file mode 100644 index 00000000..8ed59d33 --- /dev/null +++ b/vendor/gems/ruby-openid-2.1.2/test/data/test1-parsehtml.txt @@ -0,0 +1,152 @@ +found + + + +found + + + +found + + + +found + + + +found + + + +found + + + +found + + + +found + + + +None + +